PL81813B1 - Chemical processes and products[au3302471a] - Google Patents
Chemical processes and products[au3302471a] Download PDFInfo
- Publication number
- PL81813B1 PL81813B1 PL1971150397A PL15039771A PL81813B1 PL 81813 B1 PL81813 B1 PL 81813B1 PL 1971150397 A PL1971150397 A PL 1971150397A PL 15039771 A PL15039771 A PL 15039771A PL 81813 B1 PL81813 B1 PL 81813B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- benzoxazolyl
- acid
- compounds
- groups
- Prior art date
Links
- 238000001311 chemical methods and process Methods 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 37
- 238000000034 method Methods 0.000 claims abstract description 22
- -1 nitro, amino Chemical group 0.000 claims abstract description 16
- 150000003839 salts Chemical class 0.000 claims abstract description 11
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims abstract description 9
- 125000001153 fluoro group Chemical group F* 0.000 claims abstract description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims abstract description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims abstract description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000002252 acyl group Chemical group 0.000 claims abstract description 3
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims abstract description 3
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims abstract description 3
- 125000005843 halogen group Chemical group 0.000 claims abstract description 3
- 125000003396 thiol group Chemical class [H]S* 0.000 claims abstract description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims abstract 4
- 125000004970 halomethyl group Chemical group 0.000 claims abstract 4
- 125000003282 alkyl amino group Chemical group 0.000 claims abstract 2
- 125000004414 alkyl thio group Chemical group 0.000 claims abstract 2
- 239000000203 mixture Substances 0.000 claims description 43
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 40
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 17
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 229910052731 fluorine Inorganic materials 0.000 claims description 7
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 abstract description 12
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 abstract description 10
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 abstract description 10
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 abstract description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract description 4
- 239000002904 solvent Substances 0.000 abstract description 4
- 150000001408 amides Chemical class 0.000 abstract description 3
- 238000010992 reflux Methods 0.000 abstract description 3
- 206010061218 Inflammation Diseases 0.000 abstract description 2
- 230000001754 anti-pyretic effect Effects 0.000 abstract description 2
- 239000002221 antipyretic Substances 0.000 abstract description 2
- 238000010438 heat treatment Methods 0.000 abstract description 2
- 230000004054 inflammatory process Effects 0.000 abstract description 2
- FIISKTXZUZBTRC-UHFFFAOYSA-N 2-phenyl-1,3-benzoxazole Chemical class C1=CC=CC=C1C1=NC2=CC=CC=C2O1 FIISKTXZUZBTRC-UHFFFAOYSA-N 0.000 abstract 2
- 150000002431 hydrogen Chemical class 0.000 abstract 2
