NZ206933A - Processes for the preparation of cyanotetrachlorobenzenes - Google Patents
Processes for the preparation of cyanotetrachlorobenzenesInfo
- Publication number
- NZ206933A NZ206933A NZ206933A NZ20693384A NZ206933A NZ 206933 A NZ206933 A NZ 206933A NZ 206933 A NZ206933 A NZ 206933A NZ 20693384 A NZ20693384 A NZ 20693384A NZ 206933 A NZ206933 A NZ 206933A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formula
- group
- compound
- process according
- chloro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 8
- IDOFZVGHXAVYEZ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzonitrile Chemical class ClC1=CC(C#N)=C(Cl)C(Cl)=C1Cl IDOFZVGHXAVYEZ-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 12
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 10
- 239000012071 phase Substances 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 239000003444 phase transfer catalyst Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- -1 alkaline earth metal cyanide Chemical class 0.000 claims description 5
- XDIPOBQVBXLETD-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1[N+]([O-])=O XDIPOBQVBXLETD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000012074 organic phase Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- OQHXZZGZASQSOB-UHFFFAOYSA-N 3,4,5,6-tetrachlorobenzene-1,2-dicarbonitrile Chemical compound ClC1=C(Cl)C(Cl)=C(C#N)C(C#N)=C1Cl OQHXZZGZASQSOB-UHFFFAOYSA-N 0.000 claims description 3
- 239000012044 organic layer Substances 0.000 claims description 3
- YXODCXKIYJZGJP-UHFFFAOYSA-N 1,2,3,5-tetrachloro-4,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C([N+]([O-])=O)=C1Cl YXODCXKIYJZGJP-UHFFFAOYSA-N 0.000 claims description 2
- BILGRKOXNIFEIW-UHFFFAOYSA-N 1,2,4,5-tetrachloro-3,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C([N+]([O-])=O)C(Cl)=C1Cl BILGRKOXNIFEIW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 239000008346 aqueous phase Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 238000002329 infrared spectrum Methods 0.000 claims 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- TXRVDQMSXQKAPG-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(Cl)=C1C#N TXRVDQMSXQKAPG-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000004949 mass spectrometry Methods 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 239000000376 reactant Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 4
- RUEXKAHPMLPNRB-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C#N RUEXKAHPMLPNRB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical group [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960002798 cetrimide Drugs 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- XQTLDIFVVHJORV-UHFFFAOYSA-N tecnazene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl XQTLDIFVVHJORV-UHFFFAOYSA-N 0.000 description 2
- GBDZXPJXOMHESU-UHFFFAOYSA-N 1,2,3,4-tetrachlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1Cl GBDZXPJXOMHESU-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- SDXUIOOHCIQXRP-UHFFFAOYSA-N 1,2,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(F)C=C1F SDXUIOOHCIQXRP-UHFFFAOYSA-N 0.000 description 1
- VQKOZGJGPMLGMG-UHFFFAOYSA-N 2,3,4,6-tetrachloro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(C#N)=C1Cl VQKOZGJGPMLGMG-UHFFFAOYSA-N 0.000 description 1
- OEKCJRHVUDTDIR-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(C#N)C(Cl)=C1Cl OEKCJRHVUDTDIR-UHFFFAOYSA-N 0.000 description 1
- PCRSJGWFEMHHEW-UHFFFAOYSA-N 2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile Chemical compound FC1=C(F)C(C#N)=C(F)C(F)=C1C#N PCRSJGWFEMHHEW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- VMWZRHGIAVCFNS-UHFFFAOYSA-J aluminum;lithium;tetrahydroxide Chemical compound [Li+].[OH-].[OH-].[OH-].[OH-].[Al+3] VMWZRHGIAVCFNS-UHFFFAOYSA-J 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical class [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838304161A GB8304161D0 (en) | 1983-02-15 | 1983-02-15 | Chemical process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ206933A true NZ206933A (en) | 1987-05-29 |
Family
ID=10538027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ206933A NZ206933A (en) | 1983-02-15 | 1984-01-25 | Processes for the preparation of cyanotetrachlorobenzenes |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4517129A (enExample) |
| EP (1) | EP0118971B1 (enExample) |
| JP (1) | JPS59167554A (enExample) |
| AU (1) | AU562717B2 (enExample) |
| CA (1) | CA1213904A (enExample) |
