NO123807B - - Google Patents
Download PDFInfo
- Publication number
- NO123807B NO123807B NO160519A NO16051965A NO123807B NO 123807 B NO123807 B NO 123807B NO 160519 A NO160519 A NO 160519A NO 16051965 A NO16051965 A NO 16051965A NO 123807 B NO123807 B NO 123807B
- Authority
- NO
- Norway
- Prior art keywords
- stabilizers
- group
- aminocrotonic acid
- ester
- stabilized
- Prior art date
Links
- 239000003381 stabilizer Substances 0.000 claims description 21
- 229920000915 polyvinyl chloride Polymers 0.000 claims description 10
- UKVYVZLTGQVOPX-NSCUHMNNSA-N (e)-3-aminobut-2-enoic acid Chemical compound C\C(N)=C/C(O)=O UKVYVZLTGQVOPX-NSCUHMNNSA-N 0.000 claims description 5
- -1 B-aminocrotonic acid ester Chemical class 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 125000005907 alkyl ester group Chemical group 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 1
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 230000015572 biosynthetic process Effects 0.000 claims 1
- 239000000460 chlorine Substances 0.000 claims 1
- 229910052801 chlorine Inorganic materials 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- 125000000101 thioether group Chemical group 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000011888 foil Substances 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920005862 polyol Polymers 0.000 description 3
- 150000003077 polyols Chemical class 0.000 description 3
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 2
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 2
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 230000001976 improved effect Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 150000002897 organic nitrogen compounds Chemical class 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000000344 soap Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- YODZTKMDCQEPHD-UHFFFAOYSA-N thiodiglycol Chemical compound OCCSCCO YODZTKMDCQEPHD-UHFFFAOYSA-N 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- OEPOKWHJYJXUGD-UHFFFAOYSA-N 2-(3-phenylmethoxyphenyl)-1,3-thiazole-4-carbaldehyde Chemical compound O=CC1=CSC(C=2C=C(OCC=3C=CC=CC=3)C=CC=2)=N1 OEPOKWHJYJXUGD-UHFFFAOYSA-N 0.000 description 1
- TXBCBTDQIULDIA-UHFFFAOYSA-N 2-[[3-hydroxy-2,2-bis(hydroxymethyl)propoxy]methyl]-2-(hydroxymethyl)propane-1,3-diol Chemical compound OCC(CO)(CO)COCC(CO)(CO)CO TXBCBTDQIULDIA-UHFFFAOYSA-N 0.000 description 1
- WDJHALXBUFZDSR-UHFFFAOYSA-N Acetoacetic acid Natural products CC(=O)CC(O)=O WDJHALXBUFZDSR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 229920001328 Polyvinylidene chloride Polymers 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000001183 hydrocarbyl group Chemical group 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 238000010525 oxidative degradation reaction Methods 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000005033 polyvinylidene chloride Substances 0.000 description 1
- 238000005096 rolling process Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 238000010557 suspension polymerization reaction Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/36—Sulfur-, selenium-, or tellurium-containing compounds
- C08K5/37—Thiols
- C08K5/372—Sulfides, e.g. R-(S)x-R'
- C08K5/3725—Sulfides, e.g. R-(S)x-R' containing nitrogen
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DED0045968 | 1964-12-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO123807B true NO123807B (cs) | 1972-01-17 |
Family
ID=7049390
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO160519A NO123807B (cs) | 1964-12-02 | 1965-11-17 |
Country Status (12)
| Country | Link |
|---|---|
| US (2) | US3412139A (cs) |
| BE (1) | BE673113A (cs) |
| BR (1) | BR6576050D0 (cs) |
| CH (1) | CH485793A (cs) |
| DE (1) | DE1544768B2 (cs) |
| DK (1) | DK108409C (cs) |
| FR (1) | FR1457834A (cs) |
| GB (1) | GB1077208A (cs) |
| IL (1) | IL24656A (cs) |
| NL (1) | NL148085B (cs) |
| NO (1) | NO123807B (cs) |
| SE (1) | SE335617B (cs) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1273811B (de) * | 1961-07-17 | 1968-07-25 | Bayer Ag | Stabilisatoren fuer chlorhaltige Polymerisate |
| DE1803787B2 (de) * | 1968-10-18 | 1973-09-06 | Chemische Werke Hüls AG, 4370 Mari | Polyvinylchlorid-mischung zur herstellung antistatischer hohlkoerper und blasfolien |
| US3626006A (en) * | 1968-11-05 | 1971-12-07 | Stauffer Chemical Co | Thiolanhydride of 3-aminocrotonic acid |
| US3890276A (en) * | 1969-05-15 | 1975-06-17 | Cincinnati Milacron Chem | Synergistic combinations of organic stabilizers for halogenated resins |
| BE755665A (fr) * | 1969-09-12 | 1971-02-15 | Advance Prod Gmbh | Polymerisats chlores thermostabilises |
| US3983085A (en) * | 1974-07-24 | 1976-09-28 | Ajinomoto Co., Inc. | Stabilized halogen-containing resin compositions |
