NO136756B - - Google Patents
Download PDFInfo
- Publication number
- NO136756B NO136756B NO4615/72A NO461572A NO136756B NO 136756 B NO136756 B NO 136756B NO 4615/72 A NO4615/72 A NO 4615/72A NO 461572 A NO461572 A NO 461572A NO 136756 B NO136756 B NO 136756B
- Authority
- NO
- Norway
- Prior art keywords
- rifamycin
- fermentation
- production
- percent
- medium
- Prior art date
Links
- SQTCRTQCPJICLD-KTQDUKAHSA-N rifamycin B Chemical compound OC1=C(C(O)=C2C)C3=C(OCC(O)=O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O SQTCRTQCPJICLD-KTQDUKAHSA-N 0.000 claims description 26
- SQTCRTQCPJICLD-OQQFTUDCSA-N rifomycin-B Natural products COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(NC(=O)C(=C/C=C/C(C)C(O)C(C)C(O)C(C)C(OC(=O)C)C1C)C)cc(OCC(=O)O)c4c3C2=O SQTCRTQCPJICLD-OQQFTUDCSA-N 0.000 claims description 26
- 238000004519 manufacturing process Methods 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 241001468213 Amycolatopsis mediterranei Species 0.000 claims description 9
- 235000015097 nutrients Nutrition 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- 229910052799 carbon Inorganic materials 0.000 claims description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 4
- 239000011707 mineral Substances 0.000 claims description 4
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 claims description 3
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- -1 alkali metal salts Chemical class 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 2
- 125000001477 organic nitrogen group Chemical group 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims 1
- 238000000855 fermentation Methods 0.000 description 23
- 230000004151 fermentation Effects 0.000 description 23
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 239000002609 medium Substances 0.000 description 11
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- 239000007788 liquid Substances 0.000 description 8
- 230000012010 growth Effects 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 229930189077 Rifamycin Natural products 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000003115 biocidal effect Effects 0.000 description 6
- 229960003292 rifamycin Drugs 0.000 description 6
- HJYYPODYNSCCOU-ODRIEIDWSA-N rifamycin SV Chemical compound OC1=C(C(O)=C2C)C3=C(O)C=C1NC(=O)\C(C)=C/C=C/[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@H](C)[C@@H](OC)\C=C\O[C@@]1(C)OC2=C3C1=O HJYYPODYNSCCOU-ODRIEIDWSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 229940125717 barbiturate Drugs 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 238000005273 aeration Methods 0.000 description 4
- 230000009105 vegetative growth Effects 0.000 description 4
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 3
- 239000003242 anti bacterial agent Substances 0.000 description 3
- 229940088710 antibiotic agent Drugs 0.000 description 3
- 239000008103 glucose Substances 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- 229920001353 Dextrin Polymers 0.000 description 2
- 239000004375 Dextrin Substances 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 239000001888 Peptone Substances 0.000 description 2
- 108010080698 Peptones Proteins 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 239000001166 ammonium sulphate Substances 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000012752 auxiliary agent Substances 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 239000005018 casein Substances 0.000 description 2
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 description 2
- 235000021240 caseins Nutrition 0.000 description 2
- 235000019425 dextrin Nutrition 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- 235000013372 meat Nutrition 0.000 description 2
- 235000019319 peptone Nutrition 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- LWIHDJKSTIGBAC-UHFFFAOYSA-K tripotassium phosphate Chemical compound [K+].[K+].[K+].[O-]P([O-])([O-])=O LWIHDJKSTIGBAC-UHFFFAOYSA-K 0.000 description 2
