PL103009B1 - Sposob wytwarzania nowych pochodnych benzenu - Google Patents
Sposob wytwarzania nowych pochodnych benzenu Download PDFInfo
- Publication number
- PL103009B1 PL103009B1 PL1975197312A PL19731275A PL103009B1 PL 103009 B1 PL103009 B1 PL 103009B1 PL 1975197312 A PL1975197312 A PL 1975197312A PL 19731275 A PL19731275 A PL 19731275A PL 103009 B1 PL103009 B1 PL 103009B1
- Authority
- PL
- Poland
- Prior art keywords
- group
- carbon atoms
- straight
- general formula
- formula
- Prior art date
Links
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical class C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 title description 34
- 238000004519 manufacturing process Methods 0.000 title 1
- -1 halide ion Chemical class 0.000 claims description 112
- 150000001875 compounds Chemical class 0.000 claims description 86
- 125000004432 carbon atom Chemical group C* 0.000 claims description 73
- 125000000217 alkyl group Chemical group 0.000 claims description 55
- 238000000034 method Methods 0.000 claims description 20
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 18
- 229910052740 iodine Inorganic materials 0.000 claims description 16
- 238000002360 preparation method Methods 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 12
- 150000001450 anions Chemical class 0.000 claims description 12
- 239000000460 chlorine Substances 0.000 claims description 10
- 229910052801 chlorine Inorganic materials 0.000 claims description 9
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 229910052717 sulfur Inorganic materials 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 239000001301 oxygen Substances 0.000 claims description 7
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 7
- 229920006395 saturated elastomer Polymers 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000000623 heterocyclic group Chemical group 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 239000011593 sulfur Substances 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 4
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000004429 atom Chemical group 0.000 claims description 4
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 239000011630 iodine Chemical group 0.000 claims description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 150000002367 halogens Chemical group 0.000 claims description 3
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims 3
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 2
- 125000003107 substituted aryl group Chemical group 0.000 claims 2
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims 2
- 125000004434 sulfur atom Chemical group 0.000 claims 2
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 56
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 45
- 239000000243 solution Substances 0.000 description 35
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 30
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 28
- 241001465754 Metazoa Species 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 23
- 239000007787 solid Substances 0.000 description 20
- 238000000354 decomposition reaction Methods 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- 239000000725 suspension Substances 0.000 description 17
- 241000233866 Fungi Species 0.000 description 16
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 15
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 13
- 229940076134 benzene Drugs 0.000 description 13
- 150000003568 thioethers Chemical class 0.000 description 13
- 230000000694 effects Effects 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 235000019198 oils Nutrition 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- 241000700159 Rattus Species 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 241001494479 Pecora Species 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 239000004480 active ingredient Substances 0.000 description 8
