NO129145B - - Google Patents
Download PDFInfo
- Publication number
- NO129145B NO129145B NO00981/68A NO98168A NO129145B NO 129145 B NO129145 B NO 129145B NO 00981/68 A NO00981/68 A NO 00981/68A NO 98168 A NO98168 A NO 98168A NO 129145 B NO129145 B NO 129145B
- Authority
- NO
- Norway
- Prior art keywords
- reaction
- water
- carried out
- amalgam
- adiponitrile
- Prior art date
Links
- 238000006243 chemical reaction Methods 0.000 claims description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical group C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 229910000497 Amalgam Inorganic materials 0.000 claims description 7
- 239000012429 reaction media Substances 0.000 claims description 6
- 239000011541 reaction mixture Substances 0.000 claims description 6
- 150000002825 nitriles Chemical class 0.000 claims description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 4
- 239000002585 base Substances 0.000 claims description 4
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 2
- 150000008360 acrylonitriles Chemical group 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- 150000001340 alkali metals Chemical class 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- 150000001408 amides Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 150000003509 tertiary alcohols Chemical class 0.000 claims description 2
- 239000012738 dissolution medium Substances 0.000 claims 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- BTGRAWJCKBQKAO-UHFFFAOYSA-N adiponitrile Chemical compound N#CCCCCC#N BTGRAWJCKBQKAO-UHFFFAOYSA-N 0.000 description 15
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 11
- 239000000047 product Substances 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 7
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 7
- 229910001023 sodium amalgam Inorganic materials 0.000 description 7
- 239000002904 solvent Substances 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 2
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000000539 dimer Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- WJLUBOLDZCQZEV-UHFFFAOYSA-M hexadecyl(trimethyl)azanium;hydroxide Chemical compound [OH-].CCCCCCCCCCCCCCCC[N+](C)(C)C WJLUBOLDZCQZEV-UHFFFAOYSA-M 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- HADKRTWCOYPCPH-UHFFFAOYSA-M trimethylphenylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C1=CC=CC=C1 HADKRTWCOYPCPH-UHFFFAOYSA-M 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/30—Preparation of carboxylic acid nitriles by reactions not involving the formation of cyano groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/02—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C255/03—Mononitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/01—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms
- C07C255/02—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton
- C07C255/04—Carboxylic acid nitriles having cyano groups bound to acyclic carbon atoms of an acyclic and saturated carbon skeleton containing two cyano groups bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IL27411A IL27411A (en) | 1967-02-08 | 1967-02-08 | Process for the hydrodimerization of acrylic acid derivatives |
| IL2895367 | 1967-11-16 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO129145B true NO129145B (OSRAM) | 1974-03-04 |
Family
ID=26320429
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO00981/68A NO129145B (OSRAM) | 1967-02-08 | 1968-03-14 |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3686270A (OSRAM) |
| AT (1) | AT279575B (OSRAM) |
| BE (1) | BE711861A (OSRAM) |
| CH (1) | CH495315A (OSRAM) |
| CS (1) | CS149417B4 (OSRAM) |
| DE (1) | DE1668816A1 (OSRAM) |
| FR (1) | FR95036E (OSRAM) |
| GB (1) | GB1222998A (OSRAM) |
| LU (1) | LU55668A1 (OSRAM) |
| NL (1) | NL6803626A (OSRAM) |
| NO (1) | NO129145B (OSRAM) |
| SE (1) | SE351844B (OSRAM) |
-
1968
- 1968-03-08 GB GB01345/68A patent/GB1222998A/en not_active Expired
- 1968-03-08 BE BE711861D patent/BE711861A/xx unknown
- 1968-03-09 DE DE19681668816 patent/DE1668816A1/de active Pending
- 1968-03-11 FR FR143287A patent/FR95036E/fr not_active Expired
- 1968-03-11 CH CH358768A patent/CH495315A/fr unknown
- 1968-03-12 LU LU55668D patent/LU55668A1/xx unknown
- 1968-03-13 SE SE03332/68A patent/SE351844B/xx unknown
- 1968-03-13 CS CS1964A patent/CS149417B4/cs unknown
- 1968-03-13 AT AT247468A patent/AT279575B/de active
- 1968-03-14 NO NO00981/68A patent/NO129145B/no unknown
- 1968-03-14 NL NL6803626A patent/NL6803626A/xx unknown
-
1970
- 1970-11-09 US US88228A patent/US3686270A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| NL6803626A (OSRAM) | 1969-05-20 |
| CS149417B4 (OSRAM) | 1973-07-05 |
| LU55668A1 (OSRAM) | 1968-12-05 |
| SE351844B (OSRAM) | 1972-12-11 |
| AT279575B (de) | 1970-03-10 |
| DE1668816A1 (de) | 1971-09-30 |
| BE711861A (OSRAM) | 1968-09-09 |
| CH495315A (fr) | 1970-08-31 |
| FR95036E (fr) | 1970-03-27 |
| US3686270A (en) | 1972-08-22 |
| GB1222998A (en) | 1971-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US2654738A (en) | Organic derivatives of phosphonic acids and method of preparing the same | |
| EP0051202B1 (de) | Verfahren zur Herstellung von 2,3-Dichlor-sulfonyl-acrylnitrilen | |
| SU799653A3 (ru) | Способ получени нитриловКЕТОКАРбОНОВыХ КиСлОТ | |
| US4496736A (en) | Process for the preparation of carboxylic acids and N-tert.-alkylamines | |
| WO1998030533A1 (en) | Method for the preparation of alpha-chlorinated chloroformates | |
| US3165544A (en) | Chlorothiolformates and preparation thereof | |
| NO129145B (OSRAM) | ||
| US2785176A (en) | Ethylene urea derivatives and process of production | |
| JPS5955867A (ja) | N−アリル−o−アルキルチオノカルバメ−トの製造方法 | |
| US4113773A (en) | Process for the production of benzoyl cyanide (I) | |
| US3082239A (en) | Thiophosphoric acid esters and process for their production | |
| US3787472A (en) | Process for the production of alkyl isothiocyanic acid esters | |
| FI883935A0 (fi) | Foerfarande foer framstaellning av 1,6-di (n3-cyano-n1-guanidino) hexan. | |
| DE60021481T2 (de) | Verfahren zur Herstellung von N-Alk(en)oxy- oder N-Aryloxy-carbonyl-isothiocyanaten sowie deren Derivate in Anwesenheit eines N,N-Dialkyl-arylamins als Katalysator | |
| RU2283314C2 (ru) | Способ получения производных тиазола, обладающих пестицидной активностью | |
| US6657074B1 (en) | Process for the preparation of acylated 1,3-dicarbonyl compounds | |
| US2450108A (en) | Production of heterocyclic compounds | |
| US4743404A (en) | Process for preparing alkyl-sulphonyl chlorides and arylalkyl-sulphonyl chlorides | |
| EP0110329B1 (de) | Verfahren zur Herstellung von alpha-Vinylpropionsäureestern | |
| US4209461A (en) | Process for the production of benzoyl cyanide (I) | |
| US4324727A (en) | Preparation of butyrolactones | |
| NL8105837A (nl) | Azijnzuurderivaten. | |
| CS226428B2 (en) | Method of preparing dichloroacetamide | |
| US4001353A (en) | Preparation of o,s-dimethyl-thiol-phosphoric acid diester-amide | |
| SU803857A3 (ru) | Способ получени -бензиловыхэфиРОВ , -диАлКилТиОКАРбАМи-НОВОй КиСлОТы |