PL80164B1 - - Google Patents
Download PDFInfo
- Publication number
- PL80164B1 PL80164B1 PL1969135130A PL13513069A PL80164B1 PL 80164 B1 PL80164 B1 PL 80164B1 PL 1969135130 A PL1969135130 A PL 1969135130A PL 13513069 A PL13513069 A PL 13513069A PL 80164 B1 PL80164 B1 PL 80164B1
- Authority
- PL
- Poland
- Prior art keywords
- residue
- formula
- compound
- residues
- bis
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 29
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 7
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical group OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 claims description 7
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical compound C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- -1 2,6-dimethylpiperidine compound Chemical class 0.000 claims description 5
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 5
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical group C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 238000002955 isolation Methods 0.000 claims 4
- 125000000547 substituted alkyl group Chemical group 0.000 claims 3
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 2
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical class 0.000 claims 2
- JEGMWWXJUXDNJN-UHFFFAOYSA-N 3-methylpiperidine Chemical compound CC1CCCNC1 JEGMWWXJUXDNJN-UHFFFAOYSA-N 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 31
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 27
- 238000002844 melting Methods 0.000 description 24
- 230000008018 melting Effects 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 7
- 239000011630 iodine Substances 0.000 description 7
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 6
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 6
- 239000002244 precipitate Substances 0.000 description 6
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 239000000829 suppository Substances 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000013543 active substance Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 235000019359 magnesium stearate Nutrition 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 229920001592 potato starch Polymers 0.000 description 3
- 235000010265 sodium sulphite Nutrition 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- 102100022404 E3 ubiquitin-protein ligase Midline-1 Human genes 0.000 description 2
- 101710102210 E3 ubiquitin-protein ligase Midline-1 Proteins 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- 239000003708 ampul Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 2
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 2
- 238000011049 filling Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229940057847 polyethylene glycol 600 Drugs 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Substances C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 239000004334 sorbic acid Substances 0.000 description 2
- 235000010199 sorbic acid Nutrition 0.000 description 2
- 229940075582 sorbic acid Drugs 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- DIZZIOFQEYSTPV-UHFFFAOYSA-N [I].CO Chemical compound [I].CO DIZZIOFQEYSTPV-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 210000001772 blood platelet Anatomy 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-M bromate Inorganic materials [O-]Br(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-M 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- LQYCIOQCKLIHES-UHFFFAOYSA-N pyrimido[5,4-d]pyrimidin-2-amine Chemical compound N1=CN=CC2=NC(N)=NC=C21 LQYCIOQCKLIHES-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19681795030 DE1795030A1 (de) | 1968-07-31 | 1968-07-31 | Neue 2,6-Bis-(diaethanolamino)-pyrimido-[5,4-d]-pyrimidine |
| DE19691933427 DE1933427A1 (de) | 1969-07-01 | 1969-07-01 | Neue 2,6-Bis-alkonolamino-pyrimido[5,4-6]pyrimidine |
| DE19691933428 DE1933428A1 (de) | 1969-07-01 | 1969-07-01 | Neue 2,6-Bis-(diaethanolamino)-pyrimido[5,4-d]pyrimidine |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL80164B1 true PL80164B1 (index.php) | 1975-08-30 |
Family
ID=27181475
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1969135130A PL80164B1 (index.php) | 1968-07-31 | 1969-07-30 |
Country Status (12)
| Country | Link |
|---|---|
| AT (2) | AT296992B (index.php) |
| BE (1) | BE736917A (index.php) |
