PL88719B1 - - Google Patents
Download PDFInfo
- Publication number
- PL88719B1 PL88719B1 PL1974169061A PL16906174A PL88719B1 PL 88719 B1 PL88719 B1 PL 88719B1 PL 1974169061 A PL1974169061 A PL 1974169061A PL 16906174 A PL16906174 A PL 16906174A PL 88719 B1 PL88719 B1 PL 88719B1
- Authority
- PL
- Poland
- Prior art keywords
- electrolyser
- anode
- barrier
- layers
- cathode
- Prior art date
Links
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims abstract description 57
- 238000000034 method Methods 0.000 claims abstract description 46
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims abstract description 40
- 238000005868 electrolysis reaction Methods 0.000 claims abstract description 24
- 230000004888 barrier function Effects 0.000 claims abstract description 21
- 239000011780 sodium chloride Substances 0.000 claims abstract description 20
- 230000008569 process Effects 0.000 claims abstract description 19
- 229920001577 copolymer Polymers 0.000 claims abstract description 16
- 150000001875 compounds Chemical class 0.000 claims abstract description 8
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims abstract description 8
- 239000012528 membrane Substances 0.000 claims abstract description 6
- 239000007788 liquid Substances 0.000 claims description 21
- 238000005192 partition Methods 0.000 claims description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 14
- 229910052751 metal Inorganic materials 0.000 claims description 11
- 239000002184 metal Substances 0.000 claims description 11
- 229910000831 Steel Inorganic materials 0.000 claims description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 8
- 239000010959 steel Substances 0.000 claims description 8
- 238000000354 decomposition reaction Methods 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- 229920000642 polymer Polymers 0.000 claims description 7
- 239000010936 titanium Substances 0.000 claims description 7
- 229910052719 titanium Inorganic materials 0.000 claims description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 6
- 239000010425 asbestos Substances 0.000 claims description 5
- 125000002091 cationic group Chemical group 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- 229910052895 riebeckite Inorganic materials 0.000 claims description 5
- 229910001925 ruthenium oxide Inorganic materials 0.000 claims description 5
- WOCIAKWEIIZHES-UHFFFAOYSA-N ruthenium(iv) oxide Chemical compound O=[Ru]=O WOCIAKWEIIZHES-UHFFFAOYSA-N 0.000 claims description 5
- 239000011248 coating agent Substances 0.000 claims description 4
- 239000010970 precious metal Substances 0.000 claims description 4
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 3
- 229910001514 alkali metal chloride Inorganic materials 0.000 claims description 3
- 150000004706 metal oxides Chemical class 0.000 claims description 3
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 239000007858 starting material Substances 0.000 claims description 2
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical group [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 claims 1
- 235000011121 sodium hydroxide Nutrition 0.000 abstract description 17
- 239000000460 chlorine Substances 0.000 abstract description 12
- 229910052801 chlorine Inorganic materials 0.000 abstract description 12
- 239000000243 solution Substances 0.000 abstract description 12
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract description 11
- 239000012267 brine Substances 0.000 abstract description 9
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 abstract description 9
