NO126621B - - Google Patents
Download PDFInfo
- Publication number
- NO126621B NO126621B NO691349A NO134969A NO126621B NO 126621 B NO126621 B NO 126621B NO 691349 A NO691349 A NO 691349A NO 134969 A NO134969 A NO 134969A NO 126621 B NO126621 B NO 126621B
- Authority
- NO
- Norway
- Prior art keywords
- formula
- hydroxymethyl
- parts
- meaning
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 26
- -1 chlorocarboxylic acid ester Chemical class 0.000 claims description 16
- 239000012948 isocyanate Substances 0.000 claims description 15
- 150000002513 isocyanates Chemical class 0.000 claims description 15
- 238000006243 chemical reaction Methods 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 6
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 4
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 150000004657 carbamic acid derivatives Chemical class 0.000 claims description 3
- SHNUBALDGXWUJI-UHFFFAOYSA-N pyridin-2-ylmethanol Chemical class OCC1=CC=CC=N1 SHNUBALDGXWUJI-UHFFFAOYSA-N 0.000 claims description 3
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 239000000047 product Substances 0.000 description 23
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 19
- 239000003208 petroleum Substances 0.000 description 14
- 239000000243 solution Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 150000001412 amines Chemical class 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- UFEJKYYYVXYMMS-UHFFFAOYSA-N methylcarbamic acid Chemical compound CNC(O)=O UFEJKYYYVXYMMS-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 6
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 6
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 3
- 201000003068 rheumatic fever Diseases 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 2
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 2
- 206010061218 Inflammation Diseases 0.000 description 2
- 102100035792 Kininogen-1 Human genes 0.000 description 2
- 208000025747 Rheumatic disease Diseases 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 210000001367 artery Anatomy 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 230000007012 clinical effect Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 238000011866 long-term treatment Methods 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 229910001961 silver nitrate Inorganic materials 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- RNLHVODSMDJCBR-VURMDHGXSA-N (z)-3-methyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pent-4-en-2-ol Chemical compound CC(O)C(C)\C=C/C1CC=C(C)C1(C)C RNLHVODSMDJCBR-VURMDHGXSA-N 0.000 description 1
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 1
- ICSNLGPSRYBMBD-UHFFFAOYSA-N 2-aminopyridine Chemical compound NC1=CC=CC=N1 ICSNLGPSRYBMBD-UHFFFAOYSA-N 0.000 description 1
- GSLTVFIVJMCNBH-UHFFFAOYSA-N 2-isocyanatopropane Chemical compound CC(C)N=C=O GSLTVFIVJMCNBH-UHFFFAOYSA-N 0.000 description 1
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 1
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 1
- 206010003178 Arterial thrombosis Diseases 0.000 description 1
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical group CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 1
- 102000001399 Kallikrein Human genes 0.000 description 1
