NO753672L - - Google Patents
Info
- Publication number
- NO753672L NO753672L NO753672A NO753672A NO753672L NO 753672 L NO753672 L NO 753672L NO 753672 A NO753672 A NO 753672A NO 753672 A NO753672 A NO 753672A NO 753672 L NO753672 L NO 753672L
- Authority
- NO
- Norway
- Prior art keywords
- groups
- naphthalene
- compounds
- alkyl
- hydrogen
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 52
- -1 piperidino, morpholino, pyrrolidinyl Chemical group 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 22
- 239000001257 hydrogen Substances 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 16
- 150000003839 salts Chemical class 0.000 claims description 15
- 125000001424 substituent group Chemical group 0.000 claims description 14
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 13
- 150000002790 naphthalenes Chemical class 0.000 claims description 13
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 7
- 150000002367 halogens Chemical class 0.000 claims description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 6
- 125000004423 acyloxy group Chemical group 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 229910052757 nitrogen Inorganic materials 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 5
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 5
- 239000012442 inert solvent Substances 0.000 claims description 4
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- CXNJUWWRWZDVAY-UHFFFAOYSA-N 4-[[3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine;dihydrochloride Chemical compound Cl.Cl.C=1C2=CC=CC=C2C=C(CN2CCOCC2)C=1CN1CCOCC1 CXNJUWWRWZDVAY-UHFFFAOYSA-N 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000002775 capsule Substances 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- 150000004677 hydrates Chemical class 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 125000002524 organometallic group Chemical group 0.000 claims description 3
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 3
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 2
- 125000003341 7 membered heterocyclic group Chemical group 0.000 claims description 2
- 150000001350 alkyl halides Chemical class 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 150000004985 diamines Chemical class 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 229910052987 metal hydride Inorganic materials 0.000 claims description 2
- 150000004681 metal hydrides Chemical class 0.000 claims description 2
- LOTBYPQQWICYBB-UHFFFAOYSA-N methyl n-hexyl-n-[2-(hexylamino)ethyl]carbamate Chemical compound CCCCCCNCCN(C(=O)OC)CCCCCC LOTBYPQQWICYBB-UHFFFAOYSA-N 0.000 claims description 2
- 231100000252 nontoxic Toxicity 0.000 claims description 2
- 230000003000 nontoxic effect Effects 0.000 claims description 2
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 125000004193 piperazinyl group Chemical group 0.000 claims description 2
- RUOUNROCMSFCNI-UHFFFAOYSA-N 4-[[3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine Chemical compound C=1C2=CC=CC=C2C=C(CN2CCOCC2)C=1CN1CCOCC1 RUOUNROCMSFCNI-UHFFFAOYSA-N 0.000 claims 1
- ZUSNKEOADYYOGV-UHFFFAOYSA-N 4-[[3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine;hydrate;dihydrochloride Chemical compound O.Cl.Cl.C=1C2=CC=CC=C2C=C(CN2CCOCC2)C=1CN1CCOCC1 ZUSNKEOADYYOGV-UHFFFAOYSA-N 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 125000001979 organolithium group Chemical group 0.000 claims 1
