PH9787A - Blasting slurry compositions containing calcium nitrate - Google Patents
Blasting slurry compositions containing calcium nitrateInfo
- Publication number
- PH9787A PH9787A PH11390A PH11390A PH9787A PH 9787 A PH9787 A PH 9787A PH 11390 A PH11390 A PH 11390A PH 11390 A PH11390 A PH 11390A PH 9787 A PH9787 A PH 9787A
- Authority
- PH
- Philippines
- Prior art keywords
- compositions containing
- calcium nitrate
- containing calcium
- slurry compositions
- blasting slurry
- Prior art date
Links
- ZCCIPPOKBCJFDN-UHFFFAOYSA-N calcium nitrate Chemical compound [Ca+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O ZCCIPPOKBCJFDN-UHFFFAOYSA-N 0.000 title 2
- 238000005422 blasting Methods 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
- 239000002002 slurry Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B47/00—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase
- C06B47/14—Compositions in which the components are separately stored until the moment of burning or explosion, e.g. "Sprengel"-type explosives; Suspensions of solid component in a normally non-explosive liquid phase, including a thickened aqueous phase comprising a solid component and an aqueous phase
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Air Bags (AREA)
- Solid Fuels And Fuel-Associated Substances (AREA)
- Liquid Carbonaceous Fuels (AREA)
- Soil Conditioners And Soil-Stabilizing Materials (AREA)
- Fertilizers (AREA)
- Treatment Of Sludge (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US82109569A | 1969-05-01 | 1969-05-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| PH9787A true PH9787A (en) | 1976-03-17 |
Family
ID=25232488
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| PH11390A PH9787A (en) | 1969-05-01 | 1970-04-30 | Blasting slurry compositions containing calcium nitrate |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3660181A (enFirst) |
| JP (1) | JPS5034606B1 (enFirst) |
| AT (1) | AT299041B (enFirst) |
| BE (1) | BE749690A (enFirst) |
| CA (1) | CA925302A (enFirst) |
| CH (1) | CH553733A (enFirst) |
| DE (1) | DE2020490C3 (enFirst) |
| ES (1) | ES379151A1 (enFirst) |
| FI (1) | FI56167C (enFirst) |
| FR (1) | FR2047172A5 (enFirst) |
| GB (1) | GB1301185A (enFirst) |
| IE (1) | IE34109B1 (enFirst) |
| IL (1) | IL34412A (enFirst) |
| NL (1) | NL7006308A (enFirst) |
| NO (1) | NO125443B (enFirst) |
| OA (1) | OA03307A (enFirst) |
| PH (1) | PH9787A (enFirst) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3816191A (en) * | 1970-05-04 | 1974-06-11 | Dow Chemical Co | Method of making calcium nitrate explosive composition |
| US3839107A (en) * | 1970-05-04 | 1974-10-01 | Dow Chemical Co | Calcium nitrate explosive composition |
| US3787254A (en) * | 1971-06-01 | 1974-01-22 | Ireco Chemicals | Explosive compositions containing calcium nitrate |
| US3890171A (en) * | 1971-11-10 | 1975-06-17 | Ireco Chemicals | Explosive compositions containing guar gum derivative |
| US3886010A (en) * | 1972-07-24 | 1975-05-27 | Ireco Chemicals | Stabilized and aerated blasting slurry containing thiourea and a nitrite gassing agent |
| US3899374A (en) * | 1974-03-29 | 1975-08-12 | Dow Chemical Co | Calcium nitrate explosive composition |
| DE2734779C1 (de) * | 1977-08-02 | 1992-09-24 | Dynamit Nobel Ag | Verfahren zur Herstellung poroeser Treibmittelkoerper |
| CA1096172A (en) * | 1978-11-08 | 1981-02-24 | Anthony C. F. Edmonds | Gelled aqueous slurry explosive containing gas bubbles |
| US6508177B1 (en) | 1999-09-13 | 2003-01-21 | The Ensign-Bickford Company | Explosives with embedded bodies |
| RU2183209C1 (ru) * | 2000-12-26 | 2002-06-10 | Анников Владимир Эдуардович | Водосодержащий пороховой взрывчатый состав |
| RU2243200C2 (ru) * | 2002-09-26 | 2004-12-27 | Смагин Николай Петрович | Водосодержащий взрывчатый состав |
| RU2253642C1 (ru) * | 2003-12-05 | 2005-06-10 | Анников Владимир Эдуардович | Способ изготовления зарядов гелеобразного водосодержащего взрывчатого состава |
| US8114231B2 (en) * | 2005-10-26 | 2012-02-14 | Newcastle Innovation Limited | Gassing of emulsion explosives with nitric oxide |
| US20110132505A1 (en) * | 2007-01-10 | 2011-06-09 | Newcastle Innovation Limited | Method for gassing explosives especially at low temperatures |
| RU2521637C2 (ru) * | 2011-03-14 | 2014-07-10 | Иван Владимирович Бригадин | Водосодержащий пороховой взрывчатый состав |