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 abstract 2
- 238000006798 ring closing metathesis reaction Methods 0.000 abstract 2
- 125000004953 trihalomethyl group Chemical group 0.000 abstract 2
- BXKPYGNKDSFBHN-UHFFFAOYSA-N 4-(3-amino-3-oxoprop-1-en-2-yl)benzoyl chloride Chemical compound NC(=O)C(=C)C1=CC=C(C(Cl)=O)C=C1 BXKPYGNKDSFBHN-UHFFFAOYSA-N 0.000 abstract 1
- IYXGSMUGOJNHAZ-UHFFFAOYSA-N Ethyl malonate Chemical compound CCOC(=O)CC(=O)OCC IYXGSMUGOJNHAZ-UHFFFAOYSA-N 0.000 abstract 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 abstract 1
- 238000005903 acid hydrolysis reaction Methods 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract 1
- 125000001118 alkylidene group Chemical group 0.000 abstract 1
- 230000002862 amidating effect Effects 0.000 abstract 1
- 230000001760 anti-analgesic effect Effects 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 238000003682 fluorination reaction Methods 0.000 abstract 1
- 150000002690 malonic acid derivatives Chemical class 0.000 abstract 1
- 238000002844 melting Methods 0.000 abstract 1
- 230000008018 melting Effects 0.000 abstract 1
- 230000003472 neutralizing effect Effects 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- 150000002923 oximes Chemical class 0.000 abstract 1
- 239000000825 pharmaceutical preparation Substances 0.000 abstract 1
- 230000008707 rearrangement Effects 0.000 abstract 1
- 125000004385 trihaloalkyl group Chemical group 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 239000000047 product Substances 0.000 description 10
- 150000002825 nitriles Chemical class 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 239000002244 precipitate Substances 0.000 description 7
- 239000000741 silica gel Substances 0.000 description 7
- 229910002027 silica gel Inorganic materials 0.000 description 7
- 239000012043 crude product Substances 0.000 description 6
- 238000010828 elution Methods 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 239000012074 organic phase Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000000956 alloy Substances 0.000 description 4
- 229910045601 alloy Inorganic materials 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 150000003949 imides Chemical class 0.000 description 4
- 229960003424 phenylacetic acid Drugs 0.000 description 4
- 239000003279 phenylacetic acid Substances 0.000 description 4
- 235000019260 propionic acid Nutrition 0.000 description 4
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 4
- 229910052705 radium Inorganic materials 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000002023 wood Substances 0.000 description 4
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000003931 anilides Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000011521 glass Substances 0.000 description 3
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- NMVULQLWSAGZJY-UHFFFAOYSA-N 2-[4-(bromomethyl)-2-fluorophenyl]-1,3-benzoxazole Chemical compound FC1=CC(CBr)=CC=C1C1=NC2=CC=CC=C2O1 NMVULQLWSAGZJY-UHFFFAOYSA-N 0.000 description 2
- GFQKDOWVJRRVEW-UHFFFAOYSA-N 4-ethyl-2-fluorobenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C(F)=C1 GFQKDOWVJRRVEW-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 238000007605 air drying Methods 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- UJUJTJBCXVEAGQ-UHFFFAOYSA-N ethyl 2-amino-4-ethylbenzoate Chemical compound CCOC(=O)C1=CC=C(CC)C=C1N UJUJTJBCXVEAGQ-UHFFFAOYSA-N 0.000 description 2
