PL70931B1 - - Google Patents
Download PDFInfo
- Publication number
- PL70931B1 PL70931B1 PL1970137991A PL13799170A PL70931B1 PL 70931 B1 PL70931 B1 PL 70931B1 PL 1970137991 A PL1970137991 A PL 1970137991A PL 13799170 A PL13799170 A PL 13799170A PL 70931 B1 PL70931 B1 PL 70931B1
- Authority
- PL
- Poland
- Prior art keywords
- amount
- metal
- catalyst
- content
- polymerization
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 claims description 69
- 229910052751 metal Inorganic materials 0.000 claims description 56
- 239000002184 metal Substances 0.000 claims description 56
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 claims description 46
- -1 hydrocarbyl radical Chemical group 0.000 claims description 35
- 238000006116 polymerization reaction Methods 0.000 claims description 29
- 239000004698 Polyethylene Substances 0.000 claims description 25
- 150000001875 compounds Chemical class 0.000 claims description 22
- 230000003197 catalytic effect Effects 0.000 claims description 20
- 239000011777 magnesium Substances 0.000 claims description 20
- 238000000034 method Methods 0.000 claims description 20
- 229920000573 polyethylene Polymers 0.000 claims description 20
- 229910052736 halogen Inorganic materials 0.000 claims description 18
- 150000002367 halogens Chemical class 0.000 claims description 17
- 239000007787 solid Substances 0.000 claims description 14
- 229910052782 aluminium Inorganic materials 0.000 claims description 12
- 229910052749 magnesium Inorganic materials 0.000 claims description 12
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 11
- 239000005977 Ethylene Substances 0.000 claims description 11
- 150000002926 oxygen Chemical class 0.000 claims description 10
- 239000002904 solvent Substances 0.000 claims description 10
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 9
- 150000002902 organometallic compounds Chemical class 0.000 claims description 9
- 239000011575 calcium Substances 0.000 claims description 8
- 238000007334 copolymerization reaction Methods 0.000 claims description 8
- 230000000737 periodic effect Effects 0.000 claims description 8
- 150000001336 alkenes Chemical class 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 6
- 229910052791 calcium Inorganic materials 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000008096 xylene Substances 0.000 claims description 6
- 239000011701 zinc Substances 0.000 claims description 6
- 229910052725 zinc Inorganic materials 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 5
- 150000004703 alkoxides Chemical class 0.000 claims description 5
- 125000004429 atom Chemical group 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- 150000004820 halides Chemical class 0.000 claims description 5
- 229910052744 lithium Inorganic materials 0.000 claims description 5
- 239000011734 sodium Substances 0.000 claims description 5
- 229910052708 sodium Inorganic materials 0.000 claims description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229910052796 boron Inorganic materials 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 239000011572 manganese Substances 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 150000002927 oxygen compounds Chemical class 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 2
- 238000009826 distribution Methods 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- KTOQRRDVVIDEAA-UHFFFAOYSA-N 2-methylpropane Chemical compound [CH2]C(C)C KTOQRRDVVIDEAA-UHFFFAOYSA-N 0.000 claims 4