- 239000003085 diluting agent Substances 0.000 description 8
- 238000002474 experimental method Methods 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 7
- 230000000507 anthelmentic effect Effects 0.000 description 7
- 230000037396 body weight Effects 0.000 description 7
- 235000013601 eggs Nutrition 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- 235000019341 magnesium sulphate Nutrition 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 241000894007 species Species 0.000 description 7
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 6
- 241001465185 Drechslera avenae Species 0.000 description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 6
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 241000242541 Trematoda Species 0.000 description 6
- 239000000921 anthelmintic agent Substances 0.000 description 6
- 229940124339 anthelmintic agent Drugs 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 229920001817 Agar Polymers 0.000 description 5
- 241000123650 Botrytis cinerea Species 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 241000283903 Ovis aries Species 0.000 description 5
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 5
- 239000008272 agar Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- 239000003995 emulsifying agent Substances 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 5
- 230000000855 fungicidal effect Effects 0.000 description 5
- 239000000417 fungicide Substances 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- SNZXFRFQGXSSGN-UHFFFAOYSA-N phenylsulfanyloxysulfanylbenzene Chemical compound C=1C=CC=CC=1SOSC1=CC=CC=C1 SNZXFRFQGXSSGN-UHFFFAOYSA-N 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 241000196324 Embryophyta Species 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 241000882880 Nematodirus spathiger Species 0.000 description 4
- 241001126259 Nippostrongylus brasiliensis Species 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 238000009835 boiling Methods 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000004563 wettable powder Substances 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 239000005909 Kieselgur Substances 0.000 description 3
- 239000003429 antifungal agent Substances 0.000 description 3
- 229940121375 antifungal agent Drugs 0.000 description 3
- 150000001555 benzenes Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 201000010099 disease Diseases 0.000 description 3
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 3
- 235000013399 edible fruits Nutrition 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 239000012044 organic layer Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000001965 potato dextrose agar Substances 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 230000004580 weight loss Effects 0.000 description 3
- 239000000080 wetting agent Substances 0.000 description 3
- WKJOQYHMXRVQDK-UHFFFAOYSA-N 2-(dimethylamino)acetamide Chemical compound CN(C)CC(N)=O WKJOQYHMXRVQDK-UHFFFAOYSA-N 0.000 description 2
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 2
- UPUDSFHDZIXLGD-UHFFFAOYSA-N 4-(4-amino-3-nitrophenoxy)-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1OC1=CC=C(N)C([N+]([O-])=O)=C1 UPUDSFHDZIXLGD-UHFFFAOYSA-N 0.000 description 2
- HDICMTNFYJBDBJ-UHFFFAOYSA-N 4-ethylsulfanyl-2-nitroaniline Chemical compound CCSC1=CC=C(N)C([N+]([O-])=O)=C1 HDICMTNFYJBDBJ-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 241001273467 Didymella pinodes Species 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- 241000242711 Fasciola hepatica Species 0.000 description 2
