PL94713B1 - Sposob wytwarzania n-fosfonometyloglicyny - Google Patents
Sposob wytwarzania n-fosfonometyloglicyny Download PDFInfo
- Publication number
- PL94713B1 PL94713B1 PL1975181574A PL18157475A PL94713B1 PL 94713 B1 PL94713 B1 PL 94713B1 PL 1975181574 A PL1975181574 A PL 1975181574A PL 18157475 A PL18157475 A PL 18157475A PL 94713 B1 PL94713 B1 PL 94713B1
- Authority
- PL
- Poland
- Prior art keywords
- glycine
- temperature
- mol
- acid
- ooc
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 9
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 claims description 36
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 28
- 239000004471 Glycine Substances 0.000 claims description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 16
- 239000002253 acid Substances 0.000 claims description 10
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 7
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 5
- -1 alkali metal salt Chemical class 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims description 3
- 239000011707 mineral Substances 0.000 claims description 3
- WBTIFBJEYFLFFW-UHFFFAOYSA-N 2-(hydroxymethylazaniumyl)acetate Chemical compound OCNCC(O)=O WBTIFBJEYFLFFW-UHFFFAOYSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 229910052708 sodium Inorganic materials 0.000 claims description 2
- 239000011734 sodium Substances 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- GCLUIEONNKHTIQ-UHFFFAOYSA-N dihydroxyphosphanyl diethyl phosphite Chemical compound CCOP(OCC)OP(O)O GCLUIEONNKHTIQ-UHFFFAOYSA-N 0.000 claims 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 claims 1
- 238000009833 condensation Methods 0.000 claims 1
- 230000005494 condensation Effects 0.000 claims 1
- 150000005690 diesters Chemical class 0.000 claims 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 claims 1
- 230000020477 pH reduction Effects 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 description 24
- 229910052698 phosphorus Inorganic materials 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 7
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- 238000001816 cooling Methods 0.000 description 5
- 238000000354 decomposition reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- LXCYSACZTOKNNS-UHFFFAOYSA-N diethoxy(oxo)phosphanium Chemical compound CCO[P+](=O)OCC LXCYSACZTOKNNS-UHFFFAOYSA-N 0.000 description 3
- 241000196324 Embryophyta Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 238000007069 methylation reaction Methods 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- SGTQXKBRULHMLI-UHFFFAOYSA-N (methyl-$l^{2}-phosphanyl)methane Chemical compound C[P]C SGTQXKBRULHMLI-UHFFFAOYSA-N 0.000 description 1
- KOTAWJKLIIWMMJ-UHFFFAOYSA-N 2-(dimethoxyphosphorylmethylamino)acetic acid Chemical compound COP(=O)(OC)CNCC(O)=O KOTAWJKLIIWMMJ-UHFFFAOYSA-N 0.000 description 1
- PUOUFDPPEXJKCL-UHFFFAOYSA-N 2-(diphosphonomethylamino)acetic acid Chemical compound OC(=O)CNC(P(O)(O)=O)P(O)(O)=O PUOUFDPPEXJKCL-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 241000508725 Elymus repens Species 0.000 description 1
- 241000234643 Festuca arundinacea Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- NFEJQNVAGUSCHH-UHFFFAOYSA-N OP(O)OP(O)O.OP(O)OP(O)O Chemical compound OP(O)OP(O)O.OP(O)OP(O)O NFEJQNVAGUSCHH-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- 240000001949 Taraxacum officinale Species 0.000 description 1
- 235000006754 Taraxacum officinale Nutrition 0.000 description 1
- 235000005187 Taraxacum officinale ssp. officinale Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- MOFCYHDQWIZKMY-UHFFFAOYSA-N chloromethylphosphonic acid Chemical compound OP(O)(=O)CCl MOFCYHDQWIZKMY-UHFFFAOYSA-N 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000020176 deacylation Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- CZHYKKAKFWLGJO-UHFFFAOYSA-N dimethyl phosphite Chemical compound COP([O-])OC CZHYKKAKFWLGJO-UHFFFAOYSA-N 0.000 description 1
- 235000013399 edible fruits Nutrition 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 description 1
