NZ206933A - Processes for the preparation of cyanotetrachlorobenzenes - Google Patents
Processes for the preparation of cyanotetrachlorobenzenesInfo
- Publication number
- NZ206933A NZ206933A NZ206933A NZ20693384A NZ206933A NZ 206933 A NZ206933 A NZ 206933A NZ 206933 A NZ206933 A NZ 206933A NZ 20693384 A NZ20693384 A NZ 20693384A NZ 206933 A NZ206933 A NZ 206933A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formula
- group
- compound
- process according
- chloro
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 8
- IDOFZVGHXAVYEZ-UHFFFAOYSA-N 2,3,4,5-tetrachlorobenzonitrile Chemical class ClC1=CC(C#N)=C(Cl)C(Cl)=C1Cl IDOFZVGHXAVYEZ-UHFFFAOYSA-N 0.000 title description 2
- 150000001875 compounds Chemical class 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 12
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 claims description 11
- 239000007788 liquid Substances 0.000 claims description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 10
- 239000012071 phase Substances 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 7
- 239000003444 phase transfer catalyst Substances 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 7
- -1 alkaline earth metal cyanide Chemical class 0.000 claims description 5
- XDIPOBQVBXLETD-UHFFFAOYSA-N 1,2,3,4-tetrachloro-5,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1[N+]([O-])=O XDIPOBQVBXLETD-UHFFFAOYSA-N 0.000 claims description 4
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 4
- 239000012074 organic phase Substances 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- OQHXZZGZASQSOB-UHFFFAOYSA-N 3,4,5,6-tetrachlorobenzene-1,2-dicarbonitrile Chemical compound ClC1=C(Cl)C(Cl)=C(C#N)C(C#N)=C1Cl OQHXZZGZASQSOB-UHFFFAOYSA-N 0.000 claims description 3
- 239000012044 organic layer Substances 0.000 claims description 3
- YXODCXKIYJZGJP-UHFFFAOYSA-N 1,2,3,5-tetrachloro-4,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C([N+]([O-])=O)=C1Cl YXODCXKIYJZGJP-UHFFFAOYSA-N 0.000 claims description 2
- BILGRKOXNIFEIW-UHFFFAOYSA-N 1,2,4,5-tetrachloro-3,6-dinitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C([N+]([O-])=O)C(Cl)=C1Cl BILGRKOXNIFEIW-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 2
- 239000008346 aqueous phase Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims description 2
- 238000002329 infrared spectrum Methods 0.000 claims 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Substances [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 claims 2
- 239000007787 solid Substances 0.000 claims 2
- TXRVDQMSXQKAPG-UHFFFAOYSA-N 2,3,5,6-tetrachlorobenzene-1,4-dicarbonitrile Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(Cl)=C1C#N TXRVDQMSXQKAPG-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- 238000004949 mass spectrometry Methods 0.000 claims 1
- 239000007858 starting material Substances 0.000 claims 1
- 239000000376 reactant Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 4
- RUEXKAHPMLPNRB-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C#N RUEXKAHPMLPNRB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical group [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960002798 cetrimide Drugs 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 238000006396 nitration reaction Methods 0.000 description 2
- 125000002524 organometallic group Chemical group 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 150000003242 quaternary ammonium salts Chemical group 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- XQTLDIFVVHJORV-UHFFFAOYSA-N tecnazene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=CC(Cl)=C1Cl XQTLDIFVVHJORV-UHFFFAOYSA-N 0.000 description 2
- GBDZXPJXOMHESU-UHFFFAOYSA-N 1,2,3,4-tetrachlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1Cl GBDZXPJXOMHESU-UHFFFAOYSA-N 0.000 description 1
- JHBKHLUZVFWLAG-UHFFFAOYSA-N 1,2,4,5-tetrachlorobenzene Chemical compound ClC1=CC(Cl)=C(Cl)C=C1Cl JHBKHLUZVFWLAG-UHFFFAOYSA-N 0.000 description 1
- SDXUIOOHCIQXRP-UHFFFAOYSA-N 1,2,4,5-tetrafluorobenzene Chemical compound FC1=CC(F)=C(F)C=C1F SDXUIOOHCIQXRP-UHFFFAOYSA-N 0.000 description 1
- VQKOZGJGPMLGMG-UHFFFAOYSA-N 2,3,4,6-tetrachloro-5-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(C#N)=C1Cl VQKOZGJGPMLGMG-UHFFFAOYSA-N 0.000 description 1
- OEKCJRHVUDTDIR-UHFFFAOYSA-N 2,3,5,6-tetrachloro-4-nitrobenzonitrile Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(C#N)C(Cl)=C1Cl OEKCJRHVUDTDIR-UHFFFAOYSA-N 0.000 description 1
- PCRSJGWFEMHHEW-UHFFFAOYSA-N 2,3,5,6-tetrafluorobenzene-1,4-dicarbonitrile Chemical compound FC1=C(F)C(C#N)=C(F)C(F)=C1C#N PCRSJGWFEMHHEW-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- VMWZRHGIAVCFNS-UHFFFAOYSA-J aluminum;lithium;tetrahydroxide Chemical compound [Li+].[OH-].[OH-].[OH-].[OH-].[Al+3] VMWZRHGIAVCFNS-UHFFFAOYSA-J 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- MNWBNISUBARLIT-UHFFFAOYSA-N sodium cyanide Chemical class [Na+].N#[C-] MNWBNISUBARLIT-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838304161A GB8304161D0 (en) | 1983-02-15 | 1983-02-15 | Chemical process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ206933A true NZ206933A (en) | 1987-05-29 |
