NZ275060A - Free radical polymerisation using an ethylenically unsaturated chain transfer agent; various unsaturated di- and tricarboxylic acid ester compounds - Google Patents
Free radical polymerisation using an ethylenically unsaturated chain transfer agent; various unsaturated di- and tricarboxylic acid ester compoundsInfo
- Publication number
- NZ275060A NZ275060A NZ275060A NZ27506094A NZ275060A NZ 275060 A NZ275060 A NZ 275060A NZ 275060 A NZ275060 A NZ 275060A NZ 27506094 A NZ27506094 A NZ 27506094A NZ 275060 A NZ275060 A NZ 275060A
- Authority
- NZ
- New Zealand
- Prior art keywords
- alkyl
- formula
- chain transfer
- phenyl
- halogen
- Prior art date
Links
- -1 tricarboxylic acid ester compounds Chemical class 0.000 title claims description 19
- 239000012986 chain transfer agent Substances 0.000 title claims description 11
- 150000003254 radicals Chemical class 0.000 title claims description 11
- 238000000034 method Methods 0.000 claims description 47
- 238000006116 polymerization reaction Methods 0.000 claims description 34
- 238000012546 transfer Methods 0.000 claims description 27
- 150000001875 compounds Chemical class 0.000 claims description 25
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 229920000642 polymer Polymers 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 20
- 150000002367 halogens Chemical class 0.000 claims description 20
- 125000003107 substituted aryl group Chemical group 0.000 claims description 20
- 239000000178 monomer Substances 0.000 claims description 19
- 239000003795 chemical substances by application Substances 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 17
- 229910052739 hydrogen Inorganic materials 0.000 claims description 17
- 238000006243 chemical reaction Methods 0.000 claims description 16
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 13
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 125000003545 alkoxy group Chemical group 0.000 claims description 11
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 10
- 125000004423 acyloxy group Chemical group 0.000 claims description 5
- 101100516563 Caenorhabditis elegans nhr-6 gene Proteins 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000000304 alkynyl group Chemical group 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 239000011541 reaction mixture Substances 0.000 claims description 4
- 125000006539 C12 alkyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims description 3
- UTLKVCIOARHVOM-UHFFFAOYSA-N triethyl 1-methylbut-3-ene-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(=C)CC(C)(C(=O)OCC)C(=O)OCC UTLKVCIOARHVOM-UHFFFAOYSA-N 0.000 claims description 3
- ULBRTEPRZCTYAY-UHFFFAOYSA-N 3-o-tert-butyl 1-o,1-o-diethyl 1,2-dimethylbut-3-ene-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(C)(C(=O)OCC)C(C)C(=C)C(=O)OC(C)(C)C ULBRTEPRZCTYAY-UHFFFAOYSA-N 0.000 claims description 2
- 125000002837 carbocyclic group Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- OIQIINDDIVQBMS-UHFFFAOYSA-N diethyl 2-methyl-2-(2-phenylprop-2-enyl)propanedioate Chemical compound CCOC(=O)C(C)(C(=O)OCC)CC(=C)C1=CC=CC=C1 OIQIINDDIVQBMS-UHFFFAOYSA-N 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- 125000001261 isocyanato group Chemical group *N=C=O 0.000 claims description 2
- SIRCUUQBIRQYQG-UHFFFAOYSA-N triethyl 1-benzylbut-3-ene-1,1,3-tricarboxylate Chemical compound CCOC(=O)C(=C)CC(C(=O)OCC)(C(=O)OCC)CC1=CC=CC=C1 SIRCUUQBIRQYQG-UHFFFAOYSA-N 0.000 claims description 2
- ZZDGAYPTRCZOFI-UHFFFAOYSA-N triethyl hex-1-ene-1,3,3-tricarboxylate Chemical compound CCOC(=O)C(=C)CC(CC)(C(=O)OCC)C(=O)OCC ZZDGAYPTRCZOFI-UHFFFAOYSA-N 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 4
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims 2
- 125000001153 fluoro group Chemical group F* 0.000 claims 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 104
