PL55617B1 - - Google Patents
Download PDFInfo
- Publication number
- PL55617B1 PL55617B1 PL111573A PL11157365A PL55617B1 PL 55617 B1 PL55617 B1 PL 55617B1 PL 111573 A PL111573 A PL 111573A PL 11157365 A PL11157365 A PL 11157365A PL 55617 B1 PL55617 B1 PL 55617B1
- Authority
- PL
- Poland
- Prior art keywords
- acid
- nitro
- mol
- pyrido
- pyridothiazinone
- Prior art date
Links
- QFWRXHOXSMGYGY-UHFFFAOYSA-N 2h-pyrido[2,3-e]thiazine 1-oxide Chemical compound C1=CC=C2S(=O)NC=CC2=N1 QFWRXHOXSMGYGY-UHFFFAOYSA-N 0.000 claims description 12
- -1 3-nitropyridylthioglycolic acid Chemical compound 0.000 claims description 11
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 claims description 10
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 claims description 9
- 229940106681 chloroacetic acid Drugs 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 3
- JICQECMQVJTIAR-UHFFFAOYSA-N 3-nitrosulfanylpyridine Chemical compound [O-][N+](=O)SC1=CC=CN=C1 JICQECMQVJTIAR-UHFFFAOYSA-N 0.000 claims description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 claims description 2
- RUTXIHLAWFEWGM-UHFFFAOYSA-H iron(3+) sulfate Chemical compound [Fe+3].[Fe+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O RUTXIHLAWFEWGM-UHFFFAOYSA-H 0.000 claims 1
- 229910000360 iron(III) sulfate Inorganic materials 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- 238000007363 ring formation reaction Methods 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 235000003891 ferrous sulphate Nutrition 0.000 description 3
- 239000011790 ferrous sulphate Substances 0.000 description 3
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 3
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 229910021653 sulphate ion Inorganic materials 0.000 description 3
- UUOLETYDNTVQDY-UHFFFAOYSA-N 2-chloro-3-nitropyridine Chemical class [O-][N+](=O)C1=CC=CN=C1Cl UUOLETYDNTVQDY-UHFFFAOYSA-N 0.000 description 2
- WQEBRZKYXXZALY-UHFFFAOYSA-N 2h-pyrido[2,3-e]thiazine Chemical class C1=CN=C2C=CNSC2=C1 WQEBRZKYXXZALY-UHFFFAOYSA-N 0.000 description 2
- LKNPLDRVWHXGKZ-UHFFFAOYSA-N 3-nitro-1h-pyridine-2-thione Chemical compound [O-][N+](=O)C1=CC=CN=C1S LKNPLDRVWHXGKZ-UHFFFAOYSA-N 0.000 description 2
- WWDZCQQUTFWNQI-UHFFFAOYSA-N 3-nitro-1h-pyridine-4-thione Chemical compound [O-][N+](=O)C1=CNC=CC1=S WWDZCQQUTFWNQI-UHFFFAOYSA-N 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 235000014413 iron hydroxide Nutrition 0.000 description 2
- NCNCGGDMXMBVIA-UHFFFAOYSA-L iron(ii) hydroxide Chemical class [OH-].[OH-].[Fe+2] NCNCGGDMXMBVIA-UHFFFAOYSA-L 0.000 description 2
- XGBAHPXURMWPMT-UHFFFAOYSA-N n-pyridin-2-ylthiohydroxylamine Chemical class SNC1=CC=CC=N1 XGBAHPXURMWPMT-UHFFFAOYSA-N 0.000 description 2
- 150000002828 nitro derivatives Chemical class 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- RGVWXJUMRDRGAA-UHFFFAOYSA-N 3-amino-1h-pyridine-4-thione;hydrochloride Chemical compound Cl.NC1=CN=CC=C1S RGVWXJUMRDRGAA-UHFFFAOYSA-N 0.000 description 1
- AUCGLTFMKPYVNT-UHFFFAOYSA-N 3-amino-6-chloro-1h-pyridine-2-thione Chemical compound NC1=CC=C(Cl)N=C1S AUCGLTFMKPYVNT-UHFFFAOYSA-N 0.000 description 1
- JOTRPRKONYTVBV-UHFFFAOYSA-N 4-chloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CN=CC=C1Cl JOTRPRKONYTVBV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL55617B1 true PL55617B1 (enExample) | 1968-06-25 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU548207A3 (ru) | Способ получени производных 2-ариламино-2-имидазолина или их солей | |
| US2831027A (en) | Isocamphane compounds and processes for preparing the same | |
| SU686616A3 (ru) | Способ получени производных 3-фтор-6-пиперазинил-морфантридина или их солей | |
| JPS6348873B2 (enExample) | ||
| US2569801A (en) | Preparation of azlactones of phenylacetamino acrylic acids | |
| US2924599A (en) | Derivatives of 1:3:5-triazanaphthalene | |
| L'Italien et al. | 2-Hydroxy-3-alkylquinoxalines | |
| FI59086B (fi) | Foerfarande foer framstaellning av 2,5-disubstituerade bensamider | |
| PL55617B1 (enExample) | ||
| US3254094A (en) | 3-imino-2, 1-benzisothiazoles | |
| PL101804B1 (pl) | A process of producing new derivatives of cynoline | |
| SU486508A3 (ru) | Способ получени замещенных гуанидинофенилмочевины | |
| Goldberg | 120. Synthesis of derivatives of taurinamide | |
| US2910505A (en) | S-substituted n-benzhydryl pseudothioureas and their pseudothiouronium salts | |
| US3109022A (en) | Nu-aryl anthranilic acids | |
| US2489357A (en) | Benzotriazines | |
| SU501668A3 (ru) | Способ получени производных 2-аминобензиламина | |
| US2817682A (en) | Carboxy-amino compounds | |
| DE2526990A1 (de) | Neue cephalosporin- und penicillinderivate | |
| US3145229A (en) | Process for the production of nu-substituted-1-phenylcyclohexylamines | |
| FI66858B (fi) | Foerfarande foer framstaellning av nya terapeutiskt anvaendbara sulfoximider och salter daerav | |
| Malmberg et al. | The synthesis of 2-and 3-substituted naphth [1, 2] imidazoles | |
| US4515958A (en) | Process for preparing 1-alkyl-5-mercaptotetrazoles | |
| US3457261A (en) | Thiophenylpyridyl amine,chlorothiophenylpyridyl amine,their salts and preparation | |
| US2780625A (en) | Piperazine derivatives and method of preparing the same |