NO840893L - Imidazoliner og beslektede forbindelser samt fremgangsmaate for deres fremstilling - Google Patents
Imidazoliner og beslektede forbindelser samt fremgangsmaate for deres fremstillingInfo
- Publication number
- NO840893L NO840893L NO840893A NO840893A NO840893L NO 840893 L NO840893 L NO 840893L NO 840893 A NO840893 A NO 840893A NO 840893 A NO840893 A NO 840893A NO 840893 L NO840893 L NO 840893L
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- dihydro
- compound
- naphthalenyl
- imidazole
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims description 66
- 238000000034 method Methods 0.000 title claims description 31
- 150000002462 imidazolines Chemical class 0.000 title description 2
- 238000002360 preparation method Methods 0.000 title description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 45
- -1 3,4- dihydro-2-naphthalenyl Chemical group 0.000 claims description 43
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 20
- 239000002253 acid Substances 0.000 claims description 16
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 3
- 150000002431 hydrogen Chemical group 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims description 2
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 48
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 44
- 239000000047 product Substances 0.000 description 25
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 23
- 239000000243 solution Substances 0.000 description 20
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000000203 mixture Substances 0.000 description 16
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 15
- 229960002896 clonidine Drugs 0.000 description 15
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 13
- JLTRXTDYQLMHGR-UHFFFAOYSA-N trimethylaluminium Chemical compound C[Al](C)C JLTRXTDYQLMHGR-UHFFFAOYSA-N 0.000 description 13
- GJSURZIOUXUGAL-UHFFFAOYSA-N Clonidine Chemical compound ClC1=CC=CC(Cl)=C1NC1=NCCN1 GJSURZIOUXUGAL-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 12
- 239000007787 solid Substances 0.000 description 11
- 238000006243 chemical reaction Methods 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 238000001953 recrystallisation Methods 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 9
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- RONQOKZLZGKIQD-UHFFFAOYSA-N 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)=C(CC#N)CCC2=C1 RONQOKZLZGKIQD-UHFFFAOYSA-N 0.000 description 7
- 241000699670 Mus sp. Species 0.000 description 7
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- 230000036461 convulsion Effects 0.000 description 6
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 6
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- CNIIGCLFLJGOGP-UHFFFAOYSA-N 2-(1-naphthalenylmethyl)-4,5-dihydro-1H-imidazole Chemical compound C=1C=CC2=CC=CC=C2C=1CC1=NCCN1 CNIIGCLFLJGOGP-UHFFFAOYSA-N 0.000 description 5
- RLQZIECDMISZHS-UHFFFAOYSA-N 2-phenylcyclohexa-2,5-diene-1,4-dione Chemical compound O=C1C=CC(=O)C(C=2C=CC=CC=2)=C1 RLQZIECDMISZHS-UHFFFAOYSA-N 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 206010028347 Muscle twitching Diseases 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- MTNDZQHUAFNZQY-UHFFFAOYSA-N imidazoline Chemical compound C1CN=CN1 MTNDZQHUAFNZQY-UHFFFAOYSA-N 0.000 description 5
- 230000005764 inhibitory process Effects 0.000 description 5
- 229960004592 isopropanol Drugs 0.000 description 5
