PL72734B1 - - Google Patents
Download PDFInfo
- Publication number
- PL72734B1 PL72734B1 PL1970141807A PL14180770A PL72734B1 PL 72734 B1 PL72734 B1 PL 72734B1 PL 1970141807 A PL1970141807 A PL 1970141807A PL 14180770 A PL14180770 A PL 14180770A PL 72734 B1 PL72734 B1 PL 72734B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- general formula
- wzdr
- och
- substituted
- Prior art date
Links
- -1 hydroxyl compound Chemical class 0.000 claims description 21
- 238000002360 preparation method Methods 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 10
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 125000004423 acyloxy group Chemical group 0.000 claims description 4
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical compound OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 claims description 4
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 3
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 claims description 2
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 150000002148 esters Chemical class 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical compound [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 24
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 18
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 16
- 239000000243 solution Substances 0.000 description 13
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 229910000027 potassium carbonate Inorganic materials 0.000 description 12
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000003756 stirring Methods 0.000 description 9
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 8
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000000746 purification Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000012043 crude product Substances 0.000 description 6
- 238000000354 decomposition reaction Methods 0.000 description 6
- 150000002168 ethanoic acid esters Chemical class 0.000 description 6
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- SDQJTWBNWQABLE-UHFFFAOYSA-N 1h-quinazoline-2,4-dione Chemical compound C1=CC=C2C(=O)NC(=O)NC2=C1 SDQJTWBNWQABLE-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 description 4
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 3
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 3
- 239000008280 blood Substances 0.000 description 3
- 210000004369 blood Anatomy 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 210000004351 coronary vessel Anatomy 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical class NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 2
- BUHYMJLFRZAFBF-UHFFFAOYSA-N 3,4,5-trimethoxybenzoyl chloride Chemical compound COC1=CC(C(Cl)=O)=CC(OC)=C1OC BUHYMJLFRZAFBF-UHFFFAOYSA-N 0.000 description 2
- VEXDRERIMPLZLU-UHFFFAOYSA-N 3-hydroxy-2-methylbutanoic acid Chemical compound CC(O)C(C)C(O)=O VEXDRERIMPLZLU-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000004872 arterial blood pressure Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- JMGOXQQBZOMKFG-UHFFFAOYSA-N methyl 2-isocyanato-3,4,5-trimethoxybenzoate Chemical compound COC1=C(C(=CC(=C1OC)OC)C(=O)OC)N=C=O JMGOXQQBZOMKFG-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 150000003335 secondary amines Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 210000003462 vein Anatomy 0.000 description 2