- 238000004519 manufacturing process Methods 0.000 abstract description 6
- 239000002356 single layer Substances 0.000 abstract description 6
- RRZIJNVZMJUGTK-UHFFFAOYSA-N 1,1,2-trifluoro-2-(1,2,2-trifluoroethenoxy)ethene Chemical class FC(F)=C(F)OC(F)=C(F)F RRZIJNVZMJUGTK-UHFFFAOYSA-N 0.000 abstract 1
- 239000003518 caustics Substances 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 26
- 239000010410 layer Substances 0.000 description 17
- 239000000463 material Substances 0.000 description 12
- 150000002500 ions Chemical class 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 8
- -1 chlorine Chemical class 0.000 description 8
- 230000005012 migration Effects 0.000 description 7
- 238000013508 migration Methods 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000003513 alkali Substances 0.000 description 6
- 239000003792 electrolyte Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 239000002253 acid Substances 0.000 description 4
- 230000007423 decrease Effects 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 230000009471 action Effects 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 230000035699 permeability Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910001415 sodium ion Inorganic materials 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000012670 alkaline solution Substances 0.000 description 2
- 239000000956 alloy Substances 0.000 description 2
- 229910045601 alloy Inorganic materials 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000007599 discharging Methods 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 229910000510 noble metal Inorganic materials 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- LYCAGOQDEOWYGS-UHFFFAOYSA-N 1,2,2-trifluoroethenesulfonic acid Chemical compound OS(=O)(=O)C(F)=C(F)F LYCAGOQDEOWYGS-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical group [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910002065 alloy metal Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- JXLHNMVSKXFWAO-UHFFFAOYSA-N azane;7-fluoro-2,1,3-benzoxadiazole-4-sulfonic acid Chemical compound N.OS(=O)(=O)C1=CC=C(F)C2=NON=C12 JXLHNMVSKXFWAO-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000010406 cathode material Substances 0.000 description 1
- 229920003118 cationic copolymer Polymers 0.000 description 1
- 239000004568 cement Substances 0.000 description 1
- 229920001429 chelating resin Polymers 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- 239000012636 effector Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000010439 graphite Substances 0.000 description 1
- 229910002804 graphite Inorganic materials 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- OBTWBSRJZRCYQV-UHFFFAOYSA-N sulfuryl difluoride Chemical compound FS(F)(=O)=O OBTWBSRJZRCYQV-UHFFFAOYSA-N 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J5/00—Manufacture of articles or shaped materials containing macromolecular substances
- C08J5/20—Manufacture of shaped structures of ion-exchange resins
- C08J5/22—Films, membranes or diaphragms
- C08J5/2206—Films, membranes or diaphragms based on organic and/or inorganic macromolecular compounds
- C08J5/2218—Synthetic macromolecular compounds
- C08J5/2231—Synthetic macromolecular compounds based on macromolecular compounds obtained by reactions involving unsaturated carbon-to-carbon bonds
- C08J5/2237—Synthetic macromolecular compounds based on macromolecular compounds obtained by reactions involving unsaturated carbon-to-carbon bonds containing fluorine
-
- C—CHEMISTRY; METALLURGY