| WO2013082634A2 (en) * | 2011-11-30 | 2013-06-06 | Ael Mining Services Limited | Base charge explosive formulation |
| RU2537485C2 (ru) * | 2012-09-04 | 2015-01-10 | Михаил Сергеевич Архипов | Водосодержащий взрывчатый состав |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3397097A (en) * | 1966-07-12 | 1968-08-13 | Du Pont | Thickened aqueous inorganic oxidizer salt blasting compositions containing gas bubbles and a crystal habit modifier and method of preparation |
| US3395056A (en) * | 1966-08-01 | 1968-07-30 | Trojan Powder Co | Inorganic oxidizer salt-alcohol explosive slurry containing an alcohol thickening agent |
| US3450582A (en) * | 1967-12-18 | 1969-06-17 | Harold W Sheeran | Aqueous ammonium nitrate blasting composition containing solid carbonaceous fuel and method of preparing same |
| US3522117A (en) * | 1968-08-07 | 1970-07-28 | Du Pont | Aerated water-bearing inorganic oxidizer salt blasting agent containing dissolved and undissolved carbonaceous fuel |
-
1969
- 1969-05-01 US US821095A patent/US3660181A/en not_active Expired - Lifetime
-
1970
- 1970-04-21 GB GB08908/70A patent/GB1301185A/en not_active Expired
- 1970-04-21 IE IE509/70A patent/IE34109B1/xx unknown
- 1970-04-27 DE DE2020490A patent/DE2020490C3/de not_active Expired
- 1970-04-28 JP JP45036003A patent/JPS5034606B1/ja active Pending
- 1970-04-28 BE BE749690D patent/BE749690A/xx not_active IP Right Cessation
- 1970-04-29 IL IL34412A patent/IL34412A/en unknown
- 1970-04-29 ES ES379151A patent/ES379151A1/es not_active Expired
- 1970-04-29 NL NL7006308A patent/NL7006308A/xx unknown
- 1970-04-30 PH PH11390A patent/PH9787A/en unknown
- 1970-04-30 CH CH649970A patent/CH553733A/xx not_active IP Right Cessation
- 1970-04-30 FI FI1228/70A patent/FI56167C/fi not_active IP Right Cessation
- 1970-04-30 NO NO1663/70A patent/NO125443B/no unknown
- 1970-04-30 AT AT396870A patent/AT299041B/de not_active IP Right Cessation
- 1970-04-30 CA CA081604A patent/CA925302A/en not_active Expired
- 1970-04-30 FR FR7015969A patent/FR2047172A5/fr not_active Expired
- 1970-06-29 OA OA53967A patent/OA03307A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| OA03307A (fr) | 1970-12-15 |
| BE749690A (fr) | 1970-10-28 |
| ES379151A1 (es) | 1972-09-01 |
| JPS5034606B1 (enFirst) | 1975-11-10 |
| IE34109L (en) | 1970-11-01 |
| CH553733A (de) | 1974-09-13 |
| US3660181A (en) | 1972-05-02 |
| FI56167C (fi) | 1979-12-10 |
| NO125443B (enFirst) | 1972-09-11 |
| IL34412A (en) | 1973-04-30 |
| FI56167B (fi) | 1979-08-31 |
| GB1301185A (en) | 1972-12-29 |
| IL34412A0 (en) | 1970-10-30 |
| DE2020490C3 (de) | 1974-04-25 |
| DE2020490B2 (de) | 1973-08-16 |
| CA925302A (en) | 1973-05-01 |
| AT299041B (de) | 1972-06-12 |
| IE34109B1 (en) | 1975-02-05 |
| NL7006308A (enFirst) | 1970-11-03 |
| FR2047172A5 (enFirst) | 1971-03-12 |
| DE2020490A1 (de) | 1971-01-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ZM9870A1 (en) | Blasting agent package | |
| ZA713355B (en) | Blasting explosive composition | |
| PH9787A (en) | Blasting slurry compositions containing calcium nitrate | |
| ZA743305B (en) | Calcium nitrate explosive composition | |
| CA997935A (en) | Slurry blasting compositions | |
| ZA722094B (en) | Explosive compositions containing calcium nitrate | |
| ZM9269A1 (en) | A slurry explosive composition | |
| IL35445A0 (en) | Dense explosive slurry compositions of high energy | |
| ZA721034B (en) | Explosives compositions | |
| ZA703894B (en) | Water-bearing explosive compositions | |
| ZA721035B (en) | Explosives compositions | |
| PH11777A (en) | Stabilized aerated blasting slurry | |
| ZA721036B (en) | Explosives compositions | |
| ZA723020B (en) | Slurry explosive composition | |
| ZA7299B (en) | Slurry explosive compositions | |
| AU449132B2 (en) | Blasting slurry compositions containing calcium nitrate and method of preparation | |
| AU1420370A (en) | Blasting slurry compositions containing calcium nitrate and method of preparation | |
| ZA703328B (en) | Pestricidal compounds and compositions containing them | |
| CA824618A (en) | Slurry type blasting agents | |
| ZM6770A1 (en) | Improvements in explosive compositions | |
| ZM5370A1 (en) | Blasting slurry compositions containing calcium nitrate and method of preparation | |
| ZA704119B (en) | Diamond synthesis | |
| ZM18571A1 (en) | Slurry explosive compositions | |
| ZM14569A1 (en) | Explosive compositions | |
| ZM15369A1 (en) | Blasting slurries containing highly cross-linked thickeners |