PL70890B1 - - Google Patents
Download PDFInfo
- Publication number
- PL70890B1 PL70890B1 PL1971149273A PL14927371A PL70890B1 PL 70890 B1 PL70890 B1 PL 70890B1 PL 1971149273 A PL1971149273 A PL 1971149273A PL 14927371 A PL14927371 A PL 14927371A PL 70890 B1 PL70890 B1 PL 70890B1
- Authority
- PL
- Poland
- Prior art keywords
- urea
- benzoin
- acid
- reaction
- carried out
- Prior art date
Links
- ISAOCJYIOMOJEB-UHFFFAOYSA-N benzoin Chemical compound C=1C=CC=CC=1C(O)C(=O)C1=CC=CC=C1 ISAOCJYIOMOJEB-UHFFFAOYSA-N 0.000 claims description 46
- 238000000034 method Methods 0.000 claims description 41
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical group ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 claims description 26
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 21
- 239000004202 carbamide Substances 0.000 claims description 21
- 244000028419 Styrax benzoin Species 0.000 claims description 19
- 235000000126 Styrax benzoin Nutrition 0.000 claims description 19
- 235000008411 Sumatra benzointree Nutrition 0.000 claims description 19
- 229960002130 benzoin Drugs 0.000 claims description 19
- 235000019382 gum benzoic Nutrition 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 12
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims description 12
- QPFMBZIOSGYJDE-UHFFFAOYSA-N acetylene tetrachloride Natural products ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 claims description 8
- 230000031709 bromination Effects 0.000 claims description 8
- 238000005893 bromination reaction Methods 0.000 claims description 8
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 8
- 239000005711 Benzoic acid Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 7
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 claims description 6
- 235000010233 benzoic acid Nutrition 0.000 claims description 6
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 claims description 5
- 229910017604 nitric acid Inorganic materials 0.000 claims description 5
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 claims description 4
- 239000003054 catalyst Substances 0.000 claims description 3
- 239000013067 intermediate product Substances 0.000 claims description 3
- 239000003960 organic solvent Substances 0.000 claims description 3
- 238000007248 oxidative elimination reaction Methods 0.000 claims description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 claims description 2
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 claims description 2
- 235000006408 oxalic acid Nutrition 0.000 claims description 2
- QPFMBZIOSGYJDE-ZDOIIHCHSA-N 1,1,2,2-tetrachloroethane Chemical group Cl[13CH](Cl)[13CH](Cl)Cl QPFMBZIOSGYJDE-ZDOIIHCHSA-N 0.000 claims 1
- 125000003118 aryl group Chemical group 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 16
- 239000000725 suspension Substances 0.000 description 12
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 9
- 229910052794 bromium Inorganic materials 0.000 description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 6
- 238000001035 drying Methods 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- XWNSFEAWWGGSKJ-UHFFFAOYSA-N 4-acetyl-4-methylheptanedinitrile Chemical compound N#CCCC(C)(C(=O)C)CCC#N XWNSFEAWWGGSKJ-UHFFFAOYSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000004153 Potassium bromate Substances 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- -1 isopropyl ester Chemical class 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000007800 oxidant agent Substances 0.000 description 2
- 229940094037 potassium bromate Drugs 0.000 description 2
- 235000019396 potassium bromate Nutrition 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000010865 sewage Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 241000272814 Anser sp. Species 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001491 aromatic compounds Chemical class 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000749 insecticidal effect Effects 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009331 sowing Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/70—One oxygen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/56—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds from heterocyclic compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US5330370A | 1970-07-08 | 1970-07-08 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL70890B1 true PL70890B1 (enExample) | 1974-04-30 |