- 241000243974 Haemonchus contortus Species 0.000 description 2
- 208000006968 Helminthiasis Diseases 0.000 description 2
- 240000007860 Heteropogon contortus Species 0.000 description 2
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 208000030852 Parasitic disease Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 150000005215 alkyl ethers Chemical class 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 210000000013 bile duct Anatomy 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 244000000004 fungal plant pathogen Species 0.000 description 2
- 210000000232 gallbladder Anatomy 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical group [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 238000011081 inoculation Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- XUEWRZMBDLSTGD-UHFFFAOYSA-N methyl N-[[2-[[2-(dimethylamino)acetyl]amino]-4-methylsulfanylphenyl]carbamothioyl]carbamate hydrochloride Chemical compound Cl.COC(=O)NC(=S)NC1=CC=C(SC)C=C1NC(=O)CN(C)C XUEWRZMBDLSTGD-UHFFFAOYSA-N 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- LBFAAYMITJMZOC-UHFFFAOYSA-N methyl n-(sulfanylidenemethylidene)carbamate Chemical compound COC(=O)N=C=S LBFAAYMITJMZOC-UHFFFAOYSA-N 0.000 description 2
- MECHSUGBJLNQCE-UHFFFAOYSA-N methyl n-[(4-butylsulfanyl-2-nitrophenyl)carbamothioyl]carbamate Chemical compound CCCCSC1=CC=C(NC(=S)NC(=O)OC)C([N+]([O-])=O)=C1 MECHSUGBJLNQCE-UHFFFAOYSA-N 0.000 description 2
- JLDZWCQHRGXEPO-UHFFFAOYSA-N methyl n-[(4-methylsulfanyl-2-nitrophenyl)carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC=C(SC)C=C1[N+]([O-])=O JLDZWCQHRGXEPO-UHFFFAOYSA-N 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229910002055 micronized silica Inorganic materials 0.000 description 2
- HABWONZJSRPOIE-UHFFFAOYSA-N n-[4-(4-acetamidophenyl)sulfinylphenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1S(=O)C1=CC=C(NC(C)=O)C=C1 HABWONZJSRPOIE-UHFFFAOYSA-N 0.000 description 2
- 208000014837 parasitic helminthiasis infectious disease Diseases 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- QUWHIBBGKKRYFW-UHFFFAOYSA-N (4-amino-3-nitrophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1[N+]([O-])=O QUWHIBBGKKRYFW-UHFFFAOYSA-N 0.000 description 1
- GLZPCOQZEFWAFX-JXMROGBWSA-N (E)-Geraniol Chemical compound CC(C)=CCC\C(C)=C\CO GLZPCOQZEFWAFX-JXMROGBWSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- WNKBNVXUYLXITH-UHFFFAOYSA-N 1-bromo-2-ethylsulfanylethane Chemical compound CCSCCBr WNKBNVXUYLXITH-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- FKASAVXZZLJTNX-UHFFFAOYSA-N 2-(dimethylamino)acetic acid;hydrochloride Chemical compound [Cl-].C[NH+](C)CC(O)=O FKASAVXZZLJTNX-UHFFFAOYSA-N 0.000 description 1
- MVAXDKDOPWPFML-UHFFFAOYSA-N 2-(dimethylamino)acetyl chloride;hydrochloride Chemical compound [Cl-].C[NH+](C)CC(Cl)=O MVAXDKDOPWPFML-UHFFFAOYSA-N 0.000 description 1
- UPHOPMSGKZNELG-UHFFFAOYSA-N 2-hydroxynaphthalene-1-carboxylic acid Chemical compound C1=CC=C2C(C(=O)O)=C(O)C=CC2=C1 UPHOPMSGKZNELG-UHFFFAOYSA-N 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- NIXQLMVKRBUSPF-UHFFFAOYSA-N 3-(dimethylamino)propanamide Chemical compound CN(C)CCC(N)=O NIXQLMVKRBUSPF-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- OGRMQKOGSWMPGK-UHFFFAOYSA-N 4-(4-amino-3-nitrophenyl)sulfinyl-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1S(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 OGRMQKOGSWMPGK-UHFFFAOYSA-N 0.000 description 1
