PL64895B1 - - Google Patents
Download PDFInfo
- Publication number
- PL64895B1 PL64895B1 PL121602A PL12160267A PL64895B1 PL 64895 B1 PL64895 B1 PL 64895B1 PL 121602 A PL121602 A PL 121602A PL 12160267 A PL12160267 A PL 12160267A PL 64895 B1 PL64895 B1 PL 64895B1
- Authority
- PL
- Poland
- Prior art keywords
- fluorspar
- hydrogen fluoride
- sulfuric acid
- heated
- temperature
- Prior art date
Links
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 72
- 239000010436 fluorite Substances 0.000 claims description 38
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 claims description 34
- 229910000040 hydrogen fluoride Inorganic materials 0.000 claims description 34
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 claims description 32
- 238000006243 chemical reaction Methods 0.000 claims description 25
- 235000011132 calcium sulphate Nutrition 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 13
- 239000001175 calcium sulphate Substances 0.000 claims description 12
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 238000010924 continuous production Methods 0.000 claims 1
- 239000007789 gas Substances 0.000 description 13
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 6
- 239000002245 particle Substances 0.000 description 6
- 239000007921 spray Substances 0.000 description 5
- 239000006227 byproduct Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 238000005507 spraying Methods 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000001354 calcination Methods 0.000 description 2
- 229910001634 calcium fluoride Inorganic materials 0.000 description 2
- 238000011437 continuous method Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- MTJGVAJYTOXFJH-UHFFFAOYSA-N 3-aminonaphthalene-1,5-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 MTJGVAJYTOXFJH-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 241000237858 Gastropoda Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- -1 fluorine hydrogen Chemical class 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL64895B1 true PL64895B1 (OSRAM) | 1972-02-29 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR100241617B1 (ko) | 철광석 환원으로 발생되는 분진을 이용하는 방법 및 이 방법을 수행하기 위한 플랜트 | |
| RU2015144717A (ru) | Усовершенствованный способ массового производства фосфорной кислоты с применением ротационной печи | |
| US4080437A (en) | Process for thermal decomposition of aluminum chloride hexahydrate | |
| JPH0386287A (ja) | 粉粒状樹脂の洗浄方法およびその洗浄装置 | |
| US4362701A (en) | Rotating apparatus for manufacturing hydrogen fluoride | |
| JPS6116501B2 (OSRAM) | ||
| CA1110025A (en) | Granulation of sulfur | |
| US4010245A (en) | Production of hydrogen fluoride and calcium sulfate | |
| CA1088730A (en) | Method for carrying out endothermic reduction processes in a circulating fluid bed and an apparatus therefor | |
| PL208220B1 (pl) | Sposób wytwarzania melaminy oraz reaktor wysokociśnieniowy do stosowania tego sposobu | |
| US3745207A (en) | Process for the recovery of waste pickle liquor | |
| US3469939A (en) | Process for manufacturing hydrogen fluoride | |
| US4119699A (en) | Method for wet metallurgical processes | |
| PL97079B1 (pl) | Sposob wytwarzania stalego chlorowanego nitrylu kwasu ftalowego | |
| CA1117297A (en) | Method and apparatus for granulating blast furnace slag | |
| US3563701A (en) | Method of producing sulfate granules and volatile acid gases | |
| US3160473A (en) | Process for the production of hydrogen fluoride and calcium sulphate | |
| US2706144A (en) | Improved hargreaves method for making sulphate salts and hci | |
| US4508666A (en) | Process for cooling and comminuting molten calcium carbide | |
| US3230042A (en) | Process for the continuous production of chromium trioxide | |
| US4447331A (en) | Intimate contacting/separating of plural phases | |
| US2917371A (en) | Apparatus for the continuous manufacture of calcium cyanamide | |
| US3300279A (en) | Process for production of hydrofluoric acid from sulphuric acid, fluorspar and anhydrite | |
| US3816603A (en) | Process for decomposing ammonium sulfate into ammonium bisulfate and ammonia | |
| US3512942A (en) | Apparatus for mining and refining phosphorus |