| CA (1) | CA932331A (index.php) |
| CH (2) | CH529143A (index.php) |
| ES (2) | ES370068A1 (index.php) |
| FR (1) | FR2014089B1 (index.php) |
| GB (1) | GB1237788A (index.php) |
| IL (1) | IL32739A (index.php) |
| NL (1) | NL6911721A (index.php) |
| PL (1) | PL80164B1 (index.php) |
| RO (1) | RO56153A (index.php) |
| SE (1) | SE351849B (index.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2004201A1 (de) * | 1970-01-30 | 1971-08-05 | Thomae Gmbh Dr K | Neue 2,6-Bis(dialkanolamino)-pyrimido-[5,4-d]pyrimidine und Verfahren zu ihrer Herstellung |
| US4963541A (en) * | 1989-02-22 | 1990-10-16 | Abbott Laboratories | Pyrimido-pyrimidine lipoxygenase inhibiting compounds |
-
1969
- 1969-07-28 SE SE10590/69A patent/SE351849B/xx unknown
- 1969-07-30 AT AT735369A patent/AT296992B/de not_active IP Right Cessation
- 1969-07-30 ES ES370068A patent/ES370068A1/es not_active Expired
- 1969-07-30 ES ES370067A patent/ES370067A1/es not_active Expired
- 1969-07-30 PL PL1969135130A patent/PL80164B1/pl unknown
- 1969-07-30 IL IL32739A patent/IL32739A/en unknown
- 1969-07-30 RO RO62642A patent/RO56153A/ro unknown
- 1969-07-30 AT AT388571A patent/AT297717B/de not_active IP Right Cessation
- 1969-07-31 CH CH1187971A patent/CH529143A/de not_active IP Right Cessation
- 1969-07-31 NL NL6911721A patent/NL6911721A/xx unknown
- 1969-07-31 BE BE736917D patent/BE736917A/xx unknown
- 1969-07-31 GB GB38447/69A patent/GB1237788A/en not_active Expired
- 1969-07-31 CH CH1169669D patent/CH513881A/de not_active IP Right Cessation
- 1969-07-31 FR FR6926306A patent/FR2014089B1/fr not_active Expired
- 1969-07-31 CA CA058376A patent/CA932331A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL6911721A (index.php) | 1970-02-03 |
| SU429582A3 (ru) | 1974-05-25 |
| GB1237788A (en) | 1971-06-30 |
| FR2014089A1 (index.php) | 1970-04-10 |
| IL32739A0 (en) | 1969-09-25 |
| AT296992B (de) | 1972-03-10 |
| RO56153A (index.php) | 1974-03-01 |
| IL32739A (en) | 1973-07-30 |
| CH513881A (de) | 1971-10-15 |
| CA932331A (en) | 1973-08-21 |
| FR2014089B1 (index.php) | 1974-08-09 |
| CH529143A (de) | 1972-10-15 |
| ES370068A1 (es) | 1971-04-01 |
| SE351849B (index.php) | 1972-12-11 |
| BE736917A (index.php) | 1970-02-02 |
| ES370067A1 (es) | 1971-04-01 |
| AT297717B (de) | 1972-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3031450A (en) | Substituted pyrimido-[5, 4-d]-pyrimidines | |
| US3475429A (en) | Thieno(3,2-d)pyrimidines and salts thereof | |
| US3382247A (en) | 6-amino-1, 2-dihydro-1-hydroxy-2-imino-4-phenoxypyrimidines | |
| US3318883A (en) | Novel dihydrothieno[3, 2-d]pyrimidines | |
| US3995039A (en) | Pyrazolo [1,5-a] [1,3,5] triazines | |
| GB2034706A (en) | Benzodiazepines | |
| SE447256B (sv) | 2-fenoxialkyl-1,2,4-triazol-3-oner, deras framstellning och farmaceutisk komposition derav | |
| GB2052487A (en) | Pyramidine Compounds and Pharmaceutical Preparations Containing Them | |
| US3016378A (en) | Amino-substituted purine derivatives | |
| US3466274A (en) | Fluoreno-(1,9-ef)-1,4-diazepine-1-oxides and 1,3-diazafluoranthene-1-oxides | |
| HU186107B (en) | Process for preparing imidazo-tetrazine derivatives | |
| IE45700B1 (en) | 1h-pyrazolo (3,4-b) pyridines | |
| PL80164B1 (index.php) | ||
| NZ264133A (en) | 2-[pyrrolidino, piperidino and hexamethyleneimino] substituted pyrimido pyrimidine derivatives and pharmaceutical compositions | |
| HU177422B (en) | Process for preparing new 6-phenyl-s-triazolo/4,3-a/pyrido/2,3-f/ /1,4/-diazepines | |
| DE2121950A1 (en) | Thieno(3,2-d)pyrimidine derivs - with thrombocyte aggregation inhibiting activity | |
| US3133056A (en) | N-phenylpiperazine derivatives of tetrahydrobenzodiazepines | |
| Carrington et al. | Synthetic antimalarials. Part XLIX. The structure and synthesis of the dihydrotriazine metabolite of proguanil | |
| US3530140A (en) | Certain pyridyl-hydrazino-2-yl-imidazolines | |
| NZ207981A (en) | Pyrimidones and pharmaceutical compositions | |
| US3046276A (en) | S-triazolo-[2, 3-c] pyrimidine derivatives | |
| CA2002531A1 (en) | 1,2,3,4-tetrahydro-1,9-acridinediamines, a process for their preparation and their use as medicaments | |
| US3239527A (en) | Diazines and a process for their preparation | |
| US3850917A (en) | 5,7-diamino-substituted thiazolo(5,4-d)pyrimidines and salts thereof | |
| US2980677A (en) | Certificate of correction |