NO134522B - - Google Patents
Download PDFInfo
- Publication number
- NO134522B NO134522B NO162188A NO16218866A NO134522B NO 134522 B NO134522 B NO 134522B NO 162188 A NO162188 A NO 162188A NO 16218866 A NO16218866 A NO 16218866A NO 134522 B NO134522 B NO 134522B
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- indolyl
- methoxy
- lower alkyl
- halogen
- Prior art date
Links
- -1 biphenylyl Chemical group 0.000 claims description 80
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 15
- 125000003545 alkoxy group Chemical group 0.000 claims description 12
- 239000007858 starting material Substances 0.000 claims description 9
- 125000001041 indolyl group Chemical group 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000002905 alkanoylamido group Chemical group 0.000 claims description 6
- 150000001408 amides Chemical class 0.000 claims description 6
- 125000005907 alkyl ester group Chemical group 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 125000001589 carboacyl group Chemical group 0.000 claims description 4
- 150000002148 esters Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 150000002431 hydrogen Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002757 morpholinyl group Chemical group 0.000 claims description 2
- 125000001624 naphthyl group Chemical group 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 125000003396 thiol group Chemical class [H]S* 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 88
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 78
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 39
- 239000000203 mixture Substances 0.000 description 27
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Natural products CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 20
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 15
- 239000012312 sodium hydride Substances 0.000 description 15
- 229910000104 sodium hydride Inorganic materials 0.000 description 15
- 229910052757 nitrogen Inorganic materials 0.000 description 13
- 239000003208 petroleum Substances 0.000 description 13
- 239000002480 mineral oil Substances 0.000 description 12
- 235000010446 mineral oil Nutrition 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- 239000003921 oil Substances 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- 238000000034 method Methods 0.000 description 10
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 9
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 8
- 239000000047 product Substances 0.000 description 8
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 7
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- 238000003756 stirring Methods 0.000 description 5
- NNVGRWTYRUNMRQ-UHFFFAOYSA-N (5-methoxy-2,4-dimethyl-1h-indol-3-yl) acetate Chemical compound COC1=CC=C2NC(C)=C(OC(C)=O)C2=C1C NNVGRWTYRUNMRQ-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 125000003435 aroyl group Chemical group 0.000 description 3
- SIKJAQJRHWYJAI-UHFFFAOYSA-N benzopyrrole Natural products C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000010828 elution Methods 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229940080818 propionamide Drugs 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 3
- IGKCFJIMROHCRQ-UHFFFAOYSA-N 2-(1-benzoyl-5-methoxy-2-methylindol-3-yl)-3-phenylpropanoic acid Chemical compound CC1=C(C(CC=2C=CC=CC=2)C(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=CC=C1 IGKCFJIMROHCRQ-UHFFFAOYSA-N 0.000 description 2
- NWPBFGWVZQGAHM-UHFFFAOYSA-N 4-methylbenzenecarbothioyl chloride Chemical compound CC1=CC=C(C(Cl)=S)C=C1 NWPBFGWVZQGAHM-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- TXWGINUZLBAKDF-UHFFFAOYSA-N N-Deschlorobenzoyl indomethacin Chemical compound COC1=CC=C2NC(C)=C(CC(O)=O)C2=C1 TXWGINUZLBAKDF-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 150000001540 azides Chemical class 0.000 description 2
