PL114263B1 - Process for preparing derivatives of 1,2,4-triazin-5-one - Google Patents
Process for preparing derivatives of 1,2,4-triazin-5-one Download PDFInfo
- Publication number
- PL114263B1 PL114263B1 PL1978208544A PL20854478A PL114263B1 PL 114263 B1 PL114263 B1 PL 114263B1 PL 1978208544 A PL1978208544 A PL 1978208544A PL 20854478 A PL20854478 A PL 20854478A PL 114263 B1 PL114263 B1 PL 114263B1
- Authority
- PL
- Poland
- Prior art keywords
- formula
- general formula
- scheme
- tertiary
- acid
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title description 3
- BFNNILAMSKQDRN-UHFFFAOYSA-N 2h-1,2,4-triazin-5-one Chemical class O=C1C=NNC=N1 BFNNILAMSKQDRN-UHFFFAOYSA-N 0.000 title 1
- 238000006243 chemical reaction Methods 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- LJTFFORYSFGNCT-UHFFFAOYSA-N Thiocarbohydrazide Chemical compound NNC(=S)NN LJTFFORYSFGNCT-UHFFFAOYSA-N 0.000 claims description 12
- 150000001875 compounds Chemical class 0.000 claims description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 claims description 8
- 150000001336 alkenes Chemical class 0.000 claims description 7
- 150000001408 amides Chemical class 0.000 claims description 7
- 230000011987 methylation Effects 0.000 claims description 7
- 238000007069 methylation reaction Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 238000009833 condensation Methods 0.000 claims description 3
- 230000005494 condensation Effects 0.000 claims description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 3
- 150000003509 tertiary alcohols Chemical class 0.000 claims description 3
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- 150000001264 acyl cyanides Chemical class 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- -1 imide chloride Chemical class 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 239000000047 product Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- IAWVHZJZHDSEOC-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanoic acid Chemical compound CC(C)(C)C(=O)C(O)=O IAWVHZJZHDSEOC-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- JOXJYUIVUBVJMQ-UHFFFAOYSA-N CCCCNC(=O)C(=O)C(C)(C)C Chemical compound CCCCNC(=O)C(=O)C(C)(C)C JOXJYUIVUBVJMQ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- NPBLQPWAISGYEU-UHFFFAOYSA-N 2,2-dimethylpropanoyl cyanide Chemical compound CC(C)(C)C(=O)C#N NPBLQPWAISGYEU-UHFFFAOYSA-N 0.000 description 2
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 229960000583 acetic acid Drugs 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- GZUXJHMPEANEGY-UHFFFAOYSA-N bromomethane Chemical compound BrC GZUXJHMPEANEGY-UHFFFAOYSA-N 0.000 description 2
- MSZJEPVVQWJCIF-UHFFFAOYSA-N butylazanide Chemical compound CCCC[NH-] MSZJEPVVQWJCIF-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 230000002363 herbicidal effect Effects 0.000 description 2
- 239000004009 herbicide Substances 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- DURPTKYDGMDSBL-UHFFFAOYSA-N 1-butoxybutane Chemical compound CCCCOCCCC DURPTKYDGMDSBL-UHFFFAOYSA-N 0.000 description 1
- FGGFZGZVRCCRRL-UHFFFAOYSA-N 1-methylcyclopropane-1-carbonyl cyanide Chemical compound N#CC(=O)C1(C)CC1 FGGFZGZVRCCRRL-UHFFFAOYSA-N 0.000 description 1
- QMNWYGTWTXOQTP-UHFFFAOYSA-N 1h-triazin-6-one Chemical compound O=C1C=CN=NN1 QMNWYGTWTXOQTP-UHFFFAOYSA-N 0.000 description 1
- JVSFQJZRHXAUGT-UHFFFAOYSA-N 2,2-dimethylpropanoyl chloride Chemical compound CC(C)(C)C(Cl)=O JVSFQJZRHXAUGT-UHFFFAOYSA-N 0.000 description 1
- FXNDIJDIPNCZQJ-UHFFFAOYSA-N 2,4,4-trimethylpent-1-ene Chemical compound CC(=C)CC(C)(C)C FXNDIJDIPNCZQJ-UHFFFAOYSA-N 0.000 description 1
- DDCOGBPHOFARPW-UHFFFAOYSA-N 2-(1-methylcyclopropyl)-2-oxoacetic acid Chemical compound OC(=O)C(=O)C1(C)CC1 DDCOGBPHOFARPW-UHFFFAOYSA-N 0.000 description 1
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical compound CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 1
