PL80501B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80501B1 PL80501B1 PL1970141453A PL14145370A PL80501B1 PL 80501 B1 PL80501 B1 PL 80501B1 PL 1970141453 A PL1970141453 A PL 1970141453A PL 14145370 A PL14145370 A PL 14145370A PL 80501 B1 PL80501 B1 PL 80501B1
- Authority
- PL
- Poland
- Prior art keywords
- ammonium nitrate
- ammonium
- passes
- calcium carbonate
- additives
- Prior art date
Links
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 62
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 41
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 33
- 239000003337 fertilizer Substances 0.000 claims description 25
- 239000000203 mixture Substances 0.000 claims description 22
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- 239000004327 boric acid Substances 0.000 claims description 14
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 claims description 12
- 229910052921 ammonium sulfate Inorganic materials 0.000 claims description 12
- 235000011130 ammonium sulphate Nutrition 0.000 claims description 12
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 claims description 12
- 239000004254 Ammonium phosphate Substances 0.000 claims description 8
- 229910000148 ammonium phosphate Inorganic materials 0.000 claims description 8
- 235000019289 ammonium phosphates Nutrition 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 8
- 239000005696 Diammonium phosphate Substances 0.000 claims description 4
- 150000003863 ammonium salts Chemical class 0.000 claims description 4
- 229910000388 diammonium phosphate Inorganic materials 0.000 claims description 4
- 235000019838 diammonium phosphate Nutrition 0.000 claims description 4
- 230000008569 process Effects 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- -1 alkali metal salt Chemical class 0.000 claims description 2
- 239000000654 additive Substances 0.000 description 27
- 238000012360 testing method Methods 0.000 description 18
- 235000010338 boric acid Nutrition 0.000 description 12
- 238000007792 addition Methods 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 239000001166 ammonium sulphate Substances 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 238000001816 cooling Methods 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 239000008188 pellet Substances 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000003381 stabilizer Substances 0.000 description 5
- 235000019738 Limestone Nutrition 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000006028 limestone Substances 0.000 description 4
- 230000000087 stabilizing effect Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- LFVGISIMTYGQHF-UHFFFAOYSA-N ammonium dihydrogen phosphate Chemical compound [NH4+].OP(O)([O-])=O LFVGISIMTYGQHF-UHFFFAOYSA-N 0.000 description 2
- 229910000387 ammonium dihydrogen phosphate Inorganic materials 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 235000019837 monoammonium phosphate Nutrition 0.000 description 2
- 239000006012 monoammonium phosphate Substances 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910000318 alkali metal phosphate Inorganic materials 0.000 description 1
- 229910052936 alkali metal sulfate Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 244000221110 common millet Species 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 238000002309 gasification Methods 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- 235000003642 hunger Nutrition 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 230000037351 starvation Effects 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C05—FERTILISERS; MANUFACTURE THEREOF
- C05C—NITROGENOUS FERTILISERS
- C05C1/00—Ammonium nitrate fertilisers
- C05C1/02—Granulation; Pelletisation; Stabilisation; Colouring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Fertilizers (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US83521369A | 1969-06-20 | 1969-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80501B1 true PL80501B1 (OSRAM) | 1975-08-30 |