- CAEMAVFCMWOXEF-UHFFFAOYSA-N 4-butylsulfanyl-2-nitroaniline Chemical compound CCCCSC1=CC=C(N)C([N+]([O-])=O)=C1 CAEMAVFCMWOXEF-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- LWFOZCFJVOGQAM-UHFFFAOYSA-N 4-methylsulfanyl-2-nitroaniline Chemical compound CSC1=CC=C(N)C([N+]([O-])=O)=C1 LWFOZCFJVOGQAM-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- ZCWXYZBQDNFULS-UHFFFAOYSA-N 5-chloro-2-nitroaniline Chemical compound NC1=CC(Cl)=CC=C1[N+]([O-])=O ZCWXYZBQDNFULS-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 229910002016 Aerosil® 200 Inorganic materials 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 244000144730 Amygdalus persica Species 0.000 description 1
- 241000415078 Anemone hepatica Species 0.000 description 1
- 208000031295 Animal disease Diseases 0.000 description 1
- ZBJJDYGJCNTNTH-UHFFFAOYSA-N Betahistine mesilate Chemical group CS(O)(=O)=O.CS(O)(=O)=O.CNCCC1=CC=CC=N1 ZBJJDYGJCNTNTH-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000190150 Bipolaris sorokiniana Species 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241001465180 Botrytis Species 0.000 description 1
- CASXAEBRLRLQRA-UHFFFAOYSA-N CCSCCSC1=CC(=C(C=C1)NC(=S)NC(=O)OC)NC(=O)CN(C)C Chemical compound CCSCCSC1=CC(=C(C=C1)NC(=S)NC(=O)OC)NC(=O)CN(C)C CASXAEBRLRLQRA-UHFFFAOYSA-N 0.000 description 1
- 241000283707 Capra Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 241000530549 Cercospora beticola Species 0.000 description 1
- 108091005960 Citrine Proteins 0.000 description 1
- 241000371644 Curvularia ravenelii Species 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- JJHHIJFTHRNPIK-UHFFFAOYSA-N Diphenyl sulfoxide Chemical compound C=1C=CC=CC=1S(=O)C1=CC=CC=C1 JJHHIJFTHRNPIK-UHFFFAOYSA-N 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- 241000221779 Fusarium sambucinum Species 0.000 description 1
- 206010017964 Gastrointestinal infection Diseases 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- 241000613118 Gryllus integer Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 101100533890 Hypocrea jecorina (strain QM6a) sor3 gene Proteins 0.000 description 1
- 101100533874 Hypocrea jecorina (strain QM6a) sor5 gene Proteins 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- 241001226034 Nectria <echinoderm> Species 0.000 description 1
- 241001126260 Nippostrongylus Species 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000243795 Ostertagia Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000228143 Penicillium Species 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 235000006040 Prunus persica var persica Nutrition 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- 241001361634 Rhizoctonia Species 0.000 description 1
- 241000235546 Rhizopus stolonifer Species 0.000 description 1
- 241000221662 Sclerotinia Species 0.000 description 1
- 241001533598 Septoria Species 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 241000722093 Tilletia caries Species 0.000 description 1
- 241000243797 Trichostrongylus Species 0.000 description 1
- 241000243796 Trichostrongylus colubriformis Species 0.000 description 1
- 241000514371 Ustilago avenae Species 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 235000009754 Vitis X bourquina Nutrition 0.000 description 1
- 235000012333 Vitis X labruscana Nutrition 0.000 description 1
- 240000006365 Vitis vinifera Species 0.000 description 1
- 235000014787 Vitis vinifera Nutrition 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- IYABWNGZIDDRAK-UHFFFAOYSA-N allene Chemical group C=C=C IYABWNGZIDDRAK-UHFFFAOYSA-N 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 239000010775 animal oil Substances 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000001093 anti-cancer Effects 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- CXPKLBIJYBDPEW-UHFFFAOYSA-N benzenesulfinylbenzene;hydron;chloride Chemical compound [H+].[Cl-].C=1C=CC=CC=1S(=O)C1=CC=CC=C1 CXPKLBIJYBDPEW-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- BRTFVKHPEHKBQF-UHFFFAOYSA-N bromocyclopentane Chemical compound BrC1CCCC1 BRTFVKHPEHKBQF-UHFFFAOYSA-N 0.000 description 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- 239000011035 citrine Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000000084 colloidal system Substances 0.000 description 1