- KWMBADTWRIGGGG-UHFFFAOYSA-N 2-diethoxyphosphorylacetonitrile Chemical compound CCOP(=O)(CC#N)OCC KWMBADTWRIGGGG-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000000674 adrenergic antagonist Substances 0.000 description 4
- 239000000935 antidepressant agent Substances 0.000 description 4
- 229940005513 antidepressants Drugs 0.000 description 4
- 239000003480 eluent Substances 0.000 description 4
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 4
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 4
- PQNFLJBBNBOBRQ-UHFFFAOYSA-N indane Chemical compound C1=CC=C2CCCC2=C1 PQNFLJBBNBOBRQ-UHFFFAOYSA-N 0.000 description 4
- BYJAVTDNIXVSPW-UHFFFAOYSA-N tetryzoline Chemical compound N1CCN=C1C1C2=CC=CC=C2CCC1 BYJAVTDNIXVSPW-UHFFFAOYSA-N 0.000 description 4
- HZODSUZFJLKBTE-UHFFFAOYSA-N 2-(chloromethyl)-1-methylnaphthalene Chemical compound C1=CC=C2C(C)=C(CCl)C=CC2=C1 HZODSUZFJLKBTE-UHFFFAOYSA-N 0.000 description 3
- KCKZIWSINLBROE-UHFFFAOYSA-N 3,4-dihydro-1h-naphthalen-2-one Chemical compound C1=CC=C2CC(=O)CCC2=C1 KCKZIWSINLBROE-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000005557 antagonist Substances 0.000 description 3
- 230000001430 anti-depressive effect Effects 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- VGOUDZRMSWVZTB-UHFFFAOYSA-N methyl 1-methyl-2h-naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)(C)CC=CC2=C1 VGOUDZRMSWVZTB-UHFFFAOYSA-N 0.000 description 3
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 3
- UMKVQXLSQRPFHQ-UHFFFAOYSA-N (1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)methanol Chemical compound C1=CC=C2C(C)C(CO)CCC2=C1 UMKVQXLSQRPFHQ-UHFFFAOYSA-N 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 2
- VGZQKUJGVYFKBP-UHFFFAOYSA-N 1-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1=CC=C2C(C)C(=O)CCC2=C1 VGZQKUJGVYFKBP-UHFFFAOYSA-N 0.000 description 2
- NVMKSYJWGFDXIN-UHFFFAOYSA-N 2-(1-methyl-2h-naphthalen-1-yl)acetonitrile Chemical compound C1=CC=C2C(C)(CC#N)CC=CC2=C1 NVMKSYJWGFDXIN-UHFFFAOYSA-N 0.000 description 2
- JSOVLJUXGJHXKH-UHFFFAOYSA-N 2-(2,3-dihydro-1h-inden-1-yl)-4,5-dihydro-1h-imidazole Chemical compound N1CCN=C1C1C2=CC=CC=C2CC1 JSOVLJUXGJHXKH-UHFFFAOYSA-N 0.000 description 2
- NLJRUMRTUKUILX-UHFFFAOYSA-N 2-(3-methyl-1h-inden-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)=C(CC#N)CC2=C1 NLJRUMRTUKUILX-UHFFFAOYSA-N 0.000 description 2
- VIXRKFBKWOHVBR-UHFFFAOYSA-N 2-(naphthalen-2-ylmethyl)-4,5-dihydro-1h-imidazole Chemical compound C=1C=C2C=CC=CC2=CC=1CC1=NCCN1 VIXRKFBKWOHVBR-UHFFFAOYSA-N 0.000 description 2
- CMFMFKYITXSFQA-UHFFFAOYSA-N 2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydro-1h-imidazole Chemical compound C1CC2=CC=CC=C2C(C)=C1CC1=NCCN1 CMFMFKYITXSFQA-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- JZUFKLXOESDKRF-UHFFFAOYSA-N Chlorothiazide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC2=C1NCNS2(=O)=O JZUFKLXOESDKRF-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 2
- 230000003213 activating effect Effects 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 230000008485 antagonism Effects 0.000 description 2
- 230000003502 anti-nociceptive effect Effects 0.000 description 2
- 210000004556 brain Anatomy 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 150000004985 diamines Chemical class 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- UZWIGTPBKXOYJT-UHFFFAOYSA-N ethyl 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetate Chemical compound C1=CC=C2CCC(CC(=O)OCC)=C(C)C2=C1 UZWIGTPBKXOYJT-UHFFFAOYSA-N 0.000 description 2
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 2