- KUGRPPRAQNPSQD-UHFFFAOYSA-N OOOOO Chemical compound OOOOO KUGRPPRAQNPSQD-UHFFFAOYSA-N 0.000 claims 2
- RSPISYXLHRIGJD-UHFFFAOYSA-N OOOO Chemical compound OOOO RSPISYXLHRIGJD-UHFFFAOYSA-N 0.000 claims 1
- JLNTWVDSQRNWFU-UHFFFAOYSA-N OOOOOOO Chemical compound OOOOOOO JLNTWVDSQRNWFU-UHFFFAOYSA-N 0.000 claims 1
- CQGRLHBOVUGVEA-UHFFFAOYSA-N OOOOOOOOOOOOOOO Chemical compound OOOOOOOOOOOOOOO CQGRLHBOVUGVEA-UHFFFAOYSA-N 0.000 claims 1
- 229910010386 TiI4 Inorganic materials 0.000 claims 1
- 230000001186 cumulative effect Effects 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims 1
- 150000003254 radicals Chemical class 0.000 claims 1
- NLLZTRMHNHVXJJ-UHFFFAOYSA-J titanium tetraiodide Chemical compound I[Ti](I)(I)I NLLZTRMHNHVXJJ-UHFFFAOYSA-J 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 23
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 239000010936 titanium Substances 0.000 description 18
- 230000000694 effects Effects 0.000 description 12
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 11
- 229910003074 TiCl4 Inorganic materials 0.000 description 10
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 8
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 8
- 239000007788 liquid Substances 0.000 description 6
- 150000002739 metals Chemical class 0.000 description 5
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 5
- 238000005406 washing Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 4
- 229910010062 TiCl3 Inorganic materials 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 229910001507 metal halide Inorganic materials 0.000 description 4
- 229910052719 titanium Inorganic materials 0.000 description 4
- YONPGGFAJWQGJC-UHFFFAOYSA-K titanium(iii) chloride Chemical compound Cl[Ti](Cl)Cl YONPGGFAJWQGJC-UHFFFAOYSA-K 0.000 description 4
- MCULRUJILOGHCJ-UHFFFAOYSA-N triisobutylaluminium Chemical compound CC(C)C[Al](CC(C)C)CC(C)C MCULRUJILOGHCJ-UHFFFAOYSA-N 0.000 description 4
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 150000004678 hydrides Chemical class 0.000 description 3
- 150000005309 metal halides Chemical class 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- 229910000831 Steel Inorganic materials 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 description 2
- 125000003710 aryl alkyl group Chemical group 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002431 hydrogen Chemical class 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 229910001629 magnesium chloride Inorganic materials 0.000 description 2
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 description 2
- 239000010959 steel Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 2
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 2
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- 101100494773 Caenorhabditis elegans ctl-2 gene Proteins 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 101100112369 Fasciola hepatica Cat-1 gene Proteins 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 101100005271 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) cat-1 gene Proteins 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- RLWYTFZKQOKDFG-UHFFFAOYSA-N [Mg].CCO Chemical compound [Mg].CCO RLWYTFZKQOKDFG-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- JHLCADGWXYCDQA-UHFFFAOYSA-N calcium;ethanolate Chemical compound [Ca+2].CC[O-].CC[O-] JHLCADGWXYCDQA-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 150000001804 chlorine Chemical class 0.000 description 1
