NO126483B - - Google Patents
Download PDFInfo
- Publication number
- NO126483B NO126483B NO30369A NO30369A NO126483B NO 126483 B NO126483 B NO 126483B NO 30369 A NO30369 A NO 30369A NO 30369 A NO30369 A NO 30369A NO 126483 B NO126483 B NO 126483B
- Authority
- NO
- Norway
- Prior art keywords
- compounds
- compound
- tetrahydroisoquinoline
- acid
- mixture
- Prior art date
Links
- -1 methoxyphenyl Chemical group 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 27
- 239000000203 mixture Substances 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000001931 aliphatic group Chemical group 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002252 acyl group Chemical group 0.000 claims description 3
- VYFYYTLLBUKUHU-UHFFFAOYSA-N dopamine Chemical compound NCCC1=CC=C(O)C(O)=C1 VYFYYTLLBUKUHU-UHFFFAOYSA-N 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 2
- 125000005805 dimethoxy phenyl group Chemical group 0.000 claims description 2
- 239000012442 inert solvent Substances 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000001680 trimethoxyphenyl group Chemical group 0.000 claims description 2
- 125000003039 tetrahydroisoquinolinyl group Chemical class C1(NCCC2=CC=CC=C12)* 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 44
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 21
- 239000000243 solution Substances 0.000 description 19
- 238000002844 melting Methods 0.000 description 15
- 230000008018 melting Effects 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000013078 crystal Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 150000003526 tetrahydroisoquinolines Chemical class 0.000 description 6
- CTENFNNZBMHDDG-UHFFFAOYSA-N Dopamine hydrochloride Chemical compound Cl.NCCC1=CC=C(O)C(O)=C1 CTENFNNZBMHDDG-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000001816 cooling Methods 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 4
- 229940049953 phenylacetate Drugs 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 229960003424 phenylacetic acid Drugs 0.000 description 3
- 239000003279 phenylacetic acid Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- BHHGXPLMPWCGHP-UHFFFAOYSA-N Phenethylamine Natural products NCCC1=CC=CC=C1 BHHGXPLMPWCGHP-UHFFFAOYSA-N 0.000 description 2
- 238000006796 Pomeranz-Fritsch reaction Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- 238000006359 acetalization reaction Methods 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- GWCFOZUNGBECRW-UHFFFAOYSA-N 1-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical compound C1=C(OC)C(OC)=CC=C1CC1C2=CC(O)=C(O)C=C2CCN1 GWCFOZUNGBECRW-UHFFFAOYSA-N 0.000 description 1
- ZVTWHNLKDVOCNW-UHFFFAOYSA-N 1-[(3,5-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical compound COC1=CC(OC)=CC(CC2C3=CC(O)=C(O)C=C3CCN2)=C1 ZVTWHNLKDVOCNW-UHFFFAOYSA-N 0.000 description 1
- FWQAUIPLDHTNCB-UHFFFAOYSA-N 1-[(4-methoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical compound C1=CC(OC)=CC=C1CC1C2=CC(O)=C(O)C=C2CCN1 FWQAUIPLDHTNCB-UHFFFAOYSA-N 0.000 description 1
- GGGSEBXTKMTNBW-UHFFFAOYSA-N 1-benzyl-1,2,3,4-tetrahydroisoquinoline-6,7-diol Chemical compound C1=2C=C(O)C(O)=CC=2CCNC1CC1=CC=CC=C1 GGGSEBXTKMTNBW-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- MODKMHXGCGKTLE-UHFFFAOYSA-N N-acetylphenylethylamine Chemical class CC(=O)NCCC1=CC=CC=C1 MODKMHXGCGKTLE-UHFFFAOYSA-N 0.000 description 1
- 238000006929 Pictet-Spengler synthesis reaction Methods 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- IZTUINVRJSCOIR-UHFFFAOYSA-N benzylisoquinoline Chemical compound N=1C=CC2=CC=CC=C2C=1CC1=CC=CC=C1 IZTUINVRJSCOIR-UHFFFAOYSA-N 0.000 description 1
- 229940124630 bronchodilator Drugs 0.000 description 1
- 239000000168 bronchodilator agent Substances 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 230000003177 cardiotonic effect Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- PHSQGRIKRCUPMR-UHFFFAOYSA-N ethyl 2-(3,4,5-trimethoxyphenyl)acetate Chemical compound CCOC(=O)CC1=CC(OC)=C(OC)C(OC)=C1 PHSQGRIKRCUPMR-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 230000022244 formylation Effects 0.000 description 1
