NO126572B - - Google Patents
Download PDFInfo
- Publication number
- NO126572B NO126572B NO513/70A NO51370A NO126572B NO 126572 B NO126572 B NO 126572B NO 513/70 A NO513/70 A NO 513/70A NO 51370 A NO51370 A NO 51370A NO 126572 B NO126572 B NO 126572B
- Authority
- NO
- Norway
- Prior art keywords
- ether
- solution
- torr
- phenyl
- water
- Prior art date
Links
- -1 o-anilinophenylethyl alcohols Chemical class 0.000 claims description 50
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 239000001257 hydrogen Substances 0.000 claims description 8
- 229910052739 hydrogen Inorganic materials 0.000 claims description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 7
- 150000004678 hydrides Chemical class 0.000 claims description 7
- 229910052708 sodium Inorganic materials 0.000 claims description 7
- 239000011734 sodium Substances 0.000 claims description 7
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 155
- 239000000243 solution Substances 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 58
- 239000000203 mixture Substances 0.000 description 31
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 28
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 25
- 239000003208 petroleum Substances 0.000 description 22
- 239000000155 melt Substances 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 16
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 16
- 229910052938 sodium sulfate Inorganic materials 0.000 description 16
- 235000011152 sodium sulphate Nutrition 0.000 description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 15
- 238000003756 stirring Methods 0.000 description 14
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 229960000583 acetic acid Drugs 0.000 description 12
- 239000003921 oil Substances 0.000 description 12
- 238000010992 reflux Methods 0.000 description 12
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 10
- 235000011121 sodium hydroxide Nutrition 0.000 description 10
- 239000007858 starting material Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000706 filtrate Substances 0.000 description 9
- 239000013543 active substance Substances 0.000 description 8
- 125000005907 alkyl ester group Chemical group 0.000 description 8
- 239000012280 lithium aluminium hydride Substances 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- 241000700159 Rattus Species 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 206010018691 Granuloma Diseases 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000012279 sodium borohydride Substances 0.000 description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 4
- NJFCAWNKWPIBAG-UHFFFAOYSA-N 2-(2-anilinophenyl)acetic acid Chemical class OC(=O)CC1=CC=CC=C1NC1=CC=CC=C1 NJFCAWNKWPIBAG-UHFFFAOYSA-N 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 108010010803 Gelatin Proteins 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 4
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 4
- 239000012346 acetyl chloride Substances 0.000 description 4
- 230000001741 anti-phlogistic effect Effects 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 229920000159 gelatin Polymers 0.000 description 4
- 239000008273 gelatin Substances 0.000 description 4
- 235000019322 gelatine Nutrition 0.000 description 4
- 235000011852 gelatine desserts Nutrition 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 4
- 239000011736 potassium bicarbonate Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- OWPNVXATCSXTBK-UHFFFAOYSA-N 1-phenyl-3h-indol-2-one Chemical class O=C1CC2=CC=CC=C2N1C1=CC=CC=C1 OWPNVXATCSXTBK-UHFFFAOYSA-N 0.000 description 3
- SQIUEWNROMQRQY-UHFFFAOYSA-N 2,6-dimethyl-n-phenylaniline Chemical group CC1=CC=CC(C)=C1NC1=CC=CC=C1 SQIUEWNROMQRQY-UHFFFAOYSA-N 0.000 description 3
