PL84251B1 - - Google Patents
Download PDFInfo
- Publication number
- PL84251B1 PL84251B1 PL1971147806A PL14780671A PL84251B1 PL 84251 B1 PL84251 B1 PL 84251B1 PL 1971147806 A PL1971147806 A PL 1971147806A PL 14780671 A PL14780671 A PL 14780671A PL 84251 B1 PL84251 B1 PL 84251B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- general formula
- acid
- hal
- ester
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 33
- 150000001875 compounds Chemical class 0.000 claims description 18
- -1 alkali metal cyanide Chemical class 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 7
- 125000005907 alkyl ester group Chemical group 0.000 claims description 7
- 239000000460 chlorine Substances 0.000 claims description 7
- 150000002148 esters Chemical class 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 230000026030 halogenation Effects 0.000 claims description 5
- 238000005658 halogenation reaction Methods 0.000 claims description 5
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 150000001340 alkali metals Chemical class 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 150000001345 alkine derivatives Chemical class 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims description 2
- TVDSBUOJIPERQY-UHFFFAOYSA-N prop-2-yn-1-ol Chemical compound OCC#C TVDSBUOJIPERQY-UHFFFAOYSA-N 0.000 claims description 2
- HUHXLHLWASNVDB-UHFFFAOYSA-N 2-(oxan-2-yloxy)oxane Chemical compound O1CCCCC1OC1OCCCC1 HUHXLHLWASNVDB-UHFFFAOYSA-N 0.000 claims 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 1
- 229910052794 bromium Inorganic materials 0.000 claims 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims 1
- 125000001033 ether group Chemical group 0.000 claims 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 1
- 125000003259 prostaglandin group Chemical group 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 46
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 23
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 14
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 9
- 125000004494 ethyl ester group Chemical group 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 239000007788 liquid Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 5
- 235000019341 magnesium sulphate Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- PYBYLIYKZRCVBI-UHFFFAOYSA-N ethyl 7-bromohept-5-enoate Chemical compound CCOC(=O)CCCC=CCBr PYBYLIYKZRCVBI-UHFFFAOYSA-N 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- PXSBSBDNZRLRLK-UHFFFAOYSA-N 2-(2h-pyran-2-yloxy)-2h-pyran Chemical compound O1C=CC=CC1OC1OC=CC=C1 PXSBSBDNZRLRLK-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- SOMJEGUXTUWDMD-UHFFFAOYSA-N ethyl 7-hydroxyhept-5-enoate Chemical compound CCOC(=O)CCCC=CCO SOMJEGUXTUWDMD-UHFFFAOYSA-N 0.000 description 2
- 238000004508 fractional distillation Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- VCJMYUPGQJHHFU-UHFFFAOYSA-N iron(3+);trinitrate Chemical compound [Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VCJMYUPGQJHHFU-UHFFFAOYSA-N 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- HEWZVZIVELJPQZ-UHFFFAOYSA-N 2,2-dimethoxypropane Chemical compound COC(C)(C)OC HEWZVZIVELJPQZ-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 1
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- FMWAXKQEIXRUTI-UHFFFAOYSA-N dodecyl hydrogen sulfate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(O)(=O)=O FMWAXKQEIXRUTI-UHFFFAOYSA-N 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/533—Monocarboxylic acid esters having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/62—Halogen-containing esters
- C07C69/65—Halogen-containing esters of unsaturated acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR707015909A FR2085653B1 (enExample) | 1970-04-30 | 1970-04-30 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL84251B1 true PL84251B1 (enExample) | 1976-03-31 |
Family
ID=9054924
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971147806A PL84251B1 (enExample) | 1970-04-30 | 1971-04-28 |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3806540A (enExample) |
| JP (1) | JPS553337B1 (enExample) |
| AT (1) | AT306688B (enExample) |
| BE (1) | BE766520A (enExample) |
| CA (1) | CA993448A (enExample) |
| CH (1) | CH539601A (enExample) |
| CS (1) | CS169819B2 (enExample) |
| DE (1) | DE2121361B2 (enExample) |
| ES (1) | ES390718A1 (enExample) |
| FR (1) | FR2085653B1 (enExample) |
| GB (1) | GB1355991A (enExample) |
| IL (1) | IL36724A (enExample) |
| LU (1) | LU63086A1 (enExample) |
| NL (1) | NL7105988A (enExample) |
| PL (1) | PL84251B1 (enExample) |
| SE (1) | SE399251B (enExample) |
| SU (1) | SU385428A3 (enExample) |
