PL99724B1 - Sposob wytwarzania 1-/5-alkilo-1,3,4-tiadiazolilo-2/-1,3-dwualkilomocznikow - Google Patents
Sposob wytwarzania 1-/5-alkilo-1,3,4-tiadiazolilo-2/-1,3-dwualkilomocznikow Download PDFInfo
- Publication number
- PL99724B1 PL99724B1 PL1973162757A PL16275773A PL99724B1 PL 99724 B1 PL99724 B1 PL 99724B1 PL 1973162757 A PL1973162757 A PL 1973162757A PL 16275773 A PL16275773 A PL 16275773A PL 99724 B1 PL99724 B1 PL 99724B1
- Authority
- PL
- Poland
- Prior art keywords
- alkyl
- thiadiazolyl
- isocyanate
- temperature
- butyl
- Prior art date
Links
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 title description 5
- 239000004202 carbamide Substances 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 3
- 238000000034 method Methods 0.000 claims description 22
- 239000010410 layer Substances 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 11
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 239000012948 isocyanate Substances 0.000 claims description 10
- 239000011541 reaction mixture Substances 0.000 claims description 10
- 150000002513 isocyanates Chemical class 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 239000004215 Carbon black (E152) Substances 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 229930195733 hydrocarbon Natural products 0.000 claims description 3
- 239000012044 organic layer Substances 0.000 claims description 3
- 238000007363 ring formation reaction Methods 0.000 claims description 3
- 238000010586 diagram Methods 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 51
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 20
- -1 alkyl isocyanate Chemical class 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical group CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 7
- 239000008096 xylene Substances 0.000 description 6
- 229940057054 1,3-dimethylurea Drugs 0.000 description 5
- 235000013877 carbamide Nutrition 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- 239000000908 ammonium hydroxide Substances 0.000 description 4
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- RBCVXENZZZVCFS-UHFFFAOYSA-N 1-(2,2-dimethylpropanoylamino)-3-methylthiourea Chemical compound CNC(=S)NNC(=O)C(C)(C)C RBCVXENZZZVCFS-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000006210 cyclodehydration reaction Methods 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- 125000004777 2-fluoroethyl group Chemical group [H]C([H])(F)C([H])([H])* 0.000 description 1
- 125000004918 2-methyl-2-pentyl group Chemical group CC(C)(CCC)* 0.000 description 1
- 125000004917 3-methyl-2-butyl group Chemical group CC(C(C)*)C 0.000 description 1
- 125000004920 4-methyl-2-pentyl group Chemical group CC(CC(C)*)C 0.000 description 1
- GGZZISOUXJHYOY-UHFFFAOYSA-N 8-amino-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C(N)=CC=CC2=C1O GGZZISOUXJHYOY-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- FXTTXRHGRZVUAG-UHFFFAOYSA-N P.Cl.Cl.Cl.Cl.Cl Chemical compound P.Cl.Cl.Cl.Cl.Cl FXTTXRHGRZVUAG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 150000004997 alkyl benzene derivatives Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- ZFSFDELZPURLKD-UHFFFAOYSA-N azanium;hydroxide;hydrate Chemical compound N.O.O ZFSFDELZPURLKD-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- 125000005997 bromomethyl group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 210000003205 muscle Anatomy 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229940078552 o-xylene Drugs 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 238000001577 simple distillation Methods 0.000 description 1
- 238000004513 sizing Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 239000010409 thin film Substances 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D285/00—Heterocyclic compounds containing rings having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by groups C07D275/00 - C07D283/00
