NZ178645A - 2-amino-4-azido-6-formylamino-1,3,5-triazines and compositions - Google Patents
2-amino-4-azido-6-formylamino-1,3,5-triazines and compositionsInfo
- Publication number
- NZ178645A NZ178645A NZ178645A NZ17864575A NZ178645A NZ 178645 A NZ178645 A NZ 178645A NZ 178645 A NZ178645 A NZ 178645A NZ 17864575 A NZ17864575 A NZ 17864575A NZ 178645 A NZ178645 A NZ 178645A
- Authority
- NZ
- New Zealand
- Prior art keywords
- formylamino
- triazines
- azido
- amino
- compositions
- Prior art date
Links
- UBMDLSCCUMLYMA-UHFFFAOYSA-N N-(4-amino-6-azido-1,3,5-triazin-2-yl)formamide Chemical class NC1=NC(=NC(=N1)N=[N+]=[N-])NC=O UBMDLSCCUMLYMA-UHFFFAOYSA-N 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/66—Derivatives of melamine in which a hetero atom is directly attached to a nitrogen atom of melamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1241974A CH602001A5 (en) | 1974-09-12 | 1974-09-12 | N(2)-(4-Azido-6-amino-s-triazin-2-yl)-N',N'-dialkyl-formamidines |
| CH1066275A CH610491A5 (en) | 1975-08-15 | 1975-08-15 | Pesticide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NZ178645A true NZ178645A (en) | 1978-06-02 |
Family
ID=25707048
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NZ178645A NZ178645A (en) | 1974-09-12 | 1975-09-10 | 2-amino-4-azido-6-formylamino-1,3,5-triazines and compositions |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4020066A (OSRAM) |
| JP (1) | JPS5154928A (OSRAM) |
| AU (1) | AU500893B2 (OSRAM) |
| DE (1) | DE2540127A1 (OSRAM) |
| EG (1) | EG11946A (OSRAM) |
| FR (1) | FR2284600A1 (OSRAM) |
| GB (1) | GB1517747A (OSRAM) |
| IE (1) | IE41687B1 (OSRAM) |
| IL (1) | IL48074A (OSRAM) |
| IT (1) | IT1042486B (OSRAM) |
| NL (1) | NL7510795A (OSRAM) |
| NZ (1) | NZ178645A (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160832A (en) * | 1976-08-19 | 1979-07-10 | Ciba-Geigy Corporation | Novel insecticides |
| US4892871A (en) * | 1988-04-12 | 1990-01-09 | The General Hospital Corporation | Azido-substituted octopamine agonists and the use thereof to control invertebrate pests |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3326913A (en) * | 1962-06-08 | 1967-06-20 | Degussa | Azido triazines |
| IL39386A (en) * | 1971-06-01 | 1974-12-31 | Ciba Geigy Ag | Method of combating insects using 2-azido-4-alkoxymethylamino-6-alkylamino-s-triazine derivatives |
| US3856950A (en) * | 1971-06-01 | 1974-12-24 | Ciba Geigy Corp | Method of combating insects |
| DE2341555A1 (de) * | 1973-08-17 | 1975-02-27 | Basf Ag | Herbizid |
| DE2351553A1 (de) * | 1973-10-13 | 1975-04-24 | Basf Ag | Herbizid |
-
1975
- 1975-09-09 DE DE19752540127 patent/DE2540127A1/de not_active Ceased
- 1975-09-09 EG EG533/75A patent/EG11946A/xx active
- 1975-09-10 US US05/612,124 patent/US4020066A/en not_active Expired - Lifetime
- 1975-09-10 NZ NZ178645A patent/NZ178645A/xx unknown
- 1975-09-10 IL IL48074A patent/IL48074A/xx unknown