- UYBWIEGTWASWSR-UHFFFAOYSA-N 1,3-diaminopropan-2-ol Chemical compound NCC(O)CN UYBWIEGTWASWSR-UHFFFAOYSA-N 0.000 description 1
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- CFECMQYNBQYDRQ-UHFFFAOYSA-N 1-n,1-n-diethyl-2-n-methylpropane-1,2-diamine Chemical compound CCN(CC)CC(C)NC CFECMQYNBQYDRQ-UHFFFAOYSA-N 0.000 description 1
- XNIOWJUQPMKCIJ-UHFFFAOYSA-N 2-(benzylamino)ethanol Chemical compound OCCNCC1=CC=CC=C1 XNIOWJUQPMKCIJ-UHFFFAOYSA-N 0.000 description 1
- LJDSTRZHPWMDPG-UHFFFAOYSA-N 2-(butylamino)ethanol Chemical compound CCCCNCCO LJDSTRZHPWMDPG-UHFFFAOYSA-N 0.000 description 1
- RILLZYSZSDGYGV-UHFFFAOYSA-N 2-(propan-2-ylamino)ethanol Chemical compound CC(C)NCCO RILLZYSZSDGYGV-UHFFFAOYSA-N 0.000 description 1
- OUXTUSBMHNCHLI-UHFFFAOYSA-N 2-amino-3,4,5-trimethoxybenzamide Chemical compound COC1=CC(C(N)=O)=C(N)C(OC)=C1OC OUXTUSBMHNCHLI-UHFFFAOYSA-N 0.000 description 1
- DSSFSAGQNGRBOR-UHFFFAOYSA-N 2-piperazin-2-ylethanol Chemical compound OCCC1CNCCN1 DSSFSAGQNGRBOR-UHFFFAOYSA-N 0.000 description 1
- JUICNMLFNLOFMZ-UHFFFAOYSA-N 3,4,5-triethoxybenzoyl chloride Chemical compound CCOC1=CC(C(Cl)=O)=CC(OCC)=C1OCC JUICNMLFNLOFMZ-UHFFFAOYSA-N 0.000 description 1
- KRGXWTOLFOPIKV-UHFFFAOYSA-N 3-(methylamino)propan-1-ol Chemical compound CNCCCO KRGXWTOLFOPIKV-UHFFFAOYSA-N 0.000 description 1
- RSOVYHJBOYUBKJ-UHFFFAOYSA-N 3-ethoxy-n-methylpropan-1-amine Chemical compound CCOCCCNC RSOVYHJBOYUBKJ-UHFFFAOYSA-N 0.000 description 1
- HJELPNLGHMWKQT-UHFFFAOYSA-N 3-methoxy-n-methylpropan-1-amine Chemical compound CNCCCOC HJELPNLGHMWKQT-UHFFFAOYSA-N 0.000 description 1
- 101150010783 Aard gene Proteins 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 206010005746 Blood pressure fluctuation Diseases 0.000 description 1
- FWDBZJBJTDRIIY-UHFFFAOYSA-N CC(C)(C)[K] Chemical compound CC(C)(C)[K] FWDBZJBJTDRIIY-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- 206010041349 Somnolence Diseases 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 125000005263 alkylenediamine group Chemical group 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 230000017531 blood circulation Effects 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 230000003205 diastolic effect Effects 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- 230000000916 dilatatory effect Effects 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 231100000518 lethal Toxicity 0.000 description 1
- 230000001665 lethal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- MKDYQLJYEBWUIG-UHFFFAOYSA-N n',n'-diethyl-n-methylethane-1,2-diamine Chemical compound CCN(CC)CCNC MKDYQLJYEBWUIG-UHFFFAOYSA-N 0.000 description 1
- RIWRFSMVIUAEBX-UHFFFAOYSA-N n-methyl-1-phenylmethanamine Chemical compound CNCC1=CC=CC=C1 RIWRFSMVIUAEBX-UHFFFAOYSA-N 0.000 description 1
- SASNBVQSOZSTPD-UHFFFAOYSA-N n-methylphenethylamine Chemical compound CNCCC1=CC=CC=C1 SASNBVQSOZSTPD-UHFFFAOYSA-N 0.000 description 1
- IOXXVNYDGIXMIP-UHFFFAOYSA-N n-methylprop-2-en-1-amine Chemical compound CNCC=C IOXXVNYDGIXMIP-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- SSOLNOMRVKKSON-UHFFFAOYSA-N proguanil Chemical compound CC(C)\N=C(/N)N=C(N)NC1=CC=C(Cl)C=C1 SSOLNOMRVKKSON-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- BRNULMACUQOKMR-UHFFFAOYSA-N thiomorpholine Chemical compound C1CSCCN1 BRNULMACUQOKMR-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/95—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in positions 2 and 4
