IL48074A - 2-amino-4-azido-6-formylamino-s-triazine derivatives,their production and insecticidal compositions containing them - Google Patents
2-amino-4-azido-6-formylamino-s-triazine derivatives,their production and insecticidal compositions containing themInfo
- Publication number
- IL48074A IL48074A IL48074A IL4807475A IL48074A IL 48074 A IL48074 A IL 48074A IL 48074 A IL48074 A IL 48074A IL 4807475 A IL4807475 A IL 4807475A IL 48074 A IL48074 A IL 48074A
- Authority
- IL
- Israel
- Prior art keywords
- formylamino
- azido
- amino
- production
- compositions containing
- Prior art date
Links
- UBMDLSCCUMLYMA-UHFFFAOYSA-N N-(4-amino-6-azido-1,3,5-triazin-2-yl)formamide Chemical class NC1=NC(=NC(=N1)N=[N+]=[N-])NC=O UBMDLSCCUMLYMA-UHFFFAOYSA-N 0.000 title 1
- 230000000749 insecticidal effect Effects 0.000 title 1
- 239000000203 mixture Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/66—Derivatives of melamine in which a hetero atom is directly attached to a nitrogen atom of melamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1241974A CH602001A5 (en) | 1974-09-12 | 1974-09-12 | N(2)-(4-Azido-6-amino-s-triazin-2-yl)-N',N'-dialkyl-formamidines |
| CH1066275A CH610491A5 (en) | 1975-08-15 | 1975-08-15 | Pesticide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IL48074A0 IL48074A0 (en) | 1975-11-25 |
| IL48074A true IL48074A (en) | 1979-01-31 |
Family
ID=25707048
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IL48074A IL48074A (en) | 1974-09-12 | 1975-09-10 | 2-amino-4-azido-6-formylamino-s-triazine derivatives,their production and insecticidal compositions containing them |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US4020066A (OSRAM) |
| JP (1) | JPS5154928A (OSRAM) |
| AU (1) | AU500893B2 (OSRAM) |
| DE (1) | DE2540127A1 (OSRAM) |
| EG (1) | EG11946A (OSRAM) |
| FR (1) | FR2284600A1 (OSRAM) |
| GB (1) | GB1517747A (OSRAM) |
| IE (1) | IE41687B1 (OSRAM) |
| IL (1) | IL48074A (OSRAM) |
| IT (1) | IT1042486B (OSRAM) |
| NL (1) | NL7510795A (OSRAM) |
| NZ (1) | NZ178645A (OSRAM) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4160832A (en) * | 1976-08-19 | 1979-07-10 | Ciba-Geigy Corporation | Novel insecticides |
| US4892871A (en) * | 1988-04-12 | 1990-01-09 | The General Hospital Corporation | Azido-substituted octopamine agonists and the use thereof to control invertebrate pests |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3326913A (en) * | 1962-06-08 | 1967-06-20 | Degussa | Azido triazines |
| IL39386A (en) * | 1971-06-01 | 1974-12-31 | Ciba Geigy Ag | Method of combating insects using 2-azido-4-alkoxymethylamino-6-alkylamino-s-triazine derivatives |
| US3856950A (en) * | 1971-06-01 | 1974-12-24 | Ciba Geigy Corp | Method of combating insects |
| DE2341555A1 (de) * | 1973-08-17 | 1975-02-27 | Basf Ag | Herbizid |
| DE2351553A1 (de) * | 1973-10-13 | 1975-04-24 | Basf Ag | Herbizid |
-
1975
- 1975-09-09 DE DE19752540127 patent/DE2540127A1/de not_active Ceased
- 1975-09-09 EG EG533/75A patent/EG11946A/xx active
- 1975-09-10 US US05/612,124 patent/US4020066A/en not_active Expired - Lifetime
- 1975-09-10 NZ NZ178645A patent/NZ178645A/xx unknown
- 1975-09-10 IL IL48074A patent/IL48074A/xx unknown
- 1975-09-11 IT IT27157/75A patent/IT1042486B/it active
- 1975-09-11 GB GB37477/75A patent/GB1517747A/en not_active Expired
- 1975-09-11 IE IE1979/75A patent/IE41687B1/en unknown
- 1975-09-11 AU AU84729/75A patent/AU500893B2/en not_active Expired
- 1975-09-11 FR FR7527843A patent/FR2284600A1/fr active Granted
- 1975-09-12 NL NL7510795A patent/NL7510795A/xx not_active Application Discontinuation