- 238000006467 substitution reaction Methods 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 50
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 14
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 12
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- YIFXJYVHCIZPKV-UHFFFAOYSA-N 1,4-dichloro-2,3-dimethylnaphthalene Chemical compound C1=CC=CC2=C(Cl)C(C)=C(C)C(Cl)=C21 YIFXJYVHCIZPKV-UHFFFAOYSA-N 0.000 description 8
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 8
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 150000002431 hydrogen Chemical class 0.000 description 8
- 238000010992 reflux Methods 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000000706 filtrate Substances 0.000 description 7
- 239000003208 petroleum Substances 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- KSWRISNDOBRMNI-UHFFFAOYSA-N 2,3-bis(chloromethyl)-1,4-diethoxynaphthalene Chemical compound C1=CC=C2C(OCC)=C(CCl)C(CCl)=C(OCC)C2=C1 KSWRISNDOBRMNI-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- UUFXJQHTRKQSPE-UHFFFAOYSA-N [3-[hydroxy(phenyl)methyl]naphthalen-2-yl]-phenylmethanol Chemical compound C=1C2=CC=CC=C2C=C(C(O)C=2C=CC=CC=2)C=1C(O)C1=CC=CC=C1 UUFXJQHTRKQSPE-UHFFFAOYSA-N 0.000 description 6
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 239000012280 lithium aluminium hydride Substances 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000002002 slurry Substances 0.000 description 5
- HSFRODBENVJLHS-UHFFFAOYSA-N 2,3-bis(bromomethyl)naphthalene Chemical compound C1=CC=C2C=C(CBr)C(CBr)=CC2=C1 HSFRODBENVJLHS-UHFFFAOYSA-N 0.000 description 4
- LAKUPEZBSINTQI-UHFFFAOYSA-N 2,3-bis(chloromethyl)-1-phenylnaphthalene Chemical compound ClCC=1C(CCl)=CC2=CC=CC=C2C=1C1=CC=CC=C1 LAKUPEZBSINTQI-UHFFFAOYSA-N 0.000 description 4
- WWGUMAYGTYQSGA-UHFFFAOYSA-N 2,3-dimethylnaphthalene Chemical compound C1=CC=C2C=C(C)C(C)=CC2=C1 WWGUMAYGTYQSGA-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- JRNVZBWKYDBUCA-UHFFFAOYSA-N N-chlorosuccinimide Chemical compound ClN1C(=O)CCC1=O JRNVZBWKYDBUCA-UHFFFAOYSA-N 0.000 description 4
- PXCGIEWYNSJVML-UHFFFAOYSA-N [3-(hydroxymethyl)-4-phenylnaphthalen-2-yl]methanol Chemical compound OCC=1C(CO)=CC2=CC=CC=C2C=1C1=CC=CC=C1 PXCGIEWYNSJVML-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- UORVCLMRJXCDCP-UHFFFAOYSA-N propynoic acid Chemical compound OC(=O)C#C UORVCLMRJXCDCP-UHFFFAOYSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- LZQGZQKISQRHJH-UHFFFAOYSA-N 4-phenylbenzo[f][2]benzofuran-1,3-dione Chemical compound O=C1OC(=O)C2=C1C=C1C=CC=CC1=C2C1=CC=CC=C1 LZQGZQKISQRHJH-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- FFWULYPEDVHXMA-UHFFFAOYSA-N [3-(hydroxymethyl)-6-methoxynaphthalen-2-yl]methanol Chemical compound C1=C(CO)C(CO)=CC2=CC(OC)=CC=C21 FFWULYPEDVHXMA-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 230000000144 pharmacologic effect Effects 0.000 description 3
- 239000000377 silicon dioxide Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- KEAMGSGUUNWSOY-UHFFFAOYSA-N 1-(naphthalen-2-ylmethyl)piperidine Chemical compound C=1C=C2C=CC=CC2=CC=1CN1CCCCC1 KEAMGSGUUNWSOY-UHFFFAOYSA-N 0.000 description 2
- OPQOTMWEKJMDGD-UHFFFAOYSA-N 2,3-bis(bromomethyl)-1,4-dichloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(CBr)C(CBr)=C(Cl)C2=C1 OPQOTMWEKJMDGD-UHFFFAOYSA-N 0.000 description 2