- C25—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES; APPARATUS THEREFOR
- C25B—ELECTROLYTIC OR ELECTROPHORETIC PROCESSES FOR THE PRODUCTION OF COMPOUNDS OR NON-METALS; APPARATUS THEREFOR
- C25B1/00—Electrolytic production of inorganic compounds or non-metals
- C25B1/01—Products
- C25B1/34—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis
- C25B1/46—Simultaneous production of alkali metal hydroxides and chlorine, oxyacids or salts of chlorine, e.g. by chlor-alkali electrolysis in diaphragm cells
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08J—WORKING-UP; GENERAL PROCESSES OF COMPOUNDING; AFTER-TREATMENT NOT COVERED BY SUBCLASSES C08B, C08C, C08F, C08G or C08H
- C08J2327/00—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers
- C08J2327/02—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers not modified by chemical after-treatment
- C08J2327/12—Characterised by the use of homopolymers or copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen; Derivatives of such polymers not modified by chemical after-treatment containing fluorine atoms
- C08J2327/18—Homopolymers or copolymers of tetrafluoroethylene
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Manufacturing & Machinery (AREA)
- Materials Engineering (AREA)
- Metallurgy (AREA)
- Electrochemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Electrolytic Production Of Non-Metals, Compounds, Apparatuses Therefor (AREA)
- Manufacture Of Macromolecular Shaped Articles (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/335,975 US3976549A (en) | 1973-02-26 | 1973-02-26 | Electrolysis method |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL88719B1 true PL88719B1 (enExample) | 1976-09-30 |
Family
ID=23314037
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1974169061A PL88719B1 (enExample) | 1973-02-26 | 1974-02-25 |
Country Status (23)
| Country | Link |
|---|---|
| US (2) | US3976549A (enExample) |
| JP (1) | JPS49117399A (enExample) |
| AT (1) | AT328471B (enExample) |
| AU (1) | AU474158B2 (enExample) |
| BE (1) | BE811412A (enExample) |
| BR (1) | BR7401170D0 (enExample) |
| CA (1) | CA1000652A (enExample) |
| DD (1) | DD109986A5 (enExample) |
| ES (2) | ES423615A1 (enExample) |
| FR (1) | FR2218942B1 (enExample) |
| GB (1) | GB1431733A (enExample) |
| IL (1) | IL44138A (enExample) |
| IN (1) | IN141348B (enExample) |
| IT (1) | IT1006372B (enExample) |
| MX (1) | MX3510E (enExample) |
| NL (1) | NL7402414A (enExample) |
| NO (1) | NO139565C (enExample) |
| PH (1) | PH12133A (enExample) |
| PL (1) | PL88719B1 (enExample) |
| RO (1) | RO70890A (enExample) |
| SU (1) | SU784799A3 (enExample) |
| TR (1) | TR18094A (enExample) |
| ZA (1) | ZA74752B (enExample) |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4147599A (en) * | 1977-07-19 | 1979-04-03 | Diamond Shamrock Corporation | Production of alkali metal carbonates in a cell having a carboxyl membrane |
| US4166014A (en) * | 1973-12-27 | 1979-08-28 | Tokuyama Soda Kabushiki Kaisha | Electrolytic diaphragms, and method of electrolysis using the same |
| US4169023A (en) * | 1974-02-04 | 1979-09-25 | Tokuyama Soda Kabushiki Kaisha | Electrolytic diaphragms, and method of electrolysis using the same |
| AR205953A1 (es) * | 1975-01-22 | 1976-06-15 | Diamond Shamrock Corp | Produccion de carbonatos de metales a calinos en una celula de membrana |
| JPS5214584A (en) * | 1975-07-25 | 1977-02-03 | Asahi Glass Co Ltd | Electrodialysis method of a base-containing solution |
| US4110265A (en) * | 1977-03-01 | 1978-08-29 | Ionics Inc. | Ion exchange membranes based upon polyphenylene sulfide |
