PL45464B1 - - Google Patents
Download PDFInfo
- Publication number
- PL45464B1 PL45464B1 PL45464A PL4546460A PL45464B1 PL 45464 B1 PL45464 B1 PL 45464B1 PL 45464 A PL45464 A PL 45464A PL 4546460 A PL4546460 A PL 4546460A PL 45464 B1 PL45464 B1 PL 45464B1
- Authority
- PL
- Poland
- Prior art keywords
- materials
- raw materials
- asphalt
- pitch
- polyvinyl chloride
- Prior art date
Links
- 239000000463 material Substances 0.000 claims description 9
- 239000002994 raw material Substances 0.000 claims description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 6
- 239000010426 asphalt Substances 0.000 claims description 5
- 238000000576 coating method Methods 0.000 claims description 4
- 238000000034 method Methods 0.000 claims description 4
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 claims description 3
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 claims description 3
- 239000000853 adhesive Substances 0.000 claims description 3
- 230000001070 adhesive effect Effects 0.000 claims description 3
- 239000011248 coating agent Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 3
- 239000004800 polyvinyl chloride Substances 0.000 claims description 3
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 claims description 3
- 239000002699 waste material Substances 0.000 claims description 3
- 230000029936 alkylation Effects 0.000 claims description 2
- 238000005804 alkylation reaction Methods 0.000 claims description 2
- 238000009835 boiling Methods 0.000 claims description 2
- -1 which include bit Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 1
- 239000011295 pitch Substances 0.000 description 3
- 239000002966 varnish Substances 0.000 description 3
- 238000005253 cladding Methods 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 208000002193 Pain Diseases 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL45464B1 true PL45464B1 (en:Method) | 1961-12-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI76101B (fi) | Laettvikts-fogkomposition. | |
| US2680102A (en) | Fire-resistant product from comminuted woody material, urea, or melamine-formaldehyde, chlorinated hydrocarbon resin, and hydrated alumina | |
| SE7608182L (sv) | Impregnering och grundning av absorptiva substrat med plastdispersioner | |
| PL45464B1 (en:Method) | ||
| NO771786L (no) | Mineral/harpiks-matrise. | |
| US2514021A (en) | Composition board | |
| US2210348A (en) | Roofing material | |
| RU2809790C2 (ru) | Композиция для изготовления "гибкого" камня | |
| US2270047A (en) | Composition of asphalt saturants | |
| US520123A (en) | Augustine sackett | |
| US3447991A (en) | Method of using improved asphaltic adhesive | |
| DE2229405A1 (de) | Verfahren zur herstellung von bauelementen fuer die bauindustrie | |
| US887248A (en) | Coating composition. | |
| DE873675C (de) | Verfahren zur Herstellung von Fussbodenunter- oder -zwischenbelaegen | |
| US2343735A (en) | Bituminous waterproofing material | |
| US1899416A (en) | Floor covering and the like | |
| US1852676A (en) | Composite structural material | |
| DE809054C (de) | Verfahren zur Herstellung eines fugenlosen Fussbodenbelages | |
| US152503A (en) | Improvement in roofing compositions | |
| SU767058A1 (ru) | Шпатлевочна масса | |
| US1392127A (en) | Insulating and building material and method of producing same | |
| DE383173C (de) | Fliesenbelag fuer Stallfussboeden | |
| US98652A (en) | Improved composition for flooring, wainscoting, anb other purposes | |
| US531969A (en) | Paint compound | |
| EP3235973A1 (de) | Plattenförmiges bauelement |