- MWPZLYLEVLUDNL-UHFFFAOYSA-N 2-[2-(3-chloro-2-methylanilino)phenyl]acetic acid Chemical compound CC1=C(Cl)C=CC=C1NC1=CC=CC=C1CC(O)=O MWPZLYLEVLUDNL-UHFFFAOYSA-N 0.000 description 3
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 230000000202 analgesic effect Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical compound CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 description 3
- 239000008298 dragée Substances 0.000 description 3
- 239000012362 glacial acetic acid Substances 0.000 description 3
- 210000000548 hind-foot Anatomy 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Substances [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- VHXVKUJXOXJGGF-UHFFFAOYSA-N methyl 2-[2-(2,6-dimethylanilino)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC=C1NC1=C(C)C=CC=C1C VHXVKUJXOXJGGF-UHFFFAOYSA-N 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 230000008961 swelling Effects 0.000 description 3
- RPECVEMYMBMRRZ-UHFFFAOYSA-N 1-(2,6-dichlorophenyl)-5-hydroxy-3h-indol-2-one Chemical compound O=C1CC2=CC(O)=CC=C2N1C1=C(Cl)C=CC=C1Cl RPECVEMYMBMRRZ-UHFFFAOYSA-N 0.000 description 2
- OFSFYZHAGXNSIP-UHFFFAOYSA-N 1-(2,6-dichlorophenyl)-5-methoxy-3H-indol-2-one Chemical compound ClC1=C(C(=CC=C1)Cl)N1C(CC2=CC(=CC=C12)OC)=O OFSFYZHAGXNSIP-UHFFFAOYSA-N 0.000 description 2
- QKHCOLJVUBQEMB-UHFFFAOYSA-N 1-(2,6-dimethylphenyl)indole-2,3-dione Chemical compound CC1=C(C(=CC=C1)C)N1C(C(C2=CC=CC=C12)=O)=O QKHCOLJVUBQEMB-UHFFFAOYSA-N 0.000 description 2
- YVYUWWAHHJUIPO-UHFFFAOYSA-N 1-(3-chloro-2-methylphenyl)-3h-indol-2-one Chemical compound CC1=C(Cl)C=CC=C1N1C2=CC=CC=C2CC1=O YVYUWWAHHJUIPO-UHFFFAOYSA-N 0.000 description 2
- UWCPWBIMRYXUOU-UHFFFAOYSA-N 1-phenylindole-2,3-dione Chemical class C12=CC=CC=C2C(=O)C(=O)N1C1=CC=CC=C1 UWCPWBIMRYXUOU-UHFFFAOYSA-N 0.000 description 2
- BLFDNLHOYIEHMA-UHFFFAOYSA-N 2,6-dichloro-n-(4-methoxyphenyl)aniline Chemical compound C1=CC(OC)=CC=C1NC1=C(Cl)C=CC=C1Cl BLFDNLHOYIEHMA-UHFFFAOYSA-N 0.000 description 2
- UFFBMTHBGFGIHF-UHFFFAOYSA-N 2,6-dimethylaniline Chemical group CC1=CC=CC(C)=C1N UFFBMTHBGFGIHF-UHFFFAOYSA-N 0.000 description 2
- ZKYWDEUSHBRHBI-UHFFFAOYSA-N 2-(2,6-dimethylanilino)benzoic acid Chemical compound CC1=CC=CC(C)=C1NC1=CC=CC=C1C(O)=O ZKYWDEUSHBRHBI-UHFFFAOYSA-N 0.000 description 2
- FMVPHKCHGJDQMN-UHFFFAOYSA-N 2-(2-anilinophenyl)acetonitrile Chemical class N(C1=CC=CC=C1)C1=C(C=CC=C1)CC#N FMVPHKCHGJDQMN-UHFFFAOYSA-N 0.000 description 2
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- PKIQYBRRSDPRRI-UHFFFAOYSA-N 2-(chloromethyl)-N-phenylaniline Chemical class N(C1=CC=CC=C1)C1=C(CCl)C=CC=C1 PKIQYBRRSDPRRI-UHFFFAOYSA-N 0.000 description 2
- ICJTVRXTYOYEOT-UHFFFAOYSA-N 2-[2-(2,6-dimethylanilino)phenyl]acetic acid Chemical compound CC1=CC=CC(C)=C1NC1=CC=CC=C1CC(O)=O ICJTVRXTYOYEOT-UHFFFAOYSA-N 0.000 description 2
- NXHYVXRWKQWGCL-UHFFFAOYSA-N 2-chloro-6-methyl-n-phenylaniline Chemical compound CC1=CC=CC(Cl)=C1NC1=CC=CC=C1 NXHYVXRWKQWGCL-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- 125000003047 N-acetyl group Chemical group 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 2
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 2
- 239000002260 anti-inflammatory agent Substances 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 235000010418 carrageenan Nutrition 0.000 description 2
- 229920001525 carrageenan Polymers 0.000 description 2
- 239000008120 corn starch Substances 0.000 description 2
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical class C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 239000012153 distilled water Substances 0.000 description 2
- 230000032050 esterification Effects 0.000 description 2
- 238000005886 esterification reaction Methods 0.000 description 2