- XOTHHWKTZXUUGF-UHFFFAOYSA-N ethyl 4-ethyl-2-fluorobenzoate Chemical compound CCOC(=O)C1=CC=C(CC)C=C1F XOTHHWKTZXUUGF-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000355 1,3-benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000006083 1-bromoethyl group Chemical group 0.000 description 1
- MHXNHUSVBYUTJL-UHFFFAOYSA-N 1-chloro-2-fluoro-4-methylbenzene Chemical compound CC1=CC=C(Cl)C(F)=C1 MHXNHUSVBYUTJL-UHFFFAOYSA-N 0.000 description 1
- QEHVZLYSEMNBIJ-UHFFFAOYSA-N 2-(2-fluoro-4-methylphenyl)-1,3-benzoxazole Chemical compound FC1=CC(C)=CC=C1C1=NC2=CC=CC=C2O1 QEHVZLYSEMNBIJ-UHFFFAOYSA-N 0.000 description 1
- AWCMNCDJXFWKTO-UHFFFAOYSA-N 2-(3-fluoro-4-methylphenyl)-1,3-benzoxazole Chemical compound C1=C(F)C(C)=CC=C1C1=NC2=CC=CC=C2O1 AWCMNCDJXFWKTO-UHFFFAOYSA-N 0.000 description 1
- DCTFLNVNPBQXCA-UHFFFAOYSA-N 2-(4-ethyl-2-fluorophenyl)-1,3-benzoxazole Chemical compound FC1=CC(CC)=CC=C1C1=NC2=CC=CC=C2O1 DCTFLNVNPBQXCA-UHFFFAOYSA-N 0.000 description 1
- PWDRABLQVUHYAE-UHFFFAOYSA-N 2-(4-ethylphenyl)-1,3-benzoxazole Chemical compound C1=CC(CC)=CC=C1C1=NC2=CC=CC=C2O1 PWDRABLQVUHYAE-UHFFFAOYSA-N 0.000 description 1
- AOHYZOQLEUTIOK-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)-3-fluorophenyl]propanoic acid Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=NC2=CC=CC=C2O1 AOHYZOQLEUTIOK-UHFFFAOYSA-N 0.000 description 1
- FRFQGGRLXTVFBG-UHFFFAOYSA-N 2-[4-(1,3-benzoxazol-2-yl)phenyl]propanoic acid Chemical compound C1=CC(C(C(O)=O)C)=CC=C1C1=NC2=CC=CC=C2O1 FRFQGGRLXTVFBG-UHFFFAOYSA-N 0.000 description 1
- OPVVSPOJNYBBRW-UHFFFAOYSA-N 2-[4-(1-bromoethyl)-2-fluorophenyl]-1,3-benzoxazole Chemical compound FC1=CC(C(Br)C)=CC=C1C1=NC2=CC=CC=C2O1 OPVVSPOJNYBBRW-UHFFFAOYSA-N 0.000 description 1
- HGHGWDSLOJYSNO-UHFFFAOYSA-N 2-[4-(1-bromoethyl)phenyl]-1,3-benzoxazole Chemical compound C1=CC(C(Br)C)=CC=C1C1=NC2=CC=CC=C2O1 HGHGWDSLOJYSNO-UHFFFAOYSA-N 0.000 description 1
- ZAXLJGNKZIOEJN-UHFFFAOYSA-N 2-[4-(bromomethyl)-3-fluorophenyl]-1,3-benzoxazole Chemical compound C1=C(CBr)C(F)=CC(C=2OC3=CC=CC=C3N=2)=C1 ZAXLJGNKZIOEJN-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- WNYFUEDXRZPXTQ-UHFFFAOYSA-N 2-amino-4-ethylbenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C(N)=C1 WNYFUEDXRZPXTQ-UHFFFAOYSA-N 0.000 description 1
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 1
- ALFWHEYHCZRVLO-UHFFFAOYSA-N 2-fluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C(F)=C1 ALFWHEYHCZRVLO-UHFFFAOYSA-N 0.000 description 1
- PTHDBHDZSMGHKF-UHFFFAOYSA-N 2-piperidin-2-ylethanol Chemical compound OCCC1CCCCN1 PTHDBHDZSMGHKF-UHFFFAOYSA-N 0.000 description 1
- XUQCONCMPCVUDM-UHFFFAOYSA-N 3-fluoro-4-methylbenzoic acid Chemical compound CC1=CC=C(C(O)=O)C=C1F XUQCONCMPCVUDM-UHFFFAOYSA-N 0.000 description 1
- ZQVKTHRQIXSMGY-UHFFFAOYSA-N 4-Ethylbenzoic acid Chemical compound CCC1=CC=C(C(O)=O)C=C1 ZQVKTHRQIXSMGY-UHFFFAOYSA-N 0.000 description 1
- UCKQPZMVYSREGK-UHFFFAOYSA-N 4-ethyl-2-fluorobenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C(F)=C1 UCKQPZMVYSREGK-UHFFFAOYSA-N 0.000 description 1