- C07D239/96—Two oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19691934036 DE1934036A1 (de) | 1969-07-04 | 1969-07-04 | Basisch substituierte Derivate des 2,4-(1H,3H)-Chinazolindions |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL72734B1 true PL72734B1 (enExample) | 1974-08-30 |
Family
ID=5738912
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970141807A PL72734B1 (enExample) | 1969-07-04 | 1970-07-03 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3740398A (enExample) |
| AT (2) | AT296999B (enExample) |
| BE (1) | BE753009A (enExample) |
| BG (2) | BG17777A3 (enExample) |
| BR (1) | BR6915287D0 (enExample) |
| CA (1) | CA949971A (enExample) |
| CH (2) | CH551981A (enExample) |
| CS (1) | CS167924B2 (enExample) |
| DE (1) | DE1934036A1 (enExample) |
| DK (1) | DK124683B (enExample) |
| ES (2) | ES381403A1 (enExample) |
| FR (1) | FR2059481B1 (enExample) |
| GB (1) | GB1311543A (enExample) |
| IE (1) | IE34309B1 (enExample) |
| IL (1) | IL34741A (enExample) |
| NL (1) | NL7009211A (enExample) |
| NO (1) | NO127580B (enExample) |
| PL (1) | PL72734B1 (enExample) |
| RO (2) | RO62415A (enExample) |
| ZA (1) | ZA704558B (enExample) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1204071B (de) * | 1957-06-15 | 1965-10-28 | Dr Hans Thoma | Lagerung der Triebwelle einer Druckfluessigkeits-Axialkolbenmaschine |
| DE2050640A1 (de) * | 1970-10-15 | 1972-04-20 | Cassella Farbwerke Mainkur Ag, 6000 Frankfurt | Basisch substituierte Derivate des (lH,3H)-Chinazolin-2-thion-4-ons |
| US4263220A (en) * | 1979-02-02 | 1981-04-21 | The Dow Chemical Company | Alkylene dicyanates |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3274194A (en) * | 1963-03-29 | 1966-09-20 | Miles Lab | Quinazolinedione derivatives |
-
1969
- 1969-07-04 DE DE19691934036 patent/DE1934036A1/de active Pending
- 1969-12-17 BR BR215287/69A patent/BR6915287D0/pt unknown
-
1970
- 1970-06-16 IE IE782/70A patent/IE34309B1/xx unknown
- 1970-06-17 IL IL34741A patent/IL34741A/en unknown
- 1970-06-23 NL NL7009211A patent/NL7009211A/xx unknown
- 1970-06-23 BG BG014998A patent/BG17777A3/xx unknown
- 1970-06-23 BG BG016572A patent/BG17572A3/xx unknown
- 1970-06-25 DK DK331670AA patent/DK124683B/da unknown
- 1970-06-25 US US00049923A patent/US3740398A/en not_active Expired - Lifetime
- 1970-07-02 RO RO7000069978A patent/RO62415A/ro unknown
- 1970-07-02 RO RO63817A patent/RO57547A/ro unknown
- 1970-07-03 GB GB3238470A patent/GB1311543A/en not_active Expired
- 1970-07-03 ES ES381403A patent/ES381403A1/es not_active Expired
- 1970-07-03 FR FR7024774A patent/FR2059481B1/fr not_active Expired
- 1970-07-03 CA CA087,172A patent/CA949971A/en not_active Expired
- 1970-07-03 PL PL1970141807A patent/PL72734B1/pl unknown
- 1970-07-03 AT AT603670A patent/AT296999B/de not_active IP Right Cessation
- 1970-07-03 ES ES381402A patent/ES381402A1/es not_active Expired
- 1970-07-03 CH CH1013970A patent/CH551981A/xx not_active IP Right Cessation
- 1970-07-03 AT AT603570A patent/AT297711B/de not_active IP Right Cessation
- 1970-07-03 ZA ZA704558A patent/ZA704558B/xx unknown
- 1970-07-03 BE BE753009D patent/BE753009A/xx unknown
- 1970-07-03 CH CH1013870A patent/CH551980A/xx not_active IP Right Cessation
- 1970-07-03 NO NO02638/70A patent/NO127580B/no unknown
