NO750263L - - Google Patents
Info
- Publication number
- NO750263L NO750263L NO750263A NO750263A NO750263L NO 750263 L NO750263 L NO 750263L NO 750263 A NO750263 A NO 750263A NO 750263 A NO750263 A NO 750263A NO 750263 L NO750263 L NO 750263L
- Authority
- NO
- Norway
- Prior art keywords
- carbon atoms
- alkoxy
- hydroxy
- alkyl
- hydrogen
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 69
- 125000003545 alkoxy group Chemical group 0.000 claims description 42
- 150000001875 compounds Chemical class 0.000 claims description 40
- 229910052739 hydrogen Inorganic materials 0.000 claims description 31
- 239000001257 hydrogen Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 29
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 29
- 238000000034 method Methods 0.000 claims description 25
- 150000002431 hydrogen Chemical class 0.000 claims description 23
- -1 benzyloxy, hydroxy Chemical group 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 15
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 14
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 13
- 238000002360 preparation method Methods 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 11
- 125000001033 ether group Chemical group 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 8
- 239000000460 chlorine Substances 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 8
- BJVCSICIEDHBNI-UHFFFAOYSA-N benzo[b][1,8]naphthyridine Chemical group N1=CC=CC2=CC3=CC=CC=C3N=C21 BJVCSICIEDHBNI-UHFFFAOYSA-N 0.000 claims description 7
- 238000005661 deetherification reaction Methods 0.000 claims description 7
- 150000003839 salts Chemical class 0.000 claims description 7
- 230000002829 reductive effect Effects 0.000 claims description 6
- FLBAYUMRQUHISI-UHFFFAOYSA-N 1,8-naphthyridine Chemical compound N1=CC=CC2=CC=CN=C21 FLBAYUMRQUHISI-UHFFFAOYSA-N 0.000 claims description 3
- SWJXWSAKHXBQSY-UHFFFAOYSA-N benzo(c)cinnoline Chemical group C1=CC=C2C3=CC=CC=C3N=NC2=C1 SWJXWSAKHXBQSY-UHFFFAOYSA-N 0.000 claims description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 44
- 230000008018 melting Effects 0.000 description 16
- 238000002844 melting Methods 0.000 description 16
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 12
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000003277 amino group Chemical group 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000003776 cleavage reaction Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000007017 scission Effects 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- 208000009079 Bronchial Spasm Diseases 0.000 description 2
- 208000014181 Bronchial disease Diseases 0.000 description 2
- 206010006482 Bronchospasm Diseases 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 241000282326 Felis catus Species 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 239000011976 maleic acid Substances 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-M oxalate(1-) Chemical compound OC(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-M 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- HPKWCZXGKDUJAA-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-methylpiperidin-4-amine Chemical compound C1=CC(OC)=CC=C1C1C(N)CCN(C)C1 HPKWCZXGKDUJAA-UHFFFAOYSA-N 0.000 description 1
- KOVCKAZQEMBAAI-UHFFFAOYSA-N 3-(4-methoxyphenyl)-1-methylpiperidin-4-one Chemical compound C1=CC(OC)=CC=C1C1C(=O)CCN(C)C1 KOVCKAZQEMBAAI-UHFFFAOYSA-N 0.000 description 1
- 206010003598 Atelectasis Diseases 0.000 description 1