| JPS5460294A (en) * | 1977-10-21 | 1979-05-15 | Asahi Glass Co Ltd | Electrolysis of aqueous alkali chrolide |
| JPS5484892A (en) * | 1977-12-19 | 1979-07-06 | Asahi Chem Ind Co Ltd | Electrolysis of sodium chloride employing cation exchange membrane |
| US4235694A (en) * | 1978-10-06 | 1980-11-25 | Hall Frederick F | Electrolytic cells for hydrogen gas production |
| US4242193A (en) * | 1978-11-06 | 1980-12-30 | Innova, Inc. | Layered membrane and processes utilizing same |
| US4544458A (en) * | 1978-11-13 | 1985-10-01 | E. I. Du Pont De Nemours And Company | Fluorinated ion exchange polymer containing carboxylic groups, process for making same, and film and membrane thereof |
| US4416757A (en) * | 1978-12-22 | 1983-11-22 | Olin Corporation | Coated thermoplastic polymer diaphragms and a method for their preparation |
| IT1166581B (it) * | 1979-01-17 | 1987-05-05 | Oronzio De Nora Impianti | Membrane cationiche a base di copolimeri solfonati di stirene divinilbenzene e 2- o 4-vinilpiridina o acido acrilico, procedimento per la loro preparazione ed uso in celle di elettrolisi |
| IT1113412B (it) * | 1979-02-15 | 1986-01-20 | Oronzio De Nora Impianti | Procedimento eletttrolitico ed apparecchiatura per la preparazione di ipoalogenito di metallo alcalino |
| US4253923A (en) * | 1979-06-01 | 1981-03-03 | Olin Corporation | Electrolytic process for producing potassium hydroxide |
| US4289601A (en) * | 1979-11-30 | 1981-09-15 | Olin Corporation | Diaphragm structure for electrolytic cells for the electrolysis of aqueous salt solutions |
| US4276145A (en) * | 1980-01-31 | 1981-06-30 | Skala Stephen F | Electrolytic anolyte dehydration of castner cells |
| US4358545A (en) * | 1980-06-11 | 1982-11-09 | The Dow Chemical Company | Sulfonic acid electrolytic cell having flourinated polymer membrane with hydration product less than 22,000 |
| US4470889A (en) * | 1980-06-11 | 1984-09-11 | The Dow Chemical Company | Electrolytic cell having an improved ion exchange membrane and process for operating |
| US4337137A (en) * | 1980-06-11 | 1982-06-29 | The Dow Chemical Company | Composite ion exchange membranes |
| US4332662A (en) * | 1980-07-07 | 1982-06-01 | Hooker Chemicals & Plastics Corp. | Electrolytic cell having a depolarized cathode |
| US4331521A (en) * | 1981-01-19 | 1982-05-25 | Oronzio Denora Impianti Elettrochimici S.P.A. | Novel electrolytic cell and method |
| JPS57131376A (en) * | 1981-02-06 | 1982-08-14 | Japan Atom Energy Res Inst | Electrolyzing method for water |
| US4490484A (en) * | 1981-10-21 | 1984-12-25 | E. I. Du Pont De Nemours And Company | Membrane assembly, electrochemical cell, and electrolysis process using perfluorinated sandwich type membrane |
| US4544471A (en) * | 1981-11-02 | 1985-10-01 | E. I. Du Pont De Nemours And Company | Electrolytic cell with cation exchange membrane having high equivalent weight component |
| DE3278977D1 (en) * | 1982-01-04 | 1988-10-06 | Du Pont | Coextruded multilayer cation exchange membranes |
| JPS61130347A (ja) * | 1984-11-30 | 1986-06-18 | Asahi Glass Co Ltd | 新規な電解用複層隔膜 |
| US5041197A (en) * | 1987-05-05 | 1991-08-20 | Physical Sciences, Inc. | H2 /C12 fuel cells for power and HCl production - chemical cogeneration |
| US5362368A (en) * | 1993-06-03 | 1994-11-08 | Scott Lynn | Chlorine generator |
| US5654109A (en) * | 1995-06-30 | 1997-08-05 | The Dow Chemical Company | Composite fuel cell membranes |
| US5567283A (en) * | 1995-09-28 | 1996-10-22 | Lynn; Scott | Caustic concentration regulator for chlorine generators |
