PL44427B1 - - Google Patents
Download PDFInfo
- Publication number
- PL44427B1 PL44427B1 PL44427A PL4442759A PL44427B1 PL 44427 B1 PL44427 B1 PL 44427B1 PL 44427 A PL44427 A PL 44427A PL 4442759 A PL4442759 A PL 4442759A PL 44427 B1 PL44427 B1 PL 44427B1
- Authority
- PL
- Poland
- Prior art keywords
- hydroxy
- indole
- starting material
- general formula
- reactive
- Prior art date
Links
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 6
- 239000003054 catalyst Substances 0.000 claims description 4
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 229910052763 palladium Inorganic materials 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 2
- 238000000034 method Methods 0.000 claims 7
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims 2
- 239000002253 acid Substances 0.000 claims 2
- 229910052698 phosphorus Inorganic materials 0.000 claims 2
- 239000011574 phosphorus Substances 0.000 claims 2
- 239000007858 starting material Substances 0.000 claims 2
- AFINAILKDBCXMX-PBHICJAKSA-N (2s,3r)-2-amino-3-hydroxy-n-(4-octylphenyl)butanamide Chemical compound CCCCCCCCC1=CC=C(NC(=O)[C@@H](N)[C@@H](C)O)C=C1 AFINAILKDBCXMX-PBHICJAKSA-N 0.000 claims 1
- NLMQHXUGJIAKTH-UHFFFAOYSA-N 4-hydroxyindole Chemical class OC1=CC=CC2=C1C=CN2 NLMQHXUGJIAKTH-UHFFFAOYSA-N 0.000 claims 1
- 241000219198 Brassica Species 0.000 claims 1
- 235000003351 Brassica cretica Nutrition 0.000 claims 1
- 235000003343 Brassica rupestris Nutrition 0.000 claims 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 claims 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 claims 1
- 125000004432 carbon atom Chemical group C* 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000005984 hydrogenation reaction Methods 0.000 claims 1
- 238000007327 hydrogenolysis reaction Methods 0.000 claims 1
- 150000002475 indoles Chemical class 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 235000010460 mustard Nutrition 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- -1 4-hydroxydimethyltryptamine dibenzylphosphate Chemical compound 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- SMVXYBYTGKEHCS-UHFFFAOYSA-N [benzyl(chloro)phosphoryl]methylbenzene Chemical compound C=1C=CC=CC=1CP(=O)(Cl)CC1=CC=CC=C1 SMVXYBYTGKEHCS-UHFFFAOYSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- QTERVOZQCNPERI-UHFFFAOYSA-N 1h-indole;phosphoric acid Chemical compound OP(O)(O)=O.C1=CC=C2NC=CC2=C1 QTERVOZQCNPERI-UHFFFAOYSA-N 0.000 description 1
- OHHYMKDBKJPILO-UHFFFAOYSA-N 3-[2-(diethylamino)ethyl]-1h-indol-4-ol Chemical compound C1=CC(O)=C2C(CCN(CC)CC)=CNC2=C1 OHHYMKDBKJPILO-UHFFFAOYSA-N 0.000 description 1
- BCBIDTUKRGWHPL-UHFFFAOYSA-N 3-[2-(dimethylamino)ethyl]-1h-indol-4-ol;phosphoric acid Chemical compound OP(O)(O)=O.C1=CC(O)=C2C(CCN(C)C)=CNC2=C1 BCBIDTUKRGWHPL-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 235000005811 Viola adunca Nutrition 0.000 description 1
- 240000009038 Viola odorata Species 0.000 description 1
- 235000013487 Viola odorata Nutrition 0.000 description 1
- 235000002254 Viola papilionacea Nutrition 0.000 description 1
- 244000172533 Viola sororia Species 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-M dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)([O-])OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-M 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- RQKYHDHLEMEVDR-UHFFFAOYSA-N oxo-bis(phenylmethoxy)phosphanium Chemical compound C=1C=CC=CC=1CO[P+](=O)OCC1=CC=CC=C1 RQKYHDHLEMEVDR-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL44427B1 true PL44427B1 (cs) | 1961-04-15 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR101832396B1 (ko) | 에르고티오네인 및 이것의 유사체의 합성법 | |
| US2936308A (en) | Novel reductones and methods of making them | |
| RU2070194C1 (ru) | Способ получения производных гексагидроазепинов или их солей с минеральными или органическими кислотами | |
| SU648082A3 (ru) | Способ получени производных аминокислот, их солей, рацематов или оптически-активных антиподов | |
| PL113623B1 (en) | Process for preparing novel,substituted in position 11 5,11-dihydro-6h-pyrido/2,3-b//1,4/benzodiazepin-6-ones | |
| SU508176A3 (ru) | Способ получени аминопроизводных бензофенона | |
| PL44427B1 (cs) | ||
| US3185686A (en) | Pyrazine derivatives | |
| US3002965A (en) | Nucleosides and their preparation | |
| JPS6348250A (ja) | 2−アシロキシプロピルアミン誘導体、その製造方法、およびそれらを含有する薬学的組成物 | |
| US4650864A (en) | Process for preparing 5-deoxy-L-arabinose | |
| SU852173A3 (ru) | Способ получени производных дигидРОиМидАзО изОХиНО-лиНА или иХ СОлЕй | |
| US3058992A (en) | Intermediates for the preparation of | |
| US3821231A (en) | Method for preparation of n-substituted 4-aniline piperidines | |
| GB2067990A (en) | Cinnamyl moranoline derivatives | |
| SU584782A3 (ru) | Способ получени производных аминоимидазоизохинолина или их солей | |
| US4126639A (en) | Process for 11a-dehalogenation of 11a-halotetracyclines | |
| SU528877A3 (ru) | Способ получени замещенных имидазо (1,2 )пиридазинов | |
| SU1274626A3 (ru) | Способ получени @ - метил-11 -аза - 10 -деоксо- 10-дигидроэритромицина @ | |
| SU497773A3 (ru) | Способ получени производных индазола | |
| US3813415A (en) | Process for the preparation of 3-(beta dialkylamino-ethyl)-4-alkyl-7-carboethoxymethoxycoumarins | |
| SU1413106A1 (ru) | Способ получени 5-амино-3-метилпиразола | |
| SU388000A1 (ru) | Способ получения | |
| US2882295A (en) | 2-diethylaminoethyl 5-amino-2-alkoxybenzoates and their preparation | |
| AT254189B (de) | Verfahren zur Herstellung von neuen substituierten 3-(3-Hydroxyphenyl)-1-phenacylpiperidinen |