- 238000006407 Bischler-Napieralski reaction Methods 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000700199 Cavia porcellus Species 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- YZCKVEUIGOORGS-UHFFFAOYSA-N Hydrogen atom Chemical compound [H] YZCKVEUIGOORGS-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- 208000007123 Pulmonary Atelectasis Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000003833 Wallach reaction Methods 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- OIPILFWXSMYKGL-UHFFFAOYSA-N acetylcholine Chemical compound CC(=O)OCC[N+](C)(C)C OIPILFWXSMYKGL-UHFFFAOYSA-N 0.000 description 1
- 229960004373 acetylcholine Drugs 0.000 description 1
- 125000004442 acylamino group Chemical group 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- 230000001813 broncholytic effect Effects 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- MZQJXXGZGYLWMB-UHFFFAOYSA-N ethyl 3-amino-2-(4-methoxyphenyl)propanoate Chemical compound CCOC(=O)C(CN)C1=CC=C(OC)C=C1 MZQJXXGZGYLWMB-UHFFFAOYSA-N 0.000 description 1
- MOMFMKUDFXSVIQ-UHFFFAOYSA-N ethyl 5-(4-methoxyphenyl)-1-methyl-4-oxopiperidine-3-carboxylate Chemical compound O=C1C(C(=O)OCC)CN(C)CC1C1=CC=C(OC)C=C1 MOMFMKUDFXSVIQ-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 229960001340 histamine Drugs 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 208000030603 inherited susceptibility to asthma Diseases 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- TWOYTPGMVLCCQA-UHFFFAOYSA-N n-[3-(4-methoxyphenyl)-1-methylpiperidin-4-ylidene]hydroxylamine Chemical compound C1=CC(OC)=CC=C1C1C(=NO)CCN(C)C1 TWOYTPGMVLCCQA-UHFFFAOYSA-N 0.000 description 1
- 150000005054 naphthyridines Chemical class 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 230000000414 obstructive effect Effects 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- XUWHAWMETYGRKB-UHFFFAOYSA-N piperidin-2-one Chemical compound O=C1CCCCN1 XUWHAWMETYGRKB-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000002980 postoperative effect Effects 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 238000006485 reductive methylation reaction Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 230000001148 spastic effect Effects 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH155074 | 1974-02-05 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO750263L true NO750263L (show.php) | 1975-09-01 |
Family
ID=4213026
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO750263A NO750263L (show.php) | 1974-02-05 | 1975-01-29 |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS50108297A (show.php) |
| AT (1) | AT351536B (show.php) |
| BE (1) | BE825124A (show.php) |
| CA (1) | CA1055944A (show.php) |
| DD (1) | DD117216A5 (show.php) |
| DE (1) | DE2503156A1 (show.php) |
| DK (1) | DK136189B (show.php) |
| ES (1) | ES434406A1 (show.php) |
| FI (1) | FI750205A7 (show.php) |
| FR (1) | FR2259611B1 (show.php) |
| GB (2) | GB1497723A (show.php) |
| HU (1) | HU169923B (show.php) |
| IL (1) | IL46553A (show.php) |
| NL (1) | NL7501159A (show.php) |
| NO (1) | NO750263L (show.php) |
| NZ (1) | NZ176550A (show.php) |
| PH (1) | PH11824A (show.php) |
| SE (1) | SE7500859L (show.php) |
| ZA (1) | ZA75743B (show.php) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8800397D0 (en) * | 1988-01-08 | 1988-02-10 | Sandoz Ltd | Improvements in/relating to organic compounds |
| MY105344A (en) * | 1990-05-16 | 1994-09-30 | Byk Gulden Lomberg Chemische Fabrik | New sulphonyl compounds |
-
1975
- 1975-01-27 DE DE19752503156 patent/DE2503156A1/de active Pending
- 1975-01-27 FI FI750205A patent/FI750205A7/fi not_active Application Discontinuation
- 1975-01-27 DK DK24275AA patent/DK136189B/da unknown
- 1975-01-27 SE SE7500859A patent/SE7500859L/xx unknown
- 1975-01-29 NO NO750263A patent/NO750263L/no unknown
- 1975-01-31 NL NL7501159A patent/NL7501159A/xx not_active Application Discontinuation
- 1975-02-03 ES ES434406A patent/ES434406A1/es not_active Expired
- 1975-02-03 GB GB30857/77A patent/GB1497723A/en not_active Expired
- 1975-02-03 GB GB4516/75A patent/GB1497722A/en not_active Expired
