PL80526B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80526B1 PL80526B1 PL1969136834A PL13683469A PL80526B1 PL 80526 B1 PL80526 B1 PL 80526B1 PL 1969136834 A PL1969136834 A PL 1969136834A PL 13683469 A PL13683469 A PL 13683469A PL 80526 B1 PL80526 B1 PL 80526B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- compounds
- ethyl acetate
- carbon atoms
- pgf2
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 9
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 5
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 150000003180 prostaglandins Chemical class 0.000 claims description 3
- 238000009472 formulation Methods 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 150000002576 ketones Chemical class 0.000 description 8
- 230000037396 body weight Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 150000004702 methyl esters Chemical class 0.000 description 6
- 230000009467 reduction Effects 0.000 description 6
- 239000003638 chemical reducing agent Substances 0.000 description 5
- PXGPLTODNUVGFL-BRIYLRKRSA-N (E,Z)-(1R,2R,3R,5S)-7-(3,5-Dihydroxy-2-((3S)-(3-hydroxy-1-octenyl))cyclopentyl)-5-heptenoic acid Chemical compound CCCCC[C@H](O)C=C[C@H]1[C@H](O)C[C@H](O)[C@@H]1CC=CCCCC(O)=O PXGPLTODNUVGFL-BRIYLRKRSA-N 0.000 description 4
- 241000124008 Mammalia Species 0.000 description 4
- -1 aliphatic alcohols Chemical class 0.000 description 4
- 238000001802 infusion Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 208000037805 labour Diseases 0.000 description 3
- 230000016087 ovulation Effects 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 241000283690 Bos taurus Species 0.000 description 2
- 101000692466 Bos taurus Prostaglandin F synthase 2 Proteins 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- JFBZPFYRPYOZCQ-UHFFFAOYSA-N [Li].[Al] Chemical compound [Li].[Al] JFBZPFYRPYOZCQ-UHFFFAOYSA-N 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 210000003754 fetus Anatomy 0.000 description 2
- 150000004678 hydrides Chemical class 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical compound CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 description 2
- 238000004809 thin layer chromatography Methods 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RRQYJINTUHWNHW-UHFFFAOYSA-N 1-ethoxy-2-(2-ethoxyethoxy)ethane Chemical compound CCOCCOCCOCC RRQYJINTUHWNHW-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 241000282693 Cercopithecidae Species 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- 241001494479 Pecora Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010062237 Renal impairment Diseases 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 206010053615 Thermal burn Diseases 0.000 description 1
- 206010046530 Urinary bladder rupture Diseases 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001589 carboacyl group Chemical group 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229940019778 diethylene glycol diethyl ether Drugs 0.000 description 1
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 1
- 229960002986 dinoprostone Drugs 0.000 description 1
- 208000028659 discharge Diseases 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000001605 fetal effect Effects 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000000268 heptanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 208000021267 infertility disease Diseases 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000005906 menstruation Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 231100000857 poor renal function Toxicity 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US77513168A | 1968-11-12 | 1968-11-12 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80526B1 true PL80526B1 (enExample) | 1975-08-30 |
Family
ID=25103422
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969136834A PL80526B1 (enExample) | 1968-11-12 | 1969-11-11 |
Country Status (12)
| Country | Link |
|---|---|
| BE (1) | BE741555A (enExample) |
| BR (1) | BR6913826D0 (enExample) |
| CH (2) | CH540215A (enExample) |
| DE (1) | DE1956290A1 (enExample) |
| DK (1) | DK134507B (enExample) |
| ES (1) | ES373199A1 (enExample) |
| FR (1) | FR2024837B1 (enExample) |
| GB (1) | GB1251750A (enExample) |
| IL (1) | IL33226A (enExample) |
| NL (1) | NL6916822A (enExample) |
| PL (1) | PL80526B1 (enExample) |
| SE (1) | SE380015B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PL350917A1 (en) | 1999-03-05 | 2003-02-10 | Procter & Gamble | C16 unsaturated fp-selective prostaglandins analogs |
| US6894175B1 (en) | 1999-08-04 | 2005-05-17 | The Procter & Gamble Company | 2-Decarboxy-2-phosphinico prostaglandin derivatives and methods for their preparation and use |
| US20020013294A1 (en) | 2000-03-31 | 2002-01-31 | Delong Mitchell Anthony | Cosmetic and pharmaceutical compositions and methods using 2-decarboxy-2-phosphinico derivatives |
