PL97425B1 - Sposob wytwarzania nowych pochodnych sulfotlenku karbamoilu - Google Patents
Sposob wytwarzania nowych pochodnych sulfotlenku karbamoilu Download PDFInfo
- Publication number
- PL97425B1 PL97425B1 PL1973165721A PL16572173A PL97425B1 PL 97425 B1 PL97425 B1 PL 97425B1 PL 1973165721 A PL1973165721 A PL 1973165721A PL 16572173 A PL16572173 A PL 16572173A PL 97425 B1 PL97425 B1 PL 97425B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- scn
- sulfoxide
- reacted
- chloroperbenzoic acid
- Prior art date
Links
- ATTZFSUZZUNHBP-UHFFFAOYSA-N Piperonyl sulfoxide Chemical compound CCCCCCCCS(=O)C(C)CC1=CC=C2OCOC2=C1 ATTZFSUZZUNHBP-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 claims description 65
- -1 alkyl radical Chemical class 0.000 claims description 28
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 claims description 26
- 150000003462 sulfoxides Chemical class 0.000 claims description 10
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 claims description 8
- DCPZJACXSHVQOD-UHFFFAOYSA-N carbamoylsulfinylformamide Chemical class NC(=O)S(=O)C(N)=O DCPZJACXSHVQOD-UHFFFAOYSA-N 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- ULQQGOGMQRGFFR-UHFFFAOYSA-N 2-chlorobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC=C1Cl ULQQGOGMQRGFFR-UHFFFAOYSA-N 0.000 claims description 3
- LULAYUGMBFYYEX-UHFFFAOYSA-N metachloroperbenzoic acid Natural products OC(=O)C1=CC=CC(Cl)=C1 LULAYUGMBFYYEX-UHFFFAOYSA-N 0.000 claims description 3
- 239000007800 oxidant agent Substances 0.000 claims description 3
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical group [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 claims description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims 2
- VMEOFRRFNIVESX-UHFFFAOYSA-N bis(2-methylpropyl)carbamothioic s-acid Chemical compound CC(C)CN(C(S)=O)CC(C)C VMEOFRRFNIVESX-UHFFFAOYSA-N 0.000 claims 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims 2
- YNJSNEKCXVFDKW-UHFFFAOYSA-N 3-(5-amino-1h-indol-3-yl)-2-azaniumylpropanoate Chemical compound C1=C(N)C=C2C(CC(N)C(O)=O)=CNC2=C1 YNJSNEKCXVFDKW-UHFFFAOYSA-N 0.000 claims 1
- 125000003542 3-methylbutan-2-yl group Chemical group [H]C([H])([H])C([H])(*)C([H])(C([H])([H])[H])C([H])([H])[H] 0.000 claims 1
- 239000005711 Benzoic acid Substances 0.000 claims 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 claims 1
- 240000005265 Lupinus mutabilis Species 0.000 claims 1
- 235000008755 Lupinus mutabilis Nutrition 0.000 claims 1
- SBFBRBSYYMCWKA-UHFFFAOYSA-N NC(S(CC1=CC=CC=C1)=O)=O Chemical compound NC(S(CC1=CC=CC=C1)=O)=O SBFBRBSYYMCWKA-UHFFFAOYSA-N 0.000 claims 1
- 235000019095 Sechium edule Nutrition 0.000 claims 1
- 235000010233 benzoic acid Nutrition 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- NCPDPTXSMJDCIH-UHFFFAOYSA-N dipropylcarbamothioic s-acid Chemical compound CCCN(C(S)=O)CCC NCPDPTXSMJDCIH-UHFFFAOYSA-N 0.000 claims 1
- APRJFNLVTJWEPP-UHFFFAOYSA-M n,n-diethylcarbamate Chemical compound CCN(CC)C([O-])=O APRJFNLVTJWEPP-UHFFFAOYSA-M 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 description 13
- 239000007787 solid Substances 0.000 description 8
- 230000002363 herbicidal effect Effects 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 244000237956 Amaranthus retroflexus Species 0.000 description 3
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 3
- 241000217446 Calystegia sepium Species 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 3
- 244000115721 Pennisetum typhoides Species 0.000 description 3
- 235000007195 Pennisetum typhoides Nutrition 0.000 description 3
