NO125181B - - Google Patents
Download PDFInfo
- Publication number
- NO125181B NO125181B NO0713/68A NO71368A NO125181B NO 125181 B NO125181 B NO 125181B NO 0713/68 A NO0713/68 A NO 0713/68A NO 71368 A NO71368 A NO 71368A NO 125181 B NO125181 B NO 125181B
- Authority
- NO
- Norway
- Prior art keywords
- catalyst
- cadmium
- acetate
- carbonic acid
- salt
- Prior art date
Links
- 239000003054 catalyst Substances 0.000 claims description 41
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 24
- 239000005977 Ethylene Substances 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 18
- 150000001735 carboxylic acids Chemical class 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 13
- 239000001301 oxygen Substances 0.000 claims description 13
- 229910052760 oxygen Inorganic materials 0.000 claims description 13
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 12
- 239000007789 gas Substances 0.000 claims description 12
- 150000001661 cadmium Chemical class 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 10
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims description 8
- 235000012239 silicon dioxide Nutrition 0.000 claims description 8
- 229910052793 cadmium Inorganic materials 0.000 claims description 6
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 4
- 229920001567 vinyl ester resin Polymers 0.000 claims description 4
- GKDXQAKPHKQZSC-UHFFFAOYSA-L cadmium(2+);carbonate Chemical class [Cd+2].[O-]C([O-])=O GKDXQAKPHKQZSC-UHFFFAOYSA-L 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 2
- 229910052741 iridium Inorganic materials 0.000 claims description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052763 palladium Inorganic materials 0.000 claims description 2
- 150000002940 palladium Chemical class 0.000 claims description 2
- 229910052697 platinum Inorganic materials 0.000 claims description 2
- 229910052703 rhodium Inorganic materials 0.000 claims description 2
- 239000010948 rhodium Substances 0.000 claims description 2
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 2
- 229910052707 ruthenium Inorganic materials 0.000 claims description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims 4
- 229940065285 cadmium compound Drugs 0.000 claims 1
- 150000001662 cadmium compounds Chemical class 0.000 claims 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 50
- 229960000583 acetic acid Drugs 0.000 description 19
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 14
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 13
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 8
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 8
- LHQLJMJLROMYRN-UHFFFAOYSA-L cadmium acetate Chemical compound [Cd+2].CC([O-])=O.CC([O-])=O LHQLJMJLROMYRN-UHFFFAOYSA-L 0.000 description 7
- 239000012362 glacial acetic acid Substances 0.000 description 7
- 235000011056 potassium acetate Nutrition 0.000 description 7
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical class CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Chemical class CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 229910000510 noble metal Inorganic materials 0.000 description 6
- GOKIPOOTKLLKDI-UHFFFAOYSA-N acetic acid;iron Chemical compound [Fe].CC(O)=O.CC(O)=O.CC(O)=O GOKIPOOTKLLKDI-UHFFFAOYSA-N 0.000 description 5
- 230000000737 periodic effect Effects 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- KQNPFQTWMSNSAP-UHFFFAOYSA-N isobutyric acid Chemical class CC(C)C(O)=O KQNPFQTWMSNSAP-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 150000001447 alkali salts Chemical class 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical class O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- -1 aliphatic monocarboxylic acids Chemical class 0.000 description 2
- 150000001336 alkenes Chemical class 0.000 description 2
- 239000001569 carbon dioxide Substances 0.000 description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 230000007306 turnover Effects 0.000 description 2