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical class COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 14
- 101150041968 CDC13 gene Proteins 0.000 description 13
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 13
- 238000005160 1H NMR spectroscopy Methods 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- 150000003573 thiols Chemical class 0.000 description 10
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 9
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- 229910000104 sodium hydride Inorganic materials 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- OZAIFHULBGXAKX-UHFFFAOYSA-N 2,2'-azo-bis-isobutyronitrile Substances N#CC(C)(C)N=NC(C)(C)C#N OZAIFHULBGXAKX-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 125000000746 allylic group Chemical group 0.000 description 6
- 238000005227 gel permeation chromatography Methods 0.000 description 6
- SOGAXMICEFXMKE-UHFFFAOYSA-N Butylmethacrylate Chemical compound CCCCOC(=O)C(C)=C SOGAXMICEFXMKE-UHFFFAOYSA-N 0.000 description 5
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 5
- 229920002223 polystyrene Polymers 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- UPQZOUHVTJNGFK-UHFFFAOYSA-N diethyl 2-methylpropanedioate Chemical compound CCOC(=O)C(C)C(=O)OCC UPQZOUHVTJNGFK-UHFFFAOYSA-N 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 229960001866 silicon dioxide Drugs 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 3
- 229920002554 vinyl polymer Polymers 0.000 description 3
- 239000003039 volatile agent Substances 0.000 description 3
- JLIDRDJNLAWIKT-UHFFFAOYSA-N 1,2-dimethyl-3h-benzo[e]indole Chemical compound C1=CC=CC2=C(C(=C(C)N3)C)C3=CC=C21 JLIDRDJNLAWIKT-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- ROOXNKNUYICQNP-UHFFFAOYSA-N ammonium persulfate Chemical compound [NH4+].[NH4+].[O-]S(=O)(=O)OOS([O-])(=O)=O ROOXNKNUYICQNP-UHFFFAOYSA-N 0.000 description 2
- DULCUDSUACXJJC-UHFFFAOYSA-N benzeneacetic acid ethyl ester Natural products CCOC(=O)CC1=CC=CC=C1 DULCUDSUACXJJC-UHFFFAOYSA-N 0.000 description 2
- 239000000460 chlorine Chemical group 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 238000007872 degassing Methods 0.000 description 2
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 239000003999 initiator Substances 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 2
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000001902 propagating effect Effects 0.000 description 2
- 238000010526 radical polymerization reaction Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 241000894007 species Species 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- FCXJFSIYRGTDEI-DUXPYHPUSA-N (z)-2-(bromomethyl)but-2-enoic acid Chemical compound C\C=C(/CBr)C(O)=O FCXJFSIYRGTDEI-DUXPYHPUSA-N 0.000 description 1
- ZRZHXNCATOYMJH-UHFFFAOYSA-N 1-(chloromethyl)-4-ethenylbenzene Chemical compound ClCC1=CC=C(C=C)C=C1 ZRZHXNCATOYMJH-UHFFFAOYSA-N 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- FALCMQXTWHPRIH-UHFFFAOYSA-N 2,3-dichloroprop-1-ene Chemical compound ClCC(Cl)=C FALCMQXTWHPRIH-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 1
- WDQMWEYDKDCEHT-UHFFFAOYSA-N 2-ethylhexyl 2-methylprop-2-enoate Chemical compound CCCCC(CC)COC(=O)C(C)=C WDQMWEYDKDCEHT-UHFFFAOYSA-N 0.000 description 1
- WWYDYZMNFQIYPT-UHFFFAOYSA-L 2-phenylpropanedioate Chemical compound [O-]C(=O)C(C([O-])=O)C1=CC=CC=C1 WWYDYZMNFQIYPT-UHFFFAOYSA-L 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- KGIGUEBEKRSTEW-UHFFFAOYSA-N 2-vinylpyridine Chemical compound C=CC1=CC=CC=N1 KGIGUEBEKRSTEW-UHFFFAOYSA-N 0.000 description 1
- QZPSOSOOLFHYRR-UHFFFAOYSA-N 3-hydroxypropyl prop-2-enoate Chemical compound OCCCOC(=O)C=C QZPSOSOOLFHYRR-UHFFFAOYSA-N 0.000 description 1
