NO122789B - - Google Patents
Download PDFInfo
- Publication number
- NO122789B NO122789B NO1857/69A NO185769A NO122789B NO 122789 B NO122789 B NO 122789B NO 1857/69 A NO1857/69 A NO 1857/69A NO 185769 A NO185769 A NO 185769A NO 122789 B NO122789 B NO 122789B
- Authority
- NO
- Norway
- Prior art keywords
- lower alkyl
- compound
- formula
- parts
- stands
- Prior art date
Links
- -1 alkyl radicals Chemical class 0.000 claims description 21
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 13
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 150000001469 hydantoins Chemical class 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 6
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 claims description 6
- 230000001476 alcoholic effect Effects 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 238000004519 manufacturing process Methods 0.000 claims description 5
- 230000001773 anti-convulsant effect Effects 0.000 claims description 4
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 3
- 150000008051 alkyl sulfates Chemical class 0.000 claims description 3
- 239000001961 anticonvulsive agent Substances 0.000 claims description 3
- 125000001841 imino group Chemical group [H]N=* 0.000 claims description 3
- 238000011065 in-situ storage Methods 0.000 claims description 3
- ZVCDLGYNFYZZOK-UHFFFAOYSA-M sodium cyanate Chemical compound [Na]OC#N ZVCDLGYNFYZZOK-UHFFFAOYSA-M 0.000 claims description 3
- 150000003973 alkyl amines Chemical class 0.000 claims description 2
- 229960003965 antiepileptics Drugs 0.000 claims description 2
- 150000005840 aryl radicals Chemical class 0.000 claims description 2
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 claims description 2
- 239000011707 mineral Substances 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 150000003672 ureas Chemical class 0.000 claims description 2
- 150000004820 halides Chemical class 0.000 claims 1
- 150000002431 hydrogen Chemical class 0.000 claims 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 229940091173 hydantoin Drugs 0.000 description 18
- 239000007787 solid Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- 238000002844 melting Methods 0.000 description 8
- 230000008018 melting Effects 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 6
- 239000007858 starting material Substances 0.000 description 5
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- IQFVPQOLBLOTPF-HKXUKFGYSA-L congo red Chemical compound [Na+].[Na+].C1=CC=CC2=C(N)C(/N=N/C3=CC=C(C=C3)C3=CC=C(C=C3)/N=N/C3=C(C4=CC=CC=C4C(=C3)S([O-])(=O)=O)N)=CC(S([O-])(=O)=O)=C21 IQFVPQOLBLOTPF-HKXUKFGYSA-L 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 239000001099 ammonium carbonate Substances 0.000 description 2
- 235000012501 ammonium carbonate Nutrition 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229940125681 anticonvulsant agent Drugs 0.000 description 1
- 206010015037 epilepsy Diseases 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 150000002391 heterocyclic compounds Chemical class 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01D—SEPARATION
- B01D47/00—Separating dispersed particles from gases, air or vapours by liquid as separating agent
- B01D47/06—Spray cleaning
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Gas Separation By Absorption (AREA)
- Physical Or Chemical Processes And Apparatus (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE06103/68A SE330372B (xx) | 1968-05-07 | 1968-05-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO122789B true NO122789B (xx) | 1971-08-16 |
Family
ID=20267908
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO1857/69A NO122789B (xx) | 1968-05-07 | 1969-05-06 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3556490A (xx) |
| BE (1) | BE729053A (xx) |
| FR (1) | FR2007994A6 (xx) |
| GB (1) | GB1211503A (xx) |
| IE (1) | IE33086B1 (xx) |
| NO (1) | NO122789B (xx) |
| SE (1) | SE330372B (xx) |
Families Citing this family (22)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7104981U (de) * | 1971-02-10 | 1971-07-29 | Kunststofftechnik Gmbh U Co Kg | Nassabscheider fuer luftreinigungsanlage |
| US3727381A (en) * | 1971-03-26 | 1973-04-17 | Combustion Eng | Agitator for marble bed gas scrubber |
| BE793609A (fr) * | 1972-01-07 | 1973-05-02 | American Air Filter Co | Dispositif d'epuration par contact entre deux fluides |
| DE2246474A1 (de) * | 1972-09-22 | 1974-04-04 | Regehr Ulrich | Vorrichtung zum waschen von gasen |
| US3981490A (en) * | 1973-05-11 | 1976-09-21 | Vyzkumny Ustav Anorganicke Chemie | Apparatus for decomposing alkali metal amalgams |
| US3941210A (en) * | 1974-05-09 | 1976-03-02 | De Limon Fluhme & Co. | Oil mist lubricating system and condenser device |
| JPS5453671A (en) * | 1977-10-06 | 1979-04-27 | Atsuhiro Honda | Packed column type gassliquid contact apparatus |
