PL45838B1 - - Google Patents
Download PDFInfo
- Publication number
- PL45838B1 PL45838B1 PL45838A PL4583860A PL45838B1 PL 45838 B1 PL45838 B1 PL 45838B1 PL 45838 A PL45838 A PL 45838A PL 4583860 A PL4583860 A PL 4583860A PL 45838 B1 PL45838 B1 PL 45838B1
- Authority
- PL
- Poland
- Prior art keywords
- mercapto
- benzyl
- sulfonamide
- ammonia
- thiodiazole
- Prior art date
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N HCl Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 8
- -1 acetylamino-benzenesulfonyl Chemical group 0.000 claims description 6
- 238000007127 saponification reaction Methods 0.000 claims description 5
- 229960001663 sulfanilamide Drugs 0.000 claims description 4
- FDDDEECHVMSUSB-UHFFFAOYSA-N Sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 claims description 3
- 238000007112 amidation reaction Methods 0.000 claims description 3
- 238000003776 cleavage reaction Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- PKOFBDHYTMYVGJ-UHFFFAOYSA-N N-(4-sulfamoylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S(N)(=O)=O)C=C1 PKOFBDHYTMYVGJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims description 2
- 238000005660 chlorination reaction Methods 0.000 claims description 2
- 238000009833 condensation Methods 0.000 claims 2
- 230000005494 condensation Effects 0.000 claims 2
- 102000004190 Enzymes Human genes 0.000 claims 1
- 108090000790 Enzymes Proteins 0.000 claims 1
- 206010047289 Ventricular extrasystoles Diseases 0.000 claims 1
- ZOUQIAGHKFLHIA-UHFFFAOYSA-L copper;N,N-dimethylcarbamodithioate Chemical compound [Cu+2].CN(C)C([S-])=S.CN(C)C([S-])=S ZOUQIAGHKFLHIA-UHFFFAOYSA-L 0.000 claims 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims 1
- 125000003396 thiol group Chemical group [H]S* 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 150000001875 compounds Chemical group 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 8
- 239000012065 filter cake Substances 0.000 description 6
- 238000009835 boiling Methods 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- 235000011114 ammonium hydroxide Nutrition 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 230000000875 corresponding Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- QCXJEYYXVJIFCE-UHFFFAOYSA-M 4-acetamidobenzoate Chemical compound CC(=O)NC1=CC=C(C([O-])=O)C=C1 QCXJEYYXVJIFCE-UHFFFAOYSA-M 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N Benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N Carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- BLMPQMFVWMYDKT-NZTKNTHTSA-N Carfilzomib Chemical compound C([C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC=1C=CC=CC=1)C(=O)N[C@@H](CC(C)C)C(=O)[C@]1(C)OC1)NC(=O)CN1CCOCC1)CC1=CC=CC=C1 BLMPQMFVWMYDKT-NZTKNTHTSA-N 0.000 description 1
- 240000000491 Corchorus aestuans Species 0.000 description 1
- 235000011777 Corchorus aestuans Nutrition 0.000 description 1
- 235000010862 Corchorus capsularis Nutrition 0.000 description 1
- 210000003041 Ligaments Anatomy 0.000 description 1
- 210000001331 Nose Anatomy 0.000 description 1
- HVBSAKJJOYLTQU-UHFFFAOYSA-N Sulfanilic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002378 acidificating Effects 0.000 description 1
- 238000007792 addition Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 125000001743 benzylic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229950000244 sulfanilic acid Drugs 0.000 description 1
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL45838B1 true PL45838B1 (ru) | 1962-06-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL45838B1 (ru) | ||
| US2195088A (en) | Sulphonated ketones | |
| PL104307B1 (pl) | Sposob wytwarzania 1,1-dwutlenku kwasu 3,4-dwuhydro-2-metylo-4-keto-2h-1,2-benzotiazynokarboksylowego-3 | |
| JPS6144861A (ja) | モノペルオキシジカルボン酸およびそのカルカリ金属塩ないしはアルカリ土類金属塩の製造法 | |
| US2374934A (en) | Process for preparing capillary active substances | |
| Carrington | 132. Thiohydantoins. Part II. Conversion of 5: 5-disubstituted 2: 4-dithiohydantoins into the corresponding monothiohydantoins | |
| US2317832A (en) | Manufacture of reaction products from sulphite cellulose waste liquor | |
| Westerlund | The synthetic utility of heteroaromatic azido compounds. Part VII. Preparation of some 2‐and 4‐substituted thieno [3, 2‐d] pyrimidines | |
| US651045A (en) | Process of making saccharin. | |
| Burton et al. | 110. The synthesis of some aryl 2-thienyl sulphones and the nitration of thiophen-2-sulphonyl chloride | |
| SU65115A1 (ru) | Способ получени дефенилацетамидин-р,р'-дисульфамида | |
| CH467802A (de) | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen | |
| US1680778A (en) | of basel | |
| SU93041A1 (ru) | Способ получени норсульфазола | |
| CS243581B1 (cs) | Způsob výroby 2-metyl-5-chlor-l,4-diaminobenzenu | |
| SU95525A1 (ru) | Способ получени фенилуксусной кислоты | |
| US2163110A (en) | Substituted perinaphthindandiones | |
| AT239228B (de) | Verfahren zur Herstellung von 7-Sulfamyl-3, 4-dihydro-1, 2, 4-benzothiadiazin-1, 1-dioxyden | |
| SU76644A1 (ru) | Способ производства растворимого в воде производного грамицидина с | |
| PL55004B1 (ru) | ||
| PL57039B1 (ru) | ||
| Burton et al. | 121. Compounds related to 4: 4′-diaminodiphenylsulphone | |
| PL117925B1 (en) | Process for preparing novel derivatives of 5,6-dihydroimidazo/5,1-a/isoquinolineazo/5,1-a/izochinolina | |
| Ewins et al. | CXXIV.—Heterocyclic compounds containing arsenic. Part I. The action of chloroacetamide on 3: 4-diaminophenylarsinic acid | |
| PL52174B1 (ru) |