PL88911B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88911B1 PL88911B1 PL1971149829A PL14982971A PL88911B1 PL 88911 B1 PL88911 B1 PL 88911B1 PL 1971149829 A PL1971149829 A PL 1971149829A PL 14982971 A PL14982971 A PL 14982971A PL 88911 B1 PL88911 B1 PL 88911B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compound
- group
- groups
- phenyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 29
- -1 dioxymethylene Chemical group 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 150000004040 pyrrolidinones Chemical class 0.000 claims description 6
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 claims description 5
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims description 4
- 150000001412 amines Chemical class 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical group [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 230000008030 elimination Effects 0.000 claims description 3
- 238000003379 elimination reaction Methods 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical group FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 229910052731 fluorine Chemical group 0.000 claims description 2
- 239000011737 fluorine Chemical group 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- 235000005074 zinc chloride Nutrition 0.000 claims description 2
- 239000011592 zinc chloride Substances 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 229910006074 SO2NH2 Inorganic materials 0.000 claims 1
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000003282 alkyl amino group Chemical group 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 36
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 16
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 15
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000002244 precipitate Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 6
- FPDADEVDCOFTNO-UHFFFAOYSA-N 4-bromo-3-phenylbutanoyl bromide Chemical compound C1(=CC=CC=C1)C(CC(=O)Br)CBr FPDADEVDCOFTNO-UHFFFAOYSA-N 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 206010015037 epilepsy Diseases 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical class N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- CWRVKFFCRWGWCS-UHFFFAOYSA-N Pentrazole Chemical compound C1CCCCC2=NN=NN21 CWRVKFFCRWGWCS-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 125000000392 cycloalkenyl group Chemical group 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 229960005152 pentetrazol Drugs 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- LOCWBQIWHWIRGN-UHFFFAOYSA-N 2-chloro-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Cl LOCWBQIWHWIRGN-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 230000035939 shock Effects 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- DWJINVCRABJWDE-UHFFFAOYSA-N 1-amino-6-methylcyclohexa-2,4-diene-1-sulfonamide Chemical compound CC1C=CC=CC1(N)S(N)(=O)=O DWJINVCRABJWDE-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- YAZSBRQTAHVVGE-UHFFFAOYSA-N 2-aminobenzenesulfonamide Chemical compound NC1=CC=CC=C1S(N)(=O)=O YAZSBRQTAHVVGE-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- NIDOTDANGJJHPU-UHFFFAOYSA-N 4-amino-2-chlorobenzenesulfonamide Chemical compound NC1=CC=C(S(N)(=O)=O)C(Cl)=C1 NIDOTDANGJJHPU-UHFFFAOYSA-N 0.000 description 1
- HVFBADWBKHAPKV-UHFFFAOYSA-N 4-amino-3-fluorobenzenesulfonamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1F HVFBADWBKHAPKV-UHFFFAOYSA-N 0.000 description 1
- XVGQTDGDJPAZQP-UHFFFAOYSA-N 4-bromo-4-phenylbutanoyl bromide Chemical compound C1(=CC=CC=C1)C(CCC(=O)Br)Br XVGQTDGDJPAZQP-UHFFFAOYSA-N 0.000 description 1