Family
ID=10538027
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ206933A NZ206933A (en) | 1983-02-15 | 1984-01-25 | Processes for the preparation of cyanotetrachlorobenzenes |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4517129A (enExample) |
| EP (1) | EP0118971B1 (enExample) |
| JP (1) | JPS59167554A (enExample) |
| AU (1) | AU562717B2 (enExample) |
| CA (1) | CA1213904A (enExample) |
| DE (1) | DE3475515D1 (enExample) |
| GB (1) | GB8304161D0 (enExample) |
| NZ (1) | NZ206933A (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4866185A (en) * | 1986-04-18 | 1989-09-12 | Ici Americas Inc. | Difunctional polyfluoroaromatic derivatives and a process of preparing the same |
| US4965394A (en) * | 1986-04-18 | 1990-10-23 | Ici Americas Inc. | Difunctional polyfluoroaromatic derivatives and a process of preparing the same |
| US4783547A (en) * | 1986-04-18 | 1988-11-08 | Ici Americas Inc. | Polyfluoroaromatic nitriles |
| JPH01125360A (ja) * | 1987-11-11 | 1989-05-17 | Idemitsu Kosan Co Ltd | ジハロゲン化ベンゾニトリルの精製方法 |
| DE59101258D1 (de) * | 1990-05-26 | 1994-05-05 | Bayer Ag | Fluormethylierte Polycyanbenzole, deren Alkalicyanid-Addukte, Verfahren zu ihrer Herstellung und Verwendung der fluormethylierten Polycyanbenzole. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT219592B (de) * | 1959-04-28 | 1962-02-12 | Philips Nv | Verfahren zur Herstellung von 2,6-Dichlorbenzonitril |
| GB1207725A (en) * | 1968-02-29 | 1970-10-07 | Cecil Arthur Clark | Nitrocyanobenzene derivatives and fungicidal compositions containing the same |
| US3869494A (en) * | 1972-08-07 | 1975-03-04 | Diamond Shamrock Corp | Production of tetrachlorophthalonitriles |
| US4211721A (en) * | 1978-12-04 | 1980-07-08 | Hooker Chemicals & Plastics Corp. | Process for the preparation of aromatic nitriles |
-
1983
- 1983-02-15 GB GB838304161A patent/GB8304161D0/en active Pending
-
1984
- 1984-01-18 DE DE8484300304T patent/DE3475515D1/de not_active Expired
- 1984-01-18 EP EP84300304A patent/EP0118971B1/en not_active Expired
- 1984-01-25 NZ NZ206933A patent/NZ206933A/en unknown
- 1984-01-31 CA CA000446474A patent/CA1213904A/en not_active Expired
- 1984-02-01 AU AU23955/84A patent/AU562717B2/en not_active Ceased
- 1984-02-01 US US06/575,997 patent/US4517129A/en not_active Expired - Lifetime
- 1984-02-13 JP JP59023054A patent/JPS59167554A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPH0461864B2 (enExample) | 1992-10-02 |
| CA1213904A (en) | 1986-11-12 |
| JPS59167554A (ja) | 1984-09-21 |
| DE3475515D1 (en) | 1989-01-12 |
| EP0118971B1 (en) | 1988-12-07 |
| AU2395584A (en) | 1984-08-23 |
| US4517129A (en) | 1985-05-14 |
| GB8304161D0 (en) | 1983-03-16 |
| AU562717B2 (en) | 1987-06-18 |
| EP0118971A1 (en) | 1984-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Adams et al. | Trifluoromethylthiodediazoniation: a simple, efficient route to trifluoromethyl aryl sulfides | |
| CA1090374A (en) | Denitrosation of organic nitrosamines | |
| NZ206933A (en) | Processes for the preparation of cyanotetrachlorobenzenes | |
| AU2002213948B2 (en) | Process for the preparation of 2-aminoethylpyridines | |
| US8399680B2 (en) | Arylamine synthesis method | |
| US4730046A (en) | Preparation of aryl halides | |
| GB2134900A (en) | Process for the preparation of cyanotetrachlorobenzenes | |
| US4785121A (en) | Preparation of halophthalic anhydrides | |
| KR20110122180A (ko) | 질화 방향족 및 이의 혼합물의 제조 방법 | |
| US4421694A (en) | Process for the preparation of nitroanilines | |
| EP0097357B1 (en) | Process for preparing trifluoromethylbenzene derivatives | |
| TW576714B (en) | Process for the preparation of polyhalogenated para-trifluoromethylanilines | |
| US5107046A (en) | Process for preparing aromatic fluorides | |
| US4503276A (en) | Process for separating nitration isomers of substituted benzene compounds | |
| Barbero et al. | o-Benzenedisulfonimide: An organic reagent and organocatalyst of renewed interest | |
| Buján et al. | Amines as leaving groups in nucleophilic aromatic substitution reactions. Part 5. 1 Substitution vs. N-oxide formation in the reaction of Nn-butyl-2, 6-dinitroaniline with hydroxide ions | |
| JPH10509969A (ja) | フッ素化ニトロ化ベンゼン化合物からのフルオロアニリンの製造法 | |
| CA1137112A (en) | Process for the preparation of para-nitroso -diphenyl-hydroxylamines | |
| JP3511699B2 (ja) | ニトロアニリン誘導体の製造方法 | |
| JP3463338B2 (ja) | 芳香族アミンの製造方法 | |
| CA2221811A1 (en) | A continuous process for the dinitration of aromatic substrates | |
| US4745219A (en) | Chemical intermediates and a process for their preparation | |
| WO1996041788A1 (en) | Process for the production of 2,6-dichloro-3,5-di(secondary or tertiary alkyl)toluene | |
| US3726922A (en) | Process for the manufacture of n,n-bis(2-chloroethyl)-2-nitro-4-alkyl-aniline | |
| EP1535898A1 (en) | Method of producing aromatic amine compound having alkylthio group |