- NLQDHKUVSQNWOE-UHFFFAOYSA-N ethyl 2-[2-(2,6-dimethylanilino)phenyl]acetate Chemical compound C(C)OC(CC1=C(C=CC=C1)NC=1C(=CC=CC1C)C)=O NLQDHKUVSQNWOE-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003791 organic solvent mixture Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 235000011181 potassium carbonates Nutrition 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 238000001256 steam distillation Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- XFBFAOFHQQXDCX-UHFFFAOYSA-N 2-(2-anilinophenyl)-2-oxoacetic acid Chemical class N(C1=CC=CC=C1)C1=C(C=CC=C1)C(C(=O)O)=O XFBFAOFHQQXDCX-UHFFFAOYSA-N 0.000 description 1
- CNQCAFDKWBMIJV-UHFFFAOYSA-N 2-[2-(2,4-dichloro-3-methylanilino)phenyl]acetic acid Chemical compound CC1=C(Cl)C=CC(NC=2C(=CC=CC=2)CC(O)=O)=C1Cl CNQCAFDKWBMIJV-UHFFFAOYSA-N 0.000 description 1
- QVGQUDUZLSEIFS-UHFFFAOYSA-N 2-[2-(2,6-dichloroanilino)-5-methoxyphenyl]acetic acid Chemical compound OC(=O)CC1=CC(OC)=CC=C1NC1=C(Cl)C=CC=C1Cl QVGQUDUZLSEIFS-UHFFFAOYSA-N 0.000 description 1
- VGSBGWCOTSSGQY-UHFFFAOYSA-N 2-[2-(2,6-diethylanilino)phenyl]acetic acid Chemical compound CCC1=CC=CC(CC)=C1NC1=CC=CC=C1CC(O)=O VGSBGWCOTSSGQY-UHFFFAOYSA-N 0.000 description 1
- NWTKDJYRLPOOFM-UHFFFAOYSA-N 2-[5-chloro-2-(2,6-dichloroanilino)phenyl]acetic acid Chemical compound OC(=O)CC1=CC(Cl)=CC=C1NC1=C(Cl)C=CC=C1Cl NWTKDJYRLPOOFM-UHFFFAOYSA-N 0.000 description 1
- WFNLHDJJZSJARK-UHFFFAOYSA-N 2-chloro-6-methylaniline Chemical compound CC1=CC=CC(Cl)=C1N WFNLHDJJZSJARK-UHFFFAOYSA-N 0.000 description 1
- IKCLCGXPQILATA-UHFFFAOYSA-N 2-chlorobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1Cl IKCLCGXPQILATA-UHFFFAOYSA-N 0.000 description 1
- SZDXAZJCYIFJIE-UHFFFAOYSA-N 2-oxo-2-(n-phenylanilino)acetyl chloride Chemical class C=1C=CC=CC=1N(C(=O)C(=O)Cl)C1=CC=CC=C1 SZDXAZJCYIFJIE-UHFFFAOYSA-N 0.000 description 1
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- 206010002091 Anaesthesia Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 241000700198 Cavia Species 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- YXHKONLOYHBTNS-UHFFFAOYSA-N Diazomethane Chemical compound C=[N+]=[N-] YXHKONLOYHBTNS-UHFFFAOYSA-N 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 241001466453 Laminaria Species 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229930195725 Mannitol Natural products 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000551249 Piptospatha loi Species 0.000 description 1
- 206010037660 Pyrexia Diseases 0.000 description 1
- 208000025747 Rheumatic disease Diseases 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N acetonitrile Substances CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 230000037005 anaesthesia Effects 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- PPLKNQLEJDDAHV-UHFFFAOYSA-N chloroform;1,1,1,2-tetrachloroethane Chemical compound ClC(Cl)Cl.ClCC(Cl)(Cl)Cl PPLKNQLEJDDAHV-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 229940008406 diethyl sulfate Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 231100000321 erythema Toxicity 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- ZWJINEZUASEZBH-UHFFFAOYSA-N fenamic acid Chemical class OC(=O)C1=CC=CC=C1NC1=CC=CC=C1 ZWJINEZUASEZBH-UHFFFAOYSA-N 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 230000002496 gastric effect Effects 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 208000027866 inflammatory disease Diseases 0.000 description 1
- 239000007928 intraperitoneal injection Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000594 mannitol Substances 0.000 description 1
- 235000010355 mannitol Nutrition 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 239000002032 methanolic fraction Substances 0.000 description 1
