PL86547B1 - - Google Patents
Download PDFInfo
- Publication number
- PL86547B1 PL86547B1 PL1973161371A PL16137173A PL86547B1 PL 86547 B1 PL86547 B1 PL 86547B1 PL 1973161371 A PL1973161371 A PL 1973161371A PL 16137173 A PL16137173 A PL 16137173A PL 86547 B1 PL86547 B1 PL 86547B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- aminobutanol
- amide
- isomeric
- esterification
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 22
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 19
- 239000000203 mixture Substances 0.000 claims description 18
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 16
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 claims description 15
- CSWPOLMVXVBCSV-UHFFFAOYSA-N 2-ethylaziridine Chemical compound CCC1CN1 CSWPOLMVXVBCSV-UHFFFAOYSA-N 0.000 claims description 15
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 15
- -1 2-ethyl Chemical group 0.000 claims description 12
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 12
- 150000001408 amides Chemical class 0.000 claims description 11
- OZHIYEINSCNALY-UHFFFAOYSA-N 1-aminobutan-1-ol Chemical class CCCC(N)O OZHIYEINSCNALY-UHFFFAOYSA-N 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 10
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- RBACIKXCRWGCBB-UHFFFAOYSA-N 1,2-Epoxybutane Chemical compound CCC1CO1 RBACIKXCRWGCBB-UHFFFAOYSA-N 0.000 claims description 7
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 7
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 230000032050 esterification Effects 0.000 claims description 7
- 238000005886 esterification reaction Methods 0.000 claims description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 6
- 239000011707 mineral Substances 0.000 claims description 6
- 239000005711 Benzoic acid Substances 0.000 claims description 4
- 235000010233 benzoic acid Nutrition 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 2
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 claims 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims 1
- 229910017912 NH2OH Inorganic materials 0.000 claims 1
- 150000008064 anhydrides Chemical class 0.000 claims 1
- 238000010533 azeotropic distillation Methods 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- KODLUXHSIZOKTG-UHFFFAOYSA-N 1-aminobutan-2-ol Chemical compound CCC(O)CN KODLUXHSIZOKTG-UHFFFAOYSA-N 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 239000002994 raw material Substances 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 230000009471 action Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 description 2
- HXHGULXINZUGJX-UHFFFAOYSA-N 4-chlorobutanol Chemical class OCCCCCl HXHGULXINZUGJX-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- KZNICNPSHKQLFF-UHFFFAOYSA-N succinimide Chemical compound O=C1CCC(=O)N1 KZNICNPSHKQLFF-UHFFFAOYSA-N 0.000 description 2
- ILPRUPKXFVBCSB-UHFFFAOYSA-N 1-(benzylamino)butan-1-ol Chemical compound CCCC(O)NCC1=CC=CC=C1 ILPRUPKXFVBCSB-UHFFFAOYSA-N 0.000 description 1
- UJGVUACWGCQEAO-UHFFFAOYSA-N 1-ethylaziridine Chemical compound CCN1CC1 UJGVUACWGCQEAO-UHFFFAOYSA-N 0.000 description 1
- QNJAZNNWHWYOEO-UHFFFAOYSA-N 2-ethylheptan-1-ol Chemical compound CCCCCC(CC)CO QNJAZNNWHWYOEO-UHFFFAOYSA-N 0.000 description 1