- 230000001747 exhibiting effect Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 229960002003 hydrochlorothiazide Drugs 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000012528 membrane Substances 0.000 description 2
- ZWWPJQTUGCPRMO-UHFFFAOYSA-N methanimidoyl methanimidate Chemical compound N=COC=N ZWWPJQTUGCPRMO-UHFFFAOYSA-N 0.000 description 2
- 229960005016 naphazoline Drugs 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- OSDZHDOKXGSWOD-UHFFFAOYSA-N nitroxyl;hydrochloride Chemical compound Cl.O=N OSDZHDOKXGSWOD-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012265 solid product Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 229960000337 tetryzoline Drugs 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 2
- XFNJVJPLKCPIBV-UHFFFAOYSA-N trimethylenediamine Chemical compound NCCCN XFNJVJPLKCPIBV-UHFFFAOYSA-N 0.000 description 2
- 210000001177 vas deferen Anatomy 0.000 description 2
- CAZAKZQHCQEODF-UHFFFAOYSA-N (1-methylnaphthalen-2-yl)methanol Chemical compound C1=CC=C2C(C)=C(CO)C=CC2=C1 CAZAKZQHCQEODF-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- MVXDLSVGNXINCR-UHFFFAOYSA-N 1-ethyl-2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-4,5-dihydroimidazole Chemical compound CCN1CCN=C1CC1=C(C)C2=CC=CC=C2CC1 MVXDLSVGNXINCR-UHFFFAOYSA-N 0.000 description 1
- XVFJKYPFHFHIOV-UHFFFAOYSA-N 1-methyl-1,3-dihydroinden-2-one Chemical compound C1=CC=C2C(C)C(=O)CC2=C1 XVFJKYPFHFHIOV-UHFFFAOYSA-N 0.000 description 1
- XHLHPRDBBAGVEG-UHFFFAOYSA-N 1-tetralone Chemical compound C1=CC=C2C(=O)CCCC2=C1 XHLHPRDBBAGVEG-UHFFFAOYSA-N 0.000 description 1
- HJKLEAOXCZIMPI-UHFFFAOYSA-N 2,2-diethoxyethanamine Chemical compound CCOC(CN)OCC HJKLEAOXCZIMPI-UHFFFAOYSA-N 0.000 description 1
- DDHUNHGZUHZNKB-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diamine Chemical compound NCC(C)(C)CN DDHUNHGZUHZNKB-UHFFFAOYSA-N 0.000 description 1
- JDBWLTKNTGCBJB-UHFFFAOYSA-N 2-(1-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)acetonitrile Chemical compound C1=CC=C2C(C)C(CC#N)CCC2=C1 JDBWLTKNTGCBJB-UHFFFAOYSA-N 0.000 description 1
- YONMUQFJBVONIM-UHFFFAOYSA-N 2-(1-methyl-3,4-dihydronaphthalen-2-yl)acetic acid Chemical compound C1=CC=C2C(C)=C(CC(O)=O)CCC2=C1 YONMUQFJBVONIM-UHFFFAOYSA-N 0.000 description 1
- WETRBJOSGIDJHQ-UHFFFAOYSA-N 2-(3,4-dihydronaphthalen-2-ylmethyl)-4,5-dihydro-1h-imidazole Chemical compound C=1C2=CC=CC=C2CCC=1CC1=NCCN1 WETRBJOSGIDJHQ-UHFFFAOYSA-N 0.000 description 1
- ZDEZZEXVRHVGGC-UHFFFAOYSA-N 2-[(1-methyl-3,4-dihydronaphthalen-2-yl)methyl]-1h-imidazole Chemical compound C1CC2=CC=CC=C2C(C)=C1CC1=NC=CN1 ZDEZZEXVRHVGGC-UHFFFAOYSA-N 0.000 description 1
- STLSOFAFTXCYOU-UHFFFAOYSA-N 2-methylbutane-1,3-diamine Chemical compound CC(N)C(C)CN STLSOFAFTXCYOU-UHFFFAOYSA-N 0.000 description 1
- LPCWDVLDJVZIHA-UHFFFAOYSA-N 2-naphthalen-2-ylacetonitrile Chemical compound C1=CC=CC2=CC(CC#N)=CC=C21 LPCWDVLDJVZIHA-UHFFFAOYSA-N 0.000 description 1
- LQLCRMCSHBOJRE-UHFFFAOYSA-N 3,3-diethyl-2-phosphonopentanoic acid Chemical compound CCC(CC)(CC)C(C(O)=O)P(O)(O)=O LQLCRMCSHBOJRE-UHFFFAOYSA-N 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- ISBHQRSVUQBOMI-UHFFFAOYSA-N 5-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1C(=O)CCC2=C1C=CC=C2C ISBHQRSVUQBOMI-UHFFFAOYSA-N 0.000 description 1
- PLVQHRKJVDZNTK-UHFFFAOYSA-N 6-methoxy-1-methyl-3,4-dihydro-1h-naphthalen-2-one Chemical compound CC1C(=O)CCC2=CC(OC)=CC=C21 PLVQHRKJVDZNTK-UHFFFAOYSA-N 0.000 description 1