| ZA (1) | ZA712777B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2104916B1 (enExample) * | 1970-09-04 | 1973-12-21 | Roussel Uclaf | |
| US4020173A (en) * | 1976-04-14 | 1977-04-26 | The Upjohn Company | 4α,6-Dihydroxy-2β-carboxaldehyde-3α-tetrahydropyranacetic acid γ-lactone, 6-alkyl ethers |
| US4032542A (en) * | 1976-04-14 | 1977-06-28 | The Upjohn Company | 4α,6-Dihydroxy-5-iodo-2.beta.-aryloxymethyl-3α-tetrahydropyranoacetic acid γ-lactone, 6-alkyl ethers |
| JPS5944315B2 (ja) * | 1977-12-28 | 1984-10-29 | 大塚化学薬品株式会社 | 2−ペンチニルエ−テルの製造法 |
| JPS6331483U (enExample) * | 1986-08-13 | 1988-03-01 | ||
| EP0546230A1 (en) * | 1991-12-10 | 1993-06-16 | Merrell Dow Pharmaceuticals Inc. | Novel process for preparing 4-amino-5-hexenoic acid |
| DE4435421A1 (de) * | 1994-10-04 | 1996-04-11 | Basf Ag | Verfahren zur Herstellung von 0,0.-Dialkyl-4-phosphono-2-methyl-2-butensäurealkylestern und 4-Halogen-2-methyl-2-butensäurealkylestern mit hohem Anteil an E-Isomeren |
-
1970
- 1970-04-30 FR FR707015909A patent/FR2085653B1/fr not_active Expired
-
1971
- 1971-04-26 IL IL36724A patent/IL36724A/xx unknown
- 1971-04-28 CH CH624771A patent/CH539601A/fr not_active IP Right Cessation
- 1971-04-28 US US00138275A patent/US3806540A/en not_active Expired - Lifetime
- 1971-04-28 PL PL1971147806A patent/PL84251B1/pl unknown
- 1971-04-29 SU SU1646896A patent/SU385428A3/ru active
- 1971-04-29 CA CA111,791A patent/CA993448A/fr not_active Expired
- 1971-04-29 ES ES390718A patent/ES390718A1/es not_active Expired
- 1971-04-29 SE SE7105613A patent/SE399251B/xx unknown
- 1971-04-29 ZA ZA712777A patent/ZA712777B/xx unknown
- 1971-04-29 CS CS3118A patent/CS169819B2/cs unknown
- 1971-04-30 AT AT376071A patent/AT306688B/de not_active IP Right Cessation
- 1971-04-30 DE DE2121361A patent/DE2121361B2/de active Granted
- 1971-04-30 BE BE766520A patent/BE766520A/xx unknown
- 1971-04-30 JP JP2815271A patent/JPS553337B1/ja active Pending
- 1971-04-30 GB GB1244771A patent/GB1355991A/en not_active Expired
- 1971-04-30 LU LU63086D patent/LU63086A1/xx unknown
- 1971-05-03 NL NL7105988A patent/NL7105988A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| ZA712777B (en) | 1972-06-28 |
| SU385428A3 (enExample) | 1973-05-29 |
| AT306688B (de) | 1973-04-25 |
| JPS553337B1 (enExample) | 1980-01-24 |
| GB1355991A (en) | 1974-06-12 |
| FR2085653B1 (enExample) | 1973-06-08 |
| BE766520A (fr) | 1971-11-03 |
| IL36724A0 (en) | 1971-06-23 |
| FR2085653A1 (enExample) | 1971-12-31 |
| IL36724A (en) | 1975-02-10 |
| ES390718A1 (es) | 1973-06-16 |
| DE2121361C3 (enExample) | 1980-06-04 |
| SE399251B (sv) | 1978-02-06 |
| DE2121361A1 (enExample) | 1971-11-11 |
| LU63086A1 (enExample) | 1971-08-27 |
| US3806540A (en) | 1974-04-23 |
| CS169819B2 (enExample) | 1976-07-29 |
| NL7105988A (enExample) | 1971-11-02 |
| CH539601A (fr) | 1973-07-31 |
| DE2121361B2 (de) | 1979-09-13 |
| CA993448A (fr) | 1976-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Bindra | Prostaglandin synthesis | |
| Henton et al. | Chemistry of quinone derivatives. Quinone monoketals via hydrolysis of electrochemically derived quinone bisketals | |
| PL84251B1 (enExample) | ||
| Allinger et al. | Conformational Analysis. XLIII. Stereochemical Studies in the Cyclobutane Ring System1-3 | |
| Yang et al. | Highly efficient epoxidation of electron-deficient olefins with tetrabutylammonium peroxydisulfate | |
| US3991106A (en) | 16-Ethers of 8-aza-9-dioxothia-11,12-seco-prostaglandins | |
| US4175203A (en) | Interphenylene 11,12-secoprostaglandins | |
| US4055596A (en) | 11,12-Seco-prostaglandins | |
| US4150235A (en) | Interphenylene 11,12-secoprostaglandins | |
| DE1958600A1 (de) | Neue Isoxazolderivate und deren Herstellung | |
| US3932499A (en) | 2-(Substituted biphenylyl) propionic acids | |
| GB2030144A (en) | Keto-bicyclooctanes | |
| DE2550004C2 (de) | Thiaprostaglandine sowie Verfahren zu ihrer Herstellung | |
| DE2611788C2 (de) | Fluorprostaglandine, Verfahren zu ihrer Herstellung und sie enthaltende pharmazeutische Mittel | |
| DE2319017B2 (de) | Verfahren zur Herstellung von Prostaglandinen der Eins-Reihe | |
| US3683006A (en) | Cyclodecapentaene compounds | |
| US3801623A (en) | Cyclopentanone derivatives | |
| US4049823A (en) | Phenylbutanol derivatives and compositions containing them | |
| DE2449928A1 (de) | Verfahren zur herstellung neuer carbocyclischer verbindungen | |
| PL81809B1 (en) | Preparation of prostanoic acid derivatives[US4024172A] | |
| CN111945180A (zh) | 一种环己酮衍生物电催化环已烯酮合成3-羟基环己酮的合成方法 | |
| CH617676A5 (enExample) | ||
| IE42406B1 (en) | Diphenyl ether derivatives and processes for their preparation | |
| CH620893A5 (enExample) | ||
| US4136200A (en) | Phenylbutanol derivatives, processes for their preparation and compositions containing them |