| KR20030065856A (ko) * | 2002-02-01 | 2003-08-09 | 주식회사 동우워터텍 | 염소-수산화나트륨 생산을 위한 전기분해조 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1082286A (en) * | 1912-10-02 | 1913-12-23 | Niagara Alkali Company | Diaphragm for electrolytic apparatus. |
| US1929923A (en) * | 1929-09-16 | 1933-10-10 | American Anode Inc | Permeable diaphragm |
| US2293928A (en) * | 1938-08-12 | 1942-08-25 | American Anode Inc | Article comprising porous rubber |
| US2967807A (en) * | 1952-01-23 | 1961-01-10 | Hooker Chemical Corp | Electrolytic decomposition of sodium chloride |
| US2903406A (en) * | 1956-06-28 | 1959-09-08 | Clayton Manufacturing Co | Conducting diaphragms |
| US2794777A (en) * | 1956-08-27 | 1957-06-04 | Clayton Manufacturing Co | Electrolytic deionization |
| US3017338A (en) * | 1958-03-03 | 1962-01-16 | Diamond Alkali Co | Electrolytic process and apparatus |
| US3214362A (en) * | 1961-01-09 | 1965-10-26 | Ionics | Electrolysis of aqueous electrolyte solutions and apparatus therefor |
| US3282875A (en) * | 1964-07-22 | 1966-11-01 | Du Pont | Fluorocarbon vinyl ether polymers |
| US3607706A (en) * | 1967-08-04 | 1971-09-21 | Ionics | Method of making stable laminated cation-exchange membranes |
| GB1246447A (en) * | 1967-09-26 | 1971-09-15 | Imp Metal Ind Kynoch Ltd | Improvements in or relating to the manufacture of oxide-coated electrodes for use in electrolytic processes |
| US3616319A (en) * | 1968-02-09 | 1971-10-26 | Monsanto Co | Electrolytic hydrodimerization of olefinic compounds |
| US3562008A (en) * | 1968-10-14 | 1971-02-09 | Ppg Industries Inc | Method for producing a ruthenium coated titanium electrode |
| US3630863A (en) * | 1968-11-13 | 1971-12-28 | Ppg Industries Inc | Cell diaphragm treatment |
| US3694281A (en) * | 1969-04-28 | 1972-09-26 | Pullman Inc | Process for forming a diaphragm for use in an electrolytic cell |
| US3809630A (en) * | 1970-06-20 | 1974-05-07 | Oronzio De Nora Impianti | Electrolysis cell with permeable valve metal anode and diaphragms on both the anode and cathode |
| BE788557A (fr) * | 1971-09-09 | 1973-03-08 | Ppg Industries Inc | Diaphragmes pour cellules electrolytiques |
| US3853721A (en) * | 1971-09-09 | 1974-12-10 | Ppg Industries Inc | Process for electrolysing brine |
| BE790369A (fr) * | 1971-10-21 | 1973-04-20 | Diamond Shamrock Corp | Procede et appareil pour la preparation d'hydroxydes de metaux alcalins de haute purete dans une cuve electrolytique. |
| BE793281A (fr) * | 1971-12-23 | 1973-06-22 | Rhone Progil | Cadres pour cellules electrolytiques du type filtre-presse |
| ZA728589B (en) * | 1971-12-27 | 1974-01-30 | Hooker Chemical Corp | Electrolysis method and apparatus |
| US3773634A (en) * | 1972-03-09 | 1973-11-20 | Diamond Shamrock Corp | Control of an olyte-catholyte concentrations in membrane cells |
-
1973
- 1973-02-26 US US05/335,975 patent/US3976549A/en not_active Expired - Lifetime
-
1974
- 1974-01-28 CA CA191,070A patent/CA1000652A/en not_active Expired
- 1974-02-01 IN IN225/CAL/1974A patent/IN141348B/en unknown
- 1974-02-04 IL IL44138A patent/IL44138A/en unknown
- 1974-02-04 AU AU65169/74A patent/AU474158B2/en not_active Expired
- 1974-02-05 ZA ZA740752A patent/ZA74752B/xx unknown
- 1974-02-05 PH PH15479A patent/PH12133A/en unknown
- 1974-02-12 TR TR18094A patent/TR18094A/xx unknown
- 1974-02-14 GB GB673974A patent/GB1431733A/en not_active Expired
- 1974-02-14 JP JP49018066A patent/JPS49117399A/ja active Pending
- 1974-02-18 MX MX74100405U patent/MX3510E/es unknown
- 1974-02-18 BR BR1170/74A patent/BR7401170D0/pt unknown
- 1974-02-21 BE BE141248A patent/BE811412A/xx unknown