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910000323 aluminium silicate Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 229910000011 cadmium carbonate Inorganic materials 0.000 description 1
- CXKCTMHTOKXKQT-UHFFFAOYSA-N cadmium oxide Inorganic materials [Cd]=O CXKCTMHTOKXKQT-UHFFFAOYSA-N 0.000 description 1
- CFEAAQFZALKQPA-UHFFFAOYSA-N cadmium(2+);oxygen(2-) Chemical compound [O-2].[Cd+2] CFEAAQFZALKQPA-UHFFFAOYSA-N 0.000 description 1
- 150000004653 carbonic acids Chemical class 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 229910001882 dioxygen Inorganic materials 0.000 description 1
- MEGHWIAOTJPCHQ-UHFFFAOYSA-N ethenyl butanoate Chemical compound CCCC(=O)OC=C MEGHWIAOTJPCHQ-UHFFFAOYSA-N 0.000 description 1
- UIWXSTHGICQLQT-UHFFFAOYSA-N ethenyl propanoate Chemical compound CCC(=O)OC=C UIWXSTHGICQLQT-UHFFFAOYSA-N 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 159000000014 iron salts Chemical class 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N pentanoic acid group Chemical class C(CCCC)(=O)O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- 239000012495 reaction gas Substances 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- HBMJWWWQQXIZIP-UHFFFAOYSA-N silicon carbide Chemical compound [Si+]#[C-] HBMJWWWQQXIZIP-UHFFFAOYSA-N 0.000 description 1
- 229910010271 silicon carbide Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000006886 vinylation reaction Methods 0.000 description 1
- 229910052845 zircon Inorganic materials 0.000 description 1
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/04—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds
- C07C67/05—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation
- C07C67/055—Preparation of carboxylic acid esters by reacting carboxylic acids or symmetrical anhydrides onto unsaturated carbon-to-carbon bonds with oxidation in the presence of platinum group metals or their compounds
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF51719A DE1296138B (de) | 1967-03-03 | 1967-03-03 | Verfahren zur Herstellung von Carbonsaeurevinylestern |
| DEF0053201 | 1967-08-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125181B true NO125181B (fr) | 1972-07-31 |
Family
ID=25977593
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO0713/68A NO125181B (fr) | 1967-03-03 | 1968-02-27 |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US3625998A (fr) |
| AT (1) | AT279571B (fr) |
| BE (1) | BE711618A (fr) |
| CH (1) | CH494204A (fr) |
| CS (1) | CS149613B2 (fr) |
| DE (1) | DE1296138B (fr) |
| DK (1) | DK124604B (fr) |
| ES (1) | ES351062A1 (fr) |
| FR (1) | FR1556619A (fr) |
| GB (1) | GB1188737A (fr) |
| NL (1) | NL161130C (fr) |
| NO (1) | NO125181B (fr) |
| SE (1) | SE349294B (fr) |
| SU (1) | SU431667A3 (fr) |
| YU (1) | YU33848B (fr) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3939199A (en) * | 1971-01-06 | 1976-02-17 | Hoechst Aktiengesellschaft | Oxacylation of olefins in the gaseous phase |
| DE2315037C3 (de) * | 1973-03-26 | 1978-03-09 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von ungesättigten Estern von Carbonsäuren |
| US5155253A (en) * | 1988-06-30 | 1992-10-13 | Union Carbide Chemicals & Plastics Technology Corporation | Transvinylation process for the preparation of thermally labile vinyl compounds and for vinyl compounds prepared from thermally labile acids |
| US4981973A (en) * | 1988-06-30 | 1991-01-01 | Union Carbide Chemicals And Plastics Company, Inc. | Transvinylation reaction |
| ES2135006T3 (es) * | 1994-06-02 | 1999-10-16 | Standard Oil Co Ohio | Procedimiento en lecho fluido para la acetoxilacion de etileno en la produccion de acetato de vinilo. |
| US5550281A (en) * | 1994-06-02 | 1996-08-27 | Cirjak; Larry M. | Fluid bed process for the acetoxylation of ethylene in the production of vinyl acetate |
| US5688993A (en) * | 1995-12-22 | 1997-11-18 | E. I. Du Pont De Nemours And Company | Method for modifying catalyst performance during the gas phase synthesis of vinyl acetate |