- C07D285/01—Five-membered rings
- C07D285/02—Thiadiazoles; Hydrogenated thiadiazoles
- C07D285/04—Thiadiazoles; Hydrogenated thiadiazoles not condensed with other rings
- C07D285/12—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles
- C07D285/125—1,3,4-Thiadiazoles; Hydrogenated 1,3,4-thiadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
- C07D285/135—Nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00255703A US3803164A (en) | 1972-05-22 | 1972-05-22 | Simplified one vessel preparation of 1-(5-alkyl-1,3,4-thiadiazol-2-yl)-1,3-dialkyl-ureas with azeotropic drying |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL99724B1 true PL99724B1 (pl) | 1978-08-31 |
Family
ID=22969531
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973162757A PL99724B1 (pl) | 1972-05-22 | 1973-05-22 | Sposob wytwarzania 1-/5-alkilo-1,3,4-tiadiazolilo-2/-1,3-dwualkilomocznikow |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US3803164A (show.php) |
| JP (1) | JPS4948668A (show.php) |
| AR (1) | AR194667A1 (show.php) |
| AT (1) | AT325631B (show.php) |
| AU (1) | AU472800B2 (show.php) |
| BE (1) | BE799575A (show.php) |
| BG (1) | BG21215A3 (show.php) |
| BR (1) | BR7303730D0 (show.php) |
| CA (1) | CA955261A (show.php) |
| CH (1) | CH562235A5 (show.php) |
| CS (1) | CS178427B2 (show.php) |
| DD (1) | DD105232A5 (show.php) |
| DE (1) | DE2325332A1 (show.php) |
| ES (1) | ES414987A1 (show.php) |
| FR (1) | FR2185629B1 (show.php) |
| GB (1) | GB1405195A (show.php) |
| HU (1) | HU166841B (show.php) |
| IE (1) | IE37589B1 (show.php) |
| IL (1) | IL42218A (show.php) |
| IT (1) | IT986094B (show.php) |
| NL (1) | NL7307093A (show.php) |
| PH (1) | PH11138A (show.php) |
| PL (1) | PL99724B1 (show.php) |
| RO (1) | RO62899A (show.php) |
| SE (1) | SE395274B (show.php) |
| SU (1) | SU649319A3 (show.php) |
| ZA (1) | ZA732973B (show.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1427087A (show.php) * | 1972-08-14 | 1976-03-03 | ||
| US4097264A (en) * | 1973-05-14 | 1978-06-27 | Gulf Oil Corporation | Chloro-tert.butyl-1,3,4-thiadiazoleurea herbicides and use to combat unwanted vegetation |
| US4028090A (en) * | 1974-10-15 | 1977-06-07 | Eli Lilly And Company | Herbicidal use of 5-cyanoalkyl-1,3,4-thiadiazol-2-ylureas |
| DE2623657A1 (de) * | 1976-05-24 | 1977-12-08 | Schering Ag | 2-dimethylcarbamoylimino-1,3,4- thiadiazolin-3-id-salze, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel |
| ATE94538T1 (de) * | 1987-06-25 | 1993-10-15 | Dowelanco | Verfahren zur herstellung von harnstoffen. |
| CN103288777A (zh) * | 2013-05-28 | 2013-09-11 | 浙江禾田化工有限公司 | 特丁噻草隆关键中间体2-甲基氨基-5-叔丁基-1,3,4-噻二唑的合成方法 |
| US10259778B2 (en) * | 2014-11-10 | 2019-04-16 | Aurobindo Pharma Ltd | Process for the preparation of raltegravir |
| CN108794427B (zh) * | 2018-07-13 | 2022-07-29 | 江苏快达农化股份有限公司 | 一种1,3,4-噻二唑衍生物的合成方法 |
-
1972
- 1972-05-22 US US00255703A patent/US3803164A/en not_active Expired - Lifetime
-
1973
- 1973-05-02 ZA ZA732973A patent/ZA732973B/xx unknown
- 1973-05-03 IE IE697/73A patent/IE37589B1/xx unknown
- 1973-05-04 GB GB2137173A patent/GB1405195A/en not_active Expired
- 1973-05-08 IL IL42218A patent/IL42218A/en unknown
- 1973-05-09 AU AU55477/73A patent/AU472800B2/en not_active Expired
- 1973-05-11 CA CA171,019A patent/CA955261A/en not_active Expired
- 1973-05-15 FR FR7317448A patent/FR2185629B1/fr not_active Expired
- 1973-05-16 BE BE1005049A patent/BE799575A/xx unknown
- 1973-05-16 SE SE7306899A patent/SE395274B/xx unknown
- 1973-05-17 CH CH708173A patent/CH562235A5/xx not_active IP Right Cessation
- 1973-05-18 DE DE2325332A patent/DE2325332A1/de active Pending
- 1973-05-18 AR AR248101A patent/AR194667A1/es active
- 1973-05-18 PH PH14626A patent/PH11138A/en unknown
- 1973-05-21 NL NL7307093A patent/NL7307093A/xx not_active Application Discontinuation
- 1973-05-21 SU SU731925437A patent/SU649319A3/ru active
