PL84012B1 - - Google Patents
Download PDFInfo
- Publication number
- PL84012B1 PL84012B1 PL1973162554A PL16255473A PL84012B1 PL 84012 B1 PL84012 B1 PL 84012B1 PL 1973162554 A PL1973162554 A PL 1973162554A PL 16255473 A PL16255473 A PL 16255473A PL 84012 B1 PL84012 B1 PL 84012B1
- Authority
- PL
- Poland
- Prior art keywords
- cyano
- alkyl
- radical
- methyl
- general formula
- Prior art date
Links
- 239000000975 dye Substances 0.000 claims description 25
- 125000003118 aryl group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 claims description 5
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 150000008049 diazo compounds Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- -1 alkyl radical Chemical class 0.000 description 37
- 238000004043 dyeing Methods 0.000 description 6
- 150000005840 aryl radicals Chemical class 0.000 description 5
- 229920000728 polyester Polymers 0.000 description 5
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 125000000547 substituted alkyl group Chemical group 0.000 description 4
- 239000004753 textile Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 2
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- ZIUSEGSNTOUIPT-UHFFFAOYSA-N ethyl 2-cyanoacetate Chemical compound CCOC(=O)CC#N ZIUSEGSNTOUIPT-UHFFFAOYSA-N 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 229920002994 synthetic fiber Polymers 0.000 description 2
- 239000004758 synthetic textile Substances 0.000 description 2
- GPRYKVSEZCQIHD-UHFFFAOYSA-N 1-(4-aminophenyl)ethanone Chemical compound CC(=O)C1=CC=C(N)C=C1 GPRYKVSEZCQIHD-UHFFFAOYSA-N 0.000 description 1
- LTHNHFOGQMKPOV-UHFFFAOYSA-N 2-ethylhexan-1-amine Chemical compound CCCCC(CC)CN LTHNHFOGQMKPOV-UHFFFAOYSA-N 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- XJEVFFNOMKXBLU-UHFFFAOYSA-N 4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C=C1 XJEVFFNOMKXBLU-UHFFFAOYSA-N 0.000 description 1
- ODGIMMLDVSWADK-UHFFFAOYSA-N 4-trifluoromethylaniline Chemical compound NC1=CC=C(C(F)(F)F)C=C1 ODGIMMLDVSWADK-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical group [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/84—Nitriles
- C07D213/85—Nitriles in position 3
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/34—Monoazo dyes prepared by diazotising and coupling from other coupling components
- C09B29/36—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds
- C09B29/3604—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom
- C09B29/3617—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom
- C09B29/3621—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring
- C09B29/3626—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O)
- C09B29/363—Monoazo dyes prepared by diazotising and coupling from other coupling components from heterocyclic compounds containing only a nitrogen as heteroatom containing a six-membered heterocyclic with only one nitrogen as heteroatom from a pyridine ring from a pyridine ring containing one or more hydroxyl groups (or = O) from diazotized amino carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2310472A GB1398741A (en) | 1972-05-17 | 1972-05-17 | Water-insoluble monoazo dyestuffs |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL84012B1 true PL84012B1 (cs) | 1976-02-28 |
Family
ID=10190167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1973162554A PL84012B1 (cs) | 1972-05-17 | 1973-05-15 |
Country Status (19)
| Country | Link |
|---|---|
| JP (2) | JPS4992110A (cs) |
| AR (1) | AR196344A1 (cs) |
| AU (1) | AU470497B2 (cs) |
| BE (1) | BE799389R (cs) |
| BR (1) | BR7303611D0 (cs) |
| CA (1) | CA1006158A (cs) |
| CH (1) | CH567069A5 (cs) |
| CS (1) | CS189606B2 (cs) |
| DD (1) | DD103917A6 (cs) |
| DE (1) | DE2323621A1 (cs) |
| EG (1) | EG11119A (cs) |
| ES (1) | ES414836A2 (cs) |
| FR (1) | FR2329723A2 (cs) |
| GB (1) | GB1398741A (cs) |
| IT (1) | IT1051730B (cs) |
| NL (1) | NL7306804A (cs) |
| PL (1) | PL84012B1 (cs) |
| RO (1) | RO62635A (cs) |
| ZA (1) | ZA732918B (cs) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1521534A (en) * | 1975-03-25 | 1978-08-16 | Ici Ltd | Process for the colouration of aromatic polyester textile materials |
| IT1115389B (it) * | 1976-08-25 | 1986-02-03 | Ici Ltd | Coloranti azoici a dispersione,stabilizzati |