Family
ID=25268939
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141453A PL80501B1 (OSRAM) | 1969-06-20 | 1970-06-19 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3647412A (OSRAM) |
| AT (1) | AT299996B (OSRAM) |
| BE (2) | BE739881A (OSRAM) |
| BG (1) | BG20328A3 (OSRAM) |
| CH (1) | CH558765A (OSRAM) |
| CS (1) | CS163212B2 (OSRAM) |
| DE (1) | DE2029086C3 (OSRAM) |
| DK (1) | DK122719B (OSRAM) |
| ES (1) | ES372685A1 (OSRAM) |
| FI (1) | FI50706C (OSRAM) |
| FR (2) | FR2046928A1 (OSRAM) |
| GB (1) | GB1261279A (OSRAM) |
| IE (1) | IE34087B1 (OSRAM) |
| IL (1) | IL34438A (OSRAM) |
| NL (1) | NL6916860A (OSRAM) |
| NO (1) | NO121789B (OSRAM) |
| PL (1) | PL80501B1 (OSRAM) |
| RO (1) | RO58324A2 (OSRAM) |
| SE (1) | SE353525B (OSRAM) |
| ZM (1) | ZM6370A1 (OSRAM) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1252664B (it) * | 1991-12-23 | 1995-06-21 | Enichem Agricoltura Spa | Processo per la granulazione di un fertilizzante denominato nitrato ammonico |
| FR2804954B1 (fr) * | 2000-02-15 | 2002-09-06 | Cfpi Nufarm | Additif et procede pour la preparation des engrais du type can et can ainsi obtenu |
| RU2223934C1 (ru) * | 2002-09-03 | 2004-02-20 | Открытое акционерное общество "Кирово-Чепецкий химический комбинат им. Б.П.Константинова" | Способ получения известково-аммиачной селитры |
| RU2252206C1 (ru) * | 2003-12-08 | 2005-05-20 | Закрытое акционерное общество "Куйбышевазот" | Технологическая линия по производству известково-аммиачной селитры |
| RU2259979C1 (ru) * | 2004-08-26 | 2005-09-10 | Открытое акционерное общество "Азот" | Способ получения аммиачно-кальциевой селитры |
| RU2265001C1 (ru) * | 2004-11-19 | 2005-11-27 | Закрытое акционерное общество "Минерально-химическая компания "ЕвроХим" (ЗАО "МХК "ЕвроХим") | Способ получения известково-аммиачного удобрения |
| RU2281274C1 (ru) * | 2005-03-31 | 2006-08-10 | Открытое акционерное общество "Научно-исследовательский институт по удобрениям и инсектофунгицидам им. Я.В. Самойлова" | Способ получения гранулированного известково-аммиачного удобрения |
| RU2309135C2 (ru) * | 2005-12-20 | 2007-10-27 | Открытое акционерное общество "КуйбышевАзот" | Технологическая линия для производства известково-аммиачной селитры |
| EP3052583A4 (en) * | 2013-09-30 | 2017-06-21 | Donald S. Sperber | Flame-retardant formulations and methods relating thereto |
| US12338189B2 (en) * | 2023-05-24 | 2025-06-24 | Defuse Technologies, LLC | Desensitized fertilizer compositions and methods of making same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2657977A (en) * | 1949-09-21 | 1953-11-03 | Commercial Solvents Corp | Process for preventing the physical disintegration of ammonium nitrate by temperature fluctuations |
| US2912318A (en) * | 1957-01-16 | 1959-11-10 | Commercial Solvents Corp | Process for making mixed fertilizers containing ammonium nitrate and calcium carbonate |
| FR1316412A (fr) * | 1962-03-01 | 1963-01-25 | Shell Int Research | Procédé de préparation d'engrais mixtes contenant du nitrate d'ammonium et du carbonate de calcium |
| US3421878A (en) * | 1966-04-06 | 1969-01-14 | Foster Wheeler Corp | Ammonium nitrate-calcium carbonate fertilizer mixture |
| US3317276A (en) * | 1966-10-24 | 1967-05-02 | Mississippi Chem Corp | Stabilized ammonium nitrate compositions and their production |
-
1969
- 1969-06-20 US US835213A patent/US3647412A/en not_active Expired - Lifetime
- 1969-08-05 SE SE10919/69A patent/SE353525B/xx unknown
- 1969-09-18 NO NO3733/69A patent/NO121789B/no unknown
- 1969-10-02 FI FI692838A patent/FI50706C/fi active
- 1969-10-03 DK DK528869AA patent/DK122719B/da not_active IP Right Cessation
- 1969-10-06 BE BE739881D patent/BE739881A/xx not_active IP Right Cessation
- 1969-10-09 GB GB49618/69A patent/GB1261279A/en not_active Expired