- 1975-09-12 JP JP50111597A patent/JPS5154928A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| IT1042486B (it) | 1980-01-30 |
| FR2284600B1 (OSRAM) | 1978-04-07 |
| DE2540127A1 (de) | 1976-03-25 |
| NZ178645A (en) | 1978-06-02 |
| NL7510795A (nl) | 1976-03-16 |
| AU8472975A (en) | 1977-03-17 |
| IE41687L (en) | 1976-03-12 |
| EG11946A (en) | 1978-03-29 |
| AU500893B2 (en) | 1979-06-07 |
| FR2284600A1 (fr) | 1976-04-09 |
| IE41687B1 (en) | 1980-02-27 |
| US4020066A (en) | 1977-04-26 |
| IL48074A0 (en) | 1975-11-25 |
| JPS5154928A (OSRAM) | 1976-05-14 |
| GB1517747A (en) | 1978-07-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IL47046A (en) | Acylaniline derivatives,their preparation and fungicidal compositions containing them | |
| IL48481A0 (en) | New triazole derivatives,their production and compositions containing them | |
| IL46989A (en) | Heteroacylanilides,their manufacture and micrtobiocidal and fungicidal compositions containing them | |
| IL46760A (en) | 2-tetrahydrofurfuryl-6,7-benzomorphane derivatives,their production and pharmaceutical compositions containing them | |
| IL47877A0 (en) | Novel thienothiazine derivatives,their manufacture and pharmaceutical compositions containing them | |
| IL47735A (en) | 8a-substituted-6-alkyl-ergoline i derivatives,their production and pharmaceutical compositions containing them | |
| IL48396A (en) | O-methyl-n-cycloalkyl-2-methyl-furan-3-hydroxamic acids, their manufacture and fungicidal compositions containing them | |
| IL47045A (en) | N-acylanilines,their manufacture and fungicidal compositions comprising them | |
| IL53332A (en) | 3-fluoro-6-piperazino-morphanthridine derivatives,their production and pharmaceutical compositions containing them | |
| IL50091A (en) | 4-substituted-2-oxazolidinones,their production and pharmaceutical compositions containing them | |
| IL46721A0 (en) | Thiatriazine derivatives,their preparation and herbicidal compositions containing them | |
| IL47404A0 (en) | Pyrazolobenzazepines,their manufacture and pharmaceutical compositions containing them | |
| IL47333A0 (en) | Novel oxacyclohexane derivatives,their production and their use as herbicides | |
| IL48054A0 (en) | New vincanol derivatives,their production and pharmaceutical compositions containing them | |
| IL46593A0 (en) | New 2-amino-6-dialkylaminodihydropyridines,their production and pharmaceutical compositions containing them | |
| HK15578A (en) | Maleimidomethylcyclopropanecarboxylates, process for their production and pesticidal compositions containing them | |
| IL47500A0 (en) | Sulfapyrimidine derivatives,their preparation and anti-bacterial compositions containing them | |
| IL47795A0 (en) | Novel lactones,their production and their use as fungicides | |
| IL47969A (en) | N-acyl orgoteins, their production and pharmaceutical compositions containing them | |
| IL47761A (en) | 9-hydroxy-19,20-bis-nor-prostanic acid and derivatives andpharmaceutical compositions containing them | |
| IL48074A (en) | 2-amino-4-azido-6-formylamino-s-triazine derivatives,their production and insecticidal compositions containing them | |
| IL49481A0 (en) | Novel diureide compounds,their production and pesticidal compositions containing them | |
| IL48527A0 (en) | New 7,7-diphenyl-hexahydro-1,4-oxazepines,their manufacture and pharmaceutical compositions containing them | |
| IL46890A0 (en) | New-1-aryl-uracils,their production and pharmaceutical compositions containing them | |
| IL47254A0 (en) | New dibenzothiepine derivatives,their manufacture and pharmaceutical compositions containing them |