- RMRKDYNVZWKAFP-UHFFFAOYSA-N 6-methoxy-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1C(=O)CCC2=CC(OC)=CC=C21 RMRKDYNVZWKAFP-UHFFFAOYSA-N 0.000 description 1
- CSIHHNSBJNDXNO-UHFFFAOYSA-N 7-chloro-3,4-dihydro-1h-naphthalen-2-one Chemical compound C1CC(=O)CC2=CC(Cl)=CC=C21 CSIHHNSBJNDXNO-UHFFFAOYSA-N 0.000 description 1
- 238000006218 Arndt-Eistert homologation reaction Methods 0.000 description 1
- 241000269420 Bufonidae Species 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 206010015995 Eyelid ptosis Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000000150 Sympathomimetic Substances 0.000 description 1
- 210000001015 abdomen Anatomy 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- GANYMSDHMBJFIL-UHFFFAOYSA-N acetonitrile;ethoxyethane Chemical compound CC#N.CCOCC GANYMSDHMBJFIL-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 239000000048 adrenergic agonist Substances 0.000 description 1
- 102000004305 alpha Adrenergic Receptors Human genes 0.000 description 1
- 108090000861 alpha Adrenergic Receptors Proteins 0.000 description 1
- 230000036592 analgesia Effects 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- FLKYBGKDCCEQQM-WYUVZMMLSA-M cefazolin sodium Chemical compound [Na+].S1C(C)=NN=C1SCC1=C(C([O-])=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 FLKYBGKDCCEQQM-WYUVZMMLSA-M 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000003001 depressive effect Effects 0.000 description 1
- TUTOKIOKAWTABR-UHFFFAOYSA-N dimethylalumane Chemical compound C[AlH]C TUTOKIOKAWTABR-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 230000001882 diuretic effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- DLLJVQNYBYOKGS-UHFFFAOYSA-N ethoxyethane;pentane Chemical compound CCCCC.CCOCC DLLJVQNYBYOKGS-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000004970 halomethyl group Chemical group 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical class C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 1
- UMJJFEIKYGFCAT-UHFFFAOYSA-N indan-2-one Chemical compound C1=CC=C2CC(=O)CC2=C1 UMJJFEIKYGFCAT-UHFFFAOYSA-N 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- PLPIVSVTRFQJFM-UHFFFAOYSA-N methanimidoyl methanimidate;hydrochloride Chemical compound Cl.N=COC=N PLPIVSVTRFQJFM-UHFFFAOYSA-N 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- WPQDZEYPGYMDAI-UHFFFAOYSA-N methyl 1-methyl-3,4-dihydro-2h-naphthalene-1-carboxylate Chemical compound C1=CC=C2C(C(=O)OC)(C)CCCC2=C1 WPQDZEYPGYMDAI-UHFFFAOYSA-N 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- XLSZMDLNRCVEIJ-UHFFFAOYSA-N methylimidazole Natural products CC1=CNC=N1 XLSZMDLNRCVEIJ-UHFFFAOYSA-N 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- SCZVXVGZMZRGRU-UHFFFAOYSA-N n'-ethylethane-1,2-diamine Chemical compound CCNCCN SCZVXVGZMZRGRU-UHFFFAOYSA-N 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- 239000000133 nasal decongestant Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 230000003040 nociceptive effect Effects 0.000 description 1
- 239000004533 oil dispersion Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- LJCNRYVRMXRIQR-OLXYHTOASA-L potassium sodium L-tartrate Chemical class [Na+].[K+].[O-]C(=O)[C@H](O)[C@@H](O)C([O-])=O LJCNRYVRMXRIQR-OLXYHTOASA-L 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 201000003004 ptosis Diseases 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 102000005962 receptors Human genes 0.000 description 1