- WQAJKGNQVZTJAE-UHFFFAOYSA-M chloro(diethoxy)alumane Chemical compound [Cl-].CCO[Al+]OCC WQAJKGNQVZTJAE-UHFFFAOYSA-M 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- NPEFICOHWIZPMC-UHFFFAOYSA-L dichloroalumanylium;ethanolate Chemical compound [Cl-].[Cl-].CCO[Al+2] NPEFICOHWIZPMC-UHFFFAOYSA-L 0.000 description 1
- YNLAOSYQHBDIKW-UHFFFAOYSA-M diethylaluminium chloride Chemical compound CC[Al](Cl)CC YNLAOSYQHBDIKW-UHFFFAOYSA-M 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- STFIPKUMPPXPDT-UHFFFAOYSA-N ethanolate;manganese(2+) Chemical compound [Mn+2].CC[O-].CC[O-] STFIPKUMPPXPDT-UHFFFAOYSA-N 0.000 description 1
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 1
- IRGXVHXPGJJQOU-UHFFFAOYSA-N ethene;zinc Chemical compound [Zn].C=C IRGXVHXPGJJQOU-UHFFFAOYSA-N 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 235000012254 magnesium hydroxide Nutrition 0.000 description 1
- KRPXAHXWPZLBKL-UHFFFAOYSA-L magnesium;diphenoxide Chemical compound [Mg+2].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 KRPXAHXWPZLBKL-UHFFFAOYSA-L 0.000 description 1
- SWMSUKCRKOWDGN-UHFFFAOYSA-M magnesium;ethanolate;bromide Chemical compound [Br-].CCO[Mg+] SWMSUKCRKOWDGN-UHFFFAOYSA-M 0.000 description 1
- ZHLDMBMNKCIBQN-UHFFFAOYSA-M magnesium;methanolate;chloride Chemical compound [Cl-].CO[Mg+] ZHLDMBMNKCIBQN-UHFFFAOYSA-M 0.000 description 1
- FHFHPENPORXWHG-UHFFFAOYSA-N magnesium;phenol Chemical class [Mg].OC1=CC=CC=C1 FHFHPENPORXWHG-UHFFFAOYSA-N 0.000 description 1
- LWJROJCJINYWOX-UHFFFAOYSA-L mercury dichloride Chemical compound Cl[Hg]Cl LWJROJCJINYWOX-UHFFFAOYSA-L 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229960005235 piperonyl butoxide Drugs 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- OGHBATFHNDZKSO-UHFFFAOYSA-N propan-2-olate Chemical compound CC(C)[O-] OGHBATFHNDZKSO-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000004451 qualitative analysis Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011949 solid catalyst Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- UBZYKBZMAMTNKW-UHFFFAOYSA-J titanium tetrabromide Chemical compound Br[Ti](Br)(Br)Br UBZYKBZMAMTNKW-UHFFFAOYSA-J 0.000 description 1
- PGPVJNIERCISDC-UHFFFAOYSA-N titanium(4+);2,2,2-trichloroethanolate Chemical compound [Ti+4].[O-]CC(Cl)(Cl)Cl.[O-]CC(Cl)(Cl)Cl.[O-]CC(Cl)(Cl)Cl.[O-]CC(Cl)(Cl)Cl PGPVJNIERCISDC-UHFFFAOYSA-N 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- XBEXIHMRFRFRAM-UHFFFAOYSA-N tridodecylalumane Chemical compound CCCCCCCCCCCC[Al](CCCCCCCCCCCC)CCCCCCCCCCCC XBEXIHMRFRFRAM-UHFFFAOYSA-N 0.000 description 1
- LFXVBWRMVZPLFK-UHFFFAOYSA-N trioctylalumane Chemical compound CCCCCCCC[Al](CCCCCCCC)CCCCCCCC LFXVBWRMVZPLFK-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB706/69A GB1275641A (en) | 1969-01-06 | 1969-01-06 | Catalysts for the polymerisation and copolymerisation of olefins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL70931B1 true PL70931B1 (enExample) | 1974-04-30 |
Family
ID=9709124
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1970137991A PL70931B1 (enExample) | 1969-01-06 | 1970-01-05 |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4250284A (enExample) |
| AT (1) | AT295135B (enExample) |
| BE (1) | BE743325A (enExample) |
| CA (1) | CA950600A (enExample) |
| CH (1) | CH514351A (enExample) |
| CS (1) | CS167271B2 (enExample) |
| DE (1) | DE2000566C2 (enExample) |
| DK (1) | DK130469B (enExample) |
| ES (1) | ES375152A1 (enExample) |
| FR (1) | FR2027788A1 (enExample) |
| GB (1) | GB1275641A (enExample) |
| IE (1) | IE33938B1 (enExample) |