| US20020172693A1 (en) | 2000-03-31 | 2002-11-21 | Delong Michell Anthony | Compositions and methods for treating hair loss using non-naturally occurring prostaglandins |
| US20020037914A1 (en) | 2000-03-31 | 2002-03-28 | Delong Mitchell Anthony | Compositions and methods for treating hair loss using C16-C20 aromatic tetrahydro prostaglandins |
| US8623918B2 (en) | 2008-10-29 | 2014-01-07 | Novaer Holdings, Inc. | Amino acid salts of prostaglandins |
| US8722739B2 (en) | 2008-10-29 | 2014-05-13 | Novaer Holdings, Inc. | Amino acid salts of prostaglandins |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3290226A (en) * | 1964-02-19 | 1966-12-06 | Upjohn Co | Microbiological conversion of unsaturated fatty acids |
| US3505386A (en) * | 1965-12-29 | 1970-04-07 | Upjohn Co | Compounds related to prostaglandins |
| GB1198071A (en) * | 1966-08-09 | 1970-07-08 | George Erich Just | Improvements in or relating to Prostaglandin Analogues and the Manufacture thereof |
| US3435053A (en) * | 1966-06-06 | 1969-03-25 | Upjohn Co | Cyclopenta(b)pyrans |
-
1969
- 1969-10-03 GB GB1251750D patent/GB1251750A/en not_active Expired
- 1969-10-21 IL IL33226A patent/IL33226A/en unknown
- 1969-10-27 CH CH1844371A patent/CH540215A/de not_active IP Right Cessation
- 1969-10-27 CH CH1605169A patent/CH517685A/de not_active IP Right Cessation
- 1969-10-31 BR BR213826/69A patent/BR6913826D0/pt unknown
- 1969-11-05 ES ES373199A patent/ES373199A1/es not_active Expired
- 1969-11-07 NL NL6916822A patent/NL6916822A/xx unknown
- 1969-11-08 DE DE19691956290 patent/DE1956290A1/de active Pending
- 1969-11-11 SE SE6915475A patent/SE380015B/xx unknown
- 1969-11-11 PL PL1969136834A patent/PL80526B1/pl unknown
- 1969-11-11 DK DK595469AA patent/DK134507B/da unknown
- 1969-11-12 BE BE741555D patent/BE741555A/xx unknown
- 1969-11-12 FR FR696938853A patent/FR2024837B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK134507C (enExample) | 1977-04-18 |
| NL6916822A (enExample) | 1970-05-14 |
| GB1251750A (enExample) | 1971-10-27 |
| DE1956290A1 (de) | 1970-06-11 |
| ES373199A1 (es) | 1972-03-16 |
| BE741555A (enExample) | 1970-05-12 |
| CH517685A (de) | 1972-01-15 |
| DK134507B (da) | 1976-11-22 |
| FR2024837B1 (enExample) | 1973-07-13 |
| IL33226A (en) | 1973-10-25 |
| SE380015B (enExample) | 1975-10-27 |
| CH540215A (de) | 1973-09-28 |
| FR2024837A1 (enExample) | 1970-09-04 |
| BR6913826D0 (pt) | 1973-02-13 |
| IL33226A0 (en) | 1969-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Pace-Asciak et al. | Novel prostaglandin derivative formed from arachidonic acid by rat stomach homogenates | |
| US4738957A (en) | Estriol esters | |
| US4312864A (en) | Branched chain and cycloaliphatic esters of the androstane and destrane series and pharmaceutical compositions containing same | |
| CZ292047B6 (cs) | 19-Nor-pregnenové deriváty, farmaceutický prostředek obsahující tyto sloučeniny a použití | |
| CH637949A5 (en) | Process for the preparation of novel sodium salts of prostaglandin derivatives | |
| USRE34136E (en) | 9 alpha, 11 beta-substituted and 11 beta-substituted estranes | |
| PL80526B1 (enExample) | ||
| CA2358466C (en) | 17.beta.-acyl-17.alpha.-propynyl-11.beta.-arylsteroids and their derivatives having agonist or antagonist hormonal properties | |
| Jones et al. | Studies on imidazoles. III. 1-Substituted analogs of histidine and histamine | |
| EP0009869A2 (en) | Esters of prostaglandin-type compounds | |
| US4436934A (en) | Bicyclic prostaglandin analogs and method of synthesis | |
| SE435516B (sv) | Sett att framstella nya 11beta-substituerade 1,3,5(10)-triensteroidderivat | |
| US3951959A (en) | 1,3-Oxygenated 8α-estratrienes | |
| DE60004377T2 (de) | Oral wirksame 7-alpha-alkyl androgene | |
| US3487155A (en) | Substituted estradiol alkyl ethers | |
| KANEKO et al. | Synthesis and Structure-Activity Relationships of 7α-Alkylthioandrostanes | |
| Grant et al. | Sodium equilin sulfate and sodium equilenin sulfate | |
| PL75312B2 (en) | 17alpha-ehtynylestriols[au3982772a] | |
| US3936491A (en) | Adamantylene compounds | |
| Senciall et al. | URINARY AND BILIARY EXCRETION OF [4-14C] PROGESTERONE,[4-14C] 20α-AND [4-14C] 20β-HYDROXYPREGN-4-EN-3-ONE METABOLITES IN THE RABBIT | |
| NZ200779A (en) | 4-alpha,5-alpha-epoxy-3,20-dioxopregnane-2-alpha | |
| US3186907A (en) | 19-nor-testosterone derivatives, their process of preparation and their method of utilization | |
| US4149006A (en) | Prostaglandin derivatives having alkynyl, hydroxy and aryloxy junctions in the 2β side chain | |
| FI61692B (fi) | Foerfarande foer framstaellning av farmakologiskt aktiva prostaglandinderivat | |
| US3868452A (en) | 17Alpha-ethynylestriol 3-Cyclopentyl ether |