- VFXXTYGQYWRHJP-UHFFFAOYSA-N 4,4'-azobis(4-cyanopentanoic acid) Chemical compound OC(=O)CCC(C)(C#N)N=NC(C)(CCC(O)=O)C#N VFXXTYGQYWRHJP-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- OZAIFHULBGXAKX-VAWYXSNFSA-N AIBN Substances N#CC(C)(C)\N=N\C(C)(C)C#N OZAIFHULBGXAKX-VAWYXSNFSA-N 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004103 aminoalkyl group Chemical group 0.000 description 1
- 229910001870 ammonium persulfate Inorganic materials 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Chemical group 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- PIMMJVRSKGYDBZ-UHFFFAOYSA-N dimethyl 2,2-dimethyl-4-methylidenepentanedioate Chemical compound COC(=O)C(=C)CC(C)(C)C(=O)OC PIMMJVRSKGYDBZ-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920001002 functional polymer Polymers 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 150000002690 malonic acid derivatives Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/593—Dicarboxylic acid esters having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/52—Esters of acyclic unsaturated carboxylic acids having the esterified carboxyl group bound to an acyclic carbon atom
- C07C69/604—Polycarboxylic acid esters, the acid moiety containing more than two carboxyl groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/612—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a six-membered aromatic ring in the acid moiety
- C07C69/618—Esters of carboxylic acids having a carboxyl group bound to an acyclic carbon atom and having a six-membered aromatic ring in the acid moiety having unsaturation outside the six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2/00—Processes of polymerisation
- C08F2/38—Polymerisation using regulators, e.g. chain terminating agents, e.g. telomerisation
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Polymerisation Methods In General (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| AUPM218893 | 1993-11-03 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ275060A true NZ275060A (en) | 1997-06-24 |
Family
ID=3777325
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ275060A NZ275060A (en) | 1993-11-03 | 1994-11-02 | Free radical polymerisation using an ethylenically unsaturated chain transfer agent; various unsaturated di- and tricarboxylic acid ester compounds |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US5773543A (enExample) |
| EP (1) | EP0729449B1 (enExample) |
| JP (1) | JPH09510181A (enExample) |
| KR (1) | KR100255831B1 (enExample) |
| CN (2) | CN1082965C (enExample) |
| BR (1) | BR9408154A (enExample) |
| CA (1) | CA2175655A1 (enExample) |
| DE (1) | DE69422931T2 (enExample) |
| DK (1) | DK0729449T3 (enExample) |
| ES (1) | ES2143557T3 (enExample) |
| IL (1) | IL111484A (enExample) |
| NZ (1) | NZ275060A (enExample) |
| TW (1) | TW287168B (enExample) |
| WO (1) | WO1995012568A1 (enExample) |
| ZA (1) | ZA948673B (enExample) |
Families Citing this family (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AUPM930394A0 (en) * | 1994-11-09 | 1994-12-01 | Commonwealth Scientific And Industrial Research Organisation | Block copolymer synthesis |
| AUPN585595A0 (en) * | 1995-10-06 | 1995-11-02 | Commonwealth Scientific And Industrial Research Organisation | Control of molecular weight and end-group functionality in polymers |
| DE69702983T2 (de) * | 1996-07-18 | 2001-03-29 | The Dow Chemical Co., Midland | Herstellung von verzweigten polymeren |
| US6316519B1 (en) * | 1997-02-19 | 2001-11-13 | E. I. Du Pont De Nemours And Company | Molecular weight controlled polymers by photopolymerization |
| NZ502607A (en) * | 1997-07-17 | 2002-08-28 | Branched polyolefin synthesis using an anionic initiator and at least one vinylic monomer | |
| US6740723B2 (en) | 1997-07-17 | 2004-05-25 | E. I. Du Pont De Nemours And Company | Branched polyolefin synthesis |
| FR2773161B1 (fr) * | 1997-12-31 | 2000-01-21 | Rhodia Chimie Sa | Procede de synthese de polymeres a blocs |
