PL34959B1 - - Google Patents
Download PDFInfo
- Publication number
- PL34959B1 PL34959B1 PL34959A PL3495948A PL34959B1 PL 34959 B1 PL34959 B1 PL 34959B1 PL 34959 A PL34959 A PL 34959A PL 3495948 A PL3495948 A PL 3495948A PL 34959 B1 PL34959 B1 PL 34959B1
- Authority
- PL
- Poland
- Prior art keywords
- mixture according
- liquid
- decomposition
- solid
- solid component
- Prior art date
Links
- 239000000203 mixture Substances 0.000 claims description 42
- 239000007788 liquid Substances 0.000 claims description 26
- 238000000354 decomposition reaction Methods 0.000 claims description 20
- 150000001875 compounds Chemical class 0.000 claims description 19
- 239000007787 solid Substances 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical group O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 11
- 239000000575 pesticide Substances 0.000 claims description 11
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical group OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 claims description 10
- 239000005909 Kieselgur Substances 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- JOSWYUNQBRPBDN-UHFFFAOYSA-P ammonium dichromate Chemical group [NH4+].[NH4+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O JOSWYUNQBRPBDN-UHFFFAOYSA-P 0.000 claims description 6
- 239000000084 colloidal system Substances 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 6
- 239000002023 wood Substances 0.000 claims description 5
- 235000013312 flour Nutrition 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 2
- DAJYZXUXDOSMCG-UHFFFAOYSA-N diethoxyphosphoryl [diethoxyphosphoryloxy(ethoxy)phosphoryl] ethyl phosphate Chemical group CCOP(=O)(OCC)OP(=O)(OCC)OP(=O)(OCC)OP(=O)(OCC)OCC DAJYZXUXDOSMCG-UHFFFAOYSA-N 0.000 claims description 2
- 230000005484 gravity Effects 0.000 claims description 2
- NDEMNVPZDAFUKN-UHFFFAOYSA-N guanidine;nitric acid Chemical group NC(N)=N.O[N+]([O-])=O.O[N+]([O-])=O NDEMNVPZDAFUKN-UHFFFAOYSA-N 0.000 claims description 2
- 230000002269 spontaneous effect Effects 0.000 claims 3
- 206010028813 Nausea Diseases 0.000 claims 1
- 230000005587 bubbling Effects 0.000 claims 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 claims 1
- SOCTUWSJJQCPFX-UHFFFAOYSA-N dichromate(2-) Chemical compound [O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O SOCTUWSJJQCPFX-UHFFFAOYSA-N 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 230000002459 sustained effect Effects 0.000 claims 1
- RYYWUUFWQRZTIU-UHFFFAOYSA-K thiophosphate Chemical compound [O-]P([O-])([O-])=S RYYWUUFWQRZTIU-UHFFFAOYSA-K 0.000 claims 1
- IXEVGHXRXDBAOB-BREBYQMCSA-N [(1r,3r,4r)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-thiocyanatoacetate Chemical compound C1C[C@@]2(C)[C@H](OC(=O)CSC#N)C[C@@H]1C2(C)C IXEVGHXRXDBAOB-BREBYQMCSA-N 0.000 description 11
- 239000007789 gas Substances 0.000 description 7
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 6
- QLOKJRIVRGCVIM-UHFFFAOYSA-N 1-[(4-methylsulfanylphenyl)methyl]piperazine Chemical compound C1=CC(SC)=CC=C1CN1CCNCC1 QLOKJRIVRGCVIM-UHFFFAOYSA-N 0.000 description 5
- 239000000020 Nitrocellulose Substances 0.000 description 5
- 229920001220 nitrocellulos Polymers 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- NIQCNGHVCWTJSM-UHFFFAOYSA-N Dimethyl phthalate Chemical compound COC(=O)C1=CC=CC=C1C(=O)OC NIQCNGHVCWTJSM-UHFFFAOYSA-N 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- -1 ammonium nitrate ammonium dichromate potassium chloride copper Chemical compound 0.000 description 3
- 239000002917 insecticide Substances 0.000 description 3
- 230000000361 pesticidal effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 241000254173 Coleoptera Species 0.000 description 2