- 239000007799 cork Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 230000001934 delay Effects 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- SPCNPOWOBZQWJK-UHFFFAOYSA-N dimethoxy-(2-propan-2-ylsulfanylethylsulfanyl)-sulfanylidene-$l^{5}-phosphane Chemical compound COP(=S)(OC)SCCSC(C)C SPCNPOWOBZQWJK-UHFFFAOYSA-N 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 238000006266 etherification reaction Methods 0.000 description 1
- LBAQSKZHMLAFHH-UHFFFAOYSA-N ethoxyethane;hydron;chloride Chemical compound Cl.CCOCC LBAQSKZHMLAFHH-UHFFFAOYSA-N 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 208000006275 fascioliasis Diseases 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000005188 flotation Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000009036 growth inhibition Effects 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 210000004209 hair Anatomy 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 244000000013 helminth Species 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 230000001418 larval effect Effects 0.000 description 1
- 229960002809 lindane Drugs 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000009630 liquid culture Methods 0.000 description 1
- 239000006194 liquid suspension Substances 0.000 description 1
- XCOBTUNSZUJCDH-UHFFFAOYSA-B lithium magnesium sodium silicate Chemical compound [Li+].[Li+].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[OH-].[Na+].[Na+].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].[Mg+2].O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3.O1[Si](O2)([O-])O[Si]3([O-])O[Si]1([O-])O[Si]2([O-])O3 XCOBTUNSZUJCDH-UHFFFAOYSA-B 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 238000002803 maceration Methods 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- OQPGWYOYENEUND-UHFFFAOYSA-N methanesulfonic acid phenylsulfanylbenzene Chemical compound CS(O)(=O)=O.C=1C=CC=CC=1SC1=CC=CC=C1 OQPGWYOYENEUND-UHFFFAOYSA-N 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- GXBFDBGTKBGBPR-UHFFFAOYSA-N methyl N-[(4-benzylsulfanyl-2-nitrophenyl)carbamothioyl]carbamate Chemical compound C1=C([N+]([O-])=O)C(NC(=S)NC(=O)OC)=CC=C1SCC1=CC=CC=C1 GXBFDBGTKBGBPR-UHFFFAOYSA-N 0.000 description 1
- BEOBPWTVPWRLPV-UHFFFAOYSA-N methyl N-[(4-cyclopentylsulfanyl-2-nitrophenyl)carbamothioyl]carbamate Chemical compound C1=C([N+]([O-])=O)C(NC(=S)NC(=O)OC)=CC=C1SC1CCCC1 BEOBPWTVPWRLPV-UHFFFAOYSA-N 0.000 description 1
- ZBFWZXPJAOQJNU-UHFFFAOYSA-N methyl N-[[2-amino-4-(2-ethylsulfanylethoxy)phenyl]carbamothioyl]carbamate Chemical compound CCSCCOC1=CC=C(NC(=S)NC(=O)OC)C(N)=C1 ZBFWZXPJAOQJNU-UHFFFAOYSA-N 0.000 description 1
- QDFATYYOTAENID-UHFFFAOYSA-N methyl N-[[4-(2-ethylsulfanylethylsulfanyl)-2-nitrophenyl]carbamothioyl]carbamate Chemical compound CCSCCSC1=CC=C(NC(=S)NC(=O)OC)C([N+]([O-])=O)=C1 QDFATYYOTAENID-UHFFFAOYSA-N 0.000 description 1
- HGVCWLFDVIAFBA-UHFFFAOYSA-N methyl N-[[4-butylsulfanyl-2-[[2-(dimethylamino)acetyl]amino]phenyl]carbamothioyl]carbamate Chemical compound CCCCSC1=CC=C(NC(=S)NC(=O)OC)C(NC(=O)CN(C)C)=C1 HGVCWLFDVIAFBA-UHFFFAOYSA-N 0.000 description 1
- DKYCBRFYFLULCQ-UHFFFAOYSA-N methyl n-[(2-amino-4-butylsulfanylphenyl)carbamothioyl]carbamate Chemical compound CCCCSC1=CC=C(NC(=S)NC(=O)OC)C(N)=C1 DKYCBRFYFLULCQ-UHFFFAOYSA-N 0.000 description 1
- MIADXNLHDJLPOK-UHFFFAOYSA-N methyl n-[(2-amino-4-ethylsulfanylphenyl)carbamothioyl]carbamate Chemical compound CCSC1=CC=C(NC(=S)NC(=O)OC)C(N)=C1 MIADXNLHDJLPOK-UHFFFAOYSA-N 0.000 description 1