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- LAOZSCRCYVBSJA-UHFFFAOYSA-N 5,5-dimethyl-1,3-diazinane-2,4,6-trione Chemical compound CC1(C)C(=O)NC(=O)NC1=O LAOZSCRCYVBSJA-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- 108010082495 Dietary Plant Proteins Proteins 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000019764 Soybean Meal Nutrition 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N alpha-methyl toluene Natural products CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- 229940072049 amyl acetate Drugs 0.000 description 1
- PGMYKACGEOXYJE-UHFFFAOYSA-N anhydrous amyl acetate Natural products CCCCCOC(C)=O PGMYKACGEOXYJE-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000007656 barbituric acids Chemical class 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 229940041514 candida albicans extract Drugs 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- GVPFVAHMJGGAJG-UHFFFAOYSA-L cobalt dichloride Chemical compound [Cl-].[Cl-].[Co+2] GVPFVAHMJGGAJG-UHFFFAOYSA-L 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 238000012258 culturing Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000011790 ferrous sulphate Substances 0.000 description 1
- 235000003891 ferrous sulphate Nutrition 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000001727 glucose Nutrition 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 238000007654 immersion Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000002054 inoculum Substances 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 229940099596 manganese sulfate Drugs 0.000 description 1
- 239000011702 manganese sulphate Substances 0.000 description 1
- 235000007079 manganese sulphate Nutrition 0.000 description 1
- SQQMAOCOWKFBNP-UHFFFAOYSA-L manganese(II) sulfate Chemical compound [Mn+2].[O-]S([O-])(=O)=O SQQMAOCOWKFBNP-UHFFFAOYSA-L 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- 239000002366 mineral element Substances 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 235000010333 potassium nitrate Nutrition 0.000 description 1
- 239000004323 potassium nitrate Substances 0.000 description 1
- 229910000160 potassium phosphate Inorganic materials 0.000 description 1
- 235000011009 potassium phosphates Nutrition 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000012807 shake-flask culturing Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000004455 soybean meal Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 239000012138 yeast extract Substances 0.000 description 1
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K3/00—Use of inorganic substances as compounding ingredients
- C08K3/34—Silicon-containing compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21019071A | 1971-12-15 | 1971-12-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO136756B true NO136756B (fi) | 1977-07-25 |
| NO136756C NO136756C (no) | 1977-11-02 |
Family
ID=22781926
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO4615/72A NO136756C (no) | 1971-12-15 | 1972-12-14 | Termoplastisk pressmasse med forbedret elektrisk buemotstand |
Country Status (24)
| Country | Link |
|---|---|
| US (1) | US3764576A (fi) |
| JP (1) | JPS513500B2 (fi) |
| AT (1) | AT333039B (fi) |
| AU (1) | AU454512B2 (fi) |
| BE (1) | BE792712A (fi) |
| BR (1) | BR7208791D0 (fi) |
| CA (1) | CA1008582A (fi) |
| CH (1) | CH563422A5 (fi) |
| CS (1) | CS185207B2 (fi) |
| DD (1) | DD101173A5 (fi) |
| DE (1) | DE2256699B2 (fi) |
| DK (1) | DK139527B (fi) |
| ES (1) | ES409609A1 (fi) |
| FI (1) | FI57770C (fi) |
| FR (1) | FR2163635B1 (fi) |
| GB (1) | GB1367710A (fi) |
| IL (1) | IL41080A (fi) |
| IT (1) | IT971806B (fi) |
| NL (1) | NL150489B (fi) |
| NO (1) | NO136756C (fi) |
| PL (1) | PL87757B1 (fi) |
| RO (1) | RO69128A (fi) |
| SU (1) | SU475785A3 (fi) |
| ZA (1) | ZA727675B (fi) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5090649A (fi) * | 1973-12-14 | 1975-07-19 | ||
| JPS5319335B2 (fi) * | 1974-11-22 | 1978-06-20 | ||
| DE2512504A1 (de) * | 1975-03-21 | 1976-10-07 | Basf Ag | Polyesterformmassen mit verminderter brennbarkeit |
| CH595416A5 (fi) * | 1975-04-18 | 1978-02-15 | Ciba Geigy Ag | |
| CA1088235A (en) * | 1975-09-24 | 1980-10-21 | Frank M.. Berardinelli | Reinforced polyester composition having improved impact strength |
| US4203887A (en) * | 1978-01-19 | 1980-05-20 | General Electric Company | Modified polyester composition |