- 1975-02-03 BE BE153007A patent/BE825124A/xx unknown
- 1975-02-03 PH PH16771A patent/PH11824A/en unknown
- 1975-02-03 DD DD183969A patent/DD117216A5/xx unknown
- 1975-02-03 NZ NZ176550A patent/NZ176550A/xx unknown
- 1975-02-03 IL IL46553A patent/IL46553A/en unknown
- 1975-02-03 HU HUSA2741A patent/HU169923B/hu unknown
- 1975-02-04 CA CA219,303A patent/CA1055944A/en not_active Expired
- 1975-02-04 AT AT79975A patent/AT351536B/de not_active IP Right Cessation
- 1975-02-04 JP JP50014021A patent/JPS50108297A/ja active Pending
- 1975-02-05 ZA ZA00750743A patent/ZA75743B/xx unknown
- 1975-02-05 FR FR7503547A patent/FR2259611B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA1055944A (en) | 1979-06-05 |
| ATA79975A (de) | 1979-01-15 |
| IL46553A (en) | 1977-12-30 |
| IL46553A0 (en) | 1975-04-25 |
| FI750205A7 (show.php) | 1975-08-06 |
| GB1497723A (en) | 1978-01-12 |
| FR2259611B1 (show.php) | 1980-01-11 |
| HU169923B (show.php) | 1977-02-28 |
| DE2503156A1 (de) | 1975-08-07 |
| GB1497722A (en) | 1978-01-12 |
| ES434406A1 (es) | 1977-03-01 |
| PH11824A (en) | 1978-07-19 |
| SE7500859L (show.php) | 1975-08-06 |
| DK136189B (da) | 1977-08-29 |
| DK136189C (show.php) | 1978-01-30 |
| NL7501159A (nl) | 1975-08-07 |
| JPS50108297A (show.php) | 1975-08-26 |
| BE825124A (fr) | 1975-08-04 |
| AU7784375A (en) | 1976-08-05 |
| FR2259611A1 (show.php) | 1975-08-29 |
| DD117216A5 (show.php) | 1976-01-05 |
| NZ176550A (en) | 1978-09-25 |
| ZA75743B (en) | 1976-09-29 |
| AT351536B (de) | 1979-07-25 |
| DK24275A (show.php) | 1975-09-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0179383B1 (en) | 9-amino-1,2,3,4-tetrahydroacridin-1-ol and related compounds, a process for their preparation and their use as medicaments | |
| US5324733A (en) | Spirocyclic antipsychotic agents | |
| EP0677046B1 (en) | Piperazine derivatives as 5-ht antagonists | |
| HUT64520A (en) | Process forf producing of derivatives of 1,2-dihydro-2-oxopyridine and pharamceutical compositions containing them | |
| HU223947B1 (hu) | Közbenső termékként alkalmazható 1H-imidazo[4,5-c]kinolin-származékok | |
| IE55156B1 (en) | Pharmacologically active pyrazolo(4,3-c)pyridines | |
| CA2507067A1 (en) | Sinomenine and sinomenine compounds, synthesis and use | |
| CA1152989A (en) | Pyrido [1,2-a] pyrimidine derivatives, process for the preparation thereof and pharmaceutical compositions containing the same | |
| IL37749A (en) | Pyridoquinoline derivatives,their preparation and pharmaceutical compositions containing them | |
| PL119641B1 (en) | Process for preparing novel,condensed derivatives of pyrimidine pirimidina | |
| US4420480A (en) | Hexahydronaphth[1,2-b]-1,4-oxazines | |
| CA1054600A (en) | Amino derivatives of imidazo (4,5-b) pyridines | |
| JPS6123790B2 (show.php) | ||
| GB2088373A (en) | Dibenzazepine derivatives and pharmaceutical compositions containing them | |
| Frydman et al. | Synthesis of substituted 1, 5-and 1, 7-naphthyridines and related lactams | |
| NO750263L (show.php) | ||
| NO164899B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive imidazolylindolforbindelser. | |
| Fülöp et al. | Nitrogen bridgehead compounds. IX. Synthesis and reactions of 2, 3‐disubstituted pyrido [1, 2‐a] pyrimidin‐4‐ones | |
| EP0187711B1 (en) | Octahydroindolizine compounds useful as analgesics | |
| US3462443A (en) | Indeno(1,2-c)pyridine derivatives | |
| AU731262B2 (en) | 9,10-diazatricyclo{4.2.1.12,5}decane and 2,7-diazatricyclo{4.4.0.03,8}decane derivatives having analgesic activity | |
| NO781051L (no) | Kinazolinderivater. | |
| US4052404A (en) | Indolo (2,3-α)quinolizines | |
| EP0002512B1 (en) | Imino-bridged benzocycloheptapyridines, process for their preparation and pharmaceutical composition thereof | |
| EP0927163B1 (en) | Preparation of 1-butyl-4-piperidinylmethylamine |