PL90429B1 - - Google Patents
Download PDFInfo
- Publication number
- PL90429B1 PL90429B1 PL1974170389A PL17038974A PL90429B1 PL 90429 B1 PL90429 B1 PL 90429B1 PL 1974170389 A PL1974170389 A PL 1974170389A PL 17038974 A PL17038974 A PL 17038974A PL 90429 B1 PL90429 B1 PL 90429B1
- Authority
- PL
- Poland
- Prior art keywords
- housing
- signaling device
- air
- electrode
- cover
- Prior art date
Links
- 230000011664 signaling Effects 0.000 claims description 16
- 239000000779 smoke Substances 0.000 claims description 7
- 239000011810 insulating material Substances 0.000 claims description 4
- 238000002485 combustion reaction Methods 0.000 claims description 3
- 239000000443 aerosol Substances 0.000 claims description 2
- 150000002500 ions Chemical class 0.000 claims description 2
- 239000012811 non-conductive material Substances 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 5
- 238000004519 manufacturing process Methods 0.000 claims 1
- 230000002285 radioactive effect Effects 0.000 claims 1
- 239000000428 dust Substances 0.000 description 7
- 230000005684 electric field Effects 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 3
- 230000006378 damage Effects 0.000 description 3
- 230000003670 easy-to-clean Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 229910052695 Americium Inorganic materials 0.000 description 1
- 241000202252 Cerberus Species 0.000 description 1
- LXQXZNRPTYVCNG-UHFFFAOYSA-N americium atom Chemical compound [Am] LXQXZNRPTYVCNG-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007786 electrostatic charging Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 230000005669 field effect Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 230000000149 penetrating effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G08—SIGNALLING
- G08B—SIGNALLING OR CALLING SYSTEMS; ORDER TELEGRAPHS; ALARM SYSTEMS
- G08B17/00—Fire alarms; Alarms responsive to explosion
- G08B17/10—Actuation by presence of smoke or gases, e.g. automatic alarm devices for analysing flowing fluid materials by the use of optical means
- G08B17/11—Actuation by presence of smoke or gases, e.g. automatic alarm devices for analysing flowing fluid materials by the use of optical means using an ionisation chamber for detecting smoke or gas
- G08B17/113—Constructional details
Landscapes
- Chemical & Material Sciences (AREA)
- Analytical Chemistry (AREA)
- Business, Economics & Management (AREA)
- Emergency Management (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Fire-Detection Mechanisms (AREA)
- Other Investigation Or Analysis Of Materials By Electrical Means (AREA)
- Investigating Or Analysing Materials By Optical Means (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH551973A CH551057A (de) | 1973-04-17 | 1973-04-17 | Ionisationsfeuermelder. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL90429B1 true PL90429B1 (cs) | 1977-01-31 |
Family
ID=4294978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974170389A PL90429B1 (cs) | 1973-04-17 | 1974-04-16 |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3908957A (cs) |
| JP (1) | JPS49131798A (cs) |
| BE (1) | BE813068A (cs) |
| BR (1) | BR7403018D0 (cs) |
| CA (1) | CA998783A (cs) |
| CH (1) | CH551057A (cs) |
| CS (1) | CS216229B2 (cs) |
| DD (1) | DD111483A5 (cs) |
| DE (1) | DE2415479C3 (cs) |
| DK (1) | DK150415C (cs) |
| ES (1) | ES424918A1 (cs) |
| FI (1) | FI61768C (cs) |
| FR (1) | FR2226714B1 (cs) |
| GB (1) | GB1430891A (cs) |
| HU (1) | HU175210B (cs) |
| IL (1) | IL44507A (cs) |
| IT (1) | IT1006402B (cs) |
| NL (1) | NL177633C (cs) |
| NO (1) | NO139581C (cs) |
| PL (1) | PL90429B1 (cs) |
| SE (1) | SE396491B (cs) |
| YU (1) | YU35685B (cs) |