| JPS555958A (en) * | 1978-06-30 | 1980-01-17 | Dainippon Ink & Chem Inc | Flame-retardant resin composition |
| FR2486085B1 (fr) * | 1979-05-23 | 1986-09-26 | Gen Electric | Compositions modifiees de polyesters, en particulier de poly(terephtalate de butylene) |
| US4429004A (en) * | 1980-06-26 | 1984-01-31 | Ciba-Geigy Corporation | Light-reflecting body |
| US4425457A (en) | 1980-08-06 | 1984-01-10 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4483955A (en) * | 1980-08-06 | 1984-11-20 | Celanese Corporation | High gloss polyethylene terephthalate reinforced resin compositions |
| US4478964A (en) * | 1981-06-05 | 1984-10-23 | Mobay Chemical Corporation | Polycarbonate-silicate compositions |
| JPS5842639A (ja) * | 1981-09-07 | 1983-03-12 | Toa Nenryo Kogyo Kk | ポリオレフイン組成物 |
| US4487877A (en) * | 1981-12-07 | 1984-12-11 | Matsushita Electric Industrial Co., Ltd. | Diaphragm for loudspeaker |
| DE3362141D1 (en) * | 1982-03-16 | 1986-03-27 | Ciba Geigy Ag | Flame-resistant reinforced thermoplastic polyester moulding compounds, and their use |
| US4458039A (en) * | 1983-02-07 | 1984-07-03 | Celanese Corporation | Thermotropic liquid crystalline polymer blend with reduced surface abrasion |
| US4874809A (en) * | 1988-01-25 | 1989-10-17 | Eastman Kodak Company | Reinforced polyesters, article thereof and method of making low warpage articles |
| US5214088A (en) * | 1989-10-20 | 1993-05-25 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5399608A (en) * | 1989-10-20 | 1995-03-21 | General Electric Company | Highly dense thermoplastic molding compositions |
| US5149734A (en) * | 1989-10-20 | 1992-09-22 | General Electric Company | Highly filled thermoplastic polyester molding compositions |
| US5132353A (en) * | 1989-10-20 | 1992-07-21 | General Electric Company | Molding composition |
| JP3156863B2 (ja) * | 1991-12-26 | 2001-04-16 | 日本ジーイープラスチックス株式会社 | 強化難燃ポリエステル系樹脂組成物 |
| CA2103420A1 (en) * | 1992-12-22 | 1994-06-23 | Eileen B. Walsh | Stabilization of low molecular weight polybutylene terephthalate/polyester blends with phosphorus compounds |
| US5441997A (en) * | 1992-12-22 | 1995-08-15 | General Electric Company | High density polyester-polycarbonate molding composition |
| US5346767A (en) * | 1992-12-22 | 1994-09-13 | General Electric Company | Abrasion resistant highly filled polyester compositions |
| EP1439207A1 (en) * | 1993-08-19 | 2004-07-21 | General Electric Company | A mineral filled moldable thermoplastic composition |
| US5674931A (en) * | 1995-04-07 | 1997-10-07 | General Electric Company | Flame retardant heavily filled thermoplastic composition |
| US6221279B1 (en) | 1999-06-24 | 2001-04-24 | Isotag Technology, Inc. | Pigment particles for invisible marking applications |
| US20060036012A1 (en) * | 2004-08-10 | 2006-02-16 | Hayes Richard A | Process for producing a wollastonite containing polyester and products and articles produced therefrom |
| US20070232170A1 (en) * | 2005-12-22 | 2007-10-04 | Atwood Kenneth B | Polyester and modified fluoropolymer blends |
| TWI424931B (zh) * | 2011-08-26 | 2014-02-01 | Wistron Neweb Corp | 車用雷達裝置及其天線罩 |
| CN102956969A (zh) * | 2011-08-30 | 2013-03-06 | 启碁科技股份有限公司 | 车用雷达装置及其天线罩 |
| US9130426B2 (en) * | 2011-10-31 | 2015-09-08 | Regal Beloit America, Inc. | Permanent magnet rotors and methods of assembling the same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA879151A (en) * | 1971-08-24 | Celanese Corporation | Polyalkylene terephthalate molding resin | |
| US2888377A (en) * | 1954-03-25 | 1959-05-26 | Columbia Southern Chem Corp | Calcium silicate and method of producing same |
| NL234949A (fi) * | 1958-01-08 | |||
| FR84238E (fr) * | 1963-04-08 | 1964-12-24 | Organico | Matières thermoplastiques améliorées et leur procédé de fabrication |
| US3624024A (en) * | 1970-02-24 | 1971-11-30 | Eastman Kodak Co | Flame retardant poly(tetramethylene terephthalate) molding compositions |
-
0
- BE BE792712D patent/BE792712A/xx unknown
-
1971
- 1971-12-15 US US00210190A patent/US3764576A/en not_active Expired - Lifetime
-
1972
- 1972-10-30 ZA ZA727675A patent/ZA727675B/xx unknown