| NL (1) | NL162663C (enExample) |
| NO (1) | NO133840C (enExample) |
| OA (1) | OA03197A (enExample) |
| PL (1) | PL70931B1 (enExample) |
| RO (1) | RO61031A (enExample) |
| SU (1) | SU415850A3 (enExample) |
| ZA (1) | ZA698988B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| LU61816A1 (enExample) * | 1970-10-06 | 1972-06-28 | ||
| LU61899A1 (enExample) | 1970-10-20 | 1972-06-28 | ||
| NL161467C (nl) | 1970-12-02 | 1980-02-15 | Stamicarbon | Werkwijze voor het polymeriseren van etheen. |
| US3989880A (en) * | 1971-02-18 | 1976-11-02 | Solvay & Cie | Catalyst and process for the polymerization of olefins |
| US3989879A (en) | 1971-02-25 | 1976-11-02 | Solvay & Cie | Process and catalysts for the polymerization and copolymerization of olefins |
| US3907759A (en) * | 1972-10-06 | 1975-09-23 | Nissan Chemical Ind Ltd | Catalyst for polymerization of olefins and process for polymerization of olefins with use of said catalyst |
| FR2202899B1 (enExample) * | 1972-10-13 | 1977-01-14 | Ethylene Plastique Sa | |
| US4258159A (en) | 1972-11-24 | 1981-03-24 | Solvay & Cie | Process for the polymerization of olefins |
| FR2212346B1 (enExample) | 1972-12-28 | 1978-12-01 | Nippon Oil Co Ltd | |
| GB1489599A (en) * | 1973-10-09 | 1977-10-19 | Nippon Oil Co Ltd | Process for preparing polyolefins and catalyst and catalyst component therefor |
| NL7503081A (nl) * | 1974-03-21 | 1975-09-23 | Hoechst Ag | Werkwijze voor het bereiden van een gemengde katalysator. |
| US4209602A (en) * | 1975-01-10 | 1980-06-24 | Nippon Oil Company, Limited | Process for the production of polyolefins |
| US4209601A (en) * | 1975-01-10 | 1980-06-24 | Nippon Oil Company, Limited | Process for the production of polyolefins |
| JPS5285278A (en) * | 1976-01-09 | 1977-07-15 | Nippon Oil Co Ltd | Production of polyolefin |
| JPS5948003B2 (ja) * | 1976-06-02 | 1984-11-22 | 三井化学株式会社 | ポリオレフイン類の製造方法 |
| JPS5339991A (en) * | 1976-09-27 | 1978-04-12 | Mitsui Petrochem Ind Ltd | Production of titanium catalyst component |
| JPS5373279A (en) * | 1976-12-13 | 1978-06-29 | Mitsubishi Chem Ind Ltd | Preparation of olefin polymer |
| GB1569228A (en) * | 1976-12-13 | 1980-06-11 | Mitsubishi Chem Ind | Process for the polymerisation of olefins and catalyst therefor |
| US4242479A (en) * | 1976-12-23 | 1980-12-30 | Showa Yuka Kabushiki Kaisha | Process for producing an improved ethylenic polymer |
| JPS5447783A (en) * | 1977-09-22 | 1979-04-14 | Nissan Chem Ind Ltd | Preparation of ethylene polymer |
| DE2906639C2 (de) * | 1979-02-21 | 1982-03-25 | Chemische Werke Hüls AG, 4370 Marl | Verfahren zur Herstellung von weitgehend amorphen Ho mo- und/oder Copolymerisaten von α-Olefinen mit 3-3 2 Kohlenstoffatomen |
| US4246383A (en) | 1979-06-25 | 1981-01-20 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from an organomagnesium component which does not reduce TiCl4 |
| US4244838A (en) | 1979-06-25 | 1981-01-13 | The Dow Chemical Company | High efficiency catalyst for polymerizing olefins |
| DE3032224C2 (de) * | 1980-08-27 | 1985-03-28 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur Homo- und Mischpolymerisation von α-Olefinen |
| US4496660A (en) * | 1980-10-01 | 1985-01-29 | The Dow Chemical Company | Catalyst prepared from organo-magnesium compound; oxygen- or nitrogen-containing compound; halide source; transition metal compound and reducing agent |
| DE3124222A1 (de) * | 1981-06-20 | 1983-02-03 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung eines polyolefins und katalysator hierfuer |
