NO122881B - - Google Patents
Download PDFInfo
- Publication number
- NO122881B NO122881B NO159369A NO159369A NO122881B NO 122881 B NO122881 B NO 122881B NO 159369 A NO159369 A NO 159369A NO 159369 A NO159369 A NO 159369A NO 122881 B NO122881 B NO 122881B
- Authority
- NO
- Norway
- Prior art keywords
- methyl
- nitroimidazol
- carbamates
- lower alkyl
- compound
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 15
- 239000002253 acid Substances 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 3
- 239000005864 Sulphur Substances 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 150000004958 5-nitroimidazoles Chemical class 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- -1 1-substituted-5-nitroimidazoles Chemical class 0.000 description 10
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 8
- CKDWPUIZGOQOOM-UHFFFAOYSA-N Carbamyl chloride Chemical compound NC(Cl)=O CKDWPUIZGOQOOM-UHFFFAOYSA-N 0.000 description 7
- 208000035475 disorder Diseases 0.000 description 6
- XWIYNNJPQAWSGT-UHFFFAOYSA-N (1-methyl-5-nitroimidazol-2-yl)methylcarbamic acid Chemical compound CN1C(CNC(O)=O)=NC=C1[N+]([O-])=O XWIYNNJPQAWSGT-UHFFFAOYSA-N 0.000 description 5
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 208000005448 Trichomonas Infections Diseases 0.000 description 5
- 206010044620 Trichomoniasis Diseases 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- JSAQDPJIVQMBAY-UHFFFAOYSA-N (1-methyl-5-nitroimidazol-2-yl)methanol Chemical compound CN1C(CO)=NC=C1[N+]([O-])=O JSAQDPJIVQMBAY-UHFFFAOYSA-N 0.000 description 3
- 208000004881 Amebiasis Diseases 0.000 description 3
- 206010001980 Amoebiasis Diseases 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 3
- 241000286209 Phasianidae Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 235000020188 drinking water Nutrition 0.000 description 3
- 239000003651 drinking water Substances 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 229910052938 sodium sulfate Inorganic materials 0.000 description 3
- 235000011152 sodium sulphate Nutrition 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 201000002311 trypanosomiasis Diseases 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GEPNZFMLBLNJDW-UHFFFAOYSA-N C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 Chemical class C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 GEPNZFMLBLNJDW-UHFFFAOYSA-N 0.000 description 2
- JSYNKZGPKFNVIC-UHFFFAOYSA-N CCN1C([N+]([O-])=O)=CN=C1CNC(O)=O Chemical compound CCN1C([N+]([O-])=O)=CN=C1CNC(O)=O JSYNKZGPKFNVIC-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 2
- 241000242678 Schistosoma Species 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 241001061127 Thione Species 0.000 description 2
- 241000224527 Trichomonas vaginalis Species 0.000 description 2
- 206010000496 acne Diseases 0.000 description 2
- 230000001572 anti-trichomonad Effects 0.000 description 2
- 230000004071 biological effect Effects 0.000 description 2
- NBYQXBYMEUOBON-UHFFFAOYSA-N carbamothioyl chloride Chemical compound NC(Cl)=S NBYQXBYMEUOBON-UHFFFAOYSA-N 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 239000002024 ethyl acetate extract Substances 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- GTCAXTIRRLKXRU-UHFFFAOYSA-N methyl carbamate Chemical compound COC(N)=O GTCAXTIRRLKXRU-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003071 parasitic effect Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VRNQHXMQYBJYPJ-UHFFFAOYSA-N (1-methyl-5-nitroimidazol-2-yl)methanethiol Chemical compound CN1C(CS)=NC=C1[N+]([O-])=O VRNQHXMQYBJYPJ-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XOJFIXFDWAYHTE-UHFFFAOYSA-N 3,5-dimethyl-4-nitro-1h-imidazole-2-thione Chemical compound CC=1NC(=S)N(C)C=1[N+]([O-])=O XOJFIXFDWAYHTE-UHFFFAOYSA-N 0.000 description 1
- NTUBJABVOKHTGZ-UHFFFAOYSA-N CN1C([N+]([O-])=O)=CN=C1CC1=C(NC(O)=O)SC=C1 Chemical compound CN1C([N+]([O-])=O)=CN=C1CC1=C(NC(O)=O)SC=C1 NTUBJABVOKHTGZ-UHFFFAOYSA-N 0.000 description 1
- MZBFLXAQYQQBPT-UHFFFAOYSA-N CN1C([N+]([O-])=O)=CN=C1CNC(O)=S Chemical compound CN1C([N+]([O-])=O)=CN=C1CNC(O)=S MZBFLXAQYQQBPT-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 241000224526 Trichomonas Species 0.000 description 1
- 206010046914 Vaginal infection Diseases 0.000 description 1
- 201000008100 Vaginitis Diseases 0.000 description 1
- WNLRTRBMVRJNCN-UHFFFAOYSA-L adipate(2-) Chemical compound [O-]C(=O)CCCCC([O-])=O WNLRTRBMVRJNCN-UHFFFAOYSA-L 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 230000002141 anti-parasite Effects 0.000 description 1