| ZA (1) | ZA742077B (cs) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2652970C3 (de) * | 1976-11-22 | 1979-09-06 | Hartwig Ing.(Grad.) 2409 Scharbeutz Beyersdorf | Ionisations-Brandmelder |
| US4150373A (en) * | 1977-01-27 | 1979-04-17 | Ried Jr Louis | Ionization particle detector |
| JPS6234399Y2 (cs) * | 1980-03-31 | 1987-09-02 | ||
| CH648943A5 (de) * | 1980-05-09 | 1985-04-15 | Cerberus Ag | Rauchmelder. |
| US4439683A (en) * | 1981-02-11 | 1984-03-27 | General Signal Corporation | Ionization smoke detector |
| US4488044A (en) * | 1981-11-20 | 1984-12-11 | Pittway Corporation | Ionization chamber for smoke detector and the like |
| FR2523309A1 (fr) * | 1982-03-09 | 1983-09-16 | Hugon Emile | Nouveau detecteur de fumees capacitif a modules interchangeables |
| US4529976A (en) * | 1982-10-29 | 1985-07-16 | Frederick M. Jameson | Smoke detector with masking shield |
| JPH044316Y2 (cs) * | 1985-09-30 | 1992-02-07 | ||
| FR2594953B1 (fr) * | 1986-02-25 | 1989-05-05 | Lewiner Jacques | Detecteur de fumee a chambre d'ionisation |
| JPS63239592A (ja) * | 1987-03-27 | 1988-10-05 | ホーチキ株式会社 | 光電式煙感知器 |
| EP0338218B1 (de) * | 1988-03-30 | 1993-09-15 | Cerberus Ag | Verfahren zur Brandfrüherkennung |
| US5327119A (en) * | 1989-12-22 | 1994-07-05 | Hochiki Kabushiki Kaisha | Ionizing smoke sensor |
| CH681932A5 (cs) * | 1990-12-04 | 1993-06-15 | Cerberus Ag | |
| EP0641430A4 (en) * | 1992-05-14 | 1995-09-13 | Iei Pty Ltd | GAS SAMPLING POINT FOR SMOKE AND POLLUTION DETECTION SYSTEMS. |
| AU667102B2 (en) * | 1992-05-14 | 1996-03-07 | Vision Systems Limited | Gas sampling point for smoke/pollution detection systems |
| US5856784A (en) * | 1997-04-23 | 1999-01-05 | Pittway Corporation | Low profile ionization chamber |
| US6057774A (en) * | 1999-01-21 | 2000-05-02 | Brk Brands, Inc. | Smoke alarm with anti-dust screen |
| GB0213854D0 (en) * | 2002-06-15 | 2002-07-24 | Aea Technology Plc | Radioactive sources |
| US9013316B2 (en) * | 2011-07-28 | 2015-04-21 | Finsecur | Smoke detector |
| GB201219488D0 (en) | 2012-10-30 | 2012-12-12 | Univ Sussex | Apparatus for sensing ionic current and ionising radiation |
| ES3035017A1 (es) * | 2024-02-23 | 2025-08-27 | Detnov Security S L | Dispositivo separador de particulas para detectores de incendio |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3319069A (en) * | 1964-08-27 | 1967-05-09 | American District Telegraph Co | Smoke detecting radiation sensitive fire alarm system |
| CH475614A (de) * | 1968-06-18 | 1969-07-15 | Cerberus Ag Werke Fuer Elektro | Ionisationsfeuermelder |
| GB1277091A (en) * | 1968-07-11 | 1972-06-07 | Nittan Co Ltd | Ionization type smoke detectors |
| CH486082A (de) * | 1969-05-19 | 1970-02-15 | Cerberus Ag | Ionisationsfeuermelder |
| CH491449A (de) * | 1969-05-19 | 1970-05-31 | Cerberus Ag | Rauchdetektoranordnung mit mindestens einer Rauchmesskammer |
| CH508251A (de) * | 1970-07-23 | 1971-05-31 | Cerberus Ag | Ionisationsfeuermelder |
| US3728706A (en) * | 1970-09-28 | 1973-04-17 | Gen Signal Corp | System for indicating aerosols in the atmosphere |
| BE793205A (fr) * | 1971-12-30 | 1973-04-16 | Preussag Ag Feuerschutz | Avertisseur d'incendie a ionisation |
-
1973
- 1973-04-17 CH CH551973A patent/CH551057A/xx not_active IP Right Cessation
-
1974
- 1974-03-27 IL IL44507A patent/IL44507A/en unknown
- 1974-03-29 BE BE142655A patent/BE813068A/xx not_active IP Right Cessation
- 1974-03-29 DE DE2415479A patent/DE2415479C3/de not_active Expired
- 1974-03-29 YU YU891/74A patent/YU35685B/xx unknown
- 1974-04-01 FR FR7411564A patent/FR2226714B1/fr not_active Expired
- 1974-04-02 ZA ZA00742077A patent/ZA742077B/xx unknown
- 1974-04-03 JP JP49037056A patent/JPS49131798A/ja active Pending