- AKUFHNVNFCIQAI-UHFFFAOYSA-N 4-[[3-(morpholin-4-ylmethyl)-1-phenylnaphthalen-2-yl]methyl]morpholine Chemical compound C=1C2=CC=CC=C2C(C=2C=CC=CC=2)=C(CN2CCOCC2)C=1CN1CCOCC1 AKUFHNVNFCIQAI-UHFFFAOYSA-N 0.000 description 2
- HMBUZXATLDYEJA-UHFFFAOYSA-N 4-[[6-methoxy-3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine Chemical class C1COCCN1CC1=CC2=CC(OC)=CC=C2C=C1CN1CCOCC1 HMBUZXATLDYEJA-UHFFFAOYSA-N 0.000 description 2
- CFJXZNREFFTFFV-UHFFFAOYSA-N 6-chlorobenzo[f][2]benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC2=CC(Cl)=CC=C21 CFJXZNREFFTFFV-UHFFFAOYSA-N 0.000 description 2
- LTLFPBOXBQEHHO-UHFFFAOYSA-N 6-methoxybenzo[f][2]benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC2=CC(OC)=CC=C21 LTLFPBOXBQEHHO-UHFFFAOYSA-N 0.000 description 2
- 239000004342 Benzoyl peroxide Substances 0.000 description 2
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 235000019400 benzoyl peroxide Nutrition 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 210000003169 central nervous system Anatomy 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- GZZQFUJYIJVVHE-UHFFFAOYSA-N cyclohexane;n-ethylethanamine Chemical compound CCNCC.C1CCCCC1 GZZQFUJYIJVVHE-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000012259 ether extract Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 1
- RQYKSYJVWNUSHW-UHFFFAOYSA-N 1-(chloromethyl)piperidine Chemical compound ClCN1CCCCC1 RQYKSYJVWNUSHW-UHFFFAOYSA-N 0.000 description 1
- RQSYJHGXUKIYOQ-UHFFFAOYSA-N 1-chloro-2,3-dimethylnaphthalene Chemical compound C1=CC=C2C(Cl)=C(C)C(C)=CC2=C1 RQSYJHGXUKIYOQ-UHFFFAOYSA-N 0.000 description 1
- MDTDHCUFDQJUMC-UHFFFAOYSA-N 1-chloro-6,7-bis(chloromethyl)-2-methoxynaphthalene Chemical compound C1=C(CCl)C(CCl)=CC2=C(Cl)C(OC)=CC=C21 MDTDHCUFDQJUMC-UHFFFAOYSA-N 0.000 description 1
- XDDMSMQLEFRJQP-UHFFFAOYSA-M 2,2-dibutyl-1,3-dihydrobenzo[f]isoindol-2-ium;bromide Chemical compound [Br-].C1=CC=C2C=C(C[N+](CCCC)(CCCC)C3)C3=CC2=C1 XDDMSMQLEFRJQP-UHFFFAOYSA-M 0.000 description 1
- GXQLVYQLMKMUCZ-UHFFFAOYSA-N 2,3-bis(bromomethyl)-1-chloronaphthalene Chemical compound C1=CC=C2C(Cl)=C(CBr)C(CBr)=CC2=C1 GXQLVYQLMKMUCZ-UHFFFAOYSA-N 0.000 description 1
- LJOQEBMHZFSAJP-UHFFFAOYSA-N 2,3-bis[bromo(phenyl)methyl]naphthalene Chemical compound C=1C2=CC=CC=C2C=C(C(Br)C=2C=CC=CC=2)C=1C(Br)C1=CC=CC=C1 LJOQEBMHZFSAJP-UHFFFAOYSA-N 0.000 description 1
- GDEUUQMXXWFQTB-UHFFFAOYSA-N 3-(2-chlorophenyl)prop-2-ynoic acid Chemical compound OC(=O)C#CC1=CC=CC=C1Cl GDEUUQMXXWFQTB-UHFFFAOYSA-N 0.000 description 1
- HXUUKDJAFBRYMD-UHFFFAOYSA-N 3-(4-chlorophenyl)prop-2-ynoic acid Chemical compound OC(=O)C#CC1=CC=C(Cl)C=C1 HXUUKDJAFBRYMD-UHFFFAOYSA-N 0.000 description 1
- AYEMXGNOKZRIOC-UHFFFAOYSA-N 3-(4-methoxyphenyl)prop-2-ynoic acid Chemical compound COC1=CC=C(C#CC(O)=O)C=C1 AYEMXGNOKZRIOC-UHFFFAOYSA-N 0.000 description 1
- FXAHCXPEXLCFFY-UHFFFAOYSA-N 4-(chloromethyl)morpholine Chemical compound ClCN1CCOCC1 FXAHCXPEXLCFFY-UHFFFAOYSA-N 0.000 description 1
- LJLVZMUHIGMDLA-UHFFFAOYSA-N 4-[[1,4-diethoxy-3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine Chemical compound C1COCCN1CC1=C(OCC)C2=CC=CC=C2C(OCC)=C1CN1CCOCC1 LJLVZMUHIGMDLA-UHFFFAOYSA-N 0.000 description 1
- DBYUMAVJKDYZEF-UHFFFAOYSA-N 4-[[5-bromo-6-methoxy-3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine Chemical compound C1COCCN1CC1=CC2=C(Br)C(OC)=CC=C2C=C1CN1CCOCC1 DBYUMAVJKDYZEF-UHFFFAOYSA-N 0.000 description 1
