PL29105B1 - - Google Patents
Download PDFInfo
- Publication number
- PL29105B1 PL29105B1 PL29105A PL2910536A PL29105B1 PL 29105 B1 PL29105 B1 PL 29105B1 PL 29105 A PL29105 A PL 29105A PL 2910536 A PL2910536 A PL 2910536A PL 29105 B1 PL29105 B1 PL 29105B1
- Authority
- PL
- Poland
- Prior art keywords
- steel
- mixture
- desulfurization
- dephosphorization
- metal
- Prior art date
Links
- 229910000831 Steel Inorganic materials 0.000 claims description 31
- 239000010959 steel Substances 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 20
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 238000006477 desulfuration reaction Methods 0.000 claims description 14
- 230000023556 desulfurization Effects 0.000 claims description 14
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 11
- 238000005266 casting Methods 0.000 claims description 8
- 150000003112 potassium compounds Chemical class 0.000 claims description 7
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 7
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 2
- -1 sodium carbonate Chemical class 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- XXQBEVHPUKOQEO-UHFFFAOYSA-N potassium peroxide Inorganic materials [K+].[K+].[O-][O-] XXQBEVHPUKOQEO-UHFFFAOYSA-N 0.000 claims 1
- CLSKHAYBTFRDOV-UHFFFAOYSA-N potassium;molecular oxygen Chemical compound [K+].O=O CLSKHAYBTFRDOV-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 description 12
- 239000007800 oxidant agent Substances 0.000 description 10
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- 229910052760 oxygen Inorganic materials 0.000 description 6
- 239000001301 oxygen Substances 0.000 description 6
- 229910052710 silicon Inorganic materials 0.000 description 6
- 239000010703 silicon Substances 0.000 description 6
- 229910052698 phosphorus Inorganic materials 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N iron oxide Inorganic materials [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 3
- 229910001338 liquidmetal Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 2
- 235000013980 iron oxide Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 2
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical class [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- BZSXEZOLBIJVQK-UHFFFAOYSA-N 2-methylsulfonylbenzoic acid Chemical compound CS(=O)(=O)C1=CC=CC=C1C(O)=O BZSXEZOLBIJVQK-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- WUKWITHWXAAZEY-UHFFFAOYSA-L calcium difluoride Chemical compound [F-].[F-].[Ca+2] WUKWITHWXAAZEY-UHFFFAOYSA-L 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000010436 fluorite Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- VBMVTYDPPZVILR-UHFFFAOYSA-N iron(2+);oxygen(2-) Chemical class [O-2].[Fe+2] VBMVTYDPPZVILR-UHFFFAOYSA-N 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 239000012286 potassium permanganate Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL29105B1 true PL29105B1 (enExample) | 1940-06-29 |
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4586956A (en) | Method and agents for producing clean steel | |
| EP0602540B1 (de) | Mittel zur Entschwefelung, Entphosphorung, Entsilicierung und Entstickung von Roheisen-, Gusseisen-, Ferrochrom- und Ferromanganschmelzen sowie Verfahren | |
| US3681051A (en) | Desulfurizing agent for molten pig iron | |
| DE3789226T2 (de) | Verfahren zum Einstellen des gelösten Sauerstoffgehaltes in Stahlschmelzen. | |
| DE2602536A1 (de) | Verfahren zur herstellung von schwefelarmen blasstahl | |
| PL29105B1 (enExample) | ||
| US4450004A (en) | Dephosphorization and desulfurization method for molten iron alloy containing chromium | |
| JP2760817B2 (ja) | 溶鋼用含鉛添加剤および溶鋼処理方法 | |
| EP0220522A1 (de) | Entschwefelungsgemisch für Metallschmelzen, ein Verfahren zu seiner Herstellung und seine Verwendung | |
| DE2953378A1 (en) | Disilification process of manganese alloys | |
| DE2842563A1 (de) | Verfahren zur erzielung extrem niedriger phosphorgehalte | |
| US2604393A (en) | Method of desulfurizing iron and steel with metal hydrides | |
| US2194441A (en) | Refining lead | |
| US4042377A (en) | Method of and composition for the desulfurization of steel | |
| DE2709062A1 (de) | Mittel und verfahren zur entschwefelung von eisenschmelzen | |
| US2147205A (en) | Process for dephosphorizing and desulphurizing steel | |
| US1313192A (en) | Process of making salt cake and sulfuric acid from niter cake | |
| US2173205A (en) | Process for the deoxidation of steel baths | |
| US1994679A (en) | Process of producing alloys | |
| US1920465A (en) | Refining ferrous metals | |
| DE3517178C2 (de) | Verfahren zur Herstellung von Gusseisen mit Kugelgraphit | |
| AT217066B (de) | Verfahren zur Entsilizierung und Entschwefelung von Roheisenschmelzen | |
| DE944376C (de) | Verfahren zur Entphosphorung von Stahlschmelzen | |
| US2015693A (en) | Purifying copper | |
| DE69022839T2 (de) | Verfahren zur entphosphorung von chrom-enthaltenden roheisen mit niedrigem oxidationsverlust von chrom. |