- 230000000842 anti-protozoal effect Effects 0.000 description 1
- 239000003096 antiparasitic agent Substances 0.000 description 1
- 229940125687 antiparasitic agent Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- CGRNNEJYAQQCOQ-UHFFFAOYSA-N carbamic acid;2-nitro-1h-imidazole Chemical class NC(O)=O.[O-][N+](=O)C1=NC=CN1 CGRNNEJYAQQCOQ-UHFFFAOYSA-N 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 230000001684 chronic effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 239000002038 ethyl acetate fraction Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 125000005358 mercaptoalkyl group Chemical group 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 244000045947 parasite Species 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 201000006509 pleuropneumonia Diseases 0.000 description 1
- WQKGAJDYBZOFSR-UHFFFAOYSA-N potassium;propan-2-olate Chemical compound [K+].CC(C)[O-] WQKGAJDYBZOFSR-UHFFFAOYSA-N 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 235000013594 poultry meat Nutrition 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 244000000040 protozoan parasite Species 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 208000023504 respiratory system disease Diseases 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 235000014122 turkey meat Nutrition 0.000 description 1
- 210000001215 vagina Anatomy 0.000 description 1
- 239000000522 vaginal cream Substances 0.000 description 1
- 239000006216 vaginal suppository Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Landscapes
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NO159369A NO122881B (OSRAM) | 1965-07-07 | 1969-04-18 |
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US47023965A | 1965-07-07 | 1965-07-07 | |
| US55093266A | 1966-05-18 | 1966-05-18 | |
| NO163800A NO122186B (OSRAM) | 1965-07-07 | 1966-07-06 | |
| NO159369A NO122881B (OSRAM) | 1965-07-07 | 1969-04-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122881B true NO122881B (OSRAM) | 1971-08-30 |
Family
ID=27483975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO159369A NO122881B (OSRAM) | 1965-07-07 | 1969-04-18 |
Country Status (1)
| Country | Link |
|---|---|
| NO (1) | NO122881B (OSRAM) |
-
1969
- 1969-04-18 NO NO159369A patent/NO122881B/no unknown
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0339416B1 (de) | Gegebenenfalls alpha-substituierte 4-(Chinolin-2-yl-methoxy)phenylessigsäuren und -ester | |
| FI68618C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara imdazolidinderivat | |
| NO170883B (no) | Fremgangsmaate for fremstilling av 2-amino-5-hydroksy-4-metylpyrimidin-derivater | |
| CY1446A (en) | Chemical compounds derived from cyclobutene | |
| EP0125783A1 (en) | Dopamine-beta-hydroxylase inhibitors | |
| NO143942B (no) | Analogifremgangsmaate for fremstilling av farmakologisk aktive heterocyklisk substituerte guanidiner | |
| US4426526A (en) | Alkoxypyridyl alkylamines | |
| CS249115B2 (en) | Method of new imidazolylphenylamides production | |
| NO803266L (no) | Alkylurinstoff-derivater til behandling av sykdommer i fettstoffskiftet, fremg.m. til deres fremst., deres anvend. i legemidler til behandl. av fettstoffskiftetforstyrrelser, legem. inneh. disse, og fremgm. til fremst. av legemidlene | |
| CH641757A5 (en) | O-Alkylated hydroxylamines and process for the preparation thereof | |
| KR20000065885A (ko) | 항바이러스성 피리미딘다이온 유도체 및 그 제조방법 | |
| US3652579A (en) | 1-methyl-2-substituted 5-nitroimidazoles | |
| US4423046A (en) | Antibacterial and antiprotozoal 1-methyl-5-nitro-2-(2-phenylvinyl)imidazoles | |
| US3971786A (en) | Pyridyl alkylguanidine compounds, composition therewith, and methods of inhibiting H-2 histamine receptors | |
| EP0250264A1 (en) | Irreversible dopamine-Beta-hydroxylase inhibitors | |
| US4154838A (en) | Alkoxy pyridine | |
| NO122881B (OSRAM) | ||
| US4060621A (en) | Pyridyl alkylguanidine compounds | |
| PL90769B1 (OSRAM) | ||
| US3932427A (en) | Pyridyl substituted aminoalkyl-thioureas and ureas | |
| RU2026293C1 (ru) | Способ получения производного имидазола | |
| DE1620018B2 (de) | 1-methyl-5-nitroimidazol-derivate, ihre salze mit saeuren, verfahren zu ihrer herstellung und antiparasitaere mittel | |
| US4267185A (en) | Antidepressant pyrrolylpiperidines, their pharmaceutical compositions and method of use | |
| US3781290A (en) | Phenoxyphenyl phenylthiophenyl and phenylaminophenyl piperazinylthio-ureas | |
| US4066778A (en) | Tetrahydroimidazole compounds useful as pharmaceuticals |