- 108020003175 receptors Proteins 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-M sodium hydrosulfide Chemical compound [Na+].[SH-] HYHCSLBZRBJJCH-UHFFFAOYSA-M 0.000 description 1
- 235000009518 sodium iodide Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000024188 startle response Effects 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940127230 sympathomimetic drug Drugs 0.000 description 1
- 230000001975 sympathomimetic effect Effects 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
- C07D233/58—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/18—Monohydroxylic alcohols containing only six-membered aromatic rings as cyclic part
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C33/00—Unsaturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C33/34—Monohydroxylic alcohols containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/06—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/04—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
- C07D233/20—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D233/22—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/06—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having one double bond between ring members or between a ring member and a non-ring member
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/475,193 US4540705A (en) | 1983-03-14 | 1983-03-14 | Antidepressant imidazolines and related compounds |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO840893L true NO840893L (no) | 1984-09-17 |
Family
ID=23886585
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO840893A NO840893L (no) | 1983-03-14 | 1984-03-08 | Imidazoliner og beslektede forbindelser samt fremgangsmaate for deres fremstilling |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US4540705A (enFirst) |
| EP (1) | EP0125410A3 (enFirst) |
| JP (1) | JPS59193875A (enFirst) |
| KR (1) | KR900001216B1 (enFirst) |
| AU (1) | AU568839B2 (enFirst) |
| CA (1) | CA1215369A (enFirst) |
| DK (1) | DK112984A (enFirst) |
| ES (1) | ES8601907A1 (enFirst) |
| FI (1) | FI840839A7 (enFirst) |
| GR (1) | GR81813B (enFirst) |
| IL (1) | IL70966A (enFirst) |
| NO (1) | NO840893L (enFirst) |
| NZ (1) | NZ207184A (enFirst) |
| PH (1) | PH19715A (enFirst) |
| PT (1) | PT78195B (enFirst) |
| ZA (1) | ZA841323B (enFirst) |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB9016800D0 (en) * | 1990-07-31 | 1990-09-12 | Shell Int Research | Tetrahydropyrimidine derivatives |
| US6559157B2 (en) | 1997-10-02 | 2003-05-06 | Daiichi Pharmaceutical Co., Ltd. | Dihydronaphthalene compounds |
| EP1028110B1 (en) * | 1997-10-02 | 2004-04-14 | Daiichi Pharmaceutical Co., Ltd. | Novel dihydronaphthalene compounds and process for producing the same |
| US6329369B1 (en) | 1997-12-04 | 2001-12-11 | Allergan Sales, Inc. | Methods of treating pain and other conditions |
| US6841684B2 (en) | 1997-12-04 | 2005-01-11 | Allergan, Inc. | Imidiazoles having reduced side effects |
| PT924209E (pt) * | 1997-12-19 | 2003-08-29 | Lilly Co Eli | Compostos de imidazolina hipoglicemicos |
| EP1266897A3 (en) * | 1997-12-19 | 2003-12-03 | Eli Lilly And Company | Hypoglycemic imidazoline compounds |
| FR2787451B1 (fr) * | 1998-12-18 | 2001-01-26 | Adir | Nouveaux composes imidazoliniques, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| US6410562B1 (en) | 1998-12-18 | 2002-06-25 | Eli Lilly And Company | Hypoglycemic imidazoline compounds |
| BRPI0707315A2 (pt) | 2006-01-27 | 2011-05-03 | Hoffmann La Roche | uso de 2-imidazol substituìdo de derivados de imidazolina |
