NO781618L - Fremgangsmaate ved fremstilling av nye chromenderivater - Google Patents
Fremgangsmaate ved fremstilling av nye chromenderivaterInfo
- Publication number
- NO781618L NO781618L NO781618A NO781618A NO781618L NO 781618 L NO781618 L NO 781618L NO 781618 A NO781618 A NO 781618A NO 781618 A NO781618 A NO 781618A NO 781618 L NO781618 L NO 781618L
- Authority
- NO
- Norway
- Prior art keywords
- radical
- formula
- carbon atoms
- denotes
- alkyl
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 8
- 150000008371 chromenes Chemical class 0.000 title description 2
- -1 alkoxy radical Chemical class 0.000 claims description 51
- 125000004432 carbon atom Chemical group C* 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 33
- 150000003254 radicals Chemical class 0.000 claims description 23
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 10
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 7
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 150000001298 alcohols Chemical class 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- KZKRRZFCAYOXQE-UHFFFAOYSA-N 1$l^{2}-azinane Chemical group C1CC[N]CC1 KZKRRZFCAYOXQE-UHFFFAOYSA-N 0.000 claims description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical compound [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical compound O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 239000000463 material Substances 0.000 description 8
- 125000000217 alkyl group Chemical group 0.000 description 7
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical group C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 208000009079 Bronchial Spasm Diseases 0.000 description 3
- 208000014181 Bronchial disease Diseases 0.000 description 3
- 206010006482 Bronchospasm Diseases 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- SPWAIRGUACCVAD-UHFFFAOYSA-N 1-(2h-chromen-3-yl)ethanone Chemical compound C1=CC=C2OCC(C(=O)C)=CC2=C1 SPWAIRGUACCVAD-UHFFFAOYSA-N 0.000 description 2
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 206010003119 arrhythmia Diseases 0.000 description 2
- 230000006793 arrhythmia Effects 0.000 description 2
- 230000003182 bronchodilatating effect Effects 0.000 description 2
- 229940124630 bronchodilator Drugs 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- WEXRUCMBJFQVBZ-UHFFFAOYSA-N pentobarbital Chemical compound CCCC(C)C1(CC)C(=O)NC(=O)NC1=O WEXRUCMBJFQVBZ-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 230000033764 rhythmic process Effects 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- CPEONABTMRSIKA-UHFFFAOYSA-N 1,4$l^{2}-oxazinane Chemical compound C1COCC[N]1 CPEONABTMRSIKA-UHFFFAOYSA-N 0.000 description 1
- DPSJKWCTFLQCJC-UHFFFAOYSA-N 1-(2H-chromen-2-yl)ethanone Chemical compound C1=CC=C2C=CC(C(=O)C)OC2=C1 DPSJKWCTFLQCJC-UHFFFAOYSA-N 0.000 description 1
- CJNVMWOFHMIXBS-UHFFFAOYSA-N 1-(2h-chromen-3-yl)-2-(4-phenylpiperazin-1-yl)ethanol;hydrochloride Chemical compound Cl.C=1C2=CC=CC=C2OCC=1C(O)CN(CC1)CCN1C1=CC=CC=C1 CJNVMWOFHMIXBS-UHFFFAOYSA-N 0.000 description 1
- RTXOQMZAZKURNH-UHFFFAOYSA-N 1-(2h-chromen-3-yl)-2-(4-phenylpiperazin-1-yl)ethanone;hydrochloride Chemical compound Cl.C=1C2=CC=CC=C2OCC=1C(=O)CN(CC1)CCN1C1=CC=CC=C1 RTXOQMZAZKURNH-UHFFFAOYSA-N 0.000 description 1
- WDXVIENSHOAFRM-UHFFFAOYSA-N 1-(2h-chromen-3-yl)-3-(4-methylpiperazin-1-yl)propan-1-ol;hydrochloride Chemical compound Cl.C1CN(C)CCN1CCC(O)C1=CC2=CC=CC=C2OC1 WDXVIENSHOAFRM-UHFFFAOYSA-N 0.000 description 1
- QUMRLXXCRQWODL-UHFFFAOYSA-N 1-methylpiperazin-1-ium;chloride Chemical compound [Cl-].C[NH+]1CCNCC1 QUMRLXXCRQWODL-UHFFFAOYSA-N 0.000 description 1
- DSUVJRDETHXEBP-UHFFFAOYSA-N 2-bromo-1-(2h-chromen-3-yl)ethanone Chemical compound C1=CC=C2OCC(C(=O)CBr)=CC2=C1 DSUVJRDETHXEBP-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 101150041968 CDC13 gene Proteins 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 238000006683 Mannich reaction Methods 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241001122767 Theaceae Species 0.000 description 1
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 230000003288 anthiarrhythmic effect Effects 0.000 description 1