- 1975-09-11 IT IT27157/75A patent/IT1042486B/it active
- 1975-09-11 GB GB37477/75A patent/GB1517747A/en not_active Expired
- 1975-09-11 IE IE1979/75A patent/IE41687B1/en unknown
- 1975-09-11 AU AU84729/75A patent/AU500893B2/en not_active Expired
- 1975-09-11 FR FR7527843A patent/FR2284600A1/fr active Granted
- 1975-09-12 NL NL7510795A patent/NL7510795A/xx not_active Application Discontinuation
- 1975-09-12 JP JP50111597A patent/JPS5154928A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1042486B (it) | 1980-01-30 |
| FR2284600B1 (OSRAM) | 1978-04-07 |
| DE2540127A1 (de) | 1976-03-25 |
| NL7510795A (nl) | 1976-03-16 |
| AU8472975A (en) | 1977-03-17 |
| IE41687L (en) | 1976-03-12 |
| EG11946A (en) | 1978-03-29 |
| AU500893B2 (en) | 1979-06-07 |
| FR2284600A1 (fr) | 1976-04-09 |
| IE41687B1 (en) | 1980-02-27 |
| US4020066A (en) | 1977-04-26 |
| IL48074A0 (en) | 1975-11-25 |
| JPS5154928A (OSRAM) | 1976-05-14 |
| GB1517747A (en) | 1978-07-12 |
| IL48074A (en) | 1979-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL48003A (en) | 1,3,4-trisubstituted-4-phenyllpiper-idnes and their preparation | |
| ZA751986B (en) | 1,1-diaryl-1-oxadiazol-alkylamines | |
| IL48572A0 (en) | 8,8-disubstituted-6-methylergolines and related compounds | |
| ZA756609B (en) | Triazines | |
| JPS5129436A (en) | Deruta 4 *deruta 88 toransufuaruneshirusakusan mataha sonoesuterurui no seizoho | |
| IL48002A0 (en) | 5-cyanoalkyl-1,3,4-thiadiazole-2-ylureas | |
| ZA75954B (en) | 1,2,4-triazolidin-3-ones | |
| JPS5132597A (en) | Pirido * 2 33d * pirimijinjudotai no seizoho | |
| JPS5129404A (en) | 1* 1* 11 kurorujifuruoruetan no seizohoho | |
| NZ178645A (en) | 2-amino-4-azido-6-formylamino-1,3,5-triazines and compositions | |
| ZA756191B (en) | 1,4-oxazepines | |
| ZA755665B (en) | U.v.-curable resinous compounds and compositions | |
| IL48140A0 (en) | Novel 2,6-methano-3-benzazocines and their preparation | |
| JPS5173027A (en) | 2*66 jiaminopirijinkei no senryo no seiho | |
| JPS5132595A (en) | Pirido * 2 33d * pirimijinjudotai no seiho | |
| IL47111A0 (en) | 3,4-dicarboxycephalosporins and derivatives | |
| IE41250B1 (en) | 2,2-bis-hydroxymethylalkanesulphonates | |
| JPS5115629A (en) | Bopaizai * 22 * 44 chiazoriru * bentsuimidazooru * no yoekikatokunisuiyokahoho | |
| JPS5129455A (en) | 22 * 4** isobuchirufueniru * 1*22 ehokishipuropan no seizohoho | |
| JPS5126857A (en) | 1* 3* 5* 77 nafutarintetorakarubonsanarukarien no seizoho | |
| PH13018A (en) | 1,2,4-triazolidin-2-ones | |
| JPS5141392A (en) | Shinkina 22 okiso 1 2 3 44 tetorahidoropirido * 2 33d * pirimijinjudotai no seizoho | |
| NZ178646A (en) | 2,3-dihydro-1-benzothiepin-4-carboxamides and pharmaceutical compositions | |
| JPS5123295A (en) | Shinkina 22 okiso 1*2*3*44 tetorahidoropirido * 2*33d * pirimijinjudotaioyobisono sanfukaenno seizoho | |
| JPS5113794A (en) | Shinkina 22 okiso 1*2*3*44 tetorahidoropirido * 2*33d * pirimijinjudotaino seizoho |