- 108060005987 Kallikrein Proteins 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- HXBPYFMVGFDZFT-UHFFFAOYSA-N allyl isocyanate Chemical compound C=CCN=C=O HXBPYFMVGFDZFT-UHFFFAOYSA-N 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 150000003940 butylamines Chemical group 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000002497 edematous effect Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- NBEMQPLNBYYUAZ-UHFFFAOYSA-N ethyl acetate;propan-2-one Chemical compound CC(C)=O.CCOC(C)=O NBEMQPLNBYYUAZ-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 229910001385 heavy metal Chemical class 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000004968 inflammatory condition Effects 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 230000002757 inflammatory effect Effects 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- YDNLNVZZTACNJX-UHFFFAOYSA-N isocyanatomethylbenzene Chemical compound O=C=NCC1=CC=CC=C1 YDNLNVZZTACNJX-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- PSGAAPLEWMOORI-PEINSRQWSA-N medroxyprogesterone acetate Chemical compound C([C@@]12C)CC(=O)C=C1[C@@H](C)C[C@@H]1[C@@H]2CC[C@]2(C)[C@@](OC(C)=O)(C(C)=O)CC[C@H]21 PSGAAPLEWMOORI-PEINSRQWSA-N 0.000 description 1
- 150000003956 methylamines Chemical group 0.000 description 1
- 239000011259 mixed solution Substances 0.000 description 1
- RRIWSQXXBIFKQM-UHFFFAOYSA-M n-benzylcarbamate Chemical compound [O-]C(=O)NCC1=CC=CC=C1 RRIWSQXXBIFKQM-UHFFFAOYSA-M 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- IWRIVJYJQHLZSO-UHFFFAOYSA-N phenoxy formate Chemical compound O=COOC1=CC=CC=C1 IWRIVJYJQHLZSO-UHFFFAOYSA-N 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 125000005270 trialkylamine group Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/62—Oxygen or sulfur atoms
- C07D213/70—Sulfur atoms
- C07D213/71—Sulfur atoms to which a second hetero atom is attached
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2280468 | 1968-04-08 | ||
| JP2280568 | 1968-04-08 | ||
| JP6582468 | 1968-09-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126621B true NO126621B (enExample) | 1973-03-05 |
Family
ID=27283974
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO691349A NO126621B (enExample) | 1968-04-08 | 1969-03-31 |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3635992A (enExample) |
| AT (2) | AT294116B (enExample) |
| BE (1) | BE731138A (enExample) |
| BG (3) | BG15394A3 (enExample) |
| CA (1) | CA927829A (enExample) |
| CH (3) | CH527819A (enExample) |
| DE (1) | DE1917539A1 (enExample) |
| FR (1) | FR2007413A1 (enExample) |
| GB (1) | GB1226247A (enExample) |
| IE (1) | IE33020B1 (enExample) |
| IL (1) | IL31900A (enExample) |
| LU (1) | LU58388A1 (enExample) |
| NL (1) | NL6905400A (enExample) |
| NO (1) | NO126621B (enExample) |
| SE (1) | SE379349B (enExample) |
| YU (1) | YU32945B (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2659117A1 (de) * | 1976-12-28 | 1978-07-06 | Consortium Elektrochem Ind | Trichlormethyl-(3-pyridyl)-carbinol |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3013072A (en) * | 1958-09-02 | 1961-12-12 | Pfizer & Co C | Novel process for the production of sulfonylureas |
| US3202576A (en) * | 1963-05-31 | 1965-08-24 | Merck & Co Inc | Anticoccidial compositions and methods of using same |
-
1969
- 1969-03-25 IE IE395/69A patent/IE33020B1/xx unknown
- 1969-03-25 IL IL31900A patent/IL31900A/xx unknown
- 1969-03-25 US US810356A patent/US3635992A/en not_active Expired - Lifetime
- 1969-03-25 GB GB1226247D patent/GB1226247A/en not_active Expired
- 1969-03-31 NO NO691349A patent/NO126621B/no unknown
- 1969-03-31 DE DE19691917539 patent/DE1917539A1/de active Pending
- 1969-04-01 SE SE6904626A patent/SE379349B/xx unknown
- 1969-04-03 CA CA047708A patent/CA927829A/en not_active Expired
- 1969-04-04 FR FR6910548A patent/FR2007413A1/fr not_active Withdrawn
- 1969-04-07 YU YU863/69A patent/YU32945B/xx unknown
- 1969-04-08 AT AT896170A patent/AT294116B/de not_active IP Right Cessation
- 1969-04-08 BE BE731138D patent/BE731138A/xx not_active IP Right Cessation
- 1969-04-08 CH CH527469A patent/CH527819A/de not_active IP Right Cessation