- XXQUZXRLUJFDJO-UHFFFAOYSA-N methyl n-[(2-amino-4-methylsulfanylphenyl)carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC=C(SC)C=C1N XXQUZXRLUJFDJO-UHFFFAOYSA-N 0.000 description 1
- KXOAAFABRBJMKP-UHFFFAOYSA-N methyl n-[(2-amino-4-thiocyanatophenyl)carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC=C(SC#N)C=C1N KXOAAFABRBJMKP-UHFFFAOYSA-N 0.000 description 1
- HSBBURJSXVCPJM-UHFFFAOYSA-N methyl n-[(2-nitro-4-thiocyanatophenyl)carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC=C(SC#N)C=C1[N+]([O-])=O HSBBURJSXVCPJM-UHFFFAOYSA-N 0.000 description 1
- UYFKSQXDVNFCNZ-UHFFFAOYSA-N methyl n-[(4-ethylsulfanyl-2-nitrophenyl)carbamothioyl]carbamate Chemical compound CCSC1=CC=C(NC(=S)NC(=O)OC)C([N+]([O-])=O)=C1 UYFKSQXDVNFCNZ-UHFFFAOYSA-N 0.000 description 1
- SJLBZMWUTBSERP-UHFFFAOYSA-N methyl n-[[2-[[2-(dimethylamino)acetyl]amino]-4-ethylsulfanylphenyl]carbamothioyl]carbamate Chemical compound CCSC1=CC=C(NC(=S)NC(=O)OC)C(NC(=O)CN(C)C)=C1 SJLBZMWUTBSERP-UHFFFAOYSA-N 0.000 description 1
- LTNACBLMEIBQRZ-UHFFFAOYSA-N methyl n-[[2-[[2-(dimethylamino)acetyl]amino]phenyl]carbamothioyl]carbamate Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=O)CN(C)C LTNACBLMEIBQRZ-UHFFFAOYSA-N 0.000 description 1
- SRMLPMUWVGBZRU-UHFFFAOYSA-N methyl n-[[2-[[2-(dimethylamino)acetyl]amino]phenyl]carbamothioyl]carbamate;hydrochloride Chemical compound Cl.COC(=O)NC(=S)NC1=CC=CC=C1NC(=O)CN(C)C SRMLPMUWVGBZRU-UHFFFAOYSA-N 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- YIYVAKQNGDFWDA-UHFFFAOYSA-N n-[4-(4-acetamido-3-nitrophenoxy)-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1OC1=CC=C(NC(C)=O)C([N+]([O-])=O)=C1 YIYVAKQNGDFWDA-UHFFFAOYSA-N 0.000 description 1
- CAGPEIJHDIGLRU-UHFFFAOYSA-N n-[4-(4-acetamidophenyl)sulfanylphenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1SC1=CC=C(NC(C)=O)C=C1 CAGPEIJHDIGLRU-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229920001778 nylon Polymers 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- SXUXONJXVIQGLC-UHFFFAOYSA-N oxathiirane 2,2-dioxide Chemical compound O=S1(=O)CO1 SXUXONJXVIQGLC-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000003071 parasitic effect Effects 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 229910001562 pearlite Inorganic materials 0.000 description 1
- 239000012466 permeate Substances 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- WXVUCMFEGJUVTN-UHFFFAOYSA-N phenyl methanesulfonate Chemical compound CS(=O)(=O)OC1=CC=CC=C1 WXVUCMFEGJUVTN-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 150000003385 sodium Chemical class 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical class O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- ZUUZGQPEQORUEV-UHFFFAOYSA-N tetrahydrate;hydrochloride Chemical compound O.O.O.O.Cl ZUUZGQPEQORUEV-UHFFFAOYSA-N 0.000 description 1
- 238000011287 therapeutic dose Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 229940078499 tricalcium phosphate Drugs 0.000 description 1
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 1
- 235000019731 tricalcium phosphate Nutrition 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 230000003442 weekly effect Effects 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/04—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D207/08—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon radicals, substituted by hetero atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C335/00—Thioureas, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C335/04—Derivatives of thiourea
- C07C335/24—Derivatives of thiourea containing any of the groups, X being a hetero atom, Y being any atom
- C07C335/28—Y being a hetero atom, e.g. thiobiuret