- OXHDYFKENBXUEM-UHFFFAOYSA-N glyphosine Chemical compound OC(=O)CN(CP(O)(O)=O)CP(O)(O)=O OXHDYFKENBXUEM-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000002367 phosphate rock Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical class OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- YWICANUUQPYHOW-UHFFFAOYSA-M sodium;2-(phosphonomethylamino)acetate Chemical compound [Na+].OP(O)(=O)CNCC([O-])=O YWICANUUQPYHOW-UHFFFAOYSA-M 0.000 description 1
- WUWHFEHKUQVYLF-UHFFFAOYSA-M sodium;2-aminoacetate Chemical compound [Na+].NCC([O-])=O WUWHFEHKUQVYLF-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/28—Phosphorus compounds with one or more P—C bonds
- C07F9/38—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)]
- C07F9/3804—Phosphonic acids [RP(=O)(OH)2]; Thiophosphonic acids ; [RP(=X1)(X2H)2(X1, X2 are each independently O, S or Se)] not used, see subgroups
- C07F9/3808—Acyclic saturated acids which can have further substituents on alkyl
- C07F9/3813—N-Phosphonomethylglycine; Salts or complexes thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU74CI1486A HU173170B (hu) | 1974-06-27 | 1974-06-27 | Sposob poluchenija n-fosfonometil-glicina |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL94713B1 true PL94713B1 (pl) | 1977-08-31 |
Family
ID=10994524
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975181574A PL94713B1 (pl) | 1974-06-27 | 1975-06-26 | Sposob wytwarzania n-fosfonometyloglicyny |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4065491A (enExample) |
| CS (1) | CS183133B1 (enExample) |
| DD (1) | DD118435A1 (enExample) |
| HU (1) | HU173170B (enExample) |
| PL (1) | PL94713B1 (enExample) |
| SU (1) | SU645587A3 (enExample) |
| YU (1) | YU39534B (enExample) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH647528A5 (fr) * | 1978-10-27 | 1985-01-31 | Bcap Biolog Chem Act Pat | Procede pour la preparation de n-phosphonomethylglycine. |
| HU184601B (en) * | 1979-07-09 | 1984-09-28 | Alkaloida Vegyeszeti Gyar | Process for producing n-/phosphono-methyl/-glycine |
| US4439373A (en) * | 1982-12-27 | 1984-03-27 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| US4457873A (en) * | 1983-03-24 | 1984-07-03 | Stauffer Chemical Company | Process for preparing phosphonomethylated amino acids |
| FR2560198B1 (fr) * | 1984-02-23 | 1987-05-07 | Rhone Poulenc Agrochimie | Esters de la famille de la n-phosphonomethylglycine et leur utilisation pour la preparation d'herbicides connus |
| US5874612A (en) * | 1984-12-28 | 1999-02-23 | Baysdon; Sherrol L. | Process for the preparation of glyphosate and glyphosate derivatives |
| DE3532344A1 (de) * | 1985-09-11 | 1987-03-19 | Hoechst Ag | Verfahren zur herstellung von n-phosphonomethylglycin |
| US4657705A (en) * | 1985-09-23 | 1987-04-14 | Monsanto Company | Process for the preparation of N-substituted aminomethylphosphonic acids |
| US4694082A (en) * | 1985-09-23 | 1987-09-15 | Monsanto Company | Compound 1,4-diisopropyl-2,5-diketopiperazine |
| US4804499A (en) * | 1985-09-23 | 1989-02-14 | Monsanto Company | Process for the preparation of N-substituted aminomethylphosphonic acids |
| US4946993A (en) * | 1988-11-23 | 1990-08-07 | American Cyanamid Company | 2-azabicyclo[2.2.1.]hept-5-ene-2-acetic acid, derivatives thereof and related compounds, process for the preparation of said compounds, and the use of said compounds for the manufacture of N-phosphonomethylglycine |
| US5149825A (en) * | 1988-11-23 | 1992-09-22 | American Cyanamid Company | 2-azabicyclo(2.2.1)hept-5-ene-2-acetic acid, derivatives thereof and related compounds, process for the preparation of said compounds and the use of said compounds for the manufacture of N-phosphonomethylglycine |
| ATE111102T1 (de) * | 1989-06-15 | 1994-09-15 | Finchimica Srl | Verfahren zur herstellung von n- phosphonomethylglycin. |
| RU2152397C1 (ru) * | 1994-07-01 | 2000-07-10 | Монсанто Компани | Способы получения n-гидроксиалкиламинометилфосфоновой кислоты, n-фосфонометиламинокарбоновой кислоты и n-фосфонометилглицина или их солей |
| AU694782B2 (en) * | 1994-07-01 | 1998-07-30 | Monsanto Technology Llc | Process for preparing n-phosphonomethylamino carboxylic acids |
| IL110410A (en) * | 1994-07-21 | 1999-08-17 | Mul T Lock Ltd | Security system |
| CN1239473A (zh) | 1997-02-13 | 1999-12-22 | 孟山都公司 | 制备氨基羧酸的方法 |
| DE19737446A1 (de) * | 1997-08-22 | 1999-02-25 | Schering Ag | Verfahren zur Herstellung von Phosphonsäurederivaten |