- 239000003416 antiarrhythmic agent Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 230000007665 chronic toxicity Effects 0.000 description 1
- 231100000160 chronic toxicity Toxicity 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- CVVIJWRCGSYCMB-UHFFFAOYSA-N hydron;piperazine;dichloride Chemical compound Cl.Cl.C1CNCCN1 CVVIJWRCGSYCMB-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- LPMXVESGRSUGHW-HBYQJFLCSA-N ouabain Chemical compound O[C@@H]1[C@H](O)[C@@H](O)[C@H](C)O[C@H]1O[C@@H]1C[C@@]2(O)CC[C@H]3[C@@]4(O)CC[C@H](C=5COC(=O)C=5)[C@@]4(C)C[C@@H](O)[C@@H]3[C@@]2(CO)[C@H](O)C1 LPMXVESGRSUGHW-HBYQJFLCSA-N 0.000 description 1
- 229960003343 ouabain Drugs 0.000 description 1
- 235000011837 pasties Nutrition 0.000 description 1
- 229960001412 pentobarbital Drugs 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 1
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 206010047302 ventricular tachycardia Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/04—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring
- C07D311/58—Benzo[b]pyrans, not hydrogenated in the carbocyclic ring other than with oxygen or sulphur atoms in position 2 or 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrane Compounds (AREA)
- Saccharide Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB19351/77A GB1583811A (en) | 1977-05-09 | 1977-05-09 | Chromene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO781618L true NO781618L (no) | 1978-11-10 |
Family
ID=10127911
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO781618A NO781618L (no) | 1977-05-09 | 1978-05-08 | Fremgangsmaate ved fremstilling av nye chromenderivater |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4181722A (da) |
| JP (1) | JPS53149978A (da) |
| AR (1) | AR219746A1 (da) |
| AT (1) | AT361921B (da) |
| AU (1) | AU519864B2 (da) |
| BE (1) | BE866784A (da) |
| CA (1) | CA1099717A (da) |
| CH (1) | CH632261A5 (da) |
| DE (1) | DE2819896A1 (da) |
| DK (1) | DK199778A (da) |
| ES (1) | ES469961A1 (da) |
| FR (1) | FR2390445A1 (da) |
| GB (1) | GB1583811A (da) |
| IE (1) | IE46823B1 (da) |
| IL (1) | IL54576A (da) |
| IT (1) | IT7868045A0 (da) |
| NL (1) | NL7804907A (da) |
| NO (1) | NO781618L (da) |
| NZ (1) | NZ187202A (da) |
| PH (1) | PH13728A (da) |
| ZA (1) | ZA782622B (da) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4288447A (en) * | 1979-02-06 | 1981-09-08 | A. H. Robins Company, Inc. | Antihyperglycemic 4-substituted 2-iminoimidazolidine compositions |
| US4288591A (en) * | 1979-02-06 | 1981-09-08 | A. H. Robins Company, Inc. | 4-Substituted 2-iminoimidazolidine compounds |
| US4329459A (en) * | 1980-05-05 | 1982-05-11 | The Upjohn Company | Tetrahydrobenzopyran derivatives |
| US4971982A (en) * | 1987-07-06 | 1990-11-20 | Hoffmann-La Roche Inc. | Benzopyran derivatives |
| FR2618437B1 (fr) * | 1987-07-23 | 1989-11-17 | Rhone Poulenc Sante | Nouveaux derives du benzopyranne, leur preparation et les medicaments qui les contiennent |
| US6693099B2 (en) | 2000-10-17 | 2004-02-17 | The Procter & Gamble Company | Substituted piperazine compounds optionally containing a quinolyl moiety for treating multidrug resistance |
| US6376514B1 (en) | 2000-10-17 | 2002-04-23 | The Procter & Gamble Co. | Substituted six-membered heterocyclic compounds useful for treating multidrug resistance and compositions and methods thereof |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3374245A (en) * | 1964-04-01 | 1968-03-19 | Ciba Geigy Corp | Unsaturated oxacycles |
| US3959281A (en) * | 1968-01-19 | 1976-05-25 | Cassella Farbwerke Mainkur Aktiengesellschaft | Piperazino substituted coumarin derivatives |
| US3796727A (en) * | 1972-01-31 | 1974-03-12 | Eastman Kodak Co | Synthesis of novel benzopyran compounds |
| DE2325633A1 (de) * | 1973-05-21 | 1974-12-12 | Boehringer Sohn Ingelheim | Piperazinderivate |
-
1977
- 1977-05-09 GB GB19351/77A patent/GB1583811A/en not_active Expired
-
1978
- 1978-04-05 AR AR272065A patent/AR219746A1/es active
- 1978-04-25 CH CH443078A patent/CH632261A5/fr not_active IP Right Cessation
- 1978-04-25 IL IL54576A patent/IL54576A/xx unknown