- AJOAIMZPHQLGOE-UHFFFAOYSA-N 4-[[5-chloro-6-methoxy-3-(morpholin-4-ylmethyl)naphthalen-2-yl]methyl]morpholine;dihydrochloride Chemical compound Cl.Cl.C1COCCN1CC1=CC2=C(Cl)C(OC)=CC=C2C=C1CN1CCOCC1 AJOAIMZPHQLGOE-UHFFFAOYSA-N 0.000 description 1
- YHDPOTMQAAGHGF-UHFFFAOYSA-N 5-chlorobenzo[f][2]benzofuran-1,3-dione Chemical compound C1=C2C(Cl)=CC=CC2=CC2=C1C(=O)OC2=O YHDPOTMQAAGHGF-UHFFFAOYSA-N 0.000 description 1
- UQJTYIWCHVBSDM-UHFFFAOYSA-N 6-fluorobenzo[f][2]benzofuran-1,3-dione Chemical compound C1=C2C(=O)OC(=O)C2=CC2=CC(F)=CC=C21 UQJTYIWCHVBSDM-UHFFFAOYSA-N 0.000 description 1
- ASLYAFBEUJLAED-UHFFFAOYSA-N Cl.Cl.CN(C)CC1=CC2=CC=CC=C2C=C1CN1CCOCC1 Chemical compound Cl.Cl.CN(C)CC1=CC2=CC=CC=C2C=C1CN1CCOCC1 ASLYAFBEUJLAED-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- LXTXVMFFCYVGRI-UHFFFAOYSA-N N-methyl-N-[[3-(piperidin-1-ylmethyl)naphthalen-2-yl]methyl]ethanamine Chemical compound CCN(C)CC1=CC2=CC=CC=C2C=C1CN1CCCCC1 LXTXVMFFCYVGRI-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- RVPPSRBFIGKZDX-UHFFFAOYSA-N [1,4-diethoxy-3-(hydroxymethyl)naphthalen-2-yl]methanol Chemical compound C1=CC=C2C(OCC)=C(CO)C(CO)=C(OCC)C2=C1 RVPPSRBFIGKZDX-UHFFFAOYSA-N 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 150000001990 dicarboxylic acid derivatives Chemical class 0.000 description 1
- 150000005690 diesters Chemical class 0.000 description 1
- GTBYFJITPRWOBT-UHFFFAOYSA-N diethyl 1,4-dihydroxynaphthalene-2,3-dicarboxylate Chemical compound C1=CC=C2C(O)=C(C(=O)OCC)C(C(=O)OCC)=C(O)C2=C1 GTBYFJITPRWOBT-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- MPDGBCOIHNLQMR-UHFFFAOYSA-N dimethyl naphthalene-2,3-dicarboxylate Chemical compound C1=CC=C2C=C(C(=O)OC)C(C(=O)OC)=CC2=C1 MPDGBCOIHNLQMR-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 150000002641 lithium Chemical class 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000001064 morpholinomethyl group Chemical group [H]C([H])(*)N1C([H])([H])C([H])([H])OC([H])([H])C1([H])[H] 0.000 description 1
- MQPUQYWSSIKURT-UHFFFAOYSA-N n,n-diethyl-3-(piperidin-1-ylmethyl)naphthalen-2-amine Chemical compound CCN(CC)C1=CC2=CC=CC=C2C=C1CN1CCCCC1 MQPUQYWSSIKURT-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- ZIPLKLQPLOWLTM-UHFFFAOYSA-N naphthalene-2,3-dicarbaldehyde Chemical compound C1=CC=C2C=C(C=O)C(C=O)=CC2=C1 ZIPLKLQPLOWLTM-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- ANRQGKOBLBYXFM-UHFFFAOYSA-M phenylmagnesium bromide Chemical compound Br[Mg]C1=CC=CC=C1 ANRQGKOBLBYXFM-UHFFFAOYSA-M 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000001373 regressive effect Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/02—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms containing only hydrogen and carbon atoms in addition to the ring hetero elements
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/16—Amides, e.g. hydroxamic acids
- A61K31/165—Amides, e.g. hydroxamic acids having aromatic rings, e.g. colchicine, atenolol, progabide
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/12—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the ring of aromatic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C17/00—Preparation of halogenated hydrocarbons
- C07C17/093—Preparation of halogenated hydrocarbons by replacement by halogens
- C07C17/10—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms
- C07C17/14—Preparation of halogenated hydrocarbons by replacement by halogens of hydrogen atoms in the side-chain of aromatic compounds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C63/00—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings
- C07C63/68—Compounds having carboxyl groups bound to a carbon atoms of six-membered aromatic rings containing halogen
- C07C63/72—Polycyclic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
- C07C65/24—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D265/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one oxygen atom as the only ring hetero atoms
- C07D265/28—1,4-Oxazines; Hydrogenated 1,4-oxazines
- C07D265/30—1,4-Oxazines; Hydrogenated 1,4-oxazines not condensed with other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/06—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals
- C07D295/073—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by halogen atoms or nitro radicals with the ring nitrogen atoms and the substituents separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/096—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/12—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms
- C07D295/135—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly or doubly bound nitrogen atoms with the ring nitrogen atoms and the substituent nitrogen atoms separated by carbocyclic rings or by carbon chains interrupted by carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Medicinal Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB47589/74A GB1532957A (en) | 1974-11-04 | 1974-11-04 | Bis(aminomethyl)naphthalene derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO753672L true NO753672L (enFirst) | 1976-05-05 |
Family
ID=10445533
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO753672A NO753672L (enFirst) | 1974-11-04 | 1975-11-03 |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4062955A (enFirst) |
| JP (1) | JPS51125258A (enFirst) |
| AU (1) | AU497963B2 (enFirst) |
| BE (1) | BE835106A (enFirst) |
| DE (1) | DE2548668A1 (enFirst) |
| DK (1) | DK476275A (enFirst) |
| FR (1) | FR2289174A1 (enFirst) |
| GB (1) | GB1532957A (enFirst) |
| NL (1) | NL7512896A (enFirst) |
| NO (1) | NO753672L (enFirst) |
| NZ (1) | NZ179078A (enFirst) |
| SE (1) | SE7512292L (enFirst) |
| ZA (1) | ZA756708B (enFirst) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4876282A (en) * | 1987-11-25 | 1989-10-24 | Eli Lilly And Company | 1-Phenylalkylamines as selective serotonin uptake inhibitors |
| US4996235A (en) * | 1987-11-25 | 1991-02-26 | Eli Lilly And Company | 3,4-diphenylbutanamines |
| JP2931986B2 (ja) * | 1989-02-17 | 1999-08-09 | 武田薬品工業株式会社 | アラルキルアミン誘導体 |
| AU641394B2 (en) * | 1989-06-02 | 1993-09-23 | John Wyeth & Brother Limited | Amines |
| FR2653123B1 (fr) * | 1989-10-17 | 1992-01-17 | Roussel Uclaf | Nouveaux derives de la pyridone, leur procede de preparation, les nouveaux intermediaires obtenus, leur application a titre de medicaments et les compositions pharmaceutiques les renfermant. |
| US10131622B1 (en) * | 2018-01-03 | 2018-11-20 | Saudi Arabian Upstream Technology Company | N-hydroxyalkylated polyamines, methods of making N-hydroxyalkylated polyamines, and fluids containing an N-hydroxyalkylated polyamine |