- MHIHRIPETCJEMQ-UHFFFAOYSA-N 2-nitrobutan-1-ol Chemical compound CCC(CO)[N+]([O-])=O MHIHRIPETCJEMQ-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- IMDRJBNGGINRKY-UHFFFAOYSA-N 4-ethyl-3-nitroso-2-propyl-1,3-oxazolidine Chemical compound CCCC1OCC(CC)N1N=O IMDRJBNGGINRKY-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical class ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical class CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 229920006020 amorphous polyamide Polymers 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical class Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- VBJINWBNLPUWPL-UHFFFAOYSA-N n-(1-hydroxybutan-2-yl)benzamide Chemical compound CCC(CO)NC(=O)C1=CC=CC=C1 VBJINWBNLPUWPL-UHFFFAOYSA-N 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- OTYBMLCTZGSZBG-UHFFFAOYSA-L potassium sulfate Chemical compound [K+].[K+].[O-]S([O-])(=O)=O OTYBMLCTZGSZBG-UHFFFAOYSA-L 0.000 description 1
- 229910052939 potassium sulfate Inorganic materials 0.000 description 1
- 235000011151 potassium sulphates Nutrition 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Inorganic materials [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 1
- 229960002317 succinimide Drugs 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- IXZDIALLLMRYOU-UHFFFAOYSA-N tert-butyl hypochlorite Chemical compound CC(C)(C)OCl IXZDIALLLMRYOU-UHFFFAOYSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D203/00—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom
- C07D203/04—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings
- C07D203/06—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members
- C07D203/08—Heterocyclic compounds containing three-membered rings with one nitrogen atom as the only ring hetero atom not condensed with other rings having no double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring nitrogen atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL1973161371A PL86547B1 (enExample) | 1973-03-20 | 1973-03-20 | |
| DE19742410988 DE2410988C3 (de) | 1973-03-20 | 1974-03-07 | Verfahren zur Herstellung von 2-Aminobutanol |
| JP49028206A JPS49125312A (enExample) | 1973-03-20 | 1974-03-13 | |
| RO7477999A RO72478A (ro) | 1973-03-20 | 1974-03-13 | Procedeu de obtinere a alcoolului diaminobutilic |
| GB1174474A GB1428872A (en) | 1973-03-20 | 1974-03-15 | Process for manufacturing 2-amino-butanol |
| FR7408958A FR2222354B3 (enExample) | 1973-03-20 | 1974-03-15 | |
| US05/452,372 US3953512A (en) | 1973-03-20 | 1974-03-18 | Process for manufacturing 2-aminobutanol |
| DD177240A DD111901A5 (enExample) | 1973-03-20 | 1974-03-18 | |
| NL7403599A NL7403599A (enExample) | 1973-03-20 | 1974-03-18 | |
| HUPO561A HU166143B (enExample) | 1973-03-20 | 1974-03-19 | |
| SU2007300A SU496720A3 (ru) | 1973-03-20 | 1974-03-19 | Способ получени 2-аминобутанола |
| IT20856/74A IT1007660B (it) | 1973-03-20 | 1974-04-08 | Procedimento di fabbricazione del 2 amminobutanolo |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| PL1973161371A PL86547B1 (enExample) | 1973-03-20 | 1973-03-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL86547B1 true PL86547B1 (enExample) | 1976-06-30 |
Family
ID=19961947
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973161371A PL86547B1 (enExample) | 1973-03-20 | 1973-03-20 |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US3953512A (enExample) |
| JP (1) | JPS49125312A (enExample) |
| DD (1) | DD111901A5 (enExample) |
| FR (1) | FR2222354B3 (enExample) |
| GB (1) | GB1428872A (enExample) |
| HU (1) | HU166143B (enExample) |
| IT (1) | IT1007660B (enExample) |
| NL (1) | NL7403599A (enExample) |
| PL (1) | PL86547B1 (enExample) |
| RO (1) | RO72478A (enExample) |
| SU (1) | SU496720A3 (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4181624A (en) * | 1973-11-10 | 1980-01-01 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Aminoalkanols |
| DE2520275C2 (de) * | 1975-05-07 | 1986-03-20 | Degussa Ag, 6000 Frankfurt | Aminoalkanolgemische, Verfahren zu deren Herstellung und deren Verwendung |