- AVTLLLZVYYPGFX-UHFFFAOYSA-N 4-ethylbenzoyl chloride Chemical compound CCC1=CC=C(C(Cl)=O)C=C1 AVTLLLZVYYPGFX-UHFFFAOYSA-N 0.000 description 1
- 125000004860 4-ethylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 102000004316 Oxidoreductases Human genes 0.000 description 1
- 108090000854 Oxidoreductases Proteins 0.000 description 1
- 208000002193 Pain Diseases 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940035674 anesthetics Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- KMPWYEUPVWOPIM-KODHJQJWSA-N cinchonidine Chemical compound C1=CC=C2C([C@H]([C@H]3[N@]4CC[C@H]([C@H](C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-KODHJQJWSA-N 0.000 description 1
- KMPWYEUPVWOPIM-UHFFFAOYSA-N cinchonidine Natural products C1=CC=C2C(C(C3N4CCC(C(C4)C=C)C3)O)=CC=NC2=C1 KMPWYEUPVWOPIM-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000006911 enzymatic reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000003193 general anesthetic agent Substances 0.000 description 1
- 230000035876 healing Effects 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007721 medicinal effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/56—Benzoxazoles; Hydrogenated benzoxazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D263/57—Aryl or substituted aryl radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/39—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups
- C07C205/42—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/43—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by esterified hydroxy groups having nitro groups or esterified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton to carbon atoms of the same non-condensed six-membered aromatic ring or to carbon atoms of six-membered aromatic rings being part of the same condensed ring system
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US7122770A | 1970-09-10 | 1970-09-10 | |
| US16538971A | 1971-07-22 | 1971-07-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL81813B1 true PL81813B1 (en) | 1975-08-30 |
Family
ID=26751978
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971150397A PL81813B1 (en) | 1970-09-10 | 1971-09-08 | Chemical processes and products[au3302471a] |
Country Status (23)
| Country | Link |
|---|---|
| JP (2) | JPS544953B1 (show.php) |
| AT (1) | AT311964B (show.php) |
| AU (1) | AU461109B2 (show.php) |
| BE (1) | BE772395A (show.php) |
| CH (1) | CH572916A5 (show.php) |
| DD (1) | DD94814A5 (show.php) |
| DE (1) | DE2145203C2 (show.php) |
| EG (1) | EG10421A (show.php) |
| FI (1) | FI55196C (show.php) |
| FR (1) | FR2106434B1 (show.php) |
| GB (1) | GB1352723A (show.php) |
| IE (1) | IE35599B1 (show.php) |
| IL (1) | IL37633A (show.php) |
| LU (1) | LU63887A1 (show.php) |
| NL (1) | NL174043C (show.php) |
| NO (1) | NO136712C (show.php) |
| OA (1) | OA03911A (show.php) |
| PH (1) | PH11935A (show.php) |
| PL (1) | PL81813B1 (show.php) |
| RO (1) | RO61539A (show.php) |
| SE (1) | SE367203B (show.php) |
| SU (1) | SU455542A3 (show.php) |
| YU (1) | YU34689B (show.php) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3816443A (en) * | 1972-02-17 | 1974-06-11 | Merck & Co Inc | 4-(benzothiazol-2-yl)fluoro phenyl-acetic acids |
| GB1435721A (en) * | 1972-05-18 | 1976-05-12 | Lilly Industries Ltd | Benzoxazole derivatives |