- 235000008515 Setaria glauca Nutrition 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 244000105017 Vicia sativa Species 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- OUCPTWRZRLSGNG-UHFFFAOYSA-N CC(C)(C)N(C(C)(C)C)C([O-])=[S+]CC1=CC=CC=C1 Chemical compound CC(C)(C)N(C(C)(C)C)C([O-])=[S+]CC1=CC=CC=C1 OUCPTWRZRLSGNG-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 2
- 244000058871 Echinochloa crus-galli Species 0.000 description 2
- 235000011999 Panicum crusgalli Nutrition 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 150000003558 thiocarbamic acid derivatives Chemical class 0.000 description 2
- 241000209764 Avena fatua Species 0.000 description 1
- 235000007320 Avena fatua Nutrition 0.000 description 1
- 244000025254 Cannabis sativa Species 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- FFCKSXBQQVKELL-UHFFFAOYSA-N dibutylcarbamothioic s-acid Chemical compound CCCCN(C(O)=S)CCCC FFCKSXBQQVKELL-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- OVARTBFNCCXQKS-UHFFFAOYSA-N propan-2-one;hydrate Chemical compound O.CC(C)=O OVARTBFNCCXQKS-UHFFFAOYSA-N 0.000 description 1
- LBMGTDVXBJTJHB-UHFFFAOYSA-N s-benzyl n,n-dibutylcarbamothioate Chemical compound CCCCN(CCCC)C(=O)SCC1=CC=CC=C1 LBMGTDVXBJTJHB-UHFFFAOYSA-N 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/20—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carbonic acid, or sulfur or nitrogen analogues thereof
- C07D295/21—Radicals derived from sulfur analogues of carbonic acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT30240/72A IT972188B (it) | 1972-10-09 | 1972-10-09 | Composti carbamoil solfossidi |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL97425B1 true PL97425B1 (pl) | 1978-02-28 |
Family
ID=11229381
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973165721A PL97425B1 (pl) | 1972-10-09 | 1973-10-08 | Sposob wytwarzania nowych pochodnych sulfotlenku karbamoilu |
Country Status (21)
| Country | Link |
|---|---|
| JP (1) | JPS4980022A (ref) |
| BE (1) | BE805839A (ref) |
| BG (2) | BG26506A4 (ref) |
| BR (1) | BR7307801D0 (ref) |
| CA (1) | CA1156669A (ref) |
| CS (1) | CS175360B2 (ref) |
| DD (2) | DD114331A5 (ref) |
| DE (1) | DE2350475A1 (ref) |
| DK (1) | DK135361B (ref) |
| EG (1) | EG11413A (ref) |
| ES (1) | ES419439A1 (ref) |
| FR (1) | FR2202083B1 (ref) |
| GB (1) | GB1446064A (ref) |
| HU (1) | HU167344B (ref) |
| IT (1) | IT972188B (ref) |
| LU (1) | LU68575A1 (ref) |
| NL (1) | NL7313791A (ref) |
| PL (1) | PL97425B1 (ref) |
| RO (1) | RO63005A (ref) |
| SU (1) | SU482944A3 (ref) |
| ZA (1) | ZA737836B (ref) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4341702A (en) * | 1972-08-14 | 1982-07-27 | Stauffer Chemical Company | Herbicidal active sulfoxide and sulfone compounds |
| AR219067A1 (es) * | 1976-03-29 | 1980-07-31 | Stauffer Chemical Co | Nuevos compuestos herbicidas derivados de s-metil sustituido tiocarbamato y sulfoxidos de los mismos |
| ZA849423B (en) * | 1983-12-05 | 1985-10-30 | Stauffer Chemical Co | Herbicidal compositions and method of controlling weeds |
| WO2005092102A1 (en) * | 2004-03-26 | 2005-10-06 | Syngenta Participations Ag | Use of prosulfocarb to control undesired vegetation in rice fields |
| EP4251142A4 (en) * | 2020-11-30 | 2025-04-09 | Sophrosyne Pharmaceuticals Limited | Compounds and methods for treating alcohol use disorder |
| JP2024526073A (ja) | 2021-06-10 | 2024-07-17 | ソフロシネ・ファーマシューティカルズ・リミテッド | Aldh2モジュレーターの結晶形態 |
-
1972
- 1972-10-09 IT IT30240/72A patent/IT972188B/it active
-
1973
- 1973-10-04 RO RO7300076247A patent/RO63005A/ro unknown
- 1973-10-08 PL PL1973165721A patent/PL97425B1/pl unknown
- 1973-10-08 DE DE19732350475 patent/DE2350475A1/de active Pending
- 1973-10-08 ZA ZA737836*A patent/ZA737836B/xx unknown