- UXHIIMVOKRTERC-UHFFFAOYSA-N methyl 2-[2-(2,4-dichloro-3-methylanilino)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC=C1NC1=CC=C(Cl)C(C)=C1Cl UXHIIMVOKRTERC-UHFFFAOYSA-N 0.000 description 1
- YJPTYMNMFFYDCB-UHFFFAOYSA-N methyl 2-[2-(2-chloro-6-methylanilino)phenyl]acetate Chemical compound COC(=O)CC1=CC=CC=C1NC1=C(C)C=CC=C1Cl YJPTYMNMFFYDCB-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 230000036407 pain Effects 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 230000000552 rheumatic effect Effects 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HRZFUMHJMZEROT-UHFFFAOYSA-L sodium disulfite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])(=O)=O HRZFUMHJMZEROT-UHFFFAOYSA-L 0.000 description 1
- 235000010262 sodium metabisulphite Nutrition 0.000 description 1
- 239000004296 sodium metabisulphite Substances 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 239000002511 suppository base Substances 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 231100001274 therapeutic index Toxicity 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/30—Indoles; Hydrogenated indoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to carbon atoms of the hetero ring
- C07D209/32—Oxygen atoms
- C07D209/34—Oxygen atoms in position 2
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Indole Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH256169A CH506480A (de) | 1969-02-20 | 1969-02-20 | Verfahren zur Herstellung von neuen, substituierten o-Anilino-phenäthylalkoholen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126572B true NO126572B (ca) | 1973-02-26 |
Family
ID=4236570
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO513/70A NO126572B (ca) | 1969-02-20 | 1970-02-13 |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5010295B1 (ca) |
| AT (1) | AT298465B (ca) |
| BE (1) | BE746191A (ca) |
| BG (2) | BG16736A3 (ca) |
| CA (1) | CA918175A (ca) |
| CH (1) | CH506480A (ca) |
| CS (2) | CS154657B2 (ca) |
| DE (1) | DE2007700C2 (ca) |
| DK (1) | DK125241B (ca) |
| ES (1) | ES376699A1 (ca) |
| FI (1) | FI52571C (ca) |
| FR (1) | FR2034558B1 (ca) |
| GB (1) | GB1304622A (ca) |
| IE (1) | IE34016B1 (ca) |
| IL (1) | IL33932A (ca) |
| NL (1) | NL168497C (ca) |
| NO (1) | NO126572B (ca) |
| PL (1) | PL80869B1 (ca) |
| SE (1) | SE366540B (ca) |
| YU (2) | YU34026B (ca) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5254489A (en) * | 1975-10-30 | 1977-05-02 | Kusano Kagaku Kikai Seisakushi | Method of collecting small amoungs of liquid reagent |
| US4496590A (en) * | 1983-04-18 | 1985-01-29 | Sterling Drug Inc. | Benzyl alcohol derivatives, their preparation and use |
| DK335086A (da) * | 1985-08-05 | 1987-02-06 | Michele Testa | Kemiske sammensaetninger og farmaceutiske praeparater til topisk brug indeholdende mindst en af de kemiske sammensaetninger i en terapeutiskvirksom maengde |
| CN116217416A (zh) * | 2022-12-31 | 2023-06-06 | 黄淮学院 | 一种苯并咪唑类药物中间体3-硝基-4-乙基氨基苯甲醇的制备方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL133740C (ca) * | 1965-04-08 |
-
1969
- 1969-02-20 CH CH256169A patent/CH506480A/de not_active IP Right Cessation
-
1970
- 1970-02-13 DK DK71570AA patent/DK125241B/da not_active IP Right Cessation
- 1970-02-13 NL NLAANVRAGE7002097,A patent/NL168497C/xx not_active IP Right Cessation
- 1970-02-13 NO NO513/70A patent/NO126572B/no unknown
- 1970-02-13 SE SE01853/70A patent/SE366540B/xx unknown
- 1970-02-13 FI FI700402A patent/FI52571C/fi active
- 1970-02-18 YU YU390/70A patent/YU34026B/xx unknown
- 1970-02-19 IL IL33932A patent/IL33932A/xx unknown
- 1970-02-19 CS CS793472*1A patent/CS154657B2/cs unknown
- 1970-02-19 BG BG017648A patent/BG16736A3/xx unknown
- 1970-02-19 BE BE746191D patent/BE746191A/xx not_active IP Right Cessation
- 1970-02-19 IE IE212/70A patent/IE34016B1/xx unknown
- 1970-02-19 GB GB791270A patent/GB1304622A/en not_active Expired