- 1978-05-01 US US05/901,834 patent/US4181722A/en not_active Expired - Lifetime
- 1978-05-03 FR FR7813114A patent/FR2390445A1/fr active Granted
- 1978-05-06 DE DE19782819896 patent/DE2819896A1/de not_active Withdrawn
- 1978-05-08 AU AU35899/78A patent/AU519864B2/en not_active Expired
- 1978-05-08 IE IE926/78A patent/IE46823B1/en unknown
- 1978-05-08 NO NO781618A patent/NO781618L/no unknown
- 1978-05-08 IT IT7868045A patent/IT7868045A0/it unknown
- 1978-05-08 NZ NZ187202A patent/NZ187202A/xx unknown
- 1978-05-08 NL NL7804907A patent/NL7804907A/xx not_active Application Discontinuation
- 1978-05-08 DK DK199778A patent/DK199778A/da not_active Application Discontinuation
- 1978-05-08 BE BE187457A patent/BE866784A/xx unknown
- 1978-05-08 CA CA302,786A patent/CA1099717A/en not_active Expired
- 1978-05-08 JP JP5382678A patent/JPS53149978A/ja active Pending
- 1978-05-08 ZA ZA00782622A patent/ZA782622B/xx unknown
- 1978-05-09 ES ES469961A patent/ES469961A1/es not_active Expired
- 1978-05-09 AT AT336278A patent/AT361921B/de not_active IP Right Cessation
-
1980
- 1980-05-09 PH PH21117A patent/PH13728A/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IE780926L (en) | 1978-11-09 |
| FR2390445B1 (da) | 1982-03-12 |
| GB1583811A (en) | 1981-02-04 |
| IL54576A (en) | 1981-07-31 |
| ES469961A1 (es) | 1978-12-16 |
| IL54576A0 (en) | 1978-07-31 |
| AU519864B2 (en) | 1981-12-24 |
| DE2819896A1 (de) | 1978-11-23 |
| IE46823B1 (en) | 1983-10-05 |
| ZA782622B (en) | 1979-05-30 |
| AT361921B (de) | 1981-04-10 |
| CH632261A5 (fr) | 1982-09-30 |
| BE866784A (fr) | 1978-11-08 |
| CA1099717A (en) | 1981-04-21 |
| IT7868045A0 (it) | 1978-05-08 |
| DK199778A (da) | 1978-11-10 |
| FR2390445A1 (fr) | 1978-12-08 |
| NL7804907A (nl) | 1978-11-13 |
| JPS53149978A (en) | 1978-12-27 |
| US4181722A (en) | 1980-01-01 |
| NZ187202A (en) | 1979-10-25 |
| ATA336278A (de) | 1980-09-15 |
| AU3589978A (en) | 1979-11-15 |
| PH13728A (en) | 1980-09-09 |
| AR219746A1 (es) | 1980-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5346896A (en) | 1-(aryl or heteroaryl)-4[ω-(aryl or heteroaryl)ω-(aryl or heteroaryl)alkylene]piperazines | |
| CA1193264A (en) | Pharmaceutically active (3-aminopropoxy)bibenzyl derivatives | |
| US2683742A (en) | Nu, nu-disubstituted omega-arylmethoxy-omega-arylalkylamine derivatives | |
| US4478750A (en) | 1-Phenyl-azepinoindoles | |
| AU644295B2 (en) | 2-aminopyrimidine-4-carboxamide derivatives, their preparation and their use in therapeutics | |
| US4219551A (en) | Aminoalkoxyphenylpyrrolidone antihypertonic agents and use thereof | |
| NO781618L (no) | Fremgangsmaate ved fremstilling av nye chromenderivater | |
| US4278796A (en) | Piperazines | |
| SU634673A3 (ru) | Способ получени имидазо (4,5- )пиридинов или их солей | |
| US5084456A (en) | Oxazolopyridine compounds | |
| US3311636A (en) | Organic chemical compounds and process | |
| SU428602A3 (ru) | Способ получения основпозамещенных производных 1 | |
| SU498907A3 (ru) | Способ получени фенилимидазолидинонов | |
| US4925944A (en) | Process for the preparation of o-carboxypyridyl- and o-carboxyquinolylimidazolinones | |
| US4229350A (en) | Dibenzo[d,g][1,3,6]dioxazocine derivatives | |
| CA1127156A (en) | Piperazine methanimine derivatives, process for their preparation and applications thereof | |
| US3963778A (en) | Basic oximes and their preparation | |
| NO147838B (no) | Mellomprodukt til bruk ved fremstilling av det hypotensive middel 2-(4-(2-furoyl)piperazin-1-yl)-4-amino-6,7-dimetoksykinazolin | |
| US3535317A (en) | 3-hydrazinopyridazines having hypotensive activity | |
| US4010280A (en) | Phenoxyalkylamine derivatives and preparation thereof | |
| EP0001759B1 (en) | (omega-aminoalkoxy) bibenzyls, processes for their preparation and pharmaceutical compositions containing these substances | |
| US4091095A (en) | Phosphinyl compounds | |
| EP0301549A1 (en) | 1-[2-(Phenylmethyl)phenyl]-piperazine compounds, a process for preparing them and pharmaceutical compostions containing them | |
| US3580914A (en) | Derivatives of n-methylpiperazine | |
| US3450709A (en) | Process for the preparation of ring-substituted 2-aminoimidazoles |