| DE3012863A1 (de) * | 1980-04-02 | 1981-10-08 | Cassella Ag, 6000 Frankfurt | Farbstoffmischung, verfahren zu ihrer herstellung, sie enthaltende farbstoffe und verfahren zum faerben und bedrucken von synthetischem, hydrophobem fasermaterial |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH552661A (de) * | 1968-11-12 | 1974-08-15 | Ciba Geigy Ag | Verfahren zur herstellung neuer azofarbstoffe. |
-
1972
- 1972-05-17 GB GB2310472A patent/GB1398741A/en not_active Expired
-
1973
- 1973-04-30 ZA ZA732918A patent/ZA732918B/xx unknown
- 1973-05-02 IT IT23632/73A patent/IT1051730B/it active
- 1973-05-03 AU AU55175/73A patent/AU470497B2/en not_active Expired
- 1973-05-09 AR AR247921A patent/AR196344A1/es active
- 1973-05-10 BE BE130996A patent/BE799389R/xx active
- 1973-05-10 DE DE2323621A patent/DE2323621A1/de active Pending
- 1973-05-13 EG EG176/73A patent/EG11119A/xx active
- 1973-05-15 CH CH689473A patent/CH567069A5/xx not_active IP Right Cessation
- 1973-05-15 PL PL1973162554A patent/PL84012B1/pl unknown
- 1973-05-15 RO RO7300074784A patent/RO62635A/ro unknown
- 1973-05-16 NL NL7306804A patent/NL7306804A/xx not_active Application Discontinuation
- 1973-05-16 FR FR7317748A patent/FR2329723A2/fr active Granted
- 1973-05-16 DD DD170874A patent/DD103917A6/xx unknown
- 1973-05-17 JP JP48055155A patent/JPS4992110A/ja active Pending
- 1973-05-17 BR BR3611/73A patent/BR7303611D0/pt unknown
- 1973-05-17 CS CS733537A patent/CS189606B2/cs unknown
- 1973-05-17 CA CA171,653A patent/CA1006158A/en not_active Expired
- 1973-05-17 ES ES414836A patent/ES414836A2/es not_active Expired
-
1977
- 1977-03-15 JP JP2855477A patent/JPS52112629A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52112629A (en) | 1977-09-21 |
| AU470497B2 (en) | 1976-03-18 |
| IT1051730B (it) | 1981-05-20 |
| AR196344A1 (es) | 1973-12-18 |
| BR7303611D0 (pt) | 1974-07-18 |
| BE799389R (fr) | 1973-11-12 |
| AU5517573A (en) | 1974-11-07 |
| JPS4992110A (cs) | 1974-09-03 |
| NL7306804A (cs) | 1973-11-20 |
| JPS546250B2 (cs) | 1979-03-27 |
| DE2323621A1 (de) | 1973-12-06 |
| EG11119A (en) | 1976-12-31 |
| CS189606B2 (en) | 1979-04-30 |
| GB1398741A (en) | 1975-06-25 |
| CH567069A5 (cs) | 1975-09-30 |
| DD103917A6 (cs) | 1974-02-12 |
| CA1006158A (en) | 1977-03-01 |
| RO62635A (fr) | 1978-04-15 |
| ES414836A2 (es) | 1976-02-16 |
| FR2329723B2 (cs) | 1978-03-31 |
| ZA732918B (en) | 1974-04-24 |
| FR2329723A2 (fr) | 1977-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6139347B2 (cs) | ||
| US3097198A (en) | Azo dyestuffs | |
| US5132411A (en) | Azo compounds having 2,4-disubstituted-3-halothienyl-5-diazo component radicals, dyeing processes therewith and substrates dyed therewith | |
| US3657214A (en) | Monoazo dyestuffs containing a pyridyl group | |
| JPH0413385B2 (cs) | ||
| DE2727383A1 (de) | Azofarbstoffe der pyridonreihe | |
| US3642767A (en) | Water-insoluble disperse monoazo dyes | |
| PL84012B1 (cs) | ||
| JP3657628B2 (ja) | 分散染料 | |
| US3417076A (en) | Yellow and orange monoazo dyes | |
| US4542207A (en) | Heterocyclic monoazo dyes for polyester fibers | |
| DE2333828A1 (de) | Azofarbstoffe | |
| JPH07268225A (ja) | 分散染料 | |
| DE2531445A1 (de) | Wasserloesliche azofarbstoffe | |
| US4440681A (en) | Water-insoluble monoazo dyestuffs and their preparation | |
| US2140538A (en) | Coloration of organic derivatives of cellulose | |
| US4431585A (en) | Water-insoluble azo dyestuffs, processes for their manufacture and their use for dyeing and printing synthetic hydrophobic fiber material | |
| US3558593A (en) | Water-insoluble monoazo dyestuffs and process for preparing them | |
| DE1644052A1 (de) | Verfahren zur Herstellung von neuen,wasserunloeslichen Azofarbstoffen | |
| US4218373A (en) | Water-soluble phenylazoaminonaphthol sulphonic acid dyestuffs | |
| US2227977A (en) | Azo compounds and material colored therewith | |
| DE2211663A1 (de) | Azofarbstoffe mit 2,6-diaminopyridinen als kupplungskomponenten | |
| US4324723A (en) | Monoazo dyestuffs | |
| US4063881A (en) | Synthetic polyamide fibres colored with acid azobenzene dyestuffs, containing a N-alkyl (or substituted alkyl)-n-sulphophenoxyalkylamino radical in the para position to the azo linkage | |
| US4056523A (en) | Water-insoluble azo dyestuffs |