PL65769B1 - - Google Patents
Download PDFInfo
- Publication number
- PL65769B1 PL65769B1 PL127148A PL12714868A PL65769B1 PL 65769 B1 PL65769 B1 PL 65769B1 PL 127148 A PL127148 A PL 127148A PL 12714868 A PL12714868 A PL 12714868A PL 65769 B1 PL65769 B1 PL 65769B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- general formula
- carried out
- organic solvent
- reaction mixture
- Prior art date
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 23
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 13
- 239000011541 reaction mixture Substances 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 239000003960 organic solvent Substances 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 claims description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 claims description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 10
- 238000005917 acylation reaction Methods 0.000 claims description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 9
- 238000007363 ring formation reaction Methods 0.000 claims description 7
- 238000006243 chemical reaction Methods 0.000 claims description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- 150000008065 acid anhydrides Chemical class 0.000 claims description 4
- 238000009835 boiling Methods 0.000 claims description 4
- 238000009833 condensation Methods 0.000 claims description 4
- 230000005494 condensation Effects 0.000 claims description 4
- 238000001914 filtration Methods 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 239000011230 binding agent Substances 0.000 claims description 2
- 229910000039 hydrogen halide Inorganic materials 0.000 claims description 2
- 239000012433 hydrogen halide Substances 0.000 claims description 2
- SEOVTRFCIGRIMH-UHFFFAOYSA-N indole-3-acetic acid Chemical class C1=CC=C2C(CC(=O)O)=CNC2=C1 SEOVTRFCIGRIMH-UHFFFAOYSA-N 0.000 claims description 2
- 235000019796 monopotassium phosphate Nutrition 0.000 claims description 2
- 150000007524 organic acids Chemical class 0.000 claims description 2
- 235000005985 organic acids Nutrition 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000001556 precipitation Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims 1
- 125000004433 nitrogen atoms Chemical class N* 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N oxygen atom Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 125000004434 sulfur atoms Chemical group 0.000 claims 1
- 150000003512 tertiary amines Chemical class 0.000 claims 1
- 239000002244 precipitate Substances 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- JOOXCMJARBKPKM-UHFFFAOYSA-N Levulinic acid Chemical compound CC(=O)CCC(O)=O JOOXCMJARBKPKM-UHFFFAOYSA-N 0.000 description 10
- 229940040102 levulinic acid Drugs 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- 238000007792 addition Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- -1 1- (- methoxyphenyl) -1-quinoloyl-2-formylhydrazine Chemical compound 0.000 description 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 150000007857 hydrazones Chemical class 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- MQHVSBTWLBWOLA-UHFFFAOYSA-N N-(4-methoxyanilino)formamide Chemical compound COC1=CC=C(NNC=O)C=C1 MQHVSBTWLBWOLA-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 150000002475 indoles Chemical class 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- HUMNYLRZRPPJDN-UHFFFAOYSA-N Benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- QOZPTSMLFWAQMA-UHFFFAOYSA-N C(C1=CC=NC=C1)(=O)N(NC=O)C1=CC=C(C=C1)OC Chemical compound C(C1=CC=NC=C1)(=O)N(NC=O)C1=CC=C(C=C1)OC QOZPTSMLFWAQMA-UHFFFAOYSA-N 0.000 description 2
- FBGFOBYHPPSWFD-UHFFFAOYSA-N C(C1=CN=CC=C1)(=O)N(NC=O)C1=CC=C(C=C1)OCC1=CC=CC=C1 Chemical compound C(C1=CN=CC=C1)(=O)N(NC=O)C1=CC=C(C=C1)OCC1=CC=CC=C1 FBGFOBYHPPSWFD-UHFFFAOYSA-N 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N Dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 2
- 150000008046 alkali metal hydrides Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000005712 crystallization Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- ATBIAJXSKNPHEI-UHFFFAOYSA-N pyridine-3-carbonyl chloride Chemical compound ClC(=O)C1=CC=CN=C1 ATBIAJXSKNPHEI-UHFFFAOYSA-N 0.000 description 2
- PVRSIFAEUCUJPK-UHFFFAOYSA-N (4-methoxyphenyl)hydrazine Chemical compound COC1=CC=C(NN)C=C1 PVRSIFAEUCUJPK-UHFFFAOYSA-N 0.000 description 1
- PUVVVMFAQOBMPB-UHFFFAOYSA-N N-(4-phenylmethoxyanilino)formamide Chemical compound C1=CC(NNC=O)=CC=C1OCC1=CC=CC=C1 PUVVVMFAQOBMPB-UHFFFAOYSA-N 0.000 description 1