| CA2666762C (en) | 2006-10-19 | 2014-12-30 | F. Hoffmann-La Roche Ag | Aminomethyl-4-imidazoles |
| ATE533755T1 (de) | 2006-11-02 | 2011-12-15 | Hoffmann La Roche | Substituierte 2-imidazole als modulatoren der mit spurenaminen assoziierten rezeptoren |
| CN101535298A (zh) | 2006-11-16 | 2009-09-16 | 弗·哈夫曼-拉罗切有限公司 | 取代的4-咪唑类化合物 |
| CA2672617A1 (en) | 2006-12-13 | 2008-06-19 | F. Hoffmann-La Roche Ag | Novel 2-imidazoles as ligands for trace amine associated receptors (taar) |
| US20080146523A1 (en) | 2006-12-18 | 2008-06-19 | Guido Galley | Imidazole derivatives |
| US7582691B2 (en) * | 2007-01-17 | 2009-09-01 | Sabic Innovative Plastics Ip B.V. | Poly(arylene ether) compositions and articles |
| WO2008092785A1 (en) | 2007-02-02 | 2008-08-07 | F. Hoffmann-La Roche Ag | Novel 2-aminooxazolines as taar1 ligands for cns disorders |
| ES2525229T3 (es) | 2007-02-15 | 2014-12-19 | F. Hoffmann-La Roche Ag | 2-aminooxazolinas como ligandos de TAAR1 |
| JP2010531837A (ja) | 2007-07-02 | 2010-09-30 | エフ.ホフマン−ラ ロシュ アーゲー | 微量アミン関連レセプター(taar)に対して良好な親和性を有する2−イミダゾリン |
| EP2173719A1 (en) | 2007-07-03 | 2010-04-14 | F. Hoffmann-Roche AG | 4-imidazolines and their use as antidepressants |
| KR101133862B1 (ko) | 2007-07-27 | 2012-04-06 | 에프. 호프만-라 로슈 아게 | Taar 리간드로서의 2-아제티딘메테인아민 및 2-피롤리딘메테인아민 |
| BRPI0814758A2 (pt) | 2007-08-03 | 2015-03-03 | Hoffmann La Roche | Piridinacarboxamida e derivados de benzamida como ligantes taar1 |
| US8242153B2 (en) | 2008-07-24 | 2012-08-14 | Hoffmann-La Roche Inc. | 4,5-dihydro-oxazol-2YL derivatives |
| US8354441B2 (en) | 2009-11-11 | 2013-01-15 | Hoffmann-La Roche Inc. | Oxazoline derivatives |
| US9452980B2 (en) | 2009-12-22 | 2016-09-27 | Hoffmann-La Roche Inc. | Substituted benzamides |
| MA43706B1 (fr) | 2016-03-17 | 2020-09-30 | Hoffmann La Roche | Dérivé de 5-éthyl-4-méthyl-pyrazole-3-carboxamide ayant une activité en tant qu'agoniste de taar |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2731471A (en) * | 1956-01-17 | Nxg hi | ||
| US2161938A (en) * | 1934-07-31 | 1939-06-13 | Soc Of Chemical Ind | Imidazolines |
| FR926661A (fr) * | 1941-07-09 | 1947-10-08 | Lovens Kemiske Fabrik V Aug Ko | Méthyle-imidazolines substituées et leur procédé de préparation |
| GB757650A (en) * | 1953-06-15 | 1956-09-19 | Pfizer & Co C | Improvements in or relating to substituted imidazolines and the preparation thereof |
| DE1150180B (de) * | 1962-04-12 | 1963-06-12 | Merck Ag E | Mittel zur Vorbehandlung der Haut fuer die Rasur |
| GB1317514A (en) * | 1970-11-30 | 1973-05-23 | Erba Carlo Spa | Imidazoline derivatives |
| US4085209A (en) * | 1975-02-05 | 1978-04-18 | Rohm And Haas Company | Preparation and safening effect of 1-substituted imidazole metal salt complexes |
-
1983
- 1983-03-14 US US06/475,193 patent/US4540705A/en not_active Expired - Fee Related
-
1984
- 1984-02-15 IL IL70966A patent/IL70966A/xx not_active IP Right Cessation
- 1984-02-16 NZ NZ207184A patent/NZ207184A/en unknown
- 1984-02-23 AU AU24877/84A patent/AU568839B2/en not_active Ceased
- 1984-02-23 PH PH30284A patent/PH19715A/en unknown
- 1984-02-23 ZA ZA841323A patent/ZA841323B/xx unknown
- 1984-02-28 DK DK112984A patent/DK112984A/da not_active Application Discontinuation
- 1984-02-29 GR GR73944A patent/GR81813B/el unknown
- 1984-03-02 FI FI840839A patent/FI840839A7/fi not_active Application Discontinuation
- 1984-03-02 PT PT78195A patent/PT78195B/pt unknown
- 1984-03-05 EP EP84102382A patent/EP0125410A3/en not_active Withdrawn
- 1984-03-07 ES ES530345A patent/ES8601907A1/es not_active Expired