- FNDUDZPQCFTRRK-UHFFFAOYSA-N 4-bromo-N-(2-fluoro-4-sulfamoylphenyl)-3-phenylbutanamide Chemical compound C1(=CC=CC=C1)C(CC(=O)NC1=C(C=C(C=C1)S(N)(=O)=O)F)CBr FNDUDZPQCFTRRK-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010044565 Tremor Diseases 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000005210 alkyl ammonium group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 230000001773 anti-convulsant effect Effects 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 1
- 150000004292 cyclic ethers Chemical class 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- PWAPCRSSMCLZHG-UHFFFAOYSA-N cyclopentylidene Chemical group [C]1CCCC1 PWAPCRSSMCLZHG-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000012433 hydrogen halide Substances 0.000 description 1
- 229910000039 hydrogen halide Inorganic materials 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000002032 methanolic fraction Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical class O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001624 sedative effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 150000003673 urethanes Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/267—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/22—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D207/24—Oxygen or sulfur atoms
- C07D207/26—2-Pyrrolidones
- C07D207/263—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms
- C07D207/27—2-Pyrrolidones with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to other ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyrrole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3784270A GB1361388A (en) | 1970-08-05 | 1970-08-05 | Ny--sulphamoylaryl--pyrrolidines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88911B1 true PL88911B1 (oth) | 1976-10-30 |
Family
ID=10399388
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149829A PL88911B1 (oth) | 1970-08-05 | 1971-08-04 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3813387A (oth) |
| JP (1) | JPS5118948B1 (oth) |
| AR (1) | AR202884A1 (oth) |
| AT (1) | AT305997B (oth) |
| AU (1) | AU442903B2 (oth) |
| BE (1) | BE770938A (oth) |
| CA (1) | CA996565A (oth) |
| CH (1) | CH571489A5 (oth) |
| DE (1) | DE2139072C3 (oth) |
| DK (1) | DK135503B (oth) |
| ES (1) | ES393883A1 (oth) |
| FI (1) | FI54104C (oth) |
| FR (1) | FR2101241B1 (oth) |
| GB (1) | GB1361388A (oth) |
| HU (1) | HU162250B (oth) |
| NL (1) | NL7110775A (oth) |
| NO (1) | NO137153C (oth) |
| PL (1) | PL88911B1 (oth) |
| SE (1) | SE390730B (oth) |
| SU (1) | SU567401A3 (oth) |
| ZA (1) | ZA715205B (oth) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH618682A5 (oth) * | 1975-11-07 | 1980-08-15 | Ciba Geigy Ag | |
| AT360980B (de) * | 1976-01-14 | 1981-02-10 | Pliva Pharm & Chem Works | Verfahren zur herstellung von n-alkylamiden des 2-oxo-1-pyrrolidins |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| US4138495A (en) * | 1978-05-19 | 1979-02-06 | Stauffer Chemical Company | N-Substituted pyrrolidones and their use as miticides |
| US4194982A (en) * | 1978-07-03 | 1980-03-25 | Texaco Inc. | N-sulfonylated polyalkenylsuccinimide and lubricant composition |
| CH626877A5 (oth) * | 1978-08-22 | 1981-12-15 | Aerni Leuch Ag | |
| JP2833817B2 (ja) * | 1989-03-15 | 1998-12-09 | 三井化学株式会社 | 4―エチル―3―(置換フェニル)―1―(3―トリフルオロメチルフェニル)―2―ピロリジノン誘導体、その製造法およびこれらを有効成分とする除草剤 |
| US6620823B2 (en) * | 2000-07-11 | 2003-09-16 | Bristol-Myers Squibb Pharme Company | Lactam metalloprotease inhibitors |
-
1970
- 1970-08-05 GB GB3784270A patent/GB1361388A/en not_active Expired
-
1971
- 1971-08-04 CA CA119,749A patent/CA996565A/en not_active Expired
- 1971-08-04 US US00169062A patent/US3813387A/en not_active Expired - Lifetime
- 1971-08-04 AT AT682971A patent/AT305997B/de not_active IP Right Cessation
- 1971-08-04 DK DK380171AA patent/DK135503B/da unknown
- 1971-08-04 SE SE7110004A patent/SE390730B/xx unknown
- 1971-08-04 NO NO2923/71A patent/NO137153C/no unknown
- 1971-08-04 FI FI2190/71A patent/FI54104C/fi active
- 1971-08-04 JP JP46058396A patent/JPS5118948B1/ja active Pending
- 1971-08-04 CH CH1148171A patent/CH571489A5/xx not_active IP Right Cessation
- 1971-08-04 ZA ZA715205A patent/ZA715205B/xx unknown
- 1971-08-04 ES ES393883A patent/ES393883A1/es not_active Expired
- 1971-08-04 PL PL1971149829A patent/PL88911B1/pl unknown
- 1971-08-04 FR FR7128543A patent/FR2101241B1/fr not_active Expired
- 1971-08-04 BE BE770938A patent/BE770938A/xx unknown
- 1971-08-04 SU SU7101691585A patent/SU567401A3/ru active
- 1971-08-04 AR AR237175A patent/AR202884A1/es active
- 1971-08-04 HU HUGE894A patent/HU162250B/hu unknown
- 1971-08-04 DE DE2139072A patent/DE2139072C3/de not_active Expired
- 1971-08-04 NL NL7110775A patent/NL7110775A/xx not_active Application Discontinuation
- 1971-08-04 AU AU31984/71A patent/AU442903B2/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ES393883A1 (es) | 1973-11-01 |
| NL7110775A (oth) | 1972-02-08 |
| NO137153C (no) | 1978-01-11 |
| DK135503B (da) | 1977-05-09 |
| JPS5118948B1 (oth) | 1976-06-14 |
| AU442903B2 (en) | 1973-12-06 |
| ZA715205B (en) | 1972-08-30 |
| FR2101241A1 (oth) | 1972-03-31 |
| SU567401A3 (ru) | 1977-07-30 |
| FR2101241B1 (oth) | 1975-02-07 |
| US3813387A (en) | 1974-05-28 |
| AT305997B (de) | 1973-03-26 |
| CH571489A5 (oth) | 1976-01-15 |
| DE2139072B2 (de) | 1980-02-14 |
| FI54104C (fi) | 1978-10-10 |
| DE2139072A1 (de) | 1972-02-10 |
| GB1361388A (en) | 1974-07-24 |
| HU162250B (oth) | 1973-01-29 |
| DK135503C (oth) | 1977-10-24 |
| NO137153B (no) | 1977-10-03 |
| BE770938A (fr) | 1972-02-04 |
| FI54104B (fi) | 1978-06-30 |
| DE2139072C3 (de) | 1980-10-09 |
| AR202884A1 (es) | 1975-07-31 |
| SE390730B (sv) | 1977-01-17 |
| AU3198471A (en) | 1973-05-03 |
| CA996565A (en) | 1976-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Cain et al. | Potential antitumor agents. 16. 4'-(Acridin-9-ylamino) methanesulfonanilides | |
| DE2857199C2 (de) | Verfahren zur Reinigung von Imidazolen | |
| PL88911B1 (oth) | ||
| JPS62198666A (ja) | 1−ベンジル−2−/n−置換/−カルバモイル−テトラヒドロイソキノリン及びその製造方法 | |
| Shulgin | Psychotomimetic agents related to mescaline | |
| Rothman et al. | Enol Esters. II. 1a N-Acylation of Amides and Imides | |
| US2280578A (en) | Amides of aliphatic polycarbothionic acids and their preparation | |
| BR112019020343B1 (pt) | Novo sistema catalítico para preparação redimensionável de indoxacarbe | |
| CH544764A (de) | Verfahren zur Herstellung von neuen Triazolo-benzodiazepinderivaten | |
| US3928415A (en) | Benzophenone derivatives and process for their production II | |
| US4216221A (en) | 1,3-Disubstituted (2-thio)ureas | |
| Kalashnikov et al. | Nitration of Acyl Derivatives of 2, 4, 6, 8, 10, 12‐Hexaazaisowurtzitane | |
| EP0006999A1 (en) | A process for the production of 2-chlorobenzonitrile derivatives | |
| US3775401A (en) | Alpha-aryl-succinimide-sulphonamide derivatives | |
| Ayral-Kaloustian et al. | Pyrolysis of the tosylhydrazone sodium salts of two bicyclic lactones | |
| US2980693A (en) | Methods for producing same | |
| US3066156A (en) | Novel method for preparing disulfamylaniline compounds | |
| US4087451A (en) | 2,3-Dihalo-1,4-dithiocyano-2-butenes and their homologs | |
| FI63219B (fi) | Foerfarande foer framstaellning av 4-klor-2-butynyl-n-(3-klorfenyl)-karbamat | |
| EP0001585B1 (de) | Piperazino-pyrrolobenzodiazepine, Verfahren zu ihrer Herstellung sowie pharmazeutische Präparate enthaltend diese Verbindungen | |
| Shepard et al. | Activated esters of substituted pyrazinecarboxylic acids | |
| GB2106516A (en) | Anthranilic acid esters | |
| Okada et al. | A Facile and Convenient Synthetic Method for Fluorine-containing 1H-Pyrrolo (3, 2-h) quinolines | |
| KR870002017B1 (ko) | 아미노벤질아민의 제조방법 | |
| US3501473A (en) | Disubstituted - 11h - quinazolino - (2,3-b) quinazoline - 11,13 (5h) - diones and the process for their preparation |