- RHDCSUIVJBMHCT-UHFFFAOYSA-N 3,3-dimethyl-2-oxobutanethioamide Chemical compound CC(C)(C)C(=O)C(N)=S RHDCSUIVJBMHCT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- VCUFZILGIRCDQQ-KRWDZBQOSA-N N-[[(5S)-2-oxo-3-(2-oxo-3H-1,3-benzoxazol-6-yl)-1,3-oxazolidin-5-yl]methyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C1O[C@H](CN1C1=CC2=C(NC(O2)=O)C=C1)CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F VCUFZILGIRCDQQ-KRWDZBQOSA-N 0.000 description 1
- 238000006434 Ritter amidation reaction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- PXJJSXABGXMUSU-UHFFFAOYSA-N disulfur dichloride Chemical compound ClSSCl PXJJSXABGXMUSU-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 229910000037 hydrogen sulfide Inorganic materials 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 150000002527 isonitriles Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940102396 methyl bromide Drugs 0.000 description 1
- 239000012022 methylating agents Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- AHAXISXGFCFQGE-UHFFFAOYSA-N n-oxoformamide Chemical class O=CN=O AHAXISXGFCFQGE-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- JUXCNSQRTAVSNU-UHFFFAOYSA-N n-tert-butyl-3,3-dimethyl-2-oxobutanamide Chemical compound CC(C)(C)NC(=O)C(=O)C(C)(C)C JUXCNSQRTAVSNU-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D253/00—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00
- C07D253/02—Heterocyclic compounds containing six-membered rings having three nitrogen atoms as the only ring hetero atoms, not provided for by group C07D251/00 not condensed with other rings
- C07D253/06—1,2,4-Triazines
- C07D253/065—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members
- C07D253/07—1,2,4-Triazines having three double bonds between ring members or between ring members and non-ring members with hetero atoms, or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D253/075—Two hetero atoms, in positions 3 and 5
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/707—1,2,3- or 1,2,4-triazines; Hydrogenated 1,2,3- or 1,2,4-triazines
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Plant Pathology (AREA)
- Pest Control & Pesticides (AREA)
- Agronomy & Crop Science (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2733180A DE2733180C3 (de) | 1977-07-22 | 1977-07-22 | Verfahren zur Herstellung von 4-Amino-3-methylmercapto-1,2,4-triazin- 5-on-Derivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| PL208544A1 PL208544A1 (pl) | 1979-05-07 |
| PL114263B1 true PL114263B1 (en) | 1981-01-31 |
Family
ID=6014620
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1978208544A PL114263B1 (en) | 1977-07-22 | 1978-07-20 | Process for preparing derivatives of 1,2,4-triazin-5-one |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4175188A (esLanguage) |
| JP (1) | JPS5424886A (esLanguage) |
| AT (1) | AT364368B (esLanguage) |
| BE (1) | BE869139A (esLanguage) |
| BR (1) | BR7804679A (esLanguage) |
| CA (1) | CA1082705A (esLanguage) |
| CH (1) | CH635085A5 (esLanguage) |
| DD (1) | DD137225A5 (esLanguage) |
| DE (1) | DE2733180C3 (esLanguage) |
| ES (2) | ES471958A1 (esLanguage) |
| FR (1) | FR2398065B1 (esLanguage) |
| GB (1) | GB2002361B (esLanguage) |
| HU (1) | HU175069B (esLanguage) |
| IL (1) | IL55177A (esLanguage) |
| IT (1) | IT1156873B (esLanguage) |
| NL (1) | NL7807432A (esLanguage) |
| PL (1) | PL114263B1 (esLanguage) |
| SE (1) | SE444436B (esLanguage) |
| SU (1) | SU791236A3 (esLanguage) |
| YU (1) | YU160678A (esLanguage) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2733181B2 (de) * | 1977-07-22 | 1979-08-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von N-substituierten a -Ketocarbonsäureamiden |
| DE3002203A1 (de) * | 1980-01-22 | 1981-07-23 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von (alpha)-ketocarbonsaeure-n-tert.-butylamiden |