- 1973-10-08 ES ES419439A patent/ES419439A1/es not_active Expired
- 1973-10-08 DK DK545173AA patent/DK135361B/da unknown
- 1973-10-08 BR BR7801/73A patent/BR7307801D0/pt unknown
- 1973-10-08 DD DD182042*A patent/DD114331A5/xx unknown
- 1973-10-08 HU HUMO887A patent/HU167344B/hu unknown
- 1973-10-08 CS CS6906A patent/CS175360B2/cs unknown
- 1973-10-08 FR FR7335828A patent/FR2202083B1/fr not_active Expired
- 1973-10-08 LU LU68575A patent/LU68575A1/xx unknown
- 1973-10-08 DD DD173914A patent/DD110860A5/xx unknown
- 1973-10-08 EG EG387/73A patent/EG11413A/xx active
- 1973-10-08 SU SU1960590A patent/SU482944A3/ru active
- 1973-10-08 NL NL7313791A patent/NL7313791A/xx not_active Application Discontinuation
- 1973-10-08 JP JP48112439A patent/JPS4980022A/ja active Pending
- 1973-10-09 BG BG032577A patent/BG26506A4/xx unknown
- 1973-10-09 CA CA000182865A patent/CA1156669A/en not_active Expired
- 1973-10-09 BG BG024690A patent/BG25791A3/xx unknown
- 1973-10-09 GB GB4714573A patent/GB1446064A/en not_active Expired
- 1973-10-09 BE BE136486A patent/BE805839A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2202083B1 (ref) | 1979-04-27 |
| DK135361C (ref) | 1977-10-10 |
| BR7307801D0 (pt) | 1974-08-15 |
| CS175360B2 (ref) | 1977-05-31 |
| NL7313791A (ref) | 1974-04-11 |
| IT972188B (it) | 1974-05-20 |
| ES419439A1 (es) | 1976-04-01 |
| DD114331A5 (ref) | 1975-08-05 |
| ZA737836B (en) | 1974-08-28 |
| BG25791A3 (en) | 1978-12-12 |
| JPS4980022A (ref) | 1974-08-02 |
| GB1446064A (en) | 1976-08-11 |
| RO63005A (fr) | 1978-05-15 |
| DE2350475A1 (de) | 1974-04-25 |
| EG11413A (en) | 1978-03-29 |
| DD110860A5 (ref) | 1975-01-12 |
| FR2202083A1 (ref) | 1974-05-03 |
| BE805839A (fr) | 1974-04-09 |
| LU68575A1 (ref) | 1974-05-09 |
| BG26506A4 (bg) | 1979-04-12 |
| DK135361B (da) | 1977-04-18 |
| CA1156669A (en) | 1983-11-08 |
| HU167344B (ref) | 1975-09-27 |
| SU482944A3 (ru) | 1975-08-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3642900A (en) | Dithio amino alkanes | |
| US3662034A (en) | S-allylic and s-vinylic o,s'-dialkyl dithio-phosphates | |
| US3867396A (en) | Triazolyl phosphorus compounds | |
| PL97425B1 (pl) | Sposob wytwarzania nowych pochodnych sulfotlenku karbamoilu | |
| US2862019A (en) | Thiophosphoric acid esters and their production | |
| US3018215A (en) | Thiophosphoric acid ester compounds | |
| US3920677A (en) | Phosphorus acid esters of 5-alkyl-and-aralkyl-1,2,4-oxadiazolyl compounds | |
| US3318910A (en) | 2-iminothiolanes and related compounds | |
| US3644415A (en) | Thiabicyclononanes and process | |
| US3679683A (en) | Barbiturate 3-n-methylene phosphates | |
| US3591475A (en) | Preparation of unsymmetrical thiol-allene diadducts | |
| DE2261230A1 (de) | Neue kondensationsprodukte | |
| US3660543A (en) | S-2-hydrocarbylthio-alkyl esters of thiophosphorus acids | |
| CA1045630A (en) | Triazolylphosphorus compounds | |
| US3928436A (en) | Carbamoyl sulfoxide derivatives | |
| US3658901A (en) | Cyanodithioimidocarbonates | |
| US4215075A (en) | Ketoxime carbamates | |
| US3197365A (en) | Insecticidal and nematocidal phosphinyl imides | |
| US3476837A (en) | Alkali metal salts of phosphorus dithiocarbamates | |
| US3968208A (en) | Fungicidal compositions | |
| US3234082A (en) | Method for protecting plants against infestation by mites and insects employing carbonate esters of 2, 4-dinitro-6-branched alkyl-phenols and sulphur analogs thereof | |
| US4049801A (en) | Phosphite compounds as fungicidal agents | |
| US3367935A (en) | Process for the preparation of phosphoric acid esters | |
| US3349125A (en) | Aromatic sulfonyl bis-ureas and process of preparation | |
| DE2363208C3 (de) | Thiolphosphorsäureester |