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/14—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D295/145—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/15—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals with the ring nitrogen atoms and the carbon atoms with three bonds to hetero atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47889/74A GB1479624A (en) | 1974-11-05 | 1974-11-05 | (3-alkoxycarbonyl-2-thioureido)benzene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PL103009B1 true PL103009B1 (pl) | 1979-05-31 |
Family
ID=10446615
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975197312A PL103009B1 (pl) | 1974-11-05 | 1975-11-04 | Sposob wytwarzania nowych pochodnych benzenu |
| PL1975184502A PL103012B1 (pl) | 1974-11-05 | 1975-11-04 | Sposob wytwarzania nowych pochodnych benzenu |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PL1975184502A PL103012B1 (pl) | 1974-11-05 | 1975-11-04 | Sposob wytwarzania nowych pochodnych benzenu |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4034107A (enExample) |
| JP (1) | JPS5170748A (enExample) |
| AR (1) | AR213741A1 (enExample) |
| AU (1) | AU499314B2 (enExample) |
| BE (1) | BE835242A (enExample) |
| BR (1) | BR7507251A (enExample) |
| CH (3) | CH612934A5 (enExample) |
| DD (2) | DD124228A5 (enExample) |
| DE (1) | DE2549417A1 (enExample) |
| DK (1) | DK495975A (enExample) |
| ES (3) | ES442321A1 (enExample) |
| FR (1) | FR2290195A1 (enExample) |
| GB (1) | GB1479624A (enExample) |
| IE (1) | IE42453B1 (enExample) |
| IL (1) | IL48420A0 (enExample) |
| LU (1) | LU73721A1 (enExample) |
| NL (1) | NL7512928A (enExample) |
| OA (1) | OA05163A (enExample) |
| PL (2) | PL103009B1 (enExample) |
| SE (1) | SE7512349L (enExample) |
| ZA (1) | ZA756920B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU195950B (en) * | 1984-02-29 | 1988-08-29 | Richter Gedeon Vegyeszet | Process for producing nitramino-diaryl-sulfoxide derivatives and pharmaceutics comprising such compounds |
| US5371284A (en) * | 1987-09-03 | 1994-12-06 | Schering Corporation | Phenyl acetylenic acetals |
| DE19829357A1 (de) | 1998-07-01 | 2000-01-05 | Bayer Ag | Verfahren zur Herstellung von 2-Nitro-5-(phenylthio)-anilinen |
| CN103534867B (zh) * | 2011-06-17 | 2017-04-12 | 流体公司 | 含有磺酸根离子的离子液体 |
| US11424484B2 (en) | 2019-01-24 | 2022-08-23 | Octet Scientific, Inc. | Zinc battery electrolyte additive |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2025412A1 (de) * | 1970-05-25 | 1971-12-02 | Farbenfabriken Bayer Ag, 5090 Leverkusen | Amidophenylisothiohamstoffe, Verfahren zu ihrer Herstellung und ihre fungizide Verwendung |
-
1974
- 1974-11-05 GB GB47889/74A patent/GB1479624A/en not_active Expired
-
1975
- 1975-10-30 FR FR7533162A patent/FR2290195A1/fr active Granted
- 1975-11-04 IE IE2391/75A patent/IE42453B1/en unknown
- 1975-11-04 IL IL48420A patent/IL48420A0/xx unknown
- 1975-11-04 NL NL7512928A patent/NL7512928A/xx not_active Application Discontinuation
- 1975-11-04 JP JP50132408A patent/JPS5170748A/ja active Pending
- 1975-11-04 CH CH592078A patent/CH612934A5/xx not_active IP Right Cessation
- 1975-11-04 CH CH1421175A patent/CH610298A5/xx not_active IP Right Cessation
- 1975-11-04 BR BR7507251*1A patent/BR7507251A/pt unknown
- 1975-11-04 LU LU73721A patent/LU73721A1/xx unknown
- 1975-11-04 US US05/628,669 patent/US4034107A/en not_active Expired - Lifetime
- 1975-11-04 CH CH592178A patent/CH612935A5/xx not_active IP Right Cessation
- 1975-11-04 ZA ZA00756920A patent/ZA756920B/xx unknown
- 1975-11-04 BE BE161578A patent/BE835242A/xx unknown
- 1975-11-04 DE DE19752549417 patent/DE2549417A1/de not_active Withdrawn
- 1975-11-04 PL PL1975197312A patent/PL103009B1/pl unknown
- 1975-11-04 DK DK495975A patent/DK495975A/da unknown
- 1975-11-04 OA OA55664A patent/OA05163A/xx unknown
- 1975-11-04 SE SE7512349A patent/SE7512349L/xx unknown