| US10894910B2 (en) * | 2018-10-31 | 2021-01-19 | Saudi Arabian Oil Company | Additives for oil and gas drilling and production |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2040040A (en) * | 1935-06-27 | 1936-05-05 | Rohm & Haas | Morpholino-metho polyhydric phenols |
-
1974
- 1974-11-04 GB GB47589/74A patent/GB1532957A/en not_active Expired
-
1975
- 1975-10-22 DK DK476275A patent/DK476275A/da unknown
- 1975-10-24 ZA ZA00756708A patent/ZA756708B/xx unknown
- 1975-10-28 AU AU86062/75A patent/AU497963B2/en not_active Expired
- 1975-10-28 NZ NZ179078A patent/NZ179078A/xx unknown
- 1975-10-28 US US05/625,863 patent/US4062955A/en not_active Expired - Lifetime
- 1975-10-30 DE DE19752548668 patent/DE2548668A1/de not_active Withdrawn
- 1975-10-31 BE BE161454A patent/BE835106A/xx unknown
- 1975-11-03 SE SE7512292A patent/SE7512292L/xx unknown
- 1975-11-03 FR FR7533537A patent/FR2289174A1/fr active Granted
- 1975-11-03 NO NO753672A patent/NO753672L/no unknown
- 1975-11-04 JP JP50132402A patent/JPS51125258A/ja active Pending
- 1975-11-04 NL NL7512896A patent/NL7512896A/xx not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| AU497963B2 (en) | 1979-01-25 |
| SE7512292L (sv) | 1976-05-05 |
| AU8606275A (en) | 1977-05-05 |
| DE2548668A1 (de) | 1976-05-06 |
| BE835106A (fr) | 1976-04-30 |
| FR2289174B1 (enFirst) | 1979-09-14 |
| NL7512896A (nl) | 1976-05-06 |
| US4062955A (en) | 1977-12-13 |
| DK476275A (da) | 1976-05-05 |
| NZ179078A (en) | 1978-04-28 |
| FR2289174A1 (fr) | 1976-05-28 |
| ZA756708B (en) | 1976-09-29 |
| JPS51125258A (en) | 1976-11-01 |
| GB1532957A (en) | 1978-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO124073B (enFirst) | ||
| WO2000005229A1 (en) | Phenylindole derivatives as 5-ht2a receptor ligands | |
| JPS63146874A (ja) | インドール誘導体 | |
| JPS61155358A (ja) | ジアリール酪酸誘導体 | |
| US3326916A (en) | N-phenylpiperazine compounds | |
| JPH0245629B2 (enFirst) | ||
| NO753672L (enFirst) | ||
| IE913175A1 (en) | Aryl-fused and hetaryl-fused-2, 4-diazepine and 2,¹4-diazocine antiarrhythmic agents | |
| EP0038564B1 (en) | Dibenz (b,e) oxepin derivatives and pharmaceutical compositions comprising them | |
| US4018779A (en) | Derivatives of 10,11-dihydrobenzo[4,5]cyclohepta[1,2-b]-pyrazolo[4,3-e]pyridine-5(1H)ones | |
| NO812529L (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive dibenzo-diazepin-derivater | |
| US3227716A (en) | Therapeutically-active dibenzocycloheptane derivatives | |
| CS207619B2 (en) | Method of making the new derivatives of 5,11-dihydro-6h-pyrido 2,3-b 1,4 benzodiazepin-6-on | |
| US4442102A (en) | 1,5-Diphenylpyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing same | |
| NO135248B (enFirst) | ||
| US4217452A (en) | Synthesis for the preparation of tetracyclic compounds | |
| NO143902B (no) | Fenyl-lavere alkanoylaminer for bruk til fremstilling av terapeutisk virksomme fenyl-lavere-alkylaminer | |
| US3646146A (en) | Diphenylcyclopropyl-methyl-amines | |
| US3133924A (en) | Amino-substituted cyclobutane carboxamides | |
| US3810905A (en) | Pyrazolo(3,4-b)pyridine-5-carboxamides | |
| US5332743A (en) | Benzyl and benzhydryl alcohols | |
| US4139621A (en) | N-(4-substituted-3,5-dichloro-phenyl)-piperazines | |
| DK153843B (da) | Analogifremgangsmaade til fremstilling af 5-substituerede 10,11-dihydro-5h-dibenzooea,daacyclohepten-5,10-iminer eller salte deraf | |
| JPS6130588A (ja) | ベンゾ〔c〕〔1,8〕ナフチリジン、その製造方法及びその使用、並びにこれらの化合物を含有する調製剤 | |
| JPH01203379A (ja) | さらに水素化された1―ベンゾオキサシクロアルキルピリジンカルボン酸類 |