PL92125B1 - - Google Patents
Download PDFInfo
- Publication number
- PL92125B1 PL92125B1 PL18205173A PL18205173A PL92125B1 PL 92125 B1 PL92125 B1 PL 92125B1 PL 18205173 A PL18205173 A PL 18205173A PL 18205173 A PL18205173 A PL 18205173A PL 92125 B1 PL92125 B1 PL 92125B1
- Authority
- PL
- Poland
- Prior art keywords
- compounds
- formula
- benzo
- cyclohepta
- piperidylidene
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 22
- 239000002253 acid Substances 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 6
- 125000000468 ketone group Chemical group 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052736 halogen Chemical group 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- BQYAIXRTUQAHCK-UHFFFAOYSA-N 2h-benzo[1,2]cyclohepta[3,6-b]thiophene Chemical class C1=C2C=CC=CC2=CC2=CCSC2=C1 BQYAIXRTUQAHCK-UHFFFAOYSA-N 0.000 claims 1
- 150000007513 acids Chemical class 0.000 claims 1
- 125000005059 halophenyl group Chemical group 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- -1 1-benzyl-4-piperidylidene Chemical group 0.000 description 8
- 235000002639 sodium chloride Nutrition 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 230000001558 histaminolytic effect Effects 0.000 description 4
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- 231100000820 toxicity test Toxicity 0.000 description 3
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 2
- 241000700198 Cavia Species 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- IYSYPCSSDZBWHN-UHFFFAOYSA-N Nor-ketotifen Chemical compound C1=2C=CSC=2C(=O)CC2=CC=CC=C2C1=C1CCNCC1 IYSYPCSSDZBWHN-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 230000003042 antagnostic effect Effects 0.000 description 2
- 230000001078 anti-cholinergic effect Effects 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229940073608 benzyl chloride Drugs 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000004452 microanalysis Methods 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229940076279 serotonin Drugs 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- LJRKFCOGIJPEHN-UHFFFAOYSA-N 10-piperidin-4-ylidene-4h-benzo[1,2]cyclohepta[3,4-b]thiophen-5-one Chemical compound C12=CC=CC=C2C(=O)CC=2SC=CC=2C1=C1CCNCC1 LJRKFCOGIJPEHN-UHFFFAOYSA-N 0.000 description 1
- ZUZJVPBIRPJYMV-UHFFFAOYSA-N 2-(1-benzylpiperidin-4-ylidene)-6-thiatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one Chemical compound C(C1=CC=CC=C1)N1CCC(CC1)=C1C2=C(CC(C=3SC=CC31)=O)C=CC=C2 ZUZJVPBIRPJYMV-UHFFFAOYSA-N 0.000 description 1
- XRJVPLGARUETJP-UHFFFAOYSA-N C1(=CC=CC=C1)CC1=CC=CC=C1.[Cl] Chemical compound C1(=CC=CC=C1)CC1=CC=CC=C1.[Cl] XRJVPLGARUETJP-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- DDIJNWXOWAUDBQ-UHFFFAOYSA-N O=C(CC1=C2C=CC(Cl)=C1)C(SC=C1)=C1C2=C(CC1)CCN1C(C1=CC=CC=C1)C1=CC=CC=C1 Chemical compound O=C(CC1=C2C=CC(Cl)=C1)C(SC=C1)=C1C2=C(CC1)CCN1C(C1=CC=CC=C1)C1=CC=CC=C1 DDIJNWXOWAUDBQ-UHFFFAOYSA-N 0.000 description 1
- RNFJTAXCEVXIFZ-UHFFFAOYSA-N O=C(CC1=C2C=CC(Cl)=C1)C(SC=C1)=C1C2=C1CCNCC1 Chemical compound O=C(CC1=C2C=CC(Cl)=C1)C(SC=C1)=C1C2=C1CCNCC1 RNFJTAXCEVXIFZ-UHFFFAOYSA-N 0.000 description 1
- 206010040108 Serotonin syndrome Diseases 0.000 description 1
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 1