- 1972-10-31 CA CA155,293A patent/CA1008582A/en not_active Expired
- 1972-11-18 DE DE2256699A patent/DE2256699B2/de not_active Ceased
- 1972-11-27 AT AT1008972A patent/AT333039B/de not_active IP Right Cessation
- 1972-11-30 AU AU49496/72A patent/AU454512B2/en not_active Expired
- 1972-12-07 FI FI3468/72A patent/FI57770C/fi active
- 1972-12-08 RO RO7273082A patent/RO69128A/ro unknown
- 1972-12-12 JP JP47124009A patent/JPS513500B2/ja not_active Expired
- 1972-12-12 CH CH1806972A patent/CH563422A5/xx not_active IP Right Cessation
- 1972-12-13 GB GB5742972A patent/GB1367710A/en not_active Expired
- 1972-12-13 DD DD167616A patent/DD101173A5/xx unknown
- 1972-12-13 IT IT32837/72A patent/IT971806B/it active
- 1972-12-13 IL IL41080A patent/IL41080A/xx unknown
- 1972-12-13 BR BR008791/72A patent/BR7208791D0/pt unknown
- 1972-12-13 NL NL727216897A patent/NL150489B/xx unknown
- 1972-12-14 NO NO4615/72A patent/NO136756C/no unknown
- 1972-12-14 FR FR7244593A patent/FR2163635B1/fr not_active Expired
- 1972-12-14 DK DK622172AA patent/DK139527B/da unknown
- 1972-12-14 PL PL1972159519A patent/PL87757B1/pl unknown
- 1972-12-14 ES ES409609A patent/ES409609A1/es not_active Expired
- 1972-12-15 CS CS7200008651A patent/CS185207B2/cs unknown
- 1972-12-15 SU SU1857818A patent/SU475785A3/ru active
Also Published As
| Publication number | Publication date |
|---|---|
| NL150489B (nl) | 1976-08-16 |
| AT333039B (de) | 1976-10-25 |
| AU454512B2 (en) | 1974-10-31 |
| FR2163635A1 (fi) | 1973-07-27 |
| FI57770B (fi) | 1980-06-30 |
| ES409609A1 (es) | 1976-01-01 |
| CH563422A5 (fi) | 1975-06-30 |
| DE2256699A1 (de) | 1973-06-28 |
| NL7216897A (fi) | 1973-06-19 |
| AU4949672A (en) | 1974-05-30 |
| BE792712A (fr) | 1973-06-14 |
| DK139527B (da) | 1979-03-05 |
| JPS4866652A (fi) | 1973-09-12 |
| PL87757B1 (fi) | 1976-07-31 |
| CS185207B2 (en) | 1978-09-15 |
| FR2163635B1 (fi) | 1978-09-08 |
| DE2256699B2 (de) | 1976-01-02 |
| BR7208791D0 (pt) | 1973-12-11 |
| DK139527C (fi) | 1979-08-27 |
| NO136756C (no) | 1977-11-02 |
| ZA727675B (en) | 1973-07-25 |
| IT971806B (it) | 1974-05-10 |
| DD101173A5 (fi) | 1973-10-20 |
| IL41080A0 (en) | 1973-02-28 |
| ATA1008972A (de) | 1976-02-15 |
| SU475785A3 (ru) | 1975-06-30 |
| CA1008582A (en) | 1977-04-12 |
| IL41080A (en) | 1975-12-31 |
| RO69128A (ro) | 1981-08-30 |
| FI57770C (fi) | 1980-10-10 |
| US3764576A (en) | 1973-10-09 |
| JPS513500B2 (fi) | 1976-02-03 |
| GB1367710A (en) | 1974-09-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO136756B (fi) | ||
| US3369974A (en) | Production of lycopene | |
| EP2321421A1 (en) | Process for preparation of mycophenolic acid, its salt and ester derivatives | |
| US3494832A (en) | Process for the manufacture of d-lactic acid and its salts | |
| EP0032830B1 (en) | Preparation of 2-keto-l-gulonic acid | |
| SU1069631A3 (ru) | Способ получени тилактона и штамм @ @ @ 12188 дл его получени | |
| US3224945A (en) | Process for the production of ergot alkaloids | |
| JPH05504469A (ja) | Ａ８３５４３回収方法 | |
| US3014846A (en) | Production of 6-aminopenicillanic acid | |
| US4440857A (en) | Process for preparing mycarosyltylactone | |
| US3014845A (en) | Production of 6-aminopenicillanic acid | |
| DK158234B (da) | Fremgangsmaade til fremstilling af alfa-isopropylaeblesyre | |
| EP1417324B1 (en) | Process for the manufacture of 2-keto-l-gulonic acid | |
| US3010878A (en) | Process for the production of eburicoic acid | |
| US2833695A (en) | Production of dextran-dextrinase | |
| JPH06253871A (ja) | 乳酸の製造方法 | |
| US2988490A (en) | Production of rifomycin | |
| NO120171B (fi) | ||
| CA1119981A (en) | Process for preparing 2,5-diketogluconic acid | |
| US4618581A (en) | Clavine-producing strain, a process for the preparation thereof as well as a microbiological process for producing clavine alkaloids | |
| Nelson et al. | PILOT PLANTS. Production of Circulin | |
| US3770586A (en) | Process for the microbiological 1-dehydrogenation of certain 4,9-(11)-pregnadienes | |
| NO880590L (no) | Hoeyere alkylpyrrolidon-ekstraksjonsmidler for vannopploeselige fenoliske eller karbocykliske antibiotika. | |
| JP2748273B2 (ja) | 新規抗生物質ｐｆ１０１５物質ならびにその製造法 | |
| NO127316B (fi) |