| US6218503B1 (en) | 1998-05-15 | 2001-04-17 | Bausch & Lomb Incorporated | Silicone-containing prepolymers |
| US6008317A (en) * | 1998-05-15 | 1999-12-28 | Bausch & Lomb Incorporated | Hydroxy or amino terminated hydrophilic polymers |
| US6399731B2 (en) | 1998-10-08 | 2002-06-04 | The University Of Akron | Chain transfer agents and its use in polymer synthesis |
| CA2355252C (en) * | 1998-12-18 | 2008-03-04 | Basf Coatings Ag | Method for producing a polymer reaction product |
| DE19930066A1 (de) | 1999-06-30 | 2001-01-11 | Basf Coatings Ag | Farb- und/oder effektgebende Mehrschichtlackierung, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19930067A1 (de) | 1999-06-30 | 2001-01-11 | Basf Coatings Ag | Beschichtungsstoff und seine Verwendung zur Herstellung von Füllerschichten und Steinschlagschutzgrundierungen |
| DE19930664A1 (de) | 1999-07-02 | 2001-01-11 | Basf Coatings Ag | Klarlack und seine Verwendung zur Herstellung von Klarlackierungen und farb- und/oder effektgebenden Mehrschichtlackierungen |
| DE19930665A1 (de) | 1999-07-02 | 2001-01-11 | Basf Coatings Ag | Basislack und seine Verwendung zur Herstellung von farb- und/oder effektgebenden Basislackierungen und Mehrschichtlackierung |
| DE19959923A1 (de) | 1999-12-11 | 2001-06-28 | Basf Coatings Ag | Wäßrige Primärdispersionen und Beschichtungsstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19959927A1 (de) | 1999-12-11 | 2002-02-07 | Basf Coatings Ag | Wäßrige Primärdispersionen und Beschichtungsstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE19961040A1 (de) * | 1999-12-16 | 2001-06-21 | Basf Ag | Thermoplastische Formmassen mit verbessertem Verarbeitungsverhalten auf Basis von Polyarylenethersulfonen und Polyamiden |
| DE10005819A1 (de) | 2000-02-10 | 2001-08-23 | Basf Coatings Ag | Wäßrige Primärdispersionen, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10018078A1 (de) * | 2000-04-12 | 2001-11-08 | Basf Coatings Ag | Formmassen und Verfahren zur Herstellung von Formkörpern |
| DE10018601A1 (de) * | 2000-04-14 | 2001-10-25 | Basf Coatings Ag | Wäßrige Primärdispersionen und Beschichtungsstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10029695A1 (de) * | 2000-06-16 | 2001-12-20 | Basf Ag | Verfahren zur Herstellung eines polymeren Umsetzungsprodukts |
| DE10048258B4 (de) | 2000-09-29 | 2004-08-19 | Byk-Chemie Gmbh | Verlaufmittel für Oberflächenbeschichtungen |
| DE10126650B4 (de) * | 2001-06-01 | 2005-08-18 | Basf Coatings Ag | Funktionale organische Pulver, Verfahren zu ihrer Herstellung und ihre Verwendung |
| DE10126651A1 (de) * | 2001-06-01 | 2002-12-12 | Basf Coatings Ag | Pulverlacksuspensionen (Pulverslurries) und Pulverlacke, Verfahren zu ihrer Herstellung und ihre Verwendung |
| CN101010369B (zh) | 2004-08-31 | 2010-12-22 | 西巴特殊化学品控股有限公司 | 有机材料的稳定 |
| US8877830B2 (en) | 2005-02-10 | 2014-11-04 | The Regents Of The University Of Colorado, A Body Corporate | Stress relief for crosslinked polymers |
| US7943680B2 (en) * | 2005-02-10 | 2011-05-17 | The Regents Of The University Of Colorado | Stress relaxation in crosslinked polymers |
| US20120208965A1 (en) | 2011-02-15 | 2012-08-16 | 3M Innovative Properties Company | Addition-fragmentation agents |
| US10370322B2 (en) | 2011-02-15 | 2019-08-06 | 3M Innovative Properties Company | Addition-fragmentation agents |
| US9758597B2 (en) | 2011-08-05 | 2017-09-12 | The Regents Of The University Of Colorado, A Body Corporate | Reducing polymerization-induced shrinkage stress by reversible addition-fragmentation chain transfer |
| EP2794675B1 (en) * | 2011-12-22 | 2016-02-24 | Dow Global Technologies LLC | Ethylene-based polymers with improved melt strength and processes for the same |
| CN111171198B (zh) * | 2020-01-17 | 2020-12-29 | 中国科学院长春应用化学研究所 | 一种简单、低成本合成低分子量聚苯乙烯的方法 |
| KR20240170572A (ko) * | 2022-04-06 | 2024-12-03 | 고쿠리츠 다이가쿠 호우징 신슈 다이가쿠 | 연쇄 이동제, 중합체의 제조 방법, 중합체, 점착제 조성물 및 중합체 입자 |