| GB1495488A (en) * | 1976-06-23 | 1977-12-21 | Ippco Int Pharma Patents Co Es | Optically active 2-(2-phenyl-5-benzoxazolyl)propionic acids |
| IT1099589B (it) * | 1978-08-04 | 1985-09-18 | Ravizza Spa | Processo per la preparazione di derivati dell'acido benzoxazolil propionico |
| IT1157295B (it) * | 1982-07-19 | 1987-02-11 | Ravizza Spa | Processo perfezionato per la preparazione di derivati dell'acido benzoxazolil propionico |
| DE19808261A1 (de) * | 1998-02-27 | 1999-10-28 | Bayer Ag | Arylphenylsubstituierte cyclische Ketoenole |
| WO2008035359A2 (en) * | 2006-06-12 | 2008-03-27 | Cadila Healthcare Limited | Oximinophenoxyalkanoic acid and phenylalkanoic acid derivatives |
| JP2008232573A (ja) * | 2007-03-22 | 2008-10-02 | Osaka Gas Co Ltd | 吸収冷凍機 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DD70880A (show.php) * | ||||
| CH483276A (de) * | 1959-09-23 | 1969-12-31 | Ciba Geigy | Verwendung von 2-Phenyl-benzazolen als Schutzmittel vor ultravioletter Strahlung ausserhalb der Textilindustrie |
| US3401120A (en) * | 1965-10-23 | 1968-09-10 | Gaf Corp | Corrosion inhibitors |
| CH514616A (de) * | 1968-10-07 | 1971-10-31 | Ciba Geigy Ag | Verfahren zur Herstellung von Arylenoxazolen |
-
1971
- 1971-09-01 IL IL37633A patent/IL37633A/xx unknown
- 1971-09-02 OA OA54349A patent/OA03911A/xx unknown
- 1971-09-02 AU AU33024/71A patent/AU461109B2/en not_active Expired
- 1971-09-03 CH CH1295571A patent/CH572916A5/xx not_active IP Right Cessation
- 1971-09-06 PH PH12818A patent/PH11935A/en unknown
- 1971-09-06 AT AT773871A patent/AT311964B/de not_active IP Right Cessation
- 1971-09-06 GB GB4149971A patent/GB1352723A/en not_active Expired
- 1971-09-07 IE IE1136/71A patent/IE35599B1/xx unknown
- 1971-09-07 YU YU2279/71A patent/YU34689B/xx unknown
- 1971-09-08 PL PL1971150397A patent/PL81813B1/pl unknown
- 1971-09-08 EG EG396/71*UA patent/EG10421A/xx active
- 1971-09-09 NL NLAANVRAGE7112437,A patent/NL174043C/xx not_active IP Right Cessation
- 1971-09-09 FI FI2524/71A patent/FI55196C/fi active
- 1971-09-09 DE DE2145203A patent/DE2145203C2/de not_active Expired
- 1971-09-09 BE BE772395A patent/BE772395A/xx not_active IP Right Cessation
- 1971-09-09 LU LU63887D patent/LU63887A1/xx unknown
- 1971-09-09 SU SU1696052A patent/SU455542A3/ru active
- 1971-09-09 DD DD157648A patent/DD94814A5/xx unknown
- 1971-09-09 SE SE11441/71A patent/SE367203B/xx unknown
- 1971-09-09 NO NO3355/71A patent/NO136712C/no unknown
- 1971-09-10 FR FR7132748A patent/FR2106434B1/fr not_active Expired
- 1971-09-10 RO RO68180A patent/RO61539A/ro unknown
- 1971-09-10 JP JP6981371A patent/JPS544953B1/ja active Pending
-
1977
- 1977-11-02 JP JP52130931A patent/JPS6044304B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU3302471A (en) | 1973-03-08 |
| DD94814A5 (show.php) | 1973-01-05 |
| IL37633A0 (en) | 1971-11-29 |
| NL174043B (nl) | 1983-11-16 |
| YU34689B (en) | 1979-12-31 |
| BE772395A (fr) | 1972-03-09 |
| JPS544953B1 (show.php) | 1979-03-12 |
| SU455542A3 (ru) | 1974-12-30 |
| FI55196B (fi) | 1979-02-28 |
| FI55196C (fi) | 1979-06-11 |
| JPS6044304B2 (ja) | 1985-10-02 |
| IE35599L (en) | 1972-03-10 |
| JPS5390258A (en) | 1978-08-08 |
| GB1352723A (en) | 1974-05-08 |
| DE2145203C2 (de) | 1984-07-12 |
| AT311964B (de) | 1973-12-10 |
| CH572916A5 (show.php) | 1976-02-27 |