| DE3003541A1 (de) * | 1980-01-31 | 1981-08-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4h)-on |
| US4309538A (en) * | 1980-01-31 | 1982-01-05 | Bayer Aktiengesellschaft | Preparation of 4-amino-6-tert.-butyl-3-alkylthio-1,2,4-triazin-5(4H)-ones |
| DE3008921A1 (de) * | 1980-03-08 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-amino-6-tert.-butyl-3-methylthio-1,2,4,-triazin-5(4h)-on |
| DE3009043A1 (de) * | 1980-03-08 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 4-amino-6-tert.-butyl-3-methylthio-1,2,4-triazin-5(4h)-on |
| DE3009044A1 (de) * | 1980-03-08 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von (alpha)-ketocarbon-n-acylamiden |
| DE3020370C2 (de) * | 1980-05-29 | 1982-09-16 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von 4-Amino-6-tert.butyl-3-mercapto-1,2,4-triazin-5-on |
| DE3102318A1 (de) * | 1981-01-24 | 1982-08-26 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 3,6-disubstituierten 4-amino-1,2,4-triazin-5-onen |
| DE3106707A1 (de) * | 1981-02-23 | 1982-09-09 | Degussa Ag, 6000 Frankfurt | Herbizid wirksames 1,2,4-triazin-5-on-derivat |
| DE3115970A1 (de) * | 1981-04-22 | 1982-11-11 | Bayer Ag, 5090 Leverkusen | "5-acyloxy-4(5h)-oxazolonium-salze, verfahren zu ihrer herstellung und ihre verwendung als zwischenprodukte zur synthese von herbizid wirksamen triazinonen" |
| DE3339858A1 (de) * | 1983-11-04 | 1985-05-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von praktisch isomerenfreiem 4-amino-3-ethylthio-6-tert.-butyl-1,2,4-triazin-5-on |
| EP0549531A1 (de) * | 1991-12-20 | 1993-06-30 | Säurefabrik Schweizerhall | Verfahren zur Herstellung von Säureanhydriden |
| US5440038A (en) * | 1993-12-07 | 1995-08-08 | Miles Inc. | Process for the purification of substituted 4-amino-1,2,4-triazine-5-ones |
| US6274766B1 (en) | 1999-05-19 | 2001-08-14 | Bayer Corporation | Process for purifying α-keto acids |
| US6852857B2 (en) | 2002-05-16 | 2005-02-08 | Bayer Materialscience Llc | Method of preparing substituted 4-amino-3-alkylthio-1,2,4-triazine-5-ones |
| CN109206379A (zh) * | 2018-11-01 | 2019-01-15 | 江苏七洲绿色化工股份有限公司 | 一种嗪草酮的合成方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1542873C3 (de) * | 1966-04-16 | 1978-07-13 | Bayer Ag, 5090 Leverkusen | Herbizides Mittel auf Basis von 4-Amino-1,2,4-triazin-5-onen |
| US3905801A (en) * | 1966-11-28 | 1975-09-16 | Du Pont | Substituted 1,2,4-triazine-5-ones as herbicides |
| DE2165554A1 (de) * | 1971-12-30 | 1973-07-05 | Bayer Ag | Verfahren zur herstellung von 1,2,4triazin-5-on-derivaten |
| US4013649A (en) * | 1973-08-06 | 1977-03-22 | E. I. Du Pont De Nemours And Company | Method of making 4-amino-6-t-butyl-3-mercapto-1,2,4-triazin-5-one |
| DE2417511A1 (de) * | 1974-04-10 | 1975-10-30 | Bayer Ag | 6-sec.-butyl-1,2,4-triazin-5(4h)-one, verfahren zu ihrer herstellung sowie ihre verwendung als herbizide |
| DE2460889C2 (de) * | 1974-12-21 | 1983-06-09 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von 6-tert.-Butyl-3-mercapto-4-amino- 1.2.4-triazin-5(4H)-on |
| DE2517654A1 (de) * | 1975-04-22 | 1976-11-04 | Bayer Ag | 4-amino-5-thion-1,2,4-triazine, verfahren zu ihrer herstellung und ihre verwendung als herbizide |
| US4058526A (en) * | 1976-05-11 | 1977-11-15 | Bayer Aktiengesellschaft | Treatment of waste water from the preparation of 6-substituted 3-mercapto-4-amino-1,2,4-triazine-5-ones |
| GR65206B (en) * | 1977-07-20 | 1980-07-29 | Ciba Geigy Ag | Herbicidal derivative of 1,2,4-briazin-5-ons |
-
1977
- 1977-07-22 DE DE2733180A patent/DE2733180C3/de not_active Expired
-
1978
- 1978-07-05 YU YU01606/78A patent/YU160678A/xx unknown
- 1978-07-10 NL NL7807432A patent/NL7807432A/xx not_active Application Discontinuation
- 1978-07-12 US US05/924,062 patent/US4175188A/en not_active Expired - Lifetime
- 1978-07-17 JP JP8622078A patent/JPS5424886A/ja active Pending
- 1978-07-18 DD DD78206789A patent/DD137225A5/xx unknown