- 1984-03-08 NO NO840893A patent/NO840893L/no unknown
- 1984-03-09 KR KR1019840001189A patent/KR900001216B1/ko not_active Expired
- 1984-03-09 JP JP59045333A patent/JPS59193875A/ja active Pending
- 1984-03-13 CA CA000449452A patent/CA1215369A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| EP0125410A2 (en) | 1984-11-21 |
| PH19715A (en) | 1986-06-17 |
| DK112984A (da) | 1984-09-15 |
| JPS59193875A (ja) | 1984-11-02 |
| EP0125410A3 (en) | 1987-01-14 |
| ZA841323B (en) | 1984-10-31 |
| NZ207184A (en) | 1986-12-05 |
| PT78195B (en) | 1986-04-24 |
| DK112984D0 (da) | 1984-02-28 |
| ES530345A0 (es) | 1985-11-16 |
| IL70966A (en) | 1987-08-31 |
| PT78195A (en) | 1984-04-01 |
| AU2487784A (en) | 1984-09-20 |
| US4540705A (en) | 1985-09-10 |
| CA1215369A (en) | 1986-12-16 |
| FI840839A0 (fi) | 1984-03-02 |
| IL70966A0 (en) | 1984-05-31 |
| KR840008327A (ko) | 1984-12-14 |
| KR900001216B1 (ko) | 1990-02-28 |
| ES8601907A1 (es) | 1985-11-16 |
| GR81813B (enFirst) | 1984-12-12 |
| AU568839B2 (en) | 1988-01-14 |
| FI840839A7 (fi) | 1984-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO840893L (no) | Imidazoliner og beslektede forbindelser samt fremgangsmaate for deres fremstilling | |
| Godefroi et al. | DL-1-(1-arylalkyl) imidazole-5-carboxylate esters. A novel type of hypnotic agents | |
| CA2233003A1 (en) | Pyrimidine derivatives as 5ht2c-receptor antagonists | |
| DE69119013T2 (de) | Benzen-, Pyridin-, Pyrimidinderivat | |
| US4738979A (en) | α2 -blocking derivatives of imidazole | |
| CA1146563A (en) | Benzimidazole derivatives, their preparation and use, and compositions containing these derivatives | |
| DE3100575A1 (de) | "neue benzoesaeuren, ihre herstellung und ihre verwendung als arzneimittel" | |
| US3428646A (en) | 4-imidazolidones and processes for preparing same | |
| US4672063A (en) | Antiallergic 5-alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-one compounds | |
| US4169108A (en) | 5(OR 6)-[(Substituted-amino)alkyl]-2,3-naphthalenediols | |
| WO1988001268A1 (fr) | Derives d'imidazole | |
| FI67544C (fi) | Foerfarande foer framstaellning av farmakologiskt vaerdefullt imidazolinderivat | |
| US5179111A (en) | Imidazole derivatives | |
| US6127396A (en) | Imidazoline compounds | |
| US5190589A (en) | Compounds and process preparing a substituted or an unsubstituted 4(5)-(ω-aminoalkyl)imidazole | |
| US3449357A (en) | 2-((2,6-substituted)phenoxymethyl)-2-imidazolines | |
| US4598086A (en) | α2 antagonistic 2-(4,5-dihydro-2-1H-imidazolyl)-2,3-dihydro-1H-indoles | |
| HU196739B (en) | Process for producing new aminoketone derivatives and pharmaceutical compositions comprising such compounds as active ingredient | |
| US3932452A (en) | 1-Arylmethyl-2-imidazolidinones | |
| US3256278A (en) | N-hydroxy ethyl-ortho acetyl and carbalkoxy amino phenyl-glyoxamides and process formaking 2-orthoamino phenyl-morpholines | |
| US4559356A (en) | 2-(Inden-2-yl)-imidazoline derivatives, process for their preparation and pharmaceutical compositions containing them | |
| FR2643373A1 (fr) | Nouveaux derives des bisarylalcenes, leurs procedes de preparation et les compositions pharmaceutiques qui les contiennent | |
| US6132286A (en) | Preparation of 1,2,5,6-tetra-hydro-3-carboalkoxypridines such as arecoline and salts of 1,2,5,6-tetrahydro-3-carboalkoxypridines and arecoline hydrobromide | |
| CS200160B2 (en) | Method of producing novel derivatives of arylamino imidazoline | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater |