NZ202889A - Process for the preparation of alkanol alkoxylates - Google Patents
Process for the preparation of alkanol alkoxylatesInfo
- Publication number
- NZ202889A NZ202889A NZ202889A NZ20288982A NZ202889A NZ 202889 A NZ202889 A NZ 202889A NZ 202889 A NZ202889 A NZ 202889A NZ 20288982 A NZ20288982 A NZ 20288982A NZ 202889 A NZ202889 A NZ 202889A
- Authority
- NZ
- New Zealand
- Prior art keywords
- component
- alkanol
- process according
- reaction
- magnesium
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 48
- 238000002360 preparation method Methods 0.000 title claims description 14
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 41
- 238000006243 chemical reaction Methods 0.000 claims abstract description 35
- 239000003426 co-catalyst Substances 0.000 claims abstract description 34
- 150000001875 compounds Chemical class 0.000 claims abstract description 18
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims abstract description 14
- 239000011777 magnesium Substances 0.000 claims abstract description 14
- 229910052749 magnesium Inorganic materials 0.000 claims abstract description 14
- 229910052782 aluminium Inorganic materials 0.000 claims abstract description 10
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims abstract description 10
- 150000007514 bases Chemical class 0.000 claims abstract description 10
- 229910052796 boron Inorganic materials 0.000 claims abstract description 9
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims abstract description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 8
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 8
- 239000011701 zinc Substances 0.000 claims abstract description 8
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims abstract description 7
- 229910052719 titanium Inorganic materials 0.000 claims abstract description 6
- 239000010936 titanium Substances 0.000 claims abstract description 6
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims abstract description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052787 antimony Inorganic materials 0.000 claims abstract description 4
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052750 molybdenum Inorganic materials 0.000 claims abstract description 4
- 239000011733 molybdenum Substances 0.000 claims abstract description 4
- 229910052718 tin Inorganic materials 0.000 claims abstract description 4
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims abstract description 4
- 229910052721 tungsten Inorganic materials 0.000 claims abstract description 4
- 239000010937 tungsten Substances 0.000 claims abstract description 4
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims abstract description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims abstract description 3
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052797 bismuth Inorganic materials 0.000 claims abstract description 3
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052793 cadmium Inorganic materials 0.000 claims abstract description 3
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052733 gallium Inorganic materials 0.000 claims abstract description 3
- 229910052732 germanium Inorganic materials 0.000 claims abstract description 3
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052735 hafnium Inorganic materials 0.000 claims abstract description 3
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052738 indium Inorganic materials 0.000 claims abstract description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052758 niobium Inorganic materials 0.000 claims abstract description 3
- 239000010955 niobium Substances 0.000 claims abstract description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052710 silicon Inorganic materials 0.000 claims abstract description 3
- 239000010703 silicon Substances 0.000 claims abstract description 3
- 229910052715 tantalum Inorganic materials 0.000 claims abstract description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052716 thallium Inorganic materials 0.000 claims abstract description 3
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052720 vanadium Inorganic materials 0.000 claims abstract description 3
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052727 yttrium Inorganic materials 0.000 claims abstract description 3
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 claims abstract description 3
- 229910052726 zirconium Inorganic materials 0.000 claims abstract description 3
- 239000003054 catalyst Substances 0.000 claims description 25
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 12
- 238000009826 distribution Methods 0.000 claims description 11
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 claims description 9
- 239000004411 aluminium Substances 0.000 claims description 9
- 150000004703 alkoxides Chemical class 0.000 claims description 8
- SMZOGRDCAXLAAR-UHFFFAOYSA-N aluminium isopropoxide Chemical compound [Al+3].CC(C)[O-].CC(C)[O-].CC(C)[O-] SMZOGRDCAXLAAR-UHFFFAOYSA-N 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 150000007942 carboxylates Chemical class 0.000 claims description 4
- 238000007046 ethoxylation reaction Methods 0.000 claims description 4
- 238000002474 experimental method Methods 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 3
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 3
- 230000000052 comparative effect Effects 0.000 claims description 3
- 150000003567 thiocyanates Chemical class 0.000 claims description 3
- 239000011135 tin Substances 0.000 claims description 3
- JPUHCPXFQIXLMW-UHFFFAOYSA-N aluminium triethoxide Chemical compound CCO[Al](OCC)OCC JPUHCPXFQIXLMW-UHFFFAOYSA-N 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- ORPJQHHQRCLVIC-UHFFFAOYSA-N magnesium;propan-2-olate Chemical compound CC(C)O[Mg]OC(C)C ORPJQHHQRCLVIC-UHFFFAOYSA-N 0.000 claims description 2
- 229920001223 polyethylene glycol Polymers 0.000 claims description 2
- 150000007944 thiolates Chemical class 0.000 claims description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims 3
- GYIWFHXWLCXGQO-UHFFFAOYSA-N barium(2+);ethanolate Chemical compound [Ba+2].CC[O-].CC[O-] GYIWFHXWLCXGQO-UHFFFAOYSA-N 0.000 claims 1
- JHLCADGWXYCDQA-UHFFFAOYSA-N calcium;ethanolate Chemical compound [Ca+2].CC[O-].CC[O-] JHLCADGWXYCDQA-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 claims 1
- NBTOZLQBSIZIKS-UHFFFAOYSA-N methoxide Chemical compound [O-]C NBTOZLQBSIZIKS-UHFFFAOYSA-N 0.000 claims 1
- 150000004767 nitrides Chemical class 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 19
- 239000003599 detergent Substances 0.000 abstract description 5
- 238000009472 formulation Methods 0.000 abstract description 4
- 239000002736 nonionic surfactant Substances 0.000 abstract 1
- 239000000047 product Substances 0.000 description 33
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- 239000000376 reactant Substances 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 12
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000007788 liquid Substances 0.000 description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- -1 alkyl ether sulphates Chemical class 0.000 description 6
- 229910052751 metal Inorganic materials 0.000 description 6
- 239000002184 metal Substances 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 5
- 230000006698 induction Effects 0.000 description 5
- 150000002681 magnesium compounds Chemical class 0.000 description 5
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- 239000003377 acid catalyst Substances 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000007259 addition reaction Methods 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 230000000737 periodic effect Effects 0.000 description 4
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 4
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 150000001447 alkali salts Chemical class 0.000 description 3
- 229910052788 barium Inorganic materials 0.000 description 3
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 229910052791 calcium Inorganic materials 0.000 description 3
- 239000011575 calcium Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052712 strontium Inorganic materials 0.000 description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 description 3
- 229910052723 transition metal Inorganic materials 0.000 description 3
- 150000003624 transition metals Chemical class 0.000 description 3
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 239000002841 Lewis acid Substances 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical class OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- 150000001242 acetic acid derivatives Chemical class 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 description 2
- 239000012018 catalyst precursor Substances 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000004880 explosion Methods 0.000 description 2
- 239000011261 inert gas Substances 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 150000007517 lewis acids Chemical class 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical class CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 235000011149 sulphuric acid Nutrition 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- PQXKWPLDPFFDJP-UHFFFAOYSA-N 2,3-dimethyloxirane Chemical class CC1OC1C PQXKWPLDPFFDJP-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 235000011054 acetic acid Nutrition 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001399 aluminium compounds Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940077746 antacid containing aluminium compound Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical class OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 229910000085 borane Inorganic materials 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- 229940043430 calcium compound Drugs 0.000 description 1
- 150000001674 calcium compounds Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical class CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 150000004673 fluoride salts Chemical class 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 235000011167 hydrochloric acid Nutrition 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 239000006193 liquid solution Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- CRGZYKWWYNQGEC-UHFFFAOYSA-N magnesium;methanolate Chemical compound [Mg+2].[O-]C.[O-]C CRGZYKWWYNQGEC-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000004704 methoxides Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 229920001281 polyalkylene Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical compound [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- OBROYCQXICMORW-UHFFFAOYSA-N tripropoxyalumane Chemical compound [Al+3].CCC[O-].CCC[O-].CCC[O-] OBROYCQXICMORW-UHFFFAOYSA-N 0.000 description 1
- 238000004457 water analysis Methods 0.000 description 1
- XOOUIPVCVHRTMJ-UHFFFAOYSA-L zinc stearate Chemical class [Zn+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O XOOUIPVCVHRTMJ-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/26—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds
- C08G65/2642—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds characterised by the catalyst used
- C08G65/269—Mixed catalyst systems, i.e. containing more than one reactive component or catalysts formed in-situ
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C41/00—Preparation of ethers; Preparation of compounds having groups, groups or groups
- C07C41/01—Preparation of ethers
- C07C41/02—Preparation of ethers from oxiranes
- C07C41/03—Preparation of ethers from oxiranes by reaction of oxirane rings with hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/02—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring
- C08G65/26—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from cyclic ethers by opening of the heterocyclic ring from cyclic ethers and other compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/334,091 US4375564A (en) | 1981-12-23 | 1981-12-23 | Alkoxylation process |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ202889A true NZ202889A (en) | 1985-01-31 |
Family
ID=23305535
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ202889A NZ202889A (en) | 1981-12-23 | 1982-12-22 | Process for the preparation of alkanol alkoxylates |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4375564A (Direct) |
| EP (1) | EP0082554B1 (Direct) |
| JP (1) | JPS58110531A (Direct) |
| DE (1) | DE3262718D1 (Direct) |
| NZ (1) | NZ202889A (Direct) |
| ZA (1) | ZA829420B (Direct) |
Families Citing this family (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4689435A (en) * | 1984-10-29 | 1987-08-25 | Shell Oil Company | Alkoxylation process using bimetallic oxo catalyst |
| DE3574371D1 (en) * | 1984-10-29 | 1989-12-28 | Shell Int Research | Alkoxylation process using bimetallic oxo catalyst |
| EP0180266B1 (en) * | 1984-10-29 | 1989-11-23 | Shell Internationale Researchmaatschappij B.V. | Alkoxylation process using bimetallic oxo catalyst |
| US4721816A (en) * | 1985-12-23 | 1988-01-26 | Shell Oil Company | Preparation of nonionic surfactants |
| US4837190A (en) * | 1986-05-09 | 1989-06-06 | Akzo America Inc. | Organic solvent soluble polyvalent metal alkoxy alkoxides |
| US4721817A (en) * | 1986-12-31 | 1988-01-26 | Shell Oil Company | Preparation of nonionic surfactants |
| TR23339A (tr) * | 1987-06-15 | 1989-12-14 | Henkel Kgaa | Alkoksillendirme icin katalizoer,olarak eter karbonik asitlerinin toprak alkalisi tozlarinin kullanilmasi |
| CA1339379C (en) * | 1987-12-17 | 1997-08-26 | Charles Lee Edwards | Alkoxylation process using catalysts of the lanthanum series |
| DE3814849A1 (de) * | 1988-05-02 | 1989-11-16 | Henkel Kgaa | Verwendung von estern der titan- und/oder zirkonsaeure als katalysatoren fuer die ethoxylierung bzw. propoxylierung |
| EP0347064A1 (en) * | 1988-06-13 | 1989-12-20 | Texaco Development Corporation | Preparation of nonionic surfactants by oxyalkylation with a magnesium catalyst |
| US5112788A (en) * | 1988-09-30 | 1992-05-12 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified group iia metal-containing bimetallic or polymetallic catalysts |
| US5114900A (en) * | 1988-09-30 | 1992-05-19 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified calcium-containing bimetallic or polymetallic catalysts |
| US5112789A (en) * | 1988-09-30 | 1992-05-12 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation catalysis |
| US5118650A (en) * | 1988-09-30 | 1992-06-02 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified group iiib metal-containing bimetallic or polymetallic catalysts |
| US4946984A (en) * | 1988-09-30 | 1990-08-07 | Union Carbide Chemicals And Plastics Company Inc. | Alkoxylation using a calcium sulfate catalyst |
| US5120697A (en) * | 1988-09-30 | 1992-06-09 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation using modified calcium-containing catalysts |
| US5210325A (en) * | 1990-04-23 | 1993-05-11 | Shell Oil Company | Alkoxylation process catalyzed by supported rare earth elements |
| US5208199A (en) * | 1990-04-23 | 1993-05-04 | Shell Oil Company | Catalyst of rare earth and phosphorus-containing xerogels for alkoxylation process |
| US5102849A (en) * | 1990-04-23 | 1992-04-07 | Shell Oil Company | Supported rare earth and phosphorus catalyst |
| US5034361A (en) * | 1990-05-24 | 1991-07-23 | Shell Oil Company | Catalyst precursor production |
| US5104987A (en) * | 1990-09-20 | 1992-04-14 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation of active hydrogen-containing compounds |
| US5191104A (en) * | 1990-09-20 | 1993-03-02 | Union Carbide Chemicals & Plastics Technology Corporation | Alkoxylation of carboxylated compounds |
| DE4101515A1 (de) * | 1991-01-19 | 1992-07-23 | Henkel Kgaa | Ethersulfate fuer mund- und zahnpflegemittel |
| DE4117935A1 (de) * | 1991-05-31 | 1992-12-03 | Hoechst Ag | Verfahren zur herstellung von alkoxylaten mit enger homologenverteilung unter verwendung von antimonpentahalogenid-komplexen als katalysator |
| EP0684872B1 (en) * | 1993-12-22 | 2003-06-25 | Kao Corporation | Alkoxylation catalyst, process for the preparation of the catalyst and process for preparing alkoxylate with the use of the catalyst |
| US5679764A (en) * | 1995-11-06 | 1997-10-21 | Arco Chemical Technology, L.P. | Process of oxyalkylation employing solid, heterogeneous MgO catalyst |
| RU2149865C1 (ru) * | 1999-01-12 | 2000-05-27 | Индивидуальное частное предприятие "Вега-Хим" | Способ получения моноалкиловых эфиров алкиленгликолей |
| AU6201800A (en) * | 1999-06-30 | 2001-01-31 | Union Carbide Chemicals & Plastics Technology Corporation | Selective alkanol alkoxylation process |
| US6455459B1 (en) | 1999-11-18 | 2002-09-24 | Union Carbide Chemicals & Plastics Technology Corporation | Antimony catalyst compositions |
| KR100757700B1 (ko) * | 2000-11-30 | 2007-09-13 | 유니온 카바이드 케미칼즈 앤드 플라스틱스 테크날러지 코포레이션 | 안티몬 촉매 조성물의 제조방법, 당해 방법으로 제조한 안티몬 촉매 조성물 및 당해 안티몬 촉매 조성물을 사용하는 활성 수소 함유 유기 화합물의 알콕시화 방법 |