- 1973-05-21 HU HUEI477A patent/HU166841B/hu unknown
- 1973-05-21 ES ES414987A patent/ES414987A1/es not_active Expired
- 1973-05-21 BR BR3730/73A patent/BR7303730D0/pt unknown
- 1973-05-22 IT IT50116/73A patent/IT986094B/it active
- 1973-05-22 JP JP48057097A patent/JPS4948668A/ja active Pending
- 1973-05-22 DD DD170991A patent/DD105232A5/xx unknown
- 1973-05-22 RO RO74866A patent/RO62899A/ro unknown
- 1973-05-22 PL PL1973162757A patent/PL99724B1/pl unknown
- 1973-05-22 AT AT444473A patent/AT325631B/de not_active IP Right Cessation
- 1973-05-22 BG BG023692A patent/BG21215A3/xx unknown
- 1973-05-22 CS CS3683A patent/CS178427B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4948668A (show.php) | 1974-05-11 |
| PH11138A (en) | 1977-10-27 |
| ES414987A1 (es) | 1976-02-16 |
| SU649319A3 (ru) | 1979-02-25 |
| IT986094B (it) | 1975-01-10 |
| HU166841B (show.php) | 1975-06-28 |
| BE799575A (fr) | 1973-11-16 |
| RO62899A (show.php) | 1977-08-15 |
| ATA444473A (de) | 1975-01-15 |
| AU472800B2 (en) | 1976-06-03 |
| FR2185629B1 (show.php) | 1977-04-29 |
| DE2325332A1 (de) | 1973-12-06 |
| CS178427B2 (show.php) | 1977-09-15 |
| GB1405195A (en) | 1975-09-03 |
| AU5547773A (en) | 1974-11-14 |
| SE395274B (sv) | 1977-08-08 |
| NL7307093A (show.php) | 1973-11-26 |
| IE37589B1 (en) | 1977-08-31 |
| IE37589L (en) | 1973-11-22 |
| DD105232A5 (show.php) | 1974-04-12 |
| AR194667A1 (es) | 1973-07-31 |
| IL42218A0 (en) | 1973-07-30 |
| ZA732973B (en) | 1974-10-30 |
| CH562235A5 (show.php) | 1975-05-30 |
| AT325631B (de) | 1975-10-27 |
| IL42218A (en) | 1977-01-31 |
| US3803164A (en) | 1974-04-09 |
| CA955261A (en) | 1974-09-24 |
| BR7303730D0 (pt) | 1974-06-27 |
| BG21215A3 (bg) | 1976-03-20 |
| FR2185629A1 (show.php) | 1974-01-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL99724B1 (pl) | Sposob wytwarzania 1-/5-alkilo-1,3,4-tiadiazolilo-2/-1,3-dwualkilomocznikow | |
| CH651300A5 (de) | Heterocyclisch substituierte aminopropennitrile. | |
| KR800000505B1 (ko) | 1-티아디아 졸리이미다 졸리딘온의 제조방법 | |
| FI76809C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara nya 5-(3-pyridyl)pyrrolo/1,2-c/tiazol-7- karboxamid-derivat. | |
| PL88699B1 (show.php) | ||
| Angier et al. | Pteroic acid derivatives. VI. Unequivocal syntheses of some isomeric glutamic acid peptides | |
| Ketcham et al. | Heterocyclic ring-closure reactions. 6. Preparation and further cyclization reactions of 5-imino-1, 3-diphenyl-4-thioxo-2-imidazolidinone and 5-imino-1, 3-diphenyl-2, 4-imidazolidinedithione | |
| US2543333A (en) | Derivatives of upsilon-triazolo (d) pyrimidine and methods of preparing the same | |
| DE2440922A1 (de) | Verfahren zur herstellung von 2-amino-5-alkyl-1,3,4-thiadiazolen | |
| US3238220A (en) | 3-hydroxy-benzisoxazoles and their production | |
| US4072680A (en) | Derivatives of pyrazolo[1,5-a]pyrido[3,2-e]pyrimidine | |
| US4283543A (en) | Process for preparing the compound 5-t-butyl-2-methylamino-1,3,4-triadiazole | |
| PL98290B1 (pl) | Sposob wytwarzania pochodnych chinazolinonu | |
| CA1037042A (en) | Thiazoloisoquinolines, and process for their preparation | |
| Lieber et al. | Reaction of 5-Amino-1, 2, 3, 4-Thiatriazole with Benzylamine | |
| GB2119252A (en) | Use of thiadiazolylimidazolidinones to control aquatic vegetation | |
| US5081255A (en) | High melting aromatic nitrate esters | |
| US3419563A (en) | Process for producing 7-amino-carbostyrile derivatives | |
| US2945047A (en) | Thiosemicarbazides | |
| DE10353205A1 (de) | Ortho-substituierte Pentafluorsulfuranyl-Benzole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als wertvolle Synthese-Zwischenstufen | |
| PL94057B1 (show.php) | ||
| US3019259A (en) | 1, 4-dihydro-1, 4-methanonaphthalene-5, 8-diamine | |
| PL88905B1 (show.php) | ||
| US3760076A (en) | Combating pests with benzothiadiozines | |
| US2980687A (en) | Thiadiazole-dicarboxylates |