| DE3124223A1 (de) * | 1981-06-20 | 1982-12-30 | Hoechst Ag, 6000 Frankfurt | "verfahren zur herstellung eines polyolefins und katalysator hierfuer" |
| DE3124350A1 (de) * | 1981-06-20 | 1983-01-05 | Hoechst Ag, 6000 Frankfurt | "verfahren zur herstellung eines polyolefins und katalysator hierfuer" |
| DE3219117A1 (de) * | 1982-05-21 | 1983-11-24 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung einer katalysatorkomponente und ihre verwendung fuer die polymerisation von olefinen |
| US4526943A (en) * | 1982-07-29 | 1985-07-02 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4544647A (en) * | 1982-07-29 | 1985-10-01 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4426316A (en) | 1982-09-10 | 1984-01-17 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4605715A (en) * | 1982-09-20 | 1986-08-12 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4604374A (en) * | 1982-09-20 | 1986-08-05 | The Dow Chemical Company | Catalyst prepared from organomagnesium compound, epihalohydrin reducing halide source and transition metal compound |
| US4434282A (en) | 1982-10-04 | 1984-02-28 | The Dow Chemical Company | Process for polymerizing olefins |
| US4783512A (en) * | 1985-05-20 | 1988-11-08 | The Dow Chemical Company | Process for polymerizing olefins in the presence of a catalyst prepared from organomagnesium compound, organic hydroxyl-containing compound, reducing halide source and transition metal compound |
| US4661465A (en) * | 1985-10-31 | 1987-04-28 | The Dow Chemical Company | Method for preparing transition metal component of Ziegler-Natta catalysts |
| JPH06104693B2 (ja) † | 1986-01-06 | 1994-12-21 | 東邦チタニウム株式会社 | オレフイン類重合用触媒 |
| US4855371A (en) * | 1986-06-18 | 1989-08-08 | Shell Oil Company | Process for polymerizing olefins with a crystalline magnesium catalyst component |
| US5045612A (en) * | 1990-04-18 | 1991-09-03 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| US5114897A (en) * | 1990-04-18 | 1992-05-19 | The Dow Chemical Company | Catalyst and process for polymerizing olefins |
| ES2101113T3 (es) * | 1992-05-28 | 1997-07-01 | Idemitsu Petrochemical Co | Procedimiento de produccion de poliolefina. |
| FR2802833B1 (fr) * | 1999-12-24 | 2002-05-10 | Inst Francais Du Petrole | Composition catalytique et procede pour l'oligomerisation de l'ethylene, en particulier en hexene-1 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1420271B2 (de) * | 1958-05-09 | 1971-08-19 | Chemische Werke Hüls AG, 4370 Mari | Verfahren zur herstellung von polyaethylen |
| NL135604C (enExample) * | 1965-06-25 | |||
| NL137056C (enExample) * | 1966-10-21 | |||
| US3644318A (en) * | 1968-08-21 | 1972-02-22 | Hoechst Ag | Process for the polymerization of olefins |
| US3642760A (en) * | 1968-10-14 | 1972-02-15 | Solvay | Polymerization and copolymerization of diolefins |
-
1969
- 1969-01-06 GB GB706/69A patent/GB1275641A/en not_active Expired
- 1969-12-18 BE BE743325D patent/BE743325A/xx not_active IP Right Cessation
- 1969-12-22 FR FR6944529A patent/FR2027788A1/fr active Pending
- 1969-12-29 ZA ZA698988*A patent/ZA698988B/xx unknown
- 1969-12-30 OA OA53817A patent/OA03197A/xx unknown
- 1969-12-30 CH CH1946769A patent/CH514351A/fr not_active IP Right Cessation
-
1970
- 1970-01-02 IE IE8/70A patent/IE33938B1/xx unknown
- 1970-01-03 ES ES375152A patent/ES375152A1/es not_active Expired
- 1970-01-05 CA CA071,445*7A patent/CA950600A/en not_active Expired
- 1970-01-05 DK DK2270AA patent/DK130469B/da unknown
- 1970-01-05 CS CS70*BA patent/CS167271B2/cs unknown