- 1969-04-08 NL NL6905400A patent/NL6905400A/xx unknown
- 1969-04-08 LU LU58388D patent/LU58388A1/xx unknown
- 1969-04-08 AT AT338369A patent/AT294115B/de not_active IP Right Cessation
- 1969-04-08 CH CH1155971A patent/CH529759A/de not_active IP Right Cessation
- 1969-04-08 CH CH1155871A patent/CH529758A/de not_active IP Right Cessation
- 1969-06-20 BG BG012494A patent/BG15394A3/bg unknown
- 1969-06-20 BG BG012495A patent/BG15395A3/bg unknown
- 1969-06-20 BG BG012493A patent/BG15393A3/bg unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE731138A (enExample) | 1969-09-15 |
| CH527819A (de) | 1972-09-15 |
| SE379349B (enExample) | 1975-10-06 |
| NL6905400A (enExample) | 1969-10-10 |
| IL31900A (en) | 1973-03-30 |
| AT294116B (de) | 1971-11-10 |
| YU86369A (en) | 1975-06-30 |
| YU32945B (en) | 1975-12-31 |
| CH529759A (de) | 1972-10-31 |
| BG15393A3 (bg) | 1976-05-10 |
| BG15394A3 (bg) | 1976-06-28 |
| CA927829A (en) | 1973-06-05 |
| GB1226247A (enExample) | 1971-03-24 |
| IL31900A0 (en) | 1969-05-28 |
| CH529758A (de) | 1972-10-31 |
| AT294115B (de) | 1971-11-10 |
| BG15395A3 (bg) | 1976-05-10 |
| FR2007413A1 (enExample) | 1970-01-09 |
| LU58388A1 (enExample) | 1969-07-18 |
| IE33020B1 (en) | 1974-02-20 |
| DE1917539A1 (de) | 1969-10-30 |
| IE33020L (en) | 1969-10-08 |
| US3635992A (en) | 1972-01-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5587383A (en) | Imidazopyridine derivatives and their use | |
| DK170771B1 (da) | N-(2'-aminophenyl)-benzamid-derivater, deres fremstilling og anvendelse til fremstilling af et farmaceutisk præparat samt sådant præparat | |
| DE69831233T2 (de) | Barbitursaure derivaten mit antimetastatischer und antitumorischer wirkung | |
| US4001422A (en) | 4-aminoquinazoline cardiac stimulants | |
| AU599746B2 (en) | Pyridine-2,4- and -2,5-dicarboxylic acid amides, processes for their preparation, the use thereof, and medicaments based on these compounds | |
| DE69805473T2 (de) | Arylsulfonylaminohydroxamsäurederivate | |
| US4244950A (en) | Derivatives of 4-amino-3-sulfonamido-pyridine, their preparation and use | |
| AU733142B2 (en) | Cyanoguanidines as cell proliferation inhibitors | |
| US6489327B1 (en) | Tryptase inhibitors | |
| NO312834B1 (no) | Forbindelser og farmasöytisk preparat inneholdende nevnte forbindelse som er nyttig ved behandling av et menneske med ensykdomstilstand kjennetegnet ved trombotisk virkning | |
| CA2948888A1 (en) | Novel quinoline derivatives and their use in neurodegenerative diseases | |
| EP0873325B1 (en) | Process for producing guanidine derivatives, intermediates therefor and their production | |
| US6346520B1 (en) | Cyanoguanidines as cell proliferation inhibitors | |
| DE69228069T2 (de) | 4-Phenyl-3-(heteroarylureido)-1,2-dihydro-2-oxochinolin Derivate, als antihypercholesterolemische und antiatherosklerotische Mittel | |
| US5585390A (en) | Alpha-amino acid compounds | |
| US3467663A (en) | Derivatives of 2,6- and 2,5-bis (hydroxymethyl)pyridines | |
| DE68924221T2 (de) | Imidazolderivate. | |
| NO126621B (enExample) | ||
| DE2117657A1 (en) | Amino-subst pyrido(3,2-d)pyrimidines - useful for inhibiting thrombocyte aggregation and adhesion | |
| CZ401597A3 (cs) | Hydroxylaminové deriváty, způsob jejich přípravy a jejich použití | |
| US3468889A (en) | O-and/or s-nicotinoyl diacylthiamines and acylation process for preparing the same | |
| US3409625A (en) | (py)-n-oxides of certain carbamates of 2-pyridinemethanol | |
| NO140299B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive 4-aryl-5-aminoalkyl-4-oksazolin-2-oner | |
| US6046218A (en) | Pyridine derivative and medicament containing the same as an effective ingredient | |
| US3501485A (en) | Certain pyridinemethanol carbamate derivatives |