- QVXFGVVYTKZLJN-KHPPLWFESA-N [(Z)-hexadec-7-enyl] acetate Chemical compound CCCCCCCC\C=C/CCCCCCOC(C)=O QVXFGVVYTKZLJN-KHPPLWFESA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 239000001961 anticonvulsive agent Substances 0.000 description 1
- 229940054051 antipsychotic Indole derivatives Drugs 0.000 description 1
- 229940095076 benzaldehyde Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 230000000875 corresponding Effects 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- WOAZEKPXTXCPFZ-UHFFFAOYSA-N dimethyl(phenyl)azanium;chloride Chemical compound Cl.CN(C)C1=CC=CC=C1 WOAZEKPXTXCPFZ-UHFFFAOYSA-N 0.000 description 1
- 238000006047 enzymatic hydrolysis reaction Methods 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003301 hydrolyzing Effects 0.000 description 1
- 125000001041 indolyl group Chemical group 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N oxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- UPZNFEYZMRXDPD-UHFFFAOYSA-M pyridine-4-carboxylic acid;chloride Chemical compound [Cl-].OC(=O)C1=CC=NC=C1 UPZNFEYZMRXDPD-UHFFFAOYSA-M 0.000 description 1
- WFVMVMAUXYOQSW-UHFFFAOYSA-N quinoline-2-carbonyl chloride Chemical compound C1=CC=CC2=NC(C(=O)Cl)=CC=C21 WFVMVMAUXYOQSW-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 230000002194 synthesizing Effects 0.000 description 1
- DKGAVHZHDRPRBM-UHFFFAOYSA-N t-BuOH Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 1
- QIQITDHWZYEEPA-UHFFFAOYSA-N thiophene-2-carbonyl chloride Chemical compound ClC(=O)C1=CC=CS1 QIQITDHWZYEEPA-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Priority Applications (10)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1897968A CH498831A (fr) | 1967-12-27 | 1968-12-19 | Procédé pour la préparation d'acides indolyl-3 acétiques |
DK622768A DK136033B (da) | 1967-12-27 | 1968-12-19 | Fremgangsmåde til fremstilling af indolyl-3-eddikesyrer. |
CS868268A CS162665B2 (xx) | 1967-12-27 | 1968-12-20 | |
SE1765268A SE350494B (xx) | 1967-12-27 | 1968-12-20 | |
DE19681816993 DE1816993C3 (de) | 1967-12-27 | 1968-12-24 | Verfahren zur Herstellung von Indolyl-3-essigsäuren |
RO5863568A RO55545A (xx) | 1967-12-27 | 1968-12-26 | |
YU311968A YU311968A (en) | 1967-12-27 | 1968-12-27 | Postupak za proizvodnju 1-aroil-/ili 1-heteroaroil- ili 1-benzheteroaroil/-2-metil-5-alkoksi-/ili 5-aralkoksi/-indolil-3-sircetne kiseline |
FR1599484D FR1599484A (xx) | 1967-12-27 | 1968-12-27 | |
NL6818723A NL6818723A (xx) | 1967-12-27 | 1968-12-27 | |
GB1228848D GB1228848A (xx) | 1967-12-27 | 1968-12-30 |
Publications (1)
Publication Number | Publication Date |
---|---|
PL65769B1 true PL65769B1 (xx) | 1972-04-29 |
Family
ID=
Similar Documents
Publication | Publication Date | Title |
---|---|---|
US3822275A (en) | Process for producing 3-indolyl aliphatic acid compounds | |
SU493966A3 (ru) | Способ получени производных 4-/2имидазолин-2-иламино/-2,1,3-бензотиадиазола | |
US4698344A (en) | 1-Heteroaryl-4-aryl-pyrazolin-5-ones for use as medicaments | |
NO862408L (no) | Fremgangsmaate for fremstilling av thiazolidin-4(s)-karboksylsyrederivater. | |
DK148232B (da) | 2-methoxyethylesteren af 4-hydroxy-2-methyl-2h-1,2-benzothiazin-3-carboxylsyre-1,1-dioxid og fremgangsmaade til omdannelse af denne til 4-hydroxy-2-methyl-n-2-pyridyl-2h-1,2-benzothiazin-3-carboxamid-1,1-dioxid (piroxicam) | |
US4014890A (en) | Process for preparing indole derivatives | |
US3121720A (en) | I-substituted tetrahydro isoquevolines | |
PL65769B1 (xx) | ||
US4107167A (en) | Alkyl α-[3-(pyridyl)-anilinomethylene]acetoacetates | |
US4614806A (en) | Process for the asymmetric synthesis of chiral indoline-2-carboxylic acids | |
JPH059177A (ja) | 新規な窒素複素環式化合物 | |
US4847386A (en) | Process for preparing thiophene derivatives | |
US3960926A (en) | Process for preparing azasulfonium halide salts | |
US2762805A (en) | 3-ethyl-3-phenyl-2, 6-piperazinedione and derivatives thereof | |
US3954797A (en) | Process for preparing azasulfonium halide salts | |
US3158618A (en) | Nu-(acylamino)-ephedrines | |
JPS5811878B2 (ja) | フロ ( 3 2−b ) インド−ルルイノ セイホウ | |
US5290947A (en) | Process for the preparation of pyrrole derivates | |
RU2421453C1 (ru) | Способ получения несимметричных 1,2-дитиенилзамещенных циклопентенов | |
PL62464B1 (xx) | ||
SU584781A3 (ru) | Способ получени производных 1-ацилгомопиримидазола или их солей | |
Neumann et al. | 3‐Trifloxypropene iminium and propyne iminium salts derived fromN‐Allyl‐, N‐Homoallyl‐, and N‐benzyl‐substituted semicyclic enaminones | |
SU504483A3 (ru) | Способ получени производных индолил-3уксусной кислоты | |
US4432901A (en) | Beta-lactam compounds containing a C-acetal group and process for their preparation | |
US3417089A (en) | Enol betaines and process for preparing the same |