| DE10130135A1 (de) * | 2001-06-22 | 2003-01-02 | Basf Ag | Verfahren zur Herstellung von N-Phosphonomethylglycin |
| CN101395164A (zh) * | 2006-01-10 | 2009-03-25 | 罗伊·J·于 | N-(膦酰基烷基)-氨基酸、其衍生物和组合物以及使用方法 |
| CN101343288B (zh) * | 2008-08-29 | 2011-07-27 | 四川省乐山市福华通达农药科技有限公司 | 草甘膦酸制备过程中的水解方法 |
| US9676799B2 (en) | 2012-07-17 | 2017-06-13 | Straitmark Holding Ag | Method for the synthesis of N-(phosphonomethyl)glycine |
| ES2632779T3 (es) | 2012-07-17 | 2017-09-15 | Straitmark Holding Ag | Método para la síntesis de N-(fosfonometil) glicina |
| BR112015000988A2 (pt) | 2012-07-17 | 2017-06-27 | Straitmark Holding Ag | método para a síntese de ácido n-fosfonometiliminodiacético ou derivados do mesmo |
| US10280189B2 (en) | 2012-07-17 | 2019-05-07 | Monsanto Technology Llc | Method for the synthesis of aminoalkylenephosphonic acid |
| WO2014012990A1 (en) | 2012-07-17 | 2014-01-23 | Straitmark Holding Ag | Method for the synthesis of alpha-aminoalkylenephosphonic acid |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2635112A (en) * | 1949-07-28 | 1953-04-14 | Research Corp | Process for producing aminomethylphosphonic acid compounds |
| CH336065A (de) * | 1954-03-05 | 1959-02-15 | Ciba Geigy | Verfahren zur Herstellung von neuen Stickstoff und Phosphor enthaltenden Verbindungen |
| CA775575A (en) * | 1961-11-13 | 1968-01-09 | R. Irani Riyad | Organic phosphorus compounds |
| DE1250042B (enExample) * | 1965-10-21 | |||
| US3480699A (en) * | 1966-04-15 | 1969-11-25 | Stauffer Chemical Co | Chloro-substituted hydroxypolyalkoxy aminomethylphosphinates |
-
1974
- 1974-06-27 HU HU74CI1486A patent/HU173170B/hu unknown
-
1975
- 1975-06-23 DD DD186830A patent/DD118435A1/xx unknown
- 1975-06-24 YU YU1613/75A patent/YU39534B/xx unknown
- 1975-06-26 SU SU752147955A patent/SU645587A3/ru active
- 1975-06-26 PL PL1975181574A patent/PL94713B1/pl unknown
- 1975-06-27 CS CS7500004575A patent/CS183133B1/cs unknown
-
1977
- 1977-01-12 US US05/758,790 patent/US4065491A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| YU161375A (en) | 1982-02-28 |
| DD118435A1 (enExample) | 1976-03-05 |
| YU39534B (en) | 1984-12-31 |
| US4065491A (en) | 1977-12-27 |
| HU173170B (hu) | 1979-03-28 |
| SU645587A3 (ru) | 1979-01-30 |
| CS183133B1 (en) | 1978-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL94713B1 (pl) | Sposob wytwarzania n-fosfonometyloglicyny | |
| US2964549A (en) | Alkanolaminealkanephosphonic acids and derivatives thereof | |
| SU843755A3 (ru) | Способ получени сложных триэфиров -фОСфОНОМЕТилглициНА | |
| US4221583A (en) | N-Phosphonomethylglycinonitrile and certain derivatives thereof | |
| SU638238A3 (ru) | Гербицидное средство | |
| RU2007112225A (ru) | Полифосфатное производное 1, 3, 5-триазинового соединения, способ его получения и его применения | |
| FI60020C (fi) | Som herbicid anvaendbart 2-karboxietyl-n-fosfonometylglycinat och dess salter | |
| US3483178A (en) | Esters,salts,and acids of organo-phosphono-amine oxides | |
| US4422982A (en) | Method for preparation of N-phosphonomethylglycine | |
| EP0102694B1 (en) | Method for preparation of n-phosphonomethylglycine | |
| CA2203553C (en) | Process for the manufacture of n-phosphonomethylglycine | |
| CA2213726A1 (en) | Treatment of formaldehyde containing waste stream | |
| CN101307074B (zh) | 一种双甘膦的制备方法 | |
| US4415503A (en) | Method for preparation of N-phosphonomethylglycine | |
| US3429914A (en) | Organo-phosphono-amine oxides | |
| US3474133A (en) | Tris(phosphono-lower alkylidene) amine oxides | |
| US3920733A (en) | Ureidoalkylphosphonic acids | |
| JPH0257077B2 (enExample) | ||
| US3470243A (en) | Tetrakis(dihydrogen phosphono methyl)-ethylene diamine,n,n'-dioxide and related compounds | |
| AU761569B2 (en) | Process for preparing N-phosphonomethyl iminodiacetic acid | |
| US4003965A (en) | Phosphorus compounds | |
| US3838124A (en) | Derivatives of isocyanuric acid and processes for preparing the same | |
| US4211547A (en) | N-Phosphonomethyliminodiacetonitrile and certain derivatives thereof | |
| US3470244A (en) | Methyl bis(dihydrogen phosphono methyl)-amine oxide and related compounds | |
| CA1113475A (en) | Process for producing carboxy-alkane-aminoalkane diphosphonic acids and carboxy-alkane-aminoaryl- alkane diphosphonic acids |