PL57542B1 - - Google Patents
Download PDFInfo
- Publication number
- PL57542B1 PL57542B1 PL110618A PL11061865A PL57542B1 PL 57542 B1 PL57542 B1 PL 57542B1 PL 110618 A PL110618 A PL 110618A PL 11061865 A PL11061865 A PL 11061865A PL 57542 B1 PL57542 B1 PL 57542B1
- Authority
- PL
- Poland
- Prior art keywords
- weight
- tannin
- parts
- sulfonic acids
- acids
- Prior art date
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 21
- 229920001864 tannin Polymers 0.000 claims description 10
- 235000018553 tannin Nutrition 0.000 claims description 10
- 239000001648 tannin Substances 0.000 claims description 10
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- QDOXWKRWXJOMAK-UHFFFAOYSA-N chromium(III) oxide Inorganic materials O=[Cr]O[Cr]=O QDOXWKRWXJOMAK-UHFFFAOYSA-N 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- 150000004696 coordination complex Chemical class 0.000 claims description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 4
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 claims description 4
- SMMXVEBDYAIABS-UHFFFAOYSA-N dinaphthalen-1-ylmethanesulfonic acid Chemical class C1=CC=C2C(C(C=3C4=CC=CC=C4C=CC=3)S(=O)(=O)O)=CC=CC2=C1 SMMXVEBDYAIABS-UHFFFAOYSA-N 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- DSHWASKZZBZKOE-UHFFFAOYSA-K chromium(3+);hydroxide;sulfate Chemical compound [OH-].[Cr+3].[O-]S([O-])(=O)=O DSHWASKZZBZKOE-UHFFFAOYSA-K 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims description 2
- 230000005494 condensation Effects 0.000 claims description 2
- BDUPRNVPXOHWIL-UHFFFAOYSA-N dimethyl sulfite Chemical compound COS(=O)OC BDUPRNVPXOHWIL-UHFFFAOYSA-N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- -1 phenol sulfonic acids Chemical class 0.000 claims 1
- 238000006068 polycondensation reaction Methods 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000007859 condensation product Substances 0.000 description 6
- 235000015217 chromium(III) sulphate Nutrition 0.000 description 5
- 239000011696 chromium(III) sulphate Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000010985 leather Substances 0.000 description 4
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical compound CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 3
- GRWVQDDAKZFPFI-UHFFFAOYSA-H chromium(III) sulfate Chemical compound [Cr+3].[Cr+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRWVQDDAKZFPFI-UHFFFAOYSA-H 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 229920002705 flavono-ellagitannin Polymers 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- ZMESHQOXZMOOQQ-UHFFFAOYSA-N 1-(naphthalen-1-ylmethyl)naphthalene Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ZMESHQOXZMOOQQ-UHFFFAOYSA-N 0.000 description 1
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 1
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 229910000356 chromium(III) sulfate Inorganic materials 0.000 description 1
- VQWFNAGFNGABOH-UHFFFAOYSA-K chromium(iii) hydroxide Chemical compound [OH-].[OH-].[OH-].[Cr+3] VQWFNAGFNGABOH-UHFFFAOYSA-K 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- QFUDHWDUKUCCHZ-UHFFFAOYSA-N methyl hydrogen sulfite Chemical compound COS(O)=O QFUDHWDUKUCCHZ-UHFFFAOYSA-N 0.000 description 1
- 235000013824 polyphenols Nutrition 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL57542B1 true PL57542B1 (Direct) | 1969-04-28 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JPS6365720B2 (Direct) | ||
| JP5311770B2 (ja) | 酸基を含むジアルデヒド縮合物 | |
| US2191943A (en) | Tanning material | |
| PL57542B1 (Direct) | ||
| EP1693393B1 (de) | Säuregruppenhaltige Kondensationsprodukte | |
| EP0533011B1 (de) | Verfahren zur Herstellung von Chromleder | |
| AU2003298467A1 (en) | A process for making leather | |
| US3253879A (en) | Chrome-syntan pretannage followed by dry chrome tannage | |
| US3519378A (en) | Process for the rapid tanning of medium-weight and heavy leather | |
| US3254937A (en) | Dry chrome pretannage and dry syntan or vegetable tannage | |
| US2676170A (en) | Water-soluble derivatives of unsulfonated lignin | |
| JP2004149797A (ja) | Feで鞣された革の再鞣のための縮合物 | |
| US2470450A (en) | Tanning with free formaldehyde and melamine simultaneously | |
| US3429649A (en) | Preparation of condensation products | |
| US2694051A (en) | Derivatives of novolak resins and methods of preparing same | |
| US2997364A (en) | Chrome-tanning mixtures and preparation of leather therewith | |
| US1945461A (en) | Method of retanning of chrome leather | |
| US2597809A (en) | Manufacture of syntans | |
| US1919756A (en) | Process of tanning | |
| US3482925A (en) | Process for the rapid tanning of leather | |
| US2522666A (en) | Reacting a chrome-tanned hide first with a sulfonic acid syntan and then with methylol-melamine | |
| CH647551A5 (de) | Kondensationsprodukt aus mindestens einem aliphatischen aldehyd mit mindestens einer aromatischen, aminogruppenhaltigen sulfon- und/oder carbonsaeure. | |
| US3397941A (en) | Retannage of leather with melamine,dicyandiamide and aldehyde condensate reacted with a low molecular aromatic sulfonate | |
| PL66474B1 (Direct) | ||
| AT138005B (de) | Verfahren zum Gerben tierischer Häute. |