- 1974-04-03 ES ES424918A patent/ES424918A1/es not_active Expired
- 1974-04-04 US US457841A patent/US3908957A/en not_active Expired - Lifetime
- 1974-04-08 NL NLAANVRAGE7404783,A patent/NL177633C/xx not_active IP Right Cessation
- 1974-04-09 IT IT7421073A patent/IT1006402B/it active
- 1974-04-10 SE SE7404871A patent/SE396491B/xx not_active IP Right Cessation
- 1974-04-11 CA CA197,527A patent/CA998783A/en not_active Expired
- 1974-04-11 FI FI1124/74A patent/FI61768C/fi active
- 1974-04-12 CS CS742663A patent/CS216229B2/cs unknown
- 1974-04-15 DD DD177896A patent/DD111483A5/xx unknown
- 1974-04-16 PL PL1974170389A patent/PL90429B1/pl unknown
- 1974-04-16 DK DK208174A patent/DK150415C/da not_active IP Right Cessation
- 1974-04-16 BR BR3018/74A patent/BR7403018D0/pt unknown
- 1974-04-16 NO NO741357A patent/NO139581C/no unknown
- 1974-04-17 GB GB1684874A patent/GB1430891A/en not_active Expired
- 1974-04-17 HU HU74CE995A patent/HU175210B/hu unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2226714B1 (cs) | 1979-03-16 |
| US3908957A (en) | 1975-09-30 |
| NL7404783A (cs) | 1974-10-21 |
| CS216229B2 (en) | 1982-10-29 |
| AU6753274A (en) | 1975-10-09 |
| DE2415479A1 (de) | 1974-11-14 |
| DE2415479B2 (de) | 1980-09-04 |
| NL177633C (nl) | 1985-10-16 |
| SE396491B (sv) | 1977-09-19 |
| DD111483A5 (cs) | 1975-02-12 |
| GB1430891A (en) | 1976-04-07 |
| FI61768C (fi) | 1982-09-10 |
| YU35685B (en) | 1981-04-30 |
| CA998783A (en) | 1976-10-19 |
| BE813068A (fr) | 1974-07-15 |
| BR7403018D0 (pt) | 1974-11-19 |
| DK150415C (da) | 1987-07-13 |
| HU175210B (hu) | 1980-06-28 |
| IT1006402B (it) | 1976-09-30 |
| DK150415B (da) | 1987-02-23 |
| NO139581C (no) | 1979-04-04 |
| YU89174A (en) | 1980-09-25 |
| FI61768B (fi) | 1982-05-31 |
| JPS49131798A (cs) | 1974-12-17 |
| DE2415479C3 (de) | 1987-12-03 |
| NL177633B (nl) | 1985-05-17 |
| FR2226714A1 (cs) | 1974-11-15 |
| IL44507A0 (en) | 1974-06-30 |
| NO139581B (no) | 1978-12-27 |
| ZA742077B (en) | 1975-04-30 |
| NO741357L (no) | 1974-10-18 |
| CH551057A (de) | 1974-06-28 |
| ES424918A1 (es) | 1976-05-16 |
| IL44507A (en) | 1977-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL90429B1 (cs) | ||
| US3767917A (en) | Ionizing-type fire alarm sensor | |
| US3681603A (en) | Smoke detector with at least one smoke measuring chamber | |
| SG178800A1 (en) | Ion detecting apparatus and ion generating apparatus | |
| EP0399244A2 (en) | A light-scattering-type smoke detector | |
| GB1586694A (en) | Ionization fire alarm | |
| JPS6033514Y2 (ja) | 煙感知器 | |
| TWI798467B (zh) | 可裝附放電裝置的機器 | |
| US3731093A (en) | Ionization fire alarm with wind screen | |
| US4150373A (en) | Ionization particle detector | |
| US4345297A (en) | Electronic static discharge apparatus | |
| CA1091826A (en) | Ionisation detector chamber | |
| US3313946A (en) | Smoke, flame, critical temperature and rate of temperature rise detector | |
| US4171486A (en) | Ionization smoke detector with controlled sensitivity | |
| US3985453A (en) | Light scattering type smoke detector | |
| US3914616A (en) | Smoke detector | |
| GB1569209A (en) | Means for ionization efficiency of high-voltage grid systems | |
| JPH0512838B2 (cs) | ||
| US4488044A (en) | Ionization chamber for smoke detector and the like | |
| US3963929A (en) | Ionization analyzing air pollution, smoke and fire alarm device | |
| US5160916A (en) | Ionization type smoke sensor | |
| US4185196A (en) | Ionization smoke detector having improved stability and sensitivity | |
| US4227085A (en) | Ionization-type particle detector | |
| US4082952A (en) | Ion detector | |
| CA1104271A (en) | Arrangement for inhibiting the effect of extraneous electric fields on an improved ionization smoke detector |