- 1969-10-09 FR FR6934518A patent/FR2046928A1/fr not_active Withdrawn
- 1969-10-18 ES ES372685A patent/ES372685A1/es not_active Expired
- 1969-11-03 RO RO61446A patent/RO58324A2/ro unknown
- 1969-11-07 NL NL6916860A patent/NL6916860A/xx unknown
-
1970
- 1970-02-10 AT AT120670A patent/AT299996B/de not_active IP Right Cessation
- 1970-02-12 CH CH202570A patent/CH558765A/xx not_active IP Right Cessation
- 1970-05-01 IL IL34438A patent/IL34438A/xx unknown
- 1970-05-07 IE IE1290/69A patent/IE34087B1/xx unknown
- 1970-05-27 BE BE750994D patent/BE750994R/xx active
- 1970-06-01 ZM ZM63/70A patent/ZM6370A1/xx unknown
- 1970-06-12 DE DE2029086A patent/DE2029086C3/de not_active Expired
- 1970-06-16 BG BG014953A patent/BG20328A3/xx unknown
- 1970-06-16 CS CS4215A patent/CS163212B2/cs unknown
- 1970-06-19 FR FR7022743A patent/FR2054583B2/fr not_active Expired
- 1970-06-19 PL PL1970141453A patent/PL80501B1/pl unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FR2046928A1 (OSRAM) | 1971-03-12 |
| IL34438A (en) | 1973-04-30 |
| FI50706B (OSRAM) | 1976-03-01 |
| DK122719B (da) | 1972-04-04 |
| RO58324A2 (ro) | 1975-06-05 |
| FI50706C (fi) | 1976-06-10 |
| IL34438A0 (en) | 1970-07-19 |
| NO121789B (OSRAM) | 1971-04-13 |
| FR2054583B2 (OSRAM) | 1974-05-03 |
| NL6916860A (OSRAM) | 1970-12-22 |
| GB1261279A (en) | 1972-01-26 |
| BE750994R (fr) | 1970-11-03 |
| CH558765A (de) | 1975-02-14 |
| DE2029086B2 (de) | 1973-07-05 |
| SE353525B (OSRAM) | 1973-02-05 |
| FR2054583A2 (OSRAM) | 1971-04-23 |
| ZM6370A1 (en) | 1971-01-20 |
| CS163212B2 (OSRAM) | 1975-08-29 |
| US3647412A (en) | 1972-03-07 |
| ES372685A1 (es) | 1972-02-01 |
| IE34087L (en) | 1970-12-20 |
| AT299996B (de) | 1972-07-10 |
| BG20328A3 (bg) | 1975-11-05 |
| DE2029086C3 (de) | 1975-12-18 |
| DE2029086A1 (OSRAM) | 1970-12-23 |
| IE34087B1 (en) | 1975-02-05 |
| BE739881A (OSRAM) | 1970-04-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3419379A (en) | Process for coating fertilizer particles with magnesium and calcium phosphates and sulfates and the resulting product | |
| US4846871A (en) | Lignosulfonate treated fertilizer particles | |
| US5032164A (en) | Modified lignosulfonate conditioning agent for urea particles | |
| US8137431B2 (en) | Fertilizer granules and manufacturing process thereof | |
| NO149658B (no) | Fremgangsmaate for fremstilling av stabiliserte ammoniumnitratholdige granuler | |
| US3317276A (en) | Stabilized ammonium nitrate compositions and their production | |
| PL80501B1 (OSRAM) | ||
| JPS6033795B2 (ja) | 不固結性粒状無機肥料およびその製造法 | |
| SE456644B (sv) | Foerfarande foer framstaellning av granuler innehaallande karbamid samt goeds elmedelsblandning med karbamidhaltiga granuler | |
| CA2883362C (en) | Method for limiting the use of an ammonium nitrate fertilizer as a precursor for an explosive and composition therefor | |
| US12103896B2 (en) | Calcium nitrate and potassium nitrate fertiliser particles | |
| US6171358B1 (en) | Calcium nitrate based fertilizer | |
| WO1998004506A1 (en) | Improved ammonium nitrate particulate fertilizer and method for producing the same | |
| CA1190059A (en) | Process for making granules containing urea as the main component | |
| US3981713A (en) | Urea-zinc oxide composition and process | |
| CN109053229A (zh) | 一种防结块水溶性肥料的制备方法 | |
| US3630712A (en) | Stabilized ammonium nitrate compositions | |
| RU2769477C2 (ru) | Улучшение антислеживающих свойств частиц нитрата аммония при хранении в закрытом контейнере | |
| EA008385B1 (ru) | Способ получения нитратсодержащих продуктов из переохлажденных расплавов | |
| US3301658A (en) | Fertilizer | |
| WO1995021689A1 (en) | Granular urea | |
| KR830001391B1 (ko) | 부점결 무기질 비료 | |
| CA3107147A1 (en) | Compositions comprising solid thiosulfates, polysulfides and/or (bi)sulfites with an urea compound and methods for preparing same | |
| JPH0244791B2 (OSRAM) | ||
| PL134740B1 (en) | Method of obtaining granulated ammonium nitrate |