| GB1546577A (en) * | 1975-10-29 | 1979-05-23 | Dunlop Ltd | Antistatic footwear |
| US4046803A (en) * | 1976-10-27 | 1977-09-06 | Armstrong Cork Company | Method of preparing β-amino derivatives of α,β-unsaturated esters |
| FR2491480A1 (fr) * | 1980-10-03 | 1982-04-09 | Sanofi Sa | Nouvelles associations de derives b-aminocrotoniques et de dihydropyridines utiles pour la stabilisation des resines vinyliques |
| ATE459679T1 (de) | 2001-02-16 | 2010-03-15 | Chemtura Vinyl Additives Gmbh | Chlorathaltiges stabilisatorsystem mit stickstoffhaltigen synergisten zur stabilisierung von halogenhaltigen polymeren |
| CN107325399A (zh) * | 2017-06-26 | 2017-11-07 | 黄小明 | 高强度耐腐蚀塑料管及其制备方法 |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2476422A (en) * | 1946-01-26 | 1949-07-19 | Monsanto Chemicals | Stabilized vinyl resin composition |
| US2592926A (en) * | 1948-10-29 | 1952-04-15 | Advance Solvents & Chemical Co | Halogen-containing resins stabilized with polymeric organo-tin dialkoxides |
| US2666752A (en) * | 1950-01-17 | 1954-01-19 | Sherwin Williams Co | Stabilizer for halogen-containing polymers |
| DE944398C (de) * | 1952-07-10 | 1956-06-14 | Wacker Chemie Gmbh | Verfahren zur Herstellung von Schallplatten, Tonbaendern u. dgl. |
| US3235361A (en) * | 1962-10-29 | 1966-02-15 | Du Pont | Method for the control of undesirable vegetation |
| NL267526A (cs) * | 1960-08-01 | 1964-08-10 | ||
| IT645594A (cs) * | 1961-02-15 | |||
| BE625896A (cs) * | 1961-12-11 |
-
1964
- 1964-12-02 DE DE19641544768 patent/DE1544768B2/de not_active Withdrawn
-
1965
- 1965-10-20 US US499015A patent/US3412139A/en not_active Expired - Lifetime
- 1965-11-17 NO NO160519A patent/NO123807B/no unknown
- 1965-11-21 IL IL24656A patent/IL24656A/xx unknown
- 1965-11-22 SE SE15053/65A patent/SE335617B/xx unknown
- 1965-11-30 CH CH1650665A patent/CH485793A/de not_active IP Right Cessation
- 1965-11-30 FR FR40345A patent/FR1457834A/fr not_active Expired
- 1965-12-01 NL NL656515612A patent/NL148085B/xx not_active IP Right Cessation
- 1965-12-01 DK DK617765AA patent/DK108409C/da active
- 1965-12-01 BE BE673113A patent/BE673113A/xx unknown
- 1965-12-02 GB GB51218/65A patent/GB1077208A/en not_active Expired
- 1965-12-28 BR BR176050/65A patent/BR6576050D0/pt unknown
-
1968
- 1968-06-26 US US752419*A patent/US3518224A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1544768A1 (de) | 1970-04-02 |
| NL148085B (nl) | 1975-12-15 |
| FR1457834A (fr) | 1966-11-04 |
| BE673113A (cs) | 1966-04-01 |
| IL24656A (en) | 1969-11-30 |
| US3518224A (en) | 1970-06-30 |
| DE1544768B2 (de) | 1970-09-10 |
| BR6576050D0 (pt) | 1973-12-18 |
| SE335617B (cs) | 1971-06-01 |
| US3412139A (en) | 1968-11-19 |
| GB1077208A (en) | 1967-07-26 |
| DK108409C (da) | 1967-12-04 |
| CH485793A (de) | 1970-02-15 |
| NL6515612A (cs) | 1966-06-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO123807B (cs) | ||
| KR100188320B1 (ko) | 트리아릴트리아진 자와선 흡수제, 이의 제조 방법 및 이를 포함하는 중합체 안정화조성물 | |
| US4352903A (en) | Chlorinated thermoplastics stabilized with aminothiouracils | |
| NO121471B (cs) | ||
| US2841608A (en) | Cyclic glycol phosphites | |
| US2981717A (en) | Poly olefins stabilized with salts or amides of a thiodialkanoic acid | |
| US2669549A (en) | Stabilized halogen-containing resins | |
| US2684955A (en) | Vinyl halide polymers plasticized with aryl alkane sulfonates | |
| TWI513762B (zh) | 雙官能型安定劑及其組成物 | |
| US3894083A (en) | Amides | |
| NO160519B (no) | Analogifremgangsm te for fremstilling av terapeutisk aktive s- adenosylmethioninacylderivater. | |
| US2432296A (en) | Stabilized chlorine containing polymers | |
| US4038250A (en) | Light protecting agents | |
| JPH0218346B2 (cs) | ||
| US3847853A (en) | Process for the preparation of vinyl chloride resins having good thermal stability | |
| US2910454A (en) | Hydrocarbon polymers stabilized with b-resorcylic acid diesters | |
| US2988534A (en) | Novel organic tin compounds and processes for their production and process for stabilizing halogen containing, high-molecular compounds against the action of light and heat | |
| US2618625A (en) | Resins stabilized with organotin-sulfonamides | |
| US2673191A (en) | Light stable vinylidene chloride polymer compositions | |
| US2381526A (en) | Vulcanizable polymerization products | |
| US3347821A (en) | Chlorine-containing polymers stabilized with antimonyl compounds | |
| US3917553A (en) | Stabilized polyacrylonitrile compositions with sulfur containing stabilizer and method of forming same | |
| US4357434A (en) | Stabilized halogen-containing resin compositions | |
| US3661844A (en) | Organic acyl thioacetal and thioketal stabilizers for halogenated resins | |
| US3247155A (en) | Stabilizers and plasticizers for polymers which contain chemically combined chlorine |