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003480 eluent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- OKHORWCUMZIORR-UHFFFAOYSA-N methyl 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate Chemical compound C12=CC=C(OC)C=C2C(CC(=O)OC)=C(C)N1C(=O)C1=CC=C(Cl)C=C1 OKHORWCUMZIORR-UHFFFAOYSA-N 0.000 description 2
- 238000004452 microanalysis Methods 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- GMKZBFFLCONHDE-UHFFFAOYSA-N (4-nitrophenyl) benzoate Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC(=O)C1=CC=CC=C1 GMKZBFFLCONHDE-UHFFFAOYSA-N 0.000 description 1
- OEHYXZZWECLGIA-UHFFFAOYSA-N 2,4-dimethylbenzenecarbothioyl chloride Chemical compound CC1=CC=C(C(Cl)=S)C(C)=C1 OEHYXZZWECLGIA-UHFFFAOYSA-N 0.000 description 1
- BAFSYRUXYADRNK-UHFFFAOYSA-N 2-(5-methoxy-2-methyl-1h-indol-3-yl)-3-phenylpropanoic acid Chemical compound C12=CC(OC)=CC=C2NC(C)=C1C(C(O)=O)CC1=CC=CC=C1 BAFSYRUXYADRNK-UHFFFAOYSA-N 0.000 description 1
- SUSOIBZGVNNEFL-UHFFFAOYSA-N 2-[1-(4-chlorobenzoyl)-5-(dimethylamino)-2-methylindol-3-yl]acetic acid Chemical compound CC1=C(CC(O)=O)C2=CC(N(C)C)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 SUSOIBZGVNNEFL-UHFFFAOYSA-N 0.000 description 1
- YNDQHILWWBPAPR-UHFFFAOYSA-N 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetamide Chemical compound CC1=C(CC(N)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 YNDQHILWWBPAPR-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- AEJAPRPYYAHEJH-UHFFFAOYSA-N 2-[5-(dimethylamino)-2-methyl-1H-indol-3-yl]acetic acid Chemical compound CC=1NC2=CC=C(C=C2C1CC(=O)O)N(C)C AEJAPRPYYAHEJH-UHFFFAOYSA-N 0.000 description 1
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 1
- XRHGYUZYPHTUJZ-UHFFFAOYSA-N 4-chlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1 XRHGYUZYPHTUJZ-UHFFFAOYSA-N 0.000 description 1
- CZKLEJHVLCMVQR-UHFFFAOYSA-N 4-fluorobenzoyl chloride Chemical compound FC1=CC=C(C(Cl)=O)C=C1 CZKLEJHVLCMVQR-UHFFFAOYSA-N 0.000 description 1
- PJHWTWHVCOZCPU-UHFFFAOYSA-N 4-methylbenzenecarbothioic s-acid Chemical compound CC1=CC=C(C(O)=S)C=C1 PJHWTWHVCOZCPU-UHFFFAOYSA-N 0.000 description 1
- RHNLIYIVBJKECX-UHFFFAOYSA-N C(C)(=O)OC1=C(N(C2=CC=C(C(=C12)C)OC)C(C1=CC=C(C=C1)Cl)=O)C Chemical compound C(C)(=O)OC1=C(N(C2=CC=C(C(=C12)C)OC)C(C1=CC=C(C=C1)Cl)=O)C RHNLIYIVBJKECX-UHFFFAOYSA-N 0.000 description 1
- 206010018691 Granuloma Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000295 fuel oil Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- HYNDOCFHNYVELW-UHFFFAOYSA-N methyl 2-[1-(2-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate Chemical compound C12=CC=C(OC)C=C2C(CC(=O)OC)=C(C)N1C(=O)C1=CC=CC=C1Cl HYNDOCFHNYVELW-UHFFFAOYSA-N 0.000 description 1
- HDYJYMODBVUPKL-UHFFFAOYSA-N methyl 2-[1-(4-bromobenzoyl)-5-methoxy-2-methylindol-3-yl]acetate Chemical compound BrC1=CC=C(C(=O)N2C(=C(C3=CC(=CC=C23)OC)CC(=O)OC)C)C=C1 HDYJYMODBVUPKL-UHFFFAOYSA-N 0.000 description 1
- BZOYDXSFKAXISN-UHFFFAOYSA-N methyl 2-[1-(4-chlorobenzoyl)-2-methyl-5-nitroindol-3-yl]acetate Chemical compound ClC1=CC=C(C(=O)N2C(=C(C3=CC(=CC=C23)[N+](=O)[O-])CC(=O)OC)C)C=C1 BZOYDXSFKAXISN-UHFFFAOYSA-N 0.000 description 1
- NLDCIKQKIOJTTR-UHFFFAOYSA-N methyl 2-[5-methoxy-2-methyl-1-(4-nitrobenzoyl)indol-3-yl]acetate Chemical compound C12=CC=C(OC)C=C2C(CC(=O)OC)=C(C)N1C(=O)C1=CC=C([N+]([O-])=O)C=C1 NLDCIKQKIOJTTR-UHFFFAOYSA-N 0.000 description 1
- CYXSQCVTSSQJHM-UHFFFAOYSA-N methyl 2-[5-methoxy-2-methyl-1-(4-phenylbenzoyl)indol-3-yl]acetate Chemical compound C12=CC=C(OC)C=C2C(CC(=O)OC)=C(C)N1C(=O)C(C=C1)=CC=C1C1=CC=CC=C1 CYXSQCVTSSQJHM-UHFFFAOYSA-N 0.000 description 1
- PYZRSLIYENKEBN-UHFFFAOYSA-N methyl 2-[5-methoxy-2-methyl-1-(4-phenylmethoxybenzoyl)indol-3-yl]acetate Chemical compound C12=CC=C(OC)C=C2C(CC(=O)OC)=C(C)N1C(=O)C(C=C1)=CC=C1OCC1=CC=CC=C1 PYZRSLIYENKEBN-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
Landscapes
- Indole Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO162188A NO134522C (OSRAM) | 1961-03-22 | 1966-03-19 |