| US5731457A (en) * | 1997-06-03 | 1998-03-24 | Hoechst Celanese Corporation | Vinyl acetate process utilizing a palladium-gold-copper catalyst |
| GB0014583D0 (en) | 2000-06-14 | 2000-08-09 | Bp Chem Int Ltd | Process |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3190912A (en) * | 1962-05-02 | 1965-06-22 | Nat Distillers Chem Corp | Process for preparing esters |
| FR1407526A (fr) * | 1963-09-12 | 1965-07-30 | Nat Distillers Chem Corp | Procédé amélioré de préparation d'esters organiques insaturés |
| US3306930A (en) * | 1964-08-17 | 1967-02-28 | Du Pont | Cyclic method of preparing vinyl acetate |
-
1967
- 1967-03-03 DE DEF51719A patent/DE1296138B/de active Pending
-
1968
- 1968-02-23 YU YU414/68A patent/YU33848B/xx unknown
- 1968-02-27 US US708509A patent/US3625998A/en not_active Expired - Lifetime
- 1968-02-27 NO NO0713/68A patent/NO125181B/no unknown
- 1968-02-27 NL NL6802739.A patent/NL161130C/xx active
- 1968-02-29 CH CH296268A patent/CH494204A/de not_active IP Right Cessation
- 1968-02-29 ES ES351062A patent/ES351062A1/es not_active Expired
- 1968-03-01 DK DK86568AA patent/DK124604B/da not_active IP Right Cessation
- 1968-03-01 AT AT200668A patent/AT279571B/de not_active IP Right Cessation
- 1968-03-01 CS CS1662A patent/CS149613B2/cs unknown
- 1968-03-01 SU SU1222721A patent/SU431667A3/ru active
- 1968-03-01 SE SE02696/68A patent/SE349294B/xx unknown
- 1968-03-04 FR FR1556619D patent/FR1556619A/fr not_active Expired
- 1968-03-04 BE BE711618D patent/BE711618A/xx not_active IP Right Cessation
- 1968-03-04 GB GB00364/68A patent/GB1188737A/en not_active Expired
-
1972
- 1972-05-22 US US27663D patent/USRE27663E/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE349294B (fr) | 1972-09-25 |
| ES351062A1 (es) | 1969-05-16 |
| YU33848B (en) | 1978-06-30 |
| NL161130C (nl) | 1980-01-15 |
| USRE27663E (en) | 1973-06-12 |
| DE1643999B2 (de) | 1975-08-14 |
| NL6802739A (fr) | 1968-09-04 |
| DK124604B (da) | 1972-11-06 |
| CH494204A (de) | 1970-07-31 |
| CS149613B2 (fr) | 1973-07-25 |
| NL161130B (nl) | 1979-08-15 |
| AT279571B (de) | 1970-03-10 |
| US3625998A (en) | 1971-12-07 |
| DE1296138B (de) | 1969-05-29 |
| DE1643999A1 (de) | 1971-04-15 |
| BE711618A (fr) | 1968-09-04 |
| YU41468A (en) | 1977-12-31 |
| FR1556619A (fr) | 1969-02-07 |
| SU431667A3 (fr) | 1974-06-05 |
| GB1188737A (en) | 1970-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US3717670A (en) | Production of carboxylic acids and esters | |
| JPS5942661B2 (ja) | ムスイサクサンノセイホウ | |
| NO142626B (no) | Fremgangsmaate for fremstilling av maleinsyreanhydrid ved oksydasjon av n-butan. | |
| CN101511766A (zh) | 降低目标流中的醛浓度的方法 | |
| NO124481B (fr) | ||
| RU2118310C1 (ru) | Способ получения карбоновых кислот или соответствующих сложных эфиров | |
| NO125181B (fr) | ||
| JP5356334B2 (ja) | 酢酸の製造方法 | |
| US20040151659A1 (en) | Direct synthesis of hydrogen peroxide in a multicomponent solvent system | |
| EP1390288B1 (fr) | Synthese directe de peroxide d'hydrogene dans un systeme de solvants a plusieurs composes | |
| JPS58246A (ja) | アルコ−ルのカルボニル化用触媒 | |
| US3855280A (en) | Process for producing an alkenyl alkanoate from an olefin and a carboxylic acid | |
| US4668819A (en) | Process for the manufacture of unsaturated esters of carboxylic acids | |
| US4205181A (en) | Process for preparing unsaturated esters | |
| US4121039A (en) | Process for producing an unsaturated glycol diester using a catalyst comprising palladium containing thorium as a promotor | |
| CA1119203A (fr) | Methode de preparation du trichloroethylene | |
| US3592840A (en) | Production of vinyl acetate | |
| US3637818A (en) | Process for preparing mixtures of acetaldehyde acetic acid and vinyl acetate | |
| NO125814B (fr) | ||
| US4189600A (en) | Manufacture of glycol acetate | |
| JP5464145B2 (ja) | 非対称鎖状カーボネートの製造方法 | |
| KR20010103633A (ko) | 이리듐 및 플래티늄의 존재 하의 아세트산 및/또는 메틸아세테이트의 제조 방법 | |
| US3989747A (en) | Production of propionic acid | |
| US4247467A (en) | Preparation of gamma-lactones | |
| WO1994011335A1 (fr) | Procede de production de diester carbonique |