| US6207121B1 (en) * | 1998-09-30 | 2001-03-27 | The Dow Chemical Company | Composition and process for removal of acid gases |
| CN110818578A (zh) * | 2019-10-25 | 2020-02-21 | 西安凯立新材料股份有限公司 | 手性氨基丁醇的催化加氢合成方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3325476A (en) * | 1963-08-16 | 1967-06-13 | Pittsburgh Plate Glass Co | Reaction of amine with epoxides accompanied by simultaneous dehydrohalogenation |
| US3660488A (en) * | 1965-07-16 | 1972-05-02 | Phillips Petroleum Co | 2-halo-alkylene- and -cyclopentylene-2-amino-propane 1 3-diols |
| US3448153A (en) * | 1966-05-31 | 1969-06-03 | Jefferson Chem Co Inc | Method for the preparation of 2-amino-1-alkanols |
-
1973
- 1973-03-20 PL PL1973161371A patent/PL86547B1/pl unknown
-
1974
- 1974-03-13 RO RO7477999A patent/RO72478A/ro unknown
- 1974-03-13 JP JP49028206A patent/JPS49125312A/ja active Pending
- 1974-03-15 FR FR7408958A patent/FR2222354B3/fr not_active Expired
- 1974-03-15 GB GB1174474A patent/GB1428872A/en not_active Expired
- 1974-03-18 NL NL7403599A patent/NL7403599A/xx unknown
- 1974-03-18 US US05/452,372 patent/US3953512A/en not_active Expired - Lifetime
- 1974-03-18 DD DD177240A patent/DD111901A5/xx unknown
- 1974-03-19 SU SU2007300A patent/SU496720A3/ru active
- 1974-03-19 HU HUPO561A patent/HU166143B/hu unknown
- 1974-04-08 IT IT20856/74A patent/IT1007660B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| FR2222354A1 (enExample) | 1974-10-18 |
| JPS49125312A (enExample) | 1974-11-30 |
| FR2222354B3 (enExample) | 1976-12-31 |
| US3953512A (en) | 1976-04-27 |
| DE2410988A1 (de) | 1974-10-17 |
| DD111901A5 (enExample) | 1975-03-12 |
| IT1007660B (it) | 1976-10-30 |
| NL7403599A (enExample) | 1974-09-24 |
| GB1428872A (en) | 1976-03-17 |
| SU496720A3 (ru) | 1975-12-25 |
| DE2410988B2 (de) | 1977-05-18 |
| HU166143B (enExample) | 1975-01-28 |
| RO72478A (ro) | 1981-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU1200848A3 (ru) | Способ получени сложных эфиров цис- или транс-циклопропанкарбоновых кислот и рацемического @ -циано-3-феноксибензилового спирта | |
| US3435074A (en) | Process for producing nitrodiarylamines | |
| PL86547B1 (enExample) | ||
| US3996246A (en) | Resolution of racemic pantolactone | |
| US4020104A (en) | Process for isomerizing cis,cis- and cis,trans-isomers of di-(p-aminocyclohexyl)methane to the corresponding trans,trans-isomer | |
| JPS6155902B2 (enExample) | ||
| SU910113A3 (ru) | Способ получени производных з-феноксибензальдегида | |
| US4808746A (en) | Preparation of trifluoromethylbenzonitrile from trifluoromethylbenzaldehyde | |
| US4058563A (en) | Novel schiff bases | |
| DE2236040C2 (de) | Verfahren zur Herstellung von Carbonsäureamiden | |
| US4275241A (en) | Process for the preparation of 3-phenoxy-benzaldehydes | |
| US3703546A (en) | Preparation of 3-amino-2,5-dichlorobenzoic acid | |
| KR19980081393A (ko) | 카바메이트를 사용하는 클로로케토아민 제조방법 | |
| US3585233A (en) | Process for the preparation of hydroxybenzonitriles | |
| SU1209025A3 (ru) | Способ получени @ -феноксибензилового спирта | |
| SU1313851A1 (ru) | Способ получени 1-аминоциклопропан-1-карбоновой кислоты | |
| JP4519564B2 (ja) | 1−アミノシクロプロパンカルボン酸の精製方法及び製造方法 | |
| JPS5849542B2 (ja) | 芳香族スルホン酸のニトロ化法 | |
| US4724268A (en) | Purification process of 3,3'-dinitrodiphenyl compounds | |
| US2963515A (en) | Process for preparing a | |
| SU548600A1 (ru) | Способ получени 3,4-ксилидина | |
| RU2059628C1 (ru) | Способ расщепления алкоксигруппы при синтезе 2-циано-6-гидроксибензотиазола | |
| SU1010054A1 (ru) | Способ получени бензоата натри | |
| DE2410988C3 (de) | Verfahren zur Herstellung von 2-Aminobutanol | |
| US4202835A (en) | Preparation of α-cyano-3-phenoxy-benzyl alcohol |