Family Cites Families (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3707529A (en) * | 1970-09-04 | 1972-12-26 | Du Pont | Elastomeric vinylidene fluoride polymers with 55-95 percent non-ionic end groups |
| US3839309A (en) * | 1972-10-02 | 1974-10-01 | Owens Illinois Inc | Polyacrylamide derivatives and method of insolubilizing enzymes therewith |
| US4032699A (en) * | 1975-09-15 | 1977-06-28 | Minnesota Mining And Manufacturing Company | Fluid resistant terpolymer compositions |
| US4124753A (en) * | 1975-10-23 | 1978-11-07 | Allied Chemical Corporation | Process for the preparation of ethylene polymer telomer waxes employing non-toxic 2-t-butylazo-2-cyanobutane at about 140° C giving high production rates and lower reactor fouling |
| GB1556999A (en) * | 1975-10-31 | 1979-12-05 | Shell Int Research | Unsaturated carboxylic acids |
| JPS52111509A (en) * | 1976-03-15 | 1977-09-19 | Sumitomo Chem Co Ltd | Preparation of unsaturated compounds |
| DE2952697A1 (de) * | 1979-12-29 | 1981-07-02 | Hoechst Ag, 6230 Frankfurt | Durch strahlung polymerisierbares gemisch und damit hergestelltes strahlungsempfindliches kopiermaterial |
| US4503207A (en) * | 1983-07-05 | 1985-03-05 | Basf Wyandotte Corporation | Process for the preparation of acrylamide graft polymer dispersions |
| US4524197A (en) * | 1984-08-28 | 1985-06-18 | E. I. Du Pont De Nemours And Company | Process for making vinylidene fluoride containing fluoroelastomers |
| DE3512633A1 (de) * | 1985-04-06 | 1986-10-09 | Hoechst Ag, 6230 Frankfurt | Stabile, waessrige kolloidale dispersionen von copolymerisaten des typs tetrafluorethylen-ethylen und verfahren zu deren herstellung |
| ES2053582T3 (es) * | 1986-08-13 | 1994-08-01 | Ciba Geigy Ag | Procedimiento para la obtencion de derivados del acido 5-amino-4-hidroxivalerianico. |
| ATE129719T1 (de) * | 1986-12-05 | 1995-11-15 | Commw Scient Ind Res Org | Regelung des molekulargewichts und der endgruppenfunktionaltität von polymeren. |
| AU605534B2 (en) * | 1986-12-05 | 1991-01-17 | Commonwealth Scientific And Industrial Research Organisation | Control of molecular weight and end group functionality of polymers |
| US5385996A (en) * | 1986-12-05 | 1995-01-31 | Commonwealth Scientific And Industrial Research Organisation | Control of molecular weight and end-group functionality of polymers |
| US4753981A (en) * | 1987-04-01 | 1988-06-28 | Phillips Petroleum Company | Polymerization process |
| AU6616990A (en) * | 1989-11-01 | 1991-05-31 | Commonwealth Scientific And Industrial Research Organisation | Control of molecular weight and end group functionality in polymers using unsaturated peroxy compounds as chain transfer agents |
| WO1991006535A1 (en) * | 1989-11-01 | 1991-05-16 | Commonwealth Scientific And Industrial Research Organisation | Control of molecular weight and end group functionality in polymers using unsaturated peroxy compounds as chain transfer agents |
| US5260392A (en) * | 1991-07-24 | 1993-11-09 | Ausimont S.P.A. | Ionically vulcanizable fluoroelastomeric copolymers |
| US5208305A (en) * | 1992-04-17 | 1993-05-04 | Minnesota Mining And Manufacturing Company | Fluorine-containing polymers and preparation and use thereof |
| KR0161999B1 (ko) * | 1992-05-01 | 1999-01-15 | 미리암 디. 메코나헤이 | 거대단량체 연쇄 이동제를 이용한 가교결합성 중합체의 제법 |
| US5264530A (en) * | 1992-05-01 | 1993-11-23 | E. I. Du Pont De Nemours And Company | Process of polymerization in an aqueous system |
| WO2004040847A1 (en) * | 2002-10-30 | 2004-05-13 | Nokia Corporation | Method and device for simulating a communication on a terminal device |
-
1994
- 1994-11-01 IL IL11148494A patent/IL111484A/en not_active IP Right Cessation
- 1994-11-02 CA CA002175655A patent/CA2175655A1/en not_active Abandoned
- 1994-11-02 US US08/635,907 patent/US5773543A/en not_active Expired - Fee Related