Family
ID=21983272
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1971149273A PL70890B1 (enExample) | 1970-07-08 | 1971-07-07 |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5626646B1 (enExample) |
| AT (1) | AT305993B (enExample) |
| BE (1) | BE769611A (enExample) |
| CA (1) | CA961506A (enExample) |
| CH (1) | CH551936A (enExample) |
| CS (1) | CS160682B2 (enExample) |
| DE (1) | DE2133897C3 (enExample) |
| FR (1) | FR2100344A5 (enExample) |
| GB (1) | GB1340610A (enExample) |
| IL (1) | IL37251A (enExample) |
| NL (1) | NL176555C (enExample) |
| PL (1) | PL70890B1 (enExample) |
| SU (1) | SU404224A3 (enExample) |
| YU (1) | YU34655B (enExample) |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE562426A (enExample) * | 1956-11-21 |
-
1971
- 1971-07-05 CA CA117,321A patent/CA961506A/en not_active Expired
- 1971-07-06 YU YU1776/71A patent/YU34655B/xx unknown
- 1971-07-06 CS CS4961A patent/CS160682B2/cs unknown
- 1971-07-07 BE BE769611A patent/BE769611A/xx unknown
- 1971-07-07 FR FR7124835A patent/FR2100344A5/fr not_active Expired
- 1971-07-07 AT AT588571A patent/AT305993B/de not_active IP Right Cessation
- 1971-07-07 DE DE2133897A patent/DE2133897C3/de not_active Expired
- 1971-07-07 GB GB3197571A patent/GB1340610A/en not_active Expired
- 1971-07-07 PL PL1971149273A patent/PL70890B1/pl unknown
- 1971-07-07 NL NLAANVRAGE7109414,A patent/NL176555C/xx not_active IP Right Cessation
- 1971-07-07 IL IL37251A patent/IL37251A/xx unknown
- 1971-07-07 CH CH995771A patent/CH551936A/xx not_active IP Right Cessation
- 1971-07-07 JP JP5019471A patent/JPS5626646B1/ja active Pending
- 1971-07-08 SU SU1685742A patent/SU404224A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| DE2133897A1 (enExample) | 1972-01-27 |
| NL176555C (nl) | 1985-05-01 |
| IL37251A (en) | 1974-01-14 |
| IL37251A0 (en) | 1971-10-20 |
| YU34655B (en) | 1979-12-31 |
| BE769611A (fr) | 1972-01-07 |
| CH551936A (de) | 1974-07-31 |
| GB1340610A (en) | 1973-12-12 |
| AT305993B (de) | 1973-03-26 |
| SU404224A3 (enExample) | 1973-10-26 |
| DE2133897B2 (de) | 1980-03-27 |
| YU177671A (en) | 1979-07-10 |
| NL176555B (nl) | 1984-12-03 |
| NL7109414A (enExample) | 1972-01-11 |
| CA961506A (en) | 1975-01-21 |
| DE2133897C3 (de) | 1980-11-13 |
| JPS5626646B1 (enExample) | 1981-06-19 |
| CS160682B2 (enExample) | 1975-03-28 |
| FR2100344A5 (enExample) | 1972-03-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CN106459081B (zh) | 1,3-苯并二氧杂环戊烯杂环化合物的制备方法 | |
| US3907837A (en) | Production of aromatic ketones | |
| CN108191858B (zh) | 一种制备吡咯喹啉醌的中间体及制备方法 | |
| US2214117A (en) | Preparation of aromatic 1, 3-diketones | |
| GB1579383A (en) | Process for the manufacture of substituted benzaldehydes | |
| PL70890B1 (enExample) | ||
| US3911038A (en) | Process for making bis(phenylethylnyl)anthracenes | |
| PL144334B1 (en) | Method of isolating and purifying crude 5-/2-chloro-4-(trifluoromethyl)-phenoxy/-2-nitrobenzoic acid | |
| EP0274194B1 (en) | Process for the preparation of 2-nitro-5-phenoxy-n-alkylsulfonyl benzamides by nitration | |
| Buckle et al. | Studies on v-triazoles. 9. Antiallergic 4, 9-dihydro-4, 9-dioxo-1H-naphtho [2, 3-d]-v-triazoles | |
| Farinholt et al. | The halogenation of salicylic acid | |
| US3829496A (en) | Process for the production of 4,4'-dibromobenzil | |
| US3296280A (en) | The oxidation of tertiary-butyl groups attached to an aromatic ring to form the corresponding aromatic carboxylic acid | |
| Comins et al. | Bromination of 1-alkyl-3-methyl-2-pyridones with N-bromosuccinimide | |
| EP0461154B1 (en) | Iodo compounds | |
| US1955135A (en) | Halogen-benzanthrone and process of making same | |
| US1876930A (en) | Hydroxy-thionaphthenes containing alpha pyrazole ring | |
| CS196385B2 (en) | Method of producing 2,3-dichloro-1-methoxybenzene | |
| DK145643B (da) | Fremgangsmaade til fremstilling af 5-(2,4-difluorphenyl)salicylsyre | |
| US4220801A (en) | Process for making 4-aroyl-substituted phenoxyacetic acids | |
| SU392058A1 (ru) | Способ получения 1,2,3,4-тетрагидротетраоксонафталина | |
| US3280154A (en) | 5, 6, 7, 8-tetraethyl-anthraquinone-1-carboxylic acid and its 1-anthraquinonyl amide | |
| Allan et al. | 177. A novel synthesis of some quinoline derivatives | |
| JPH02204473A (ja) | 1―アミノ―2―ブロム―4―ヒドロキシ―アントラキノンの製造方法 | |
| Gilman et al. | Some 1, 2-, 2, 3-and 3, 4-Disubstituted Dibenzofurans |