- 1974-02-22 AT AT146674A patent/AT328471B/de not_active IP Right Cessation
- 1974-02-22 FR FR7406085A patent/FR2218942B1/fr not_active Expired
- 1974-02-22 NL NL7402414A patent/NL7402414A/xx unknown
- 1974-02-25 NO NO740634A patent/NO139565C/no unknown
- 1974-02-25 SU SU742021818A patent/SU784799A3/ru active
- 1974-02-25 ES ES423615A patent/ES423615A1/es not_active Expired
- 1974-02-25 RO RO7477810A patent/RO70890A/ro unknown
- 1974-02-25 PL PL1974169061A patent/PL88719B1/pl unknown
- 1974-02-26 DD DD176810A patent/DD109986A5/xx unknown
- 1974-04-08 IT IT20730/74A patent/IT1006372B/it active
-
1976
- 1976-03-17 ES ES446163A patent/ES446163A1/es not_active Expired
- 1976-06-04 US US05/692,818 patent/US4062753A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| IL44138A (en) | 1976-12-31 |
| RO70890A (ro) | 1981-07-30 |
| FR2218942B1 (enExample) | 1978-01-06 |
| CA1000652A (en) | 1976-11-30 |
| DE2409193A1 (de) | 1974-08-29 |
| IN141348B (enExample) | 1977-02-19 |
| ZA74752B (en) | 1974-12-24 |
| IT1006372B (it) | 1976-09-30 |
| US4062753A (en) | 1977-12-13 |
| SU784799A3 (ru) | 1980-11-30 |
| DE2409193B2 (de) | 1977-06-02 |
| IL44138A0 (en) | 1974-05-16 |
| PH12133A (en) | 1978-11-07 |
| NL7402414A (enExample) | 1974-08-28 |
| TR18094A (tr) | 1976-09-30 |
| ES446163A1 (es) | 1977-06-01 |
| GB1431733A (en) | 1976-04-14 |
| ES423615A1 (es) | 1976-11-01 |
| NO740634L (no) | 1974-08-27 |
| BE811412A (fr) | 1974-08-21 |
| ATA146674A (de) | 1975-06-15 |
| NO139565C (no) | 1979-04-04 |
| NO139565B (no) | 1978-12-27 |
| BR7401170D0 (pt) | 1974-11-05 |
| FR2218942A1 (enExample) | 1974-09-20 |
| MX3510E (es) | 1981-01-14 |
| DD109986A5 (enExample) | 1974-12-05 |
| US3976549A (en) | 1976-08-24 |
| JPS49117399A (enExample) | 1974-11-09 |
| AT328471B (de) | 1976-03-25 |
| AU6516974A (en) | 1975-09-04 |
| AU474158B2 (en) | 1976-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL88719B1 (enExample) | ||
| US5082543A (en) | Filter press electrolysis cell | |
| US5041196A (en) | Electrochemical method for producing chlorine dioxide solutions | |
| US5084149A (en) | Electrolytic process for producing chlorine dioxide | |
| US4142950A (en) | Apparatus and process for electrolysis using a cation-permselective membrane and turbulence inducing means | |
| PL110147B1 (en) | Method of producing carbonates of alkaline metals by electrolysis | |
| KR830002163B1 (ko) | 염소-알칼리 전해조 | |
| CA1153982A (en) | Electrolytic production of alkali metal hypohalite and apparatus therefor | |
| KR840001427B1 (ko) | 2격실 전해조 및 3격실 전해조를 이용한 크롬산 제조방법 | |
| JPH05504170A (ja) | 塩素酸・アルカリ金属塩素酸塩混合物の電気化学的製造方法 | |
| US5158658A (en) | Electrochemical chlorine dioxide generator | |
| CA1073847A (en) | Method of operating a three compartment electrolytic cell for the production of alkali metal hydroxides | |
| Ito et al. | Chlor–alkali electrolysis | |
| CA1160983A (en) | Method for electrolyzing hydrochloric acid | |
| US4174266A (en) | Method of operating an electrolytic cell having an asbestos diaphragm | |
| US3948737A (en) | Process for electrolysis of brine | |
| US4127457A (en) | Method of reducing chlorate formation in a chlor-alkali electrolytic cell | |
| JPH0125835B2 (enExample) | ||
| US4528077A (en) | Membrane electrolytic cell for minimizing hypochlorite and chlorate formation | |
| US4488947A (en) | Process of operation of catholyteless membrane electrolytic cell | |
| US4061550A (en) | Process for electrolysis | |
| US4285795A (en) | Electrolysis apparatus | |
| PL90034B1 (enExample) | ||
| RU2317351C2 (ru) | Способ получения хлората щелочного металла | |
| JP4447081B2 (ja) | 多硫化物の製造方法 |