- 1994-11-02 KR KR1019960702293A patent/KR100255831B1/ko not_active Expired - Fee Related
- 1994-11-02 ES ES94931465T patent/ES2143557T3/es not_active Expired - Lifetime
- 1994-11-02 EP EP94931465A patent/EP0729449B1/en not_active Expired - Lifetime
- 1994-11-02 WO PCT/AU1994/000672 patent/WO1995012568A1/en not_active Ceased
- 1994-11-02 JP JP7512915A patent/JPH09510181A/ja not_active Ceased
- 1994-11-02 CN CN94194602A patent/CN1082965C/zh not_active Expired - Fee Related
- 1994-11-02 NZ NZ275060A patent/NZ275060A/en unknown
- 1994-11-02 BR BR9408154A patent/BR9408154A/pt not_active IP Right Cessation
- 1994-11-02 DK DK94931465T patent/DK0729449T3/da active
- 1994-11-02 DE DE69422931T patent/DE69422931T2/de not_active Expired - Fee Related
- 1994-11-03 ZA ZA948673A patent/ZA948673B/xx unknown
- 1994-11-03 TW TW083110131A patent/TW287168B/zh active
-
2001
- 2001-09-18 CN CN01140852A patent/CN1389451A/zh active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| EP0729449B1 (en) | 2000-02-02 |
| IL111484A (en) | 2001-06-14 |
| ZA948673B (en) | 1995-07-04 |
| IL111484A0 (en) | 1995-01-24 |
| KR960705764A (ko) | 1996-11-08 |
| EP0729449A1 (en) | 1996-09-04 |
| DE69422931D1 (de) | 2000-03-09 |
| BR9408154A (pt) | 1997-08-05 |
| CA2175655A1 (en) | 1995-05-11 |
| EP0729449A4 (en) | 1997-01-22 |
| KR100255831B1 (ko) | 2000-05-01 |
| JPH09510181A (ja) | 1997-10-14 |
| DK0729449T3 (da) | 2000-05-15 |
| DE69422931T2 (de) | 2000-10-05 |
| US5773543A (en) | 1998-06-30 |
| TW287168B (enExample) | 1996-10-01 |
| ES2143557T3 (es) | 2000-05-16 |
| CN1389451A (zh) | 2003-01-08 |
| CN1082965C (zh) | 2002-04-17 |
| WO1995012568A1 (en) | 1995-05-11 |
| CN1138320A (zh) | 1996-12-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0729449B1 (en) | Allylic chain transfer agents | |
| US5362826A (en) | Method of preparing macrmonomer compositions | |
| US6235857B1 (en) | Control of molecular weight and end-group functionality in polymers | |
| EP0586379B1 (en) | Polymerisation regulation | |
| US5385996A (en) | Control of molecular weight and end-group functionality of polymers | |
| US5932675A (en) | Free-radical chain transfer polymerization process | |
| WO1991006535A1 (en) | Control of molecular weight and end group functionality in polymers using unsaturated peroxy compounds as chain transfer agents | |
| EP0041396B1 (en) | Dienyl methacrylates | |
| US20030149211A1 (en) | Branched polyolefin synthesis | |
| US5977278A (en) | Polymers formed from allylic chain transfer agents | |
| AU688403B2 (en) | Allylic chain transfer agents | |
| KR100252615B1 (ko) | 신규한 펜테노에이트 유도체 | |
| JP2002529438A (ja) | α−メチレン−β−ヒドロキシ酸エステル誘導体の製造方法と使用 | |
| US4041229A (en) | Polymeric fluoromethylated dienes | |
| US4766187A (en) | Copolymerizable ethylenically unsaturated surfactants for latex preparation | |
| US6034263A (en) | Control of molecular weight and end group functionality in polymers using unsaturated peroxy compounds as chain transfer agents | |
| US4683100A (en) | Copolymerizable ethylenically unsaturated surfactants for latex preparation | |
| CA2192271C (en) | N-vinylformamidopropionates and process for their synthesis | |
| US6197905B1 (en) | Process for producing polymers or oligomers of controlled molecular weight and end group functionalities | |
| US4004073A (en) | Polymeric fluoromethylated dienes | |
| JP2554644B2 (ja) | 新規なホスフイニル含有エチレン系不飽和化合物 | |
| FI85860B (fi) | Nya etyleniskt omaettade foereningar innehaollande fosfinyl. | |
| JPH08225585A (ja) | 新規なホスフィニル含有エチレン系不飽和化合物を含むポリマー組成物 | |
| AU720690B2 (en) | Control of molecular weight and end-group functionality in polymers | |
| AU6616990A (en) | Control of molecular weight and end group functionality in polymers using unsaturated peroxy compounds as chain transfer agents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| RENW | Renewal (renewal fees accepted) |