- 1970-02-19 CA CA075274A patent/CA918175A/en not_active Expired
- 1970-02-19 PL PL1970138890A patent/PL80869B1/pl unknown
- 1970-02-19 AT AT151070A patent/AT298465B/de not_active IP Right Cessation
- 1970-02-19 CS CS115770A patent/CS154656B2/cs unknown
- 1970-02-19 DE DE2007700A patent/DE2007700C2/de not_active Expired
- 1970-02-19 FR FR707005945A patent/FR2034558B1/fr not_active Expired
- 1970-02-19 JP JP45013881A patent/JPS5010295B1/ja active Pending
- 1970-02-19 BG BG014015A patent/BG17292A3/xx unknown
- 1970-02-19 ES ES376699A patent/ES376699A1/es not_active Expired
-
1977
- 1977-05-20 YU YU1267/77A patent/YU34027B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI52571C (fi) | 1977-10-10 |
| YU39070A (en) | 1978-05-15 |
| IE34016L (en) | 1970-08-20 |
| IE34016B1 (en) | 1975-01-08 |
| CS154657B2 (ca) | 1974-04-30 |
| JPS5010295B1 (ca) | 1975-04-19 |
| NL168497B (nl) | 1981-11-16 |
| YU34027B (en) | 1978-10-31 |
| BE746191A (fr) | 1970-08-19 |
| CH506480A (de) | 1971-04-30 |
| FI52571B (ca) | 1977-06-30 |
| NL7002097A (ca) | 1970-08-24 |
| CA918175A (en) | 1973-01-02 |
| BG16736A3 (bg) | 1973-02-15 |
| DE2007700C2 (de) | 1983-04-28 |
| IL33932A0 (en) | 1970-04-20 |
| BG17292A3 (bg) | 1973-07-25 |
| CS154656B2 (ca) | 1974-04-30 |
| PL80869B1 (ca) | 1975-08-30 |
| ES376699A1 (es) | 1972-07-01 |
| AT298465B (de) | 1972-05-10 |
| GB1304622A (ca) | 1973-01-24 |
| DK125241B (da) | 1973-01-22 |
| NL168497C (nl) | 1982-04-16 |
| SE366540B (ca) | 1974-04-29 |
| FR2034558B1 (ca) | 1973-07-13 |
| IL33932A (en) | 1973-05-31 |
| YU34026B (en) | 1978-10-31 |
| DE2007700A1 (de) | 1970-11-19 |
| YU126777A (en) | 1978-05-15 |
| FR2034558A1 (ca) | 1970-12-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3781328A (en) | Phenoxy-alkyl-carboxylic acid compounds | |
| NO142441B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk virksomme karboksylsyrederivater | |
| US4207341A (en) | Hypoglycaemically and hypolipidaemically active derivatives of phenylacetic acid | |
| NO153001B (no) | Drivanordning for skip | |
| NO170029B (no) | Fremgangsmaate til reduksjon av koksdannelse paa metalloverflater som bringes i beroering med en hydrokarbonholdig gasstroem i en termisk krakkingsprosess og middel til bruk i fremgangsmaaten | |
| US3839431A (en) | Cyclopropylmethylphenylacetic acids and derivatives | |
| US4247706A (en) | Dibenzothiepin derivatives and a process for producing the same | |
| US2489236A (en) | Synthesis of biotin and related compounds | |
| US3898271A (en) | Cyclopropylmethylphenylacetic acids and derivatives | |
| NO126572B (ca) | ||
| US4545993A (en) | 1,2-Benzopyran-6-yl acetic acid compound and pharmaceutical compositions containing said compounds | |
| US3255242A (en) | (alpha-alkylideneacyl)naphthyloxy monocarboxylic acids | |
| US3257420A (en) | Carboxylic acids alpha-substituted by at least one cyclic radical | |
| US4173577A (en) | Phenylacetohydroxamic acids | |
| CA1217187A (en) | Thiazine derivatives | |
| US4092430A (en) | Antiphlogistic phenylacetohydroxamic acid compositions | |
| NO118798B (ca) | ||
| US4740518A (en) | 4H-benzo(4,5)cyclohepta(1,2-B)thiophene derivatives | |
| US4473583A (en) | Compositions containing certain derivatives of 4-phenyl-4-oxobuten-2-oic acid and methods of treatment using them | |
| US3987116A (en) | Ethynylaryl compounds and derivatives thereof | |
| US3651084A (en) | Substituted phenylalkanoic acids | |
| JPS6033373B2 (ja) | 1−ナフチル酢酸誘導体、その製造法ならびに1−ナフチル酢酸誘導体を含有する薬剤 | |
| US4690945A (en) | Process for the preparation of 5'-substituted 2-(3'-thienyl)propionic acids | |
| US3984565A (en) | Acetophenone derivatives | |
| PT95362B (pt) | Processo de preparacao de dibenzofuranos substituidos e de composicoes farmaceuticas que os contem |