- 238000006170 formylation reaction Methods 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- UHSXRTHJCJGEKG-UHFFFAOYSA-N hydron;1-[(3,4,5-trimethoxyphenyl)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;chloride Chemical compound Cl.COC1=C(OC)C(OC)=CC(CC2C3=CC(O)=C(O)C=C3CCN2)=C1 UHSXRTHJCJGEKG-UHFFFAOYSA-N 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- MBFUSGLXKQWVDW-UHFFFAOYSA-N norsalsolinol Chemical class C1CNCC2=C1C=C(O)C(O)=C2 MBFUSGLXKQWVDW-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229940117803 phenethylamine Drugs 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/12—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with radicals, substituted by hetero atoms, attached to carbon atoms of the nitrogen-containing ring
- C07D217/18—Aralkyl radicals
- C07D217/20—Aralkyl radicals with oxygen atoms directly attached to the aromatic ring of said aralkyl radical, e.g. papaverine
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP588968 | 1968-01-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO126483B true NO126483B (da) | 1973-02-12 |
Family
ID=11623444
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO30369A NO126483B (da) | 1968-01-31 | 1969-01-27 |
Country Status (9)
| Country | Link |
|---|---|
| AT (1) | AT286987B (da) |
| CH (1) | CH521345A (da) |
| CS (2) | CS159755B2 (da) |
| DK (1) | DK135765B (da) |
| ES (1) | ES363129A1 (da) |
| FI (1) | FI49165C (da) |
| NL (1) | NL6901221A (da) |
| NO (1) | NO126483B (da) |
| SE (1) | SE352889B (da) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8518635D0 (en) * | 1985-07-23 | 1985-08-29 | Smithkline Beckman Corp | Chemical compounds |
| GB8518634D0 (en) * | 1985-07-23 | 1985-08-29 | Smithkline Beckman Corp | Chemical compounds |
-
1969
- 1969-01-22 SE SE85369A patent/SE352889B/xx unknown
- 1969-01-23 FI FI20769A patent/FI49165C/fi active
- 1969-01-24 NL NL6901221A patent/NL6901221A/xx unknown
- 1969-01-27 NO NO30369A patent/NO126483B/no unknown
- 1969-01-28 CS CS872372A patent/CS159755B2/cs unknown
- 1969-01-28 CS CS53969A patent/CS159754B2/cs unknown
- 1969-01-30 ES ES363129A patent/ES363129A1/es not_active Expired
- 1969-01-30 AT AT94169A patent/AT286987B/de active
- 1969-01-30 DK DK51769A patent/DK135765B/da not_active IP Right Cessation
- 1969-01-31 CH CH155569A patent/CH521345A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CH521345A (de) | 1972-04-15 |
| FI49165B (da) | 1974-12-31 |
| DK135765B (da) | 1977-06-20 |
| FI49165C (fi) | 1975-04-10 |
| ES363129A1 (es) | 1970-11-16 |
| SE352889B (da) | 1973-01-15 |
| DK135765C (da) | 1977-11-28 |
| NL6901221A (da) | 1969-08-04 |
| CS159754B2 (da) | 1975-01-31 |
| AT286987B (de) | 1971-01-11 |
| CS159755B2 (da) | 1975-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU867298A3 (ru) | Способ получени производных пиперидина или их солей | |
| JP3055819B2 (ja) | ２−チエニルグリシド酸誘導体およびその製造法 | |
| EP2155684B1 (en) | Process for producing cisatracurium compounds and associated intermediates | |
| US4118393A (en) | Phenyl azabicyclohexanones | |
| WO2014079344A1 (zh) | 1-(4-氯苯基)-2-环丙基-1-丙酮的制备方法及其中间体 | |
| US3397208A (en) | Method for preparing 4-hydroxy-6, 7-dialkoxy-3-carboalkoxyquinolines and novel 4-chloro-6, 7-dialkoxy-3-carboalkoxyquinolines useful therein | |
| US4384144A (en) | Process for preparing cyclopentenone derivatives | |
| NO126483B (da) | ||
| US4309542A (en) | Process for the O-methylation of hydroxyaporphines | |
| US4469633A (en) | N-oxides of 5-oxo-1-phenyl-2-benzazepines | |
| US3761482A (en) | Process and intermediates for the preparation of n-substituted 6,7-methylenedioxy-4-quinolone derivatives | |
| US7834184B2 (en) | Opiate intermediates and methods of synthesis | |
| US4009187A (en) | 8-(5-Formyl-2-furyl)-octanoic acid | |
| PL75064B1 (da) | ||
| US4760145A (en) | Certain 6,7-methylene dioxydihydro or tetrahydro-isoquinoline derivatives | |
| US3976652A (en) | Isoquinoline compounds | |
| US2789111A (en) | Process for the manufacture of octahy- | |
| US4656179A (en) | Isoquinoline derivatives, and pharmaceutical compositions containing them | |
| Tsuda et al. | Studies on the Coal Tar Bases. III.: Synthesis of Dimethylpyridines. | |
| US4318854A (en) | Intermediates in the production of 2-benzazepines | |
| Sugasawa et al. | Extension of Bischler-Napieralski reaction—I: Synthesis of isoquinoline derivatives: A synthesis of rac.-apomorphine dimethyl ether | |
| SU665802A3 (ru) | Способ получени арилалкиламинов или их солей | |
| CA1309720C (en) | Benzylamine derivative | |
| US4501891A (en) | Method of forming a solution of papavrine carbanion | |
| US3917605A (en) | Process for the preparation on N-substituted 6,7-methylenedioxy-4-quinolone derivatives |