- 1978-07-19 BE BE6046544A patent/BE869139A/xx not_active IP Right Cessation
- 1978-07-20 SU SU782639548A patent/SU791236A3/ru active
- 1978-07-20 IL IL55177A patent/IL55177A/xx unknown
- 1978-07-20 GB GB7830565A patent/GB2002361B/en not_active Expired
- 1978-07-20 BR BR7804679A patent/BR7804679A/pt unknown
- 1978-07-20 PL PL1978208544A patent/PL114263B1/pl unknown
- 1978-07-20 IT IT50401/78A patent/IT1156873B/it active
- 1978-07-21 ES ES471958A patent/ES471958A1/es not_active Expired
- 1978-07-21 FR FR7821720A patent/FR2398065B1/fr not_active Expired
- 1978-07-21 SE SE7808059A patent/SE444436B/sv not_active IP Right Cessation
- 1978-07-21 AT AT0530978A patent/AT364368B/de not_active IP Right Cessation
- 1978-07-21 HU HU78DE970A patent/HU175069B/hu unknown
- 1978-07-21 CA CA307,857A patent/CA1082705A/en not_active Expired
- 1978-07-21 CH CH792178A patent/CH635085A5/de not_active IP Right Cessation
- 1978-07-21 ES ES471951A patent/ES471951A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| ATA530978A (de) | 1981-03-15 |
| GB2002361A (en) | 1979-02-21 |
| FR2398065B1 (esLanguage) | 1983-05-06 |
| DE2733180B2 (de) | 1979-12-13 |
| FR2398065A1 (esLanguage) | 1979-02-16 |
| IL55177A (en) | 1982-04-30 |
| SU791236A3 (ru) | 1980-12-23 |
| BR7804679A (pt) | 1979-04-10 |
| ES471951A1 (es) | 1979-02-01 |
| PL208544A1 (pl) | 1979-05-07 |
| NL7807432A (nl) | 1979-01-24 |
| HU175069B (hu) | 1980-05-28 |
| CH635085A5 (de) | 1983-03-15 |
| JPS5424886A (en) | 1979-02-24 |
| SE444436B (sv) | 1986-04-14 |
| IT1156873B (it) | 1987-02-04 |
| GB2002361B (en) | 1982-01-13 |
| YU160678A (en) | 1983-01-21 |
| IT7850401A0 (it) | 1978-07-20 |
| DD137225A5 (de) | 1979-08-22 |
| DE2733180A1 (de) | 1979-01-25 |
| CA1082705A (en) | 1980-07-29 |
| SE7808059L (sv) | 1979-01-23 |
| AT364368B (de) | 1981-10-12 |
| ES471958A1 (es) | 1979-02-01 |
| BE869139A (fr) | 1979-01-19 |
| US4175188A (en) | 1979-11-20 |
| IL55177A0 (en) | 1978-09-29 |
| DE2733180C3 (de) | 1983-04-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PL114263B1 (en) | Process for preparing derivatives of 1,2,4-triazin-5-one | |
| IL238003A (en) | Processes for Synthesis of 2-Amino-6,4-Dimethoxybenzamide and Other Benzamide Compounds | |
| PL84115B3 (en) | 2-(furfuryl-methyl)-6,7-benzomorphans and acid addition salts thereof[us3823150a] | |
| US3988367A (en) | Preparation of N,N'-dicarboxymethyl-1,3-propanediamines | |
| PL75064B1 (esLanguage) | ||
| PL200223B1 (pl) | Sposób wytwarzania podstawionych benzoilocyjanidoamidynohydrazonów | |
| AU2002367765B2 (en) | A new and efficient process for the preparation of lamotrigine and related 3,5-diamino-6-substituted-1,2,4-triazines | |
| US4757142A (en) | Process for preparing 6-amino-3-hydrazinopyridazine derivatives | |
| PL80902B1 (esLanguage) | ||
| US4059548A (en) | Hexahydropyrimidine-1,3-diacetonitriles and processes for preparing the same | |
| US2585935A (en) | Quaternary salts of pyrimidylaminocinnolines and process of preparing same | |
| US3397200A (en) | Nitropyrrolylmethyleneaminouracils | |
| Russell et al. | The Reaction of Aromatic Nitriles with Guanidine1 | |
| US4058528A (en) | 5-Hydroxyhexahydropyrimidine | |
| Popov | Investigations of unsaturated azoles. 13. Synthesis and some reactions of 1-alkylbenzimidazoles | |
| SU399120A1 (ru) | Способ получения индоанилинов | |
| HU182857B (en) | Herbicide preparations containing 1,2,4-triazine-5-onderivatives and process for producing the agent | |
| JPS5913762A (ja) | 新規イミダゾ−ル化合物及びその製造方法 | |
| US3198829A (en) | N, n' dicyanoamidines and methods of preparation | |
| US2603639A (en) | Sulfonamido compounds | |
| US3919216A (en) | 6-(Alkyl)-3,4,6,7-tetrahydro-1,2,4-triazinoquinazolines | |
| US4058527A (en) | Preparation of N,N'-Dicarboxymethyl-1,3-propanediamines | |
| KR830002138B1 (ko) | 1,2,4-트리아진-5-온 유도체의 제조방법 | |
| PL92416B1 (esLanguage) | ||
| PL88722B1 (esLanguage) |