| NO136712B (show.php) | 1977-07-18 |
| NL174043C (nl) | 1984-04-16 |
| PH11935A (en) | 1978-09-15 |
| AU461109B2 (en) | 1975-05-15 |
| NL7112437A (show.php) | 1972-03-14 |
| OA03911A (fr) | 1975-08-14 |
| FR2106434B1 (show.php) | 1974-10-18 |
| LU63887A1 (show.php) | 1972-03-01 |
| YU227971A (en) | 1979-07-10 |
| FR2106434A1 (show.php) | 1972-05-05 |
| IL37633A (en) | 1975-08-31 |
| SE367203B (show.php) | 1974-05-20 |
| DE2145203A1 (de) | 1972-03-16 |
| NO136712C (no) | 1977-10-26 |
| EG10421A (en) | 1976-02-29 |
| RO61539A (show.php) | 1976-12-15 |
| IE35599B1 (en) | 1976-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3641127A (en) | (3-benzoylphenyl) alkanoic acids | |
| EP0061386B1 (fr) | Acides ((2-oxo-3-tétrahydrothiénylcarbamoyl)-alkylthio) acétiques, leurs sels et leurs esters, leur procédé de préparation et les compositions pharmaceutiques en contenant | |
| EP0172096A1 (fr) | Dérivés d'acylaminométhyl-3 imidazo[1,2-a]pyridines, leur préparation et leur application en thérapeutique | |
| FR2576901A1 (fr) | Nouveaux derives de l'acide a-(oxo-2 hexahydro-2,4,5,6,7,7a thieno (3,2-c) pyridyl-5) phenyl acetique, leur procede de preparation et leur application therapeutique | |
| PL81813B1 (en) | Chemical processes and products[au3302471a] | |
| US5185370A (en) | Substituted β-diketones and their use | |
| US3976686A (en) | [1-Oxo-2,3-hydrocarbylene-5-indanyloxy(or thio)]alkanoic acids | |
| CA1324134C (en) | Process for preparing (rs)-2-(2,3-dihydro-5-hydroxy-4,6, 7-trimethylbenzofuranyl) acetic acids and 2-(2,3-dihydro-5-acyloxy-4,6,7-trimethylbenzofuranyl) acetic acids and esters thereof, useful as mucoregulator and antihyschaemic drugs | |
| US3663627A (en) | 1-indanmethanols | |
| US3821289A (en) | Tetrahydronaphthylalkanoic acids and their derivatives | |
| KR100224330B1 (ko) | 골관절 질환의 치료에 유용한 n-((4,5-디히드록시-및 4,5,8-트리히드록시-9,10-디히드로-9,10-디옥소-2-안트라센-일)카르보닐)아미노산 | |
| EP0017543B1 (fr) | Dérivés du benzothiazole, leur procédé de préparation et leurs applications en thérapeutique | |
| US3466372A (en) | Treatment of inflammation with 4-phenyl - alpha - methyl - phenyl acetic acid,its salts,esters or amide derivatives | |
| US3947582A (en) | Phenylacetic acid compounds in treating abnormal platelet aggregation | |
| US4116972A (en) | Anti-inflammatory 1-oxo-isoindoline derivatives and processes for their preparation | |
| EP0083222B1 (en) | New quinolylacetic acid compounds and pharmaceutical compositions containing them | |
| US3899506A (en) | 4-(Benzoxazol-2-yl)-phenylacetic acids and derivatives thereof | |
| CH542835A (de) | Verfahren zur Herstellung von neuen Aryloxy- und Arylthioalkansäuren und ihren Salzen | |
| JPS60104084A (ja) | 4H‐ベンゾ〔4,5〕シクロヘプタ〔1,2‐b〕チオフエン誘導体 | |
| EP0344737B1 (en) | Process for purifying alpha-substituted acetic acids | |
| US4046905A (en) | Anti-inflammatory, analgesic and antipyretic phenylacetic acids | |
| US4148916A (en) | Derivatives of oxaminic acids and esters | |
| Balenović et al. | SYNTHESIS OF L-β-AMINO-γ-BENZYLTHIOBUTYRIC ACID.[L-β-AMINO-S-(BENZYL) HOMOCYSTEINE.] AMINO ACIDS. VI. | |
| JPS6040420B2 (ja) | 3−アミノ−2−(5−フルオル−及び5−メトキシ−1h−インド−ル−3−イル)プロパン酸誘導体類、その製法及び利用 | |
| US4330555A (en) | Indanyloxamic derivatives, their preparation and pharmaceutical compositions containing them |