| DE7801105U1 (de) * | 1978-01-16 | 1978-04-27 | Fa. Carl Still, 4350 Recklinghausen | Vorrichtung zur schmutz- und wasserabscheidung aus den loeschschwaden in koksloeschtuermen |
| JPS54131544U (xx) * | 1978-03-03 | 1979-09-12 | ||
| CA1123579A (en) * | 1979-08-02 | 1982-05-18 | Xuan T. Nguyen | Turbulent transport contactor |
| US4533367A (en) * | 1981-07-10 | 1985-08-06 | Dzemal Hadzismajlovic | Gas scrubbing method using gas liquid contact in a particulate bed |
| US5302361A (en) * | 1991-04-08 | 1994-04-12 | Ari Technologies, Inc. | Multi-bed mass transfer column with mobile packing |
| US5707410A (en) * | 1995-10-24 | 1998-01-13 | Northrup Grumman Corporation | Exhaust stack scrubber |
| KR100242956B1 (ko) * | 1997-06-03 | 2000-02-01 | 윤종용 | 가스 배기 시스템의 잔류물 제거 및 차단장치 |
| US6245554B1 (en) | 1999-05-06 | 2001-06-12 | James M. Durham | Sewer gas odor abatement system |
| US6267358B1 (en) * | 1999-06-18 | 2001-07-31 | The Babcock & Wilcox Company | Low pressure drop inlet for high velocity absorbers with straight tanks |
| US6312503B1 (en) * | 1999-10-13 | 2001-11-06 | Arteva North America S.A.R.L. | System to quench gasses and remove condensables |
| DE10118961B4 (de) * | 2001-04-10 | 2006-08-31 | Thermoselect Ag | Wäscher und Verfahren zum Reinigen von Gasen |
| US10843124B2 (en) * | 2015-11-16 | 2020-11-24 | Redeem Ccs Pty Ltd | Process and contactor vessel for the absorption of target gas by counter-current absorption process and fluidised bed |
| CN108605815A (zh) * | 2018-03-19 | 2018-10-02 | 金华市博益飞科技有限公司 | 猕猴桃嫩枝扦插喷灌设备 |
| CN109731459A (zh) * | 2019-03-08 | 2019-05-10 | 祝恩波 | 气体污染物处理器 |
| CN115040958B (zh) * | 2022-07-14 | 2024-06-04 | 四川汇利实业有限公司 | 一种车间油烟处理装置 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2691423A (en) * | 1951-06-14 | 1954-10-12 | Simpson Herbert Corp | Dust collector |
| US3219324A (en) * | 1960-08-01 | 1965-11-23 | Universal Oil Prod Co | Apparatus for interphase contact between fluids |
| BE625252A (xx) * | 1961-12-14 | 1963-03-15 | ||
| US3302372A (en) * | 1964-04-17 | 1967-02-07 | Armour Agricult Chem | Gas scrubbing process and apparatus |
| US3348825A (en) * | 1966-02-03 | 1967-10-24 | Nat Dust Collector Corp | Apparatus for collecting contaminants from gases |
| US3488039A (en) * | 1968-05-20 | 1970-01-06 | Nat Dust Collector Corp | Filter bed for dust collector |
-
1968
- 1968-05-07 SE SE06103/68A patent/SE330372B/xx unknown
-
1969
- 1969-02-27 BE BE729053D patent/BE729053A/xx unknown
- 1969-03-17 GB GB03967/69A patent/GB1211503A/en not_active Expired
- 1969-04-22 IE IE549/69A patent/IE33086B1/xx unknown
- 1969-05-05 US US821814A patent/US3556490A/en not_active Expired - Lifetime
- 1969-05-06 NO NO1857/69A patent/NO122789B/no unknown
- 1969-05-07 FR FR6914587A patent/FR2007994A6/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| SE330372B (xx) | 1970-11-16 |
| IE33086B1 (en) | 1974-03-20 |
| BE729053A (xx) | 1969-08-01 |
| FR2007994A6 (xx) | 1970-01-16 |
| IE33086L (en) | 1969-11-07 |
| US3556490A (en) | 1971-01-19 |
| GB1211503A (en) | 1970-11-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO122789B (xx) | ||
| NO130680B (xx) | ||
| US3895028A (en) | Alpha-(2-phenylbenzothiazol-5-yl)propionic acid | |
| NO139918B (no) | Nye ioniske jodbenzenderivater for anvendelse i roentgenkontrastmidler | |
| PL83235B1 (xx) | ||
| NO117866B (xx) | ||
| NO120075B (xx) | ||
| SU856382A3 (ru) | Способ получени циннолин-3-ил-карбоновых кислот или их солей | |
| US2546159A (en) | Piperidyl ketones and process of | |
| SU502607A3 (ru) | Способ получени лактамов | |
| NO124687B (xx) | ||
| US3152139A (en) | Certain aminoisoxazolone derivatives | |
| SU505358A3 (ru) | Способ получени производных пиперазина | |
| US2449038A (en) | Preparation of 3-substituted benzotetronic acid and salts thereof | |
| DE2038919C2 (de) | Verfahren zur Herstellung von 3-Amino- δ↑2↑-pyrazolinderivaten | |
| US3488360A (en) | 1,2,5-thiadiazoles and methods for preparing same | |
| US2535971A (en) | 1-carbalkoxy-4-substituted piperazines | |
| US4316037A (en) | N-Benzyl and N-substituted benzyl tetrazole-5-carboxylic acids and the preparation thereof | |
| SU554810A3 (ru) | Способ получени производных бифенила или их солей, или рацематов, или оптически активных антиподов | |
| DK156391B (da) | Analogifremgangsmaade til fremstilling af 3-aminopyrrolderivater | |
| SU474149A3 (ru) | Способ получени производных 2,3,5,6-тетрагидроимидазо(2,1-в) тиазола | |
| SU1252326A1 (ru) | Способ получени алкилзамещенных 6-окситетрагидро-1,3-тиазин-2-тионов | |
| US2776978A (en) | X-diamevotmazoles containing a halo- | |
| US4220794A (en) | Synthetic intermediates for the preparation of diaromatic O-(amino-alkyl)oximes | |
| Kochikyan et al. | Synthesis of 5-substituted 3-(2-oxopropyl) tetrahydrofuran-2-ones and heterocyclic compounds on their base |