Applications Claiming Priority (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US9743461A | 1961-03-22 | 1961-03-22 | |
| US16461562A | 1962-01-05 | 1962-01-05 | |
| NO14373562 | 1962-03-21 | ||
| US28693563 US3161654A (en) | 1962-01-05 | 1963-06-11 | alpha-(1-aroyl-3-indolyl) alkanoic acids |
| US296451A US3201414A (en) | 1963-07-22 | 1963-07-22 | New 1-heteroacyl-3-indolyl aliphatic acids |
| US31047763A | 1963-09-20 | 1963-09-20 | |
| US31045463A | 1963-09-20 | 1963-09-20 | |
| US314503A US3242185A (en) | 1963-10-07 | 1963-10-07 | Lower aliphatic acids, salts and derivatives thereof |
| US32386363A | 1963-11-04 | 1963-11-04 | |
| US321328A US3275644A (en) | 1962-01-05 | 1963-11-04 | Certain 1-azolylindol-3-ylaliphatic acids |
| US321686A US3275645A (en) | 1962-01-05 | 1963-11-06 | N-(1-acyl-3-indolyl)-acids |
| US437338A US3338921A (en) | 1962-01-05 | 1965-01-26 | Thenoic and furoic acids |
| US442152A US3328423A (en) | 1962-01-05 | 1965-03-23 | alpha-(3-indolyl)-cyclopropyl lower aliphatic acids |
| US528020A US3316267A (en) | 1962-01-05 | 1966-02-15 | Indolyl acids |
| NO162188A NO134522C (OSRAM) | 1961-03-22 | 1966-03-19 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| NO134522B true NO134522B (OSRAM) | 1976-07-19 |
| NO134522C NO134522C (OSRAM) | 1976-10-27 |
Family
ID=27585419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO162188A NO134522C (OSRAM) | 1961-03-22 | 1966-03-19 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO134522C (OSRAM) |
-
1966
- 1966-03-19 NO NO162188A patent/NO134522C/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO134522C (OSRAM) | 1976-10-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FERRIS | α-Oximino Ketones. IV. The “Normal” and “Abnormal” Beckmann Rearrangements1 | |
| CA1073907A (en) | 3-(biphenylyl and phenyloxy) butane-1-amine derivatives | |
| US3969402A (en) | Phenylalkanoic acids | |
| NO164897B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive oxazolidinonderivater. | |
| US4544740A (en) | Process for the preparation of 5-(2-bromovinyl)-uridine | |
| NO134522B (OSRAM) | ||
| DE2414038A1 (de) | Verfahren zur herstellung von 3-(4- oder 5-substituierten-thiazol-2-oxy)propandiol-1,2-acetoniden und der entsprechenden azidocarbonyl- und isocyanatoderivate | |
| NO122372B (OSRAM) | ||
| JPS6312063B2 (OSRAM) | ||
| US4059601A (en) | 8-Halo-11,12-secoprostaglandins | |
| Ichikawa et al. | The Reaction of Olefins with Aromatic Substances in the Presence of Mercury Salts and Catalyst. II. Synthesis of β-Arylethyl Alcohols and sym-Diarylethanes | |
| US20080167360A1 (en) | Cycloalkylidene Compounds as Selective Estrogen Receptor Modulators | |
| US4052514A (en) | Trihalosubstituted biphenylyl propionic acids | |
| EP0080271A1 (en) | Indomethacin phenyl ester derivatives, their use, and compositions containing them | |
| Levy et al. | The Action of Triphenylphosphine Dibromide on Sterol and Bile Acid Derivatives1 | |
| JPS6056130B2 (ja) | 新規なサリチル酸誘導体 | |
| EP0046710A1 (en) | Preparation of aminoacetonitrile derivatives | |
| AT390615B (de) | Verfahren zur herstellung von neuen, 3-substituierten 2-oxo-hexahydro-pyrimido (1,2-a)azepinen sowie von deren pharmazeutisch geeigneten salzen | |
| DE3688032T2 (de) | Amidderivate und diese enthaltende 5-lipoxygenase-inhibitoren. | |
| SU974935A3 (ru) | Способ получени сложных эфиров замещенного фенилэтиламина или его соли | |
| NO137546B (no) | Analogifremgangsm}te for fremstilling av terapeutisk aktive bifenylpropionsyrer og derivater herav | |
| US4339594A (en) | Process for the manufacture of phenylacetic acid and simple derivatives thereof | |
| US2944064A (en) | Process for preparing 5-hydroxy-tryptamine through new intermediates | |
| US3758688A (en) | Substituted sulfonanilides in the treatment of inflammation | |
| US3931275A (en) | Bis(4-(4-hydroxybenzyl)phenyl) carbonic acid ester |