- 1970-01-05 PL PL1970137991A patent/PL70931B1/pl unknown
- 1970-01-05 NO NO19/70A patent/NO133840C/no unknown
- 1970-01-06 RO RO62054A patent/RO61031A/ro unknown
- 1970-01-06 SU SU1493271A patent/SU415850A3/ru active
- 1970-01-06 NL NL7000094.A patent/NL162663C/xx not_active IP Right Cessation
- 1970-01-07 DE DE2000566A patent/DE2000566C2/de not_active Expired
- 1970-01-07 AT AT12470A patent/AT295135B/de not_active IP Right Cessation
-
1975
- 1975-02-24 US US05/552,335 patent/US4250284A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| ZA698988B (en) | 1971-07-28 |
| IE33938L (en) | 1970-07-06 |
| DE2000566A1 (de) | 1970-11-12 |
| ES375152A1 (es) | 1972-05-16 |
| GB1275641A (en) | 1972-05-24 |
| SU415850A3 (enExample) | 1974-02-15 |
| CS167271B2 (enExample) | 1976-04-29 |
| IE33938B1 (en) | 1974-12-11 |
| AT295135B (de) | 1971-12-27 |
| OA03197A (fr) | 1970-12-15 |
| US4250284A (en) | 1981-02-10 |
| NL7000094A (enExample) | 1970-07-08 |
| DK130469C (enExample) | 1975-07-21 |
| NL162663C (nl) | 1980-06-16 |
| NL162663B (nl) | 1980-01-15 |
| FR2027788A1 (enExample) | 1970-10-02 |
| NO133840C (enExample) | 1976-07-07 |
| NO133840B (enExample) | 1976-03-29 |
| DE2000566C2 (de) | 1986-05-22 |
| BE743325A (enExample) | 1970-06-18 |
| CA950600A (en) | 1974-07-02 |
| RO61031A (enExample) | 1976-11-15 |
| DK130469B (da) | 1975-02-24 |
| CH514351A (fr) | 1971-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL70931B1 (enExample) | ||
| US4244838A (en) | High efficiency catalyst for polymerizing olefins | |
| EP0055589B1 (en) | Catalyst for polymerization of olefins and polymerization process using the catalyst | |
| US4124532A (en) | Catalysts for polymerizing olefins | |
| CA1080206A (en) | Olefin polymerization catalyst | |
| JP4306807B2 (ja) | オレフィンの重合用成分および触媒 | |
| CA1226872A (en) | Titanium complexes and catalysts prepared therefrom | |
| US4246383A (en) | Process for polymerizing olefins in the presence of a catalyst prepared from an organomagnesium component which does not reduce TiCl4 | |
| EP0083074B1 (en) | New catalyst components for the polymerization of ethylene and of mixtures thereof with olefins and catalysts obtained therefrom | |
| PL70285B1 (enExample) | ||
| PL105364B1 (pl) | Sposob polimeryzacji alfa-olefin zawierajacych co najmniej 3 atomy wegla | |
| US4528339A (en) | Polymerization of olefins employing catalysts prepared from novel titanium compounds | |
| US4295992A (en) | Support prepared from organomagnesium compounds and silicon halides; and catalysts for polymerizing olefins | |
| US4622309A (en) | Novel titanium complexes and catalysts prepared therefrom | |
| CN102039187A (zh) | 负载型非茂金属催化剂、其制备方法及其应用 | |
| US3998996A (en) | Process for the manufacture of a mixed catalyst | |
| US4525556A (en) | Polymerization of olefins | |
| JPH05214025A (ja) | オレフィンの重合用触媒 | |
| CN102060945B (zh) | 一种乙烯聚合固体钛催化剂组分的制备和应用 | |
| US4399053A (en) | High efficiency catalyst containing titanium, zirconium and zinc for polymerizing olefins | |
| NL8002351A (nl) | Werkwijze ter bereiding van een vaste component van een katalysator voor de polymerisatie van alkenen, katalysator die deze component bevat, alsmede werk- wijze voor het bereiden van een polyalkeen onder toe- passing van de katalysator. | |
| CN102059153A (zh) | 负载型非茂金属催化剂、其制备方法及其应用 | |
| CN107840910B (zh) | 用于乙烯聚合反应的催化剂组分及其制备方法、催化剂及其应用 | |
| US4451626A (en) | Process for polymerizing alpha-olefins | |
| EP0020808A1 (en) | Support, catalyst and process for polymerizing olefins |