| EP1778397B1 (en) | 2004-08-26 | 2018-08-29 | Huntsman Petrochemical LLC | Method for preparing alkaline earth-based alkoxylation catalysts |
| JP4541827B2 (ja) * | 2004-10-18 | 2010-09-08 | 第一工業製薬株式会社 | アルキレンオキサイド付加物の製造方法 |
| CN102634005B (zh) * | 2012-03-15 | 2014-08-13 | 上海多纶化工有限公司 | 异构醇聚氧乙烯醚的合成方法 |
| CA2930727A1 (en) * | 2013-11-22 | 2015-05-28 | Dow Global Technologies Llc | Zinc catalyst/additive system for the polymerization of epoxide monomers |
| CA2930698A1 (en) * | 2013-11-22 | 2015-05-28 | Dow Global Technologies Llc | Zinc catalyst/additive system for the polymerization of epoxide monomers |
| KR20160089381A (ko) | 2013-11-22 | 2016-07-27 | 다우 글로벌 테크놀로지스 엘엘씨 | 에폭사이드 모노머의 중합용 아연 촉매/첨가제 시스템 |
| JP6915825B2 (ja) * | 2015-10-09 | 2021-08-04 | 花王株式会社 | 乳化重合用反応性界面活性剤組成物 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES377675A1 (es) * | 1969-06-18 | 1972-07-16 | Continental Oil Co | Perfeccionamientos en los procedimientos de obtencion de esteres poliglicolicos de alcanoles primarios monohidricos saturados. |
| US3972948A (en) * | 1974-11-29 | 1976-08-03 | Jefferson Chemical Company, Inc. | Anhydrous catalyst for manufacture of glycol ethers |
| SE403611B (sv) * | 1975-09-05 | 1978-08-28 | Berol Kemi Ab | Forfarande for framstellning av en reaktionsprodukt mellan en epoxid och en organisk forening innehallande reaktivt vete i nervaro av viss angiven katalysator |
| US4210764A (en) * | 1979-05-04 | 1980-07-01 | Conoco, Inc. | Barium oxide/cresylic acid catalyzed ethoxylation |
| US4302613A (en) * | 1980-08-22 | 1981-11-24 | Conoco Inc. | Inorganic catalyst for alkoxylation of alcohols |
-
1981
- 1981-12-23 US US06/334,091 patent/US4375564A/en not_active Expired - Lifetime
-
1982
- 1982-12-09 EP EP82201565A patent/EP0082554B1/en not_active Expired
- 1982-12-09 DE DE8282201565T patent/DE3262718D1/de not_active Expired
- 1982-12-22 NZ NZ202889A patent/NZ202889A/en unknown
- 1982-12-22 JP JP57224067A patent/JPS58110531A/ja active Granted
- 1982-12-22 ZA ZA829420A patent/ZA829420B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS58110531A (ja) | 1983-07-01 |
| DE3262718D1 (en) | 1985-04-25 |
| US4375564A (en) | 1983-03-01 |
| ZA829420B (en) | 1983-09-28 |
| EP0082554A1 (en) | 1983-06-29 |
| JPH0318605B2 (Direct) | 1991-03-13 |
| EP0082554B1 (en) | 1985-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0082554B1 (en) | Process for the preparation of alkanol alkoxylates | |
| EP0082569B1 (en) | Process for preparing alkanol alkoxylates | |
| EP0091146B1 (en) | Process for the preparation of alkanol alkoxylates | |
| US4665236A (en) | Alkoxylation process using bimetallic oxo catalyst | |
| EP0273521B1 (en) | A process for the preparation of an alkanol akoxylate product | |
| JPS6332055B2 (Direct) | ||
| US4465877A (en) | Magnesium catalyzed alkoxylation of alkanols in the presence of alkoxylate reaction activators | |
| EP0228121B1 (en) | Preparation of nonionic surfactants | |
| US5059719A (en) | Alkoxylation process using catalyst of the lanthanum series | |
| EP0046582B1 (en) | Inorganic catalyst for alkoxylation of alcohols | |
| EP0018463A2 (en) | Barium oxide/phenol or substituted phenol catalyzed ethoxylation | |
| EP0180266B1 (en) | Alkoxylation process using bimetallic oxo catalyst | |
| EP0333076B1 (en) | Method for one-step synthesis of methyl t-butyl ether | |
| EP0180267B1 (en) | Alkoxylation process using bimetallic oxo catalyst | |
| CA1185992A (en) | Process for the preparation of alkanol alkoxylates | |
| US4575569A (en) | Alkoxylation of thiols in the presence of a reaction promoter | |
| US4689435A (en) | Alkoxylation process using bimetallic oxo catalyst | |
| US4933502A (en) | Process for the preparation of nonionic surfactants | |
| EP0321053B1 (en) | Alkoxylation process using catalysts of the lanthanum series | |
| US4825009A (en) | Preparation of nonionic surfactants | |
| EP0341393B1 (en) | Method for the single step synthesis of methyl-tert.butyl ether from tert.butanol using supported rhenium catalysts | |
| WO2001000552A9 (en) | Selective alkanol alkoxylations process | |
| JPH06182206A (ja) | 活性水素含有有機化合物アルコキシレート製造用触媒 | |
| JPH0351462B2 (Direct) |