- 240000007182 Ochroma pyramidale Species 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- JLYXXMFPNIAWKQ-CDRYSYESSA-N beta-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@@H](Cl)[C@@H]1Cl JLYXXMFPNIAWKQ-CDRYSYESSA-N 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- JNUNSOWOBBAUKB-UHFFFAOYSA-N dimethoxyphosphoryl [dimethoxyphosphoryloxy(methoxy)phosphoryl] methyl phosphate Chemical compound COP(=O)(OC)OP(=O)(OC)OP(=O)(OC)OP(=O)(OC)OC JNUNSOWOBBAUKB-UHFFFAOYSA-N 0.000 description 2
- FBSAITBEAPNWJG-UHFFFAOYSA-N dimethyl phthalate Natural products CC(=O)OC1=CC=CC=C1OC(C)=O FBSAITBEAPNWJG-UHFFFAOYSA-N 0.000 description 2
- 229960001826 dimethylphthalate Drugs 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000001988 toxicity Effects 0.000 description 2
- 231100000419 toxicity Toxicity 0.000 description 2
- IDCPFAYURAQKDZ-UHFFFAOYSA-N 1-nitroguanidine Chemical compound NC(=N)N[N+]([O-])=O IDCPFAYURAQKDZ-UHFFFAOYSA-N 0.000 description 1
- 241001124076 Aphididae Species 0.000 description 1
- 240000004045 Cassia javanica Species 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- 244000141359 Malus pumila Species 0.000 description 1
- 235000011430 Malus pumila Nutrition 0.000 description 1
- 235000015103 Malus silvestris Nutrition 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000254179 Sitophilus granarius Species 0.000 description 1
- 241001454295 Tetranychidae Species 0.000 description 1
- 241000254113 Tribolium castaneum Species 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001845 chromium compounds Chemical class 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 239000002360 explosive Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000003517 fume Substances 0.000 description 1
- JLYXXMFPNIAWKQ-GNIYUCBRSA-N gamma-hexachlorocyclohexane Chemical compound Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl JLYXXMFPNIAWKQ-GNIYUCBRSA-N 0.000 description 1
- JLYXXMFPNIAWKQ-UHFFFAOYSA-N gamma-hexachlorocyclohexane Natural products ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl JLYXXMFPNIAWKQ-UHFFFAOYSA-N 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 239000000077 insect repellent Substances 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL34959B1 true PL34959B1 (OSRAM) | 1952-02-28 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| JP2023133405A5 (ja) | 自己消火性成形品 | |
| US2436146A (en) | Composition of matter | |
| US2682461A (en) | Solid gas generating charge | |
| CN115192953A (zh) | 一种有机无机复合的微罐灭火剂及其制备方法 | |
| US3124505A (en) | Aerosol concentrates containing a sta- | |
| GB724620A (en) | Process for the production of non spontaneously inflammable phosphine | |
| US4777032A (en) | Paper distributing an active compound on burning, and a pyrotechnic distributor using such paper | |
| US2700011A (en) | Fumigating compositions | |
| US2590529A (en) | Fumigating compositions | |
| DE884170C (de) | Gaserzeugende Ladung | |
| RU2064765C1 (ru) | Фунгицидная пиротехническая композиция | |
| US2637678A (en) | Aerosol generating and propelling composition and insecticide | |
| US3042580A (en) | Aerosol generating preparations | |
| US3523893A (en) | Fire extinguishing powder composition | |
| JPH11246306A (ja) | 燻煙剤組成物 | |
| DE834464C (de) | Schaedlingsbekaempfungsmittel | |
| RU2124839C1 (ru) | Состав для получения пестицидных аэрозолей | |
| US2411070A (en) | Smoke-producing composition | |
| US2695258A (en) | Pest control smoke generators | |
| DE1155631B (de) | Mittel zur Bekaempfung von Insekten und Nagetieren | |
| RU2717301C1 (ru) | Фунгицидная пиротехническая композиция | |
| CH273885A (de) | Räuchermasse zur Ausbreitung von thermisch verdampfbaren Schädlingsbekämpfungsmitteln. | |
| US2311629A (en) | Insecticide spray material and method of making the same | |
| US2633444A (en) | Alkali metal nitrite and ammonium salt of an inorganic acid gas generating composition containing a vaporizable pesticide | |
| CN110771622A (zh) | 一种敌敌畏烟剂 |