| DE (1) | DE3475515D1 (enExample) |
| GB (1) | GB8304161D0 (enExample) |
| NZ (1) | NZ206933A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4965394A (en) * | 1986-04-18 | 1990-10-23 | Ici Americas Inc. | Difunctional polyfluoroaromatic derivatives and a process of preparing the same |
| US4866185A (en) * | 1986-04-18 | 1989-09-12 | Ici Americas Inc. | Difunctional polyfluoroaromatic derivatives and a process of preparing the same |
| US4783547A (en) * | 1986-04-18 | 1988-11-08 | Ici Americas Inc. | Polyfluoroaromatic nitriles |
| JPH01125360A (ja) * | 1987-11-11 | 1989-05-17 | Idemitsu Kosan Co Ltd | ジハロゲン化ベンゾニトリルの精製方法 |
| EP0459196B1 (de) * | 1990-05-26 | 1994-03-30 | Bayer Ag | Fluormethylierte Polycyanbenzole, deren Alkalicyanid-Addukte, Verfahren zu ihrer Herstellung und Verwendung der fluormethylierten Polycyanbenzole |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT219592B (de) * | 1959-04-28 | 1962-02-12 | Philips Nv | Verfahren zur Herstellung von 2,6-Dichlorbenzonitril |
| GB1207725A (en) * | 1968-02-29 | 1970-10-07 | Cecil Arthur Clark | Nitrocyanobenzene derivatives and fungicidal compositions containing the same |
| US3869494A (en) * | 1972-08-07 | 1975-03-04 | Diamond Shamrock Corp | Production of tetrachlorophthalonitriles |
| US4211721A (en) * | 1978-12-04 | 1980-07-08 | Hooker Chemicals & Plastics Corp. | Process for the preparation of aromatic nitriles |
-
1983
- 1983-02-15 GB GB838304161A patent/GB8304161D0/en active Pending
-
1984
- 1984-01-18 EP EP84300304A patent/EP0118971B1/en not_active Expired
- 1984-01-18 DE DE8484300304T patent/DE3475515D1/de not_active Expired
- 1984-01-25 NZ NZ206933A patent/NZ206933A/en unknown
- 1984-01-31 CA CA000446474A patent/CA1213904A/en not_active Expired
- 1984-02-01 US US06/575,997 patent/US4517129A/en not_active Expired - Lifetime
- 1984-02-01 AU AU23955/84A patent/AU562717B2/en not_active Ceased
- 1984-02-13 JP JP59023054A patent/JPS59167554A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS59167554A (ja) | 1984-09-21 |
| US4517129A (en) | 1985-05-14 |
| AU2395584A (en) | 1984-08-23 |
| AU562717B2 (en) | 1987-06-18 |
| EP0118971B1 (en) | 1988-12-07 |
| CA1213904A (en) | 1986-11-12 |
| JPH0461864B2 (enExample) | 1992-10-02 |
| DE3475515D1 (en) | 1989-01-12 |
| GB8304161D0 (en) | 1983-03-16 |
| EP0118971A1 (en) | 1984-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Adams et al. | Trifluoromethylthiodediazoniation: a simple, efficient route to trifluoromethyl aryl sulfides | |
| AU2002213948B2 (en) | Process for the preparation of 2-aminoethylpyridines | |
| NZ206933A (en) | Processes for the preparation of cyanotetrachlorobenzenes | |
| IE46944B1 (en) | Denitrosation of organic nitrosamines | |
| US8399680B2 (en) | Arylamine synthesis method | |
| US4730046A (en) | Preparation of aryl halides | |
| GB2134900A (en) | Process for the preparation of cyanotetrachlorobenzenes | |
| US4785121A (en) | Preparation of halophthalic anhydrides | |
| US4421694A (en) | Process for the preparation of nitroanilines | |
| US5856577A (en) | Process for the preparation of fluoroanilines from fluorinated nitrated benzene compounds | |
| EP0155441B1 (en) | A process for separating nitration isomers of substituted benzene compounds | |
| EP0097357B1 (en) | Process for preparing trifluoromethylbenzene derivatives | |
| TW576714B (en) | Process for the preparation of polyhalogenated para-trifluoromethylanilines | |
| KR20010072450A (ko) | 3,5-디플루오로아닐린의 제조 방법 | |
| US5107046A (en) | Process for preparing aromatic fluorides | |
| Buján et al. | Amines as leaving groups in nucleophilic aromatic substitution reactions. Part 5. 1 Substitution vs. N-oxide formation in the reaction of Nn-butyl-2, 6-dinitroaniline with hydroxide ions | |
| Barbero et al. | o-Benzenedisulfonimide: An organic reagent and organocatalyst of renewed interest | |
| KR910004664B1 (ko) | 할로겐화된 아닐린류의 제조방법 | |
| US6410796B2 (en) | Process for the preparation of poly(fluoroalkyl)acetophenones | |
| JP3511699B2 (ja) | ニトロアニリン誘導体の製造方法 | |
| CA2221811A1 (en) | A continuous process for the dinitration of aromatic substrates | |
| US4745219A (en) | Chemical intermediates and a process for their preparation | |
| US3726922A (en) | Process for the manufacture of n,n-bis(2-chloroethyl)-2-nitro-4-alkyl-aniline | |
| EP1535898A1 (en) | Method of producing aromatic amine compound having alkylthio group | |
| RU2053220C1 (ru) | Способ получения 1,2-дибром-3,5-динитробензола |