- 1975-11-04 PL PL1975184502A patent/PL103012B1/pl unknown
- 1975-11-04 ES ES442321A patent/ES442321A1/es not_active Expired
- 1975-11-04 AU AU86311/75A patent/AU499314B2/en not_active Expired
- 1975-11-05 DD DD189263A patent/DD124228A5/xx unknown
- 1975-11-05 DD DD7500195892A patent/DD127743A5/xx unknown
-
1976
- 1976-07-20 ES ES449961A patent/ES449961A1/es not_active Expired
- 1976-07-20 ES ES449962A patent/ES449962A1/es not_active Expired
- 1976-12-21 AR AR265941A patent/AR213741A1/es active
Also Published As
| Publication number | Publication date |
|---|---|
| OA05163A (fr) | 1981-01-31 |
| ES442321A1 (es) | 1977-04-16 |
| DD124228A5 (enExample) | 1977-02-09 |
| GB1479624A (en) | 1977-07-13 |
| PL103012B1 (pl) | 1979-05-31 |
| AU8631175A (en) | 1977-05-12 |
| LU73721A1 (enExample) | 1976-09-06 |
| US4034107A (en) | 1977-07-05 |
| DE2549417A1 (de) | 1976-07-29 |
| CH612935A5 (enExample) | 1979-08-31 |
| IL48420A0 (en) | 1976-01-30 |
| BR7507251A (pt) | 1976-08-03 |
| IE42453L (en) | 1976-05-05 |
| CH612934A5 (enExample) | 1979-08-31 |
| SE7512349L (sv) | 1976-05-06 |
| BE835242A (fr) | 1976-05-04 |
| ES449962A1 (es) | 1977-08-16 |
| FR2290195B1 (enExample) | 1979-09-14 |
| CH610298A5 (enExample) | 1979-04-12 |
| JPS5170748A (enExample) | 1976-06-18 |
| ZA756920B (en) | 1976-10-27 |
| AU499314B2 (en) | 1979-04-12 |
| DD127743A5 (de) | 1977-10-12 |
| FR2290195A1 (fr) | 1976-06-04 |
| DK495975A (da) | 1976-05-06 |
| AR213741A1 (es) | 1979-03-15 |
| ES449961A1 (es) | 1977-08-16 |
| IE42453B1 (en) | 1980-08-13 |
| NL7512928A (nl) | 1976-05-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1578852A (en) | Methods of treating plants and crops with propynylamine derivatives and pesticidal preparations suitable therefor | |
| US2302388A (en) | Insecticidal composition containing an amine having one alkoxyalkylene group | |
| US3930835A (en) | Pesticidal compositions and methods employing substituted oxirane compounds | |
| DE2654314A1 (de) | Asymmetrische bis-carbamoylsulfidverbindungen und verfahren zu ihrer herstellung | |
| US3954868A (en) | Bis(diphenylaminomethane) antimicrobial agents | |
| PL103009B1 (pl) | Sposob wytwarzania nowych pochodnych benzenu | |
| CS201020B2 (en) | Fungicide | |
| US3060225A (en) | Aminophenyl carbamates | |
| US3652770A (en) | Combatting phytopathogenic fungi on plants with sub-phytotoxic fungicidally effective amounts of herbicidal oximes of 3 5-dihalosalicylaldehyde | |
| US3443926A (en) | Herbicidal composition and method employing 3-benzyl hydantoins | |
| US2971884A (en) | Method for the control of fungal organisms | |
| EP0010692B1 (de) | Neue m-Anilidurethane, sie enthaltende Herbizide und Verfahren zu deren Herstellung, sowie Verfahren zur Bekämpfung von unerwünschtem Pflanzenwuchs | |
| US3141818A (en) | Biological toxicant | |
| US3084098A (en) | Aminophenyl carbamates | |
| US3224862A (en) | Controlling vegetation with phenylthionocarbamates | |
| US3265563A (en) | Phenyl nu-alkyl thiolcarbamate microbiocide | |
| US3542865A (en) | Ethylenic sulfilimines | |
| DE2442684A1 (de) | (substit.-dialkylphenyl)-alkylsulfide, -sulfoxide und -sulfone und deren verwendung | |
| US3113968A (en) | 1-phenyl, 1-hydroxyalkyl, 3, 3-dialkyl-ureas | |
| US3095437A (en) | Alpha-thiocyanatoalkyl esters of aromatic carboxylic acids | |
| US2973297A (en) | Fungicidal quaternary ammonium salts of dithiocarbamic acids | |
| US3399199A (en) | Nitroalkyl-piperazines | |
| DE2632692A1 (de) | Schaedlingsbekaempfungsmittel | |
| US3453330A (en) | Process for preparing 4 - (phenylthiomethyl) anilines,and 4 - (p - chlorophenylthiomethyl)-n-methyl aniline | |
| US3679622A (en) | Nitroalkyl piperazines as antibacterial agents in aqueous paint solutions |