- 1970-07-06 CS CS4715A patent/CS167924B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE753009A (fr) | 1971-01-04 |
| ZA704558B (en) | 1971-03-31 |
| CH551980A (de) | 1974-07-31 |
| IL34741A0 (en) | 1970-08-19 |
| DE1934036A1 (de) | 1971-01-07 |
| ES381402A1 (es) | 1973-04-01 |
| NO127580B (enExample) | 1973-07-16 |
| DK124683B (da) | 1972-11-13 |
| BR6915287D0 (pt) | 1973-04-19 |
| FR2059481A1 (enExample) | 1971-06-04 |
| FR2059481B1 (enExample) | 1974-03-22 |
| NL7009211A (enExample) | 1971-01-06 |
| RO57547A (enExample) | 1975-02-15 |
| IE34309L (en) | 1971-01-04 |
| BG17777A3 (bg) | 1973-12-25 |
| GB1311543A (en) | 1973-03-28 |
| AT296999B (de) | 1972-03-10 |
| BG17572A3 (bg) | 1973-11-10 |
| ES381403A1 (es) | 1973-03-16 |
| RO62415A (fr) | 1977-10-15 |
| AT297711B (de) | 1972-04-10 |
| CH551981A (de) | 1974-07-31 |
| IE34309B1 (en) | 1975-04-02 |
| US3740398A (en) | 1973-06-19 |
| CS167924B2 (enExample) | 1976-05-28 |
| IL34741A (en) | 1973-03-30 |
| CA949971A (en) | 1974-06-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3994890A (en) | 1-Aminoalkyl, 3-phenyl indazoles | |
| PL69767B1 (en) | 11-substituted 5 11-dihydro-6h-pyrido(2 3-b)(1 4)benzodiazepin-6-ones [us3660380a] | |
| DE2245159A1 (de) | Stickstoffhaltige heterocyclische verbindungen | |
| US3192204A (en) | Trifluoromethylthiaxanthene and -xanthene derivatives | |
| US3939161A (en) | 1,3-Dimethyl- 1H-pyrazolo(4,3-D) pyrimidine-7 (6H)-ones | |
| US3980655A (en) | Basically substituted 1,4-dihydro-2H-isoquinoline derivatives and process for preparing them | |
| US3748327A (en) | Basically substituted 4(3h)-quinazolinone derivatives | |
| US4472400A (en) | Triazoloquinazolones having antihistaminic and bronchospasmolytic activity | |
| PL72734B1 (enExample) | ||
| US3118884A (en) | Derivatives of 3-azaphenothiazine and 3-azaphenoxazine | |
| EP0010398B1 (en) | Isatin derivatives, processes for the preparation thereof and pharmaceutical composition comprising the same | |
| AU674167B2 (en) | Benzopyranones, method of preparing them and their use | |
| US3845052A (en) | Basically substituted 1(2h)-phthalazinone derivatives | |
| US3291808A (en) | Naphthalene diamine compounds and methods for their production | |
| US3963735A (en) | Acylated 2-aminothiazole derivatives | |
| US3759907A (en) | 3 - (alpha-substituted amino-beta-alkoxybenzoxypropyl)-6,7- or 6,7,8-alkoxy - 1,2,3-benzotriazine-4(3h)-ones | |
| US3316249A (en) | Part a.xmethyl n n-(z-diethylaminoethyl)-n-(z- nitrophenyl) anthranilate hydrochloride | |
| RU2022965C1 (ru) | Производные дигидропиримидотиазина или их терапевтически приемлемые соли присоединения кислоты, обладающие противоангинной и антивоспалительной активностью | |
| CA1085847A (en) | Piperazine derivatives, a process for their preparation and their applications | |
| DE1770466A1 (de) | 3-(omega-aminoalkyl)-4-substituierte 1,3-Benzoxazin-2-one und Verfahren zu ihrer Herstellung | |
| US3946018A (en) | 1,4-Dihydro-3 (2H)-isoquinolinone derivatives | |
| DE1926076A1 (de) | Basisch substituierte Derivate des 1,2,3-Benzotriazin-4(3H)-ons | |
| US3770733A (en) | Novel therapeutically active dihydrobenzothiazine-s-dioxides and processes for preparing them | |
| US3933805A (en) | S(IV)-benzo-1,2,4-thiadiazine compounds and process for their preparation | |
| US3738985A (en) | Certain 3-(3-amino-2-benzoyloxypropyl)-4(3h)-quinazolinones |