- ZDVDCDLBOLSVGM-UHFFFAOYSA-N [chloro(phenyl)methyl]benzene Chemical compound C=1C=CC=CC=1C(Cl)C1=CC=CC=C1 ZDVDCDLBOLSVGM-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 230000003902 lesion Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL18205173A PL92125B1 (enEXAMPLES) | 1973-01-22 | 1973-01-22 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL18205173A PL92125B1 (enEXAMPLES) | 1973-01-22 | 1973-01-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL92125B1 true PL92125B1 (enEXAMPLES) | 1977-03-31 |
Family
ID=19972953
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL18205173A PL92125B1 (enEXAMPLES) | 1973-01-22 | 1973-01-22 |
Country Status (1)
| Country | Link |
|---|---|
| PL (1) | PL92125B1 (enEXAMPLES) |
-
1973
- 1973-01-22 PL PL18205173A patent/PL92125B1/pl unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4818756A (en) | 2-pyrimidinyl-1-piperazine derivatives, processes for their preparation and medicaments containing them | |
| CA2557541C (en) | Pyrimidine derivatives | |
| US4690930A (en) | Pyrazolo[4,3-c]quinoline-3-one and imidazo[4,3-c]cinnolin-3-one derivatives and their use as psychotropic agents | |
| Anzini et al. | Novel, potent, and selective 5-HT3 receptor antagonists based on the arylpiperazine skeleton: synthesis, structure, biological activity, and comparative molecular field analysis studies | |
| US4174397A (en) | Thiazolidine derivatives | |
| PL115756B1 (en) | Process for preparing novel 1,1-dioxid-4-hydroxy-2h-1,2-benzothiazin-3-carboxyamides | |
| US20030120072A1 (en) | Decahydro-isoquinolines | |
| WO2021203812A1 (zh) | 苯并噻嗪酮衍生物及其制备方法与作为抗结核药物的应用 | |
| NO860319L (no) | Fremgangsmaate for fremstillig av terapeutisk aktive 4h-1-benzopyran-4-on-derivater og deres svovelholdige analoger. | |
| NO162414B (no) | Fleksibel beholder for transport og lagring av massegods. | |
| EP1446399B1 (en) | Piperazine derivatives having sst1 antagonistic activity | |
| CS258483B2 (en) | Method of new thienopyridones production | |
| WO1994022871A1 (en) | THIENO-INDOLE DERIVATIVES AS 5HT2c AND 5HT2b ANTAGONISTS | |
| NO172437B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyrimidindionforbindelser | |
| US3862156A (en) | 4h-benzo{8 4,5{9 cyclohepta{8 1,2-6{9 thiophenes | |
| AU608511B2 (en) | Benzimidazolesulfonamides and imidazopyridine-sulfonamides, their preparation and their application as drugs | |
| CS272783B2 (en) | Method of arylpiperazinyl-alkylenphenyl-heterocyclic compounds production | |
| Cain et al. | Potential antitumor agents. 19. Multiply substituted 4'-(9-acridinylamino) methanesulfonanilides | |
| US3706747A (en) | Benzothieno(3,2-d)- and benzofuro(3,2-d)pyrimidines | |
| HU195509B (en) | Process for producing pyridinyl-piperazine derivatives and pharmaceutical compositions containing them as active agents | |
| JPH0337554B2 (enEXAMPLES) | ||
| CZ325196A3 (en) | Derivatives of hydroximic acid, pharmaceutical compositions containing thereof, process of their preparation and intermediates used in the preparation process | |
| US4588725A (en) | 2-piperazinyl-quinazoline derivatives and pharmaceutical compositions containing them | |
| PL123699B1 (en) | Process for preparing novel derivatives of pyran-4-one | |
| PL92125B1 (enEXAMPLES) |