NO119008B - - Google Patents
Download PDFInfo
- Publication number
- NO119008B NO119008B NO164725A NO16472566A NO119008B NO 119008 B NO119008 B NO 119008B NO 164725 A NO164725 A NO 164725A NO 16472566 A NO16472566 A NO 16472566A NO 119008 B NO119008 B NO 119008B
- Authority
- NO
- Norway
- Prior art keywords
- titanium
- alloys
- approx
- molybdenum
- tin
- Prior art date
Links
- 229910001069 Ti alloy Inorganic materials 0.000 claims description 12
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 11
- 239000010936 titanium Substances 0.000 claims description 11
- 229910052719 titanium Inorganic materials 0.000 claims description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 8
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 claims description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052750 molybdenum Inorganic materials 0.000 claims description 6
- 239000011733 molybdenum Substances 0.000 claims description 6
- 229910052718 tin Inorganic materials 0.000 claims description 6
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052804 chromium Inorganic materials 0.000 claims description 5
- 239000011651 chromium Substances 0.000 claims description 5
- 239000012535 impurity Substances 0.000 claims description 5
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 238000004881 precipitation hardening Methods 0.000 claims description 4
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 3
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052790 beryllium Inorganic materials 0.000 claims description 3
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052796 boron Inorganic materials 0.000 claims description 3
- 229910052748 manganese Inorganic materials 0.000 claims description 3
- 239000011572 manganese Substances 0.000 claims description 3
- 229910052758 niobium Inorganic materials 0.000 claims description 3
- 239000010955 niobium Substances 0.000 claims description 3
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 239000010703 silicon Substances 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- 229910052720 vanadium Inorganic materials 0.000 claims description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000003344 environmental pollutant Substances 0.000 claims description 2
- 231100000719 pollutant Toxicity 0.000 claims description 2
- 238000005728 strengthening Methods 0.000 claims description 2
- 229910052845 zircon Inorganic materials 0.000 claims description 2
- GFQYVLUOOAAOGM-UHFFFAOYSA-N zirconium(iv) silicate Chemical compound [Zr+4].[O-][Si]([O-])([O-])[O-] GFQYVLUOOAAOGM-UHFFFAOYSA-N 0.000 claims description 2
- 239000000470 constituent Substances 0.000 claims 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 20
- 229910045601 alloy Inorganic materials 0.000 description 12
- 239000000956 alloy Substances 0.000 description 12
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 229910052757 nitrogen Inorganic materials 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 238000007792 addition Methods 0.000 description 2
- 239000004411 aluminium Substances 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- 241000197727 Euscorpius alpha Species 0.000 description 1
- 238000003483 aging Methods 0.000 description 1
- 239000003623 enhancer Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H04—ELECTRIC COMMUNICATION TECHNIQUE
- H04B—TRANSMISSION
- H04B10/00—Transmission systems employing electromagnetic waves other than radio-waves, e.g. infrared, visible or ultraviolet light, or employing corpuscular radiation, e.g. quantum communication
- H04B10/11—Arrangements specific to free-space transmission, i.e. transmission through air or vacuum
- H04B10/112—Line-of-sight transmission over an extended range
- H04B10/1123—Bidirectional transmission
- H04B10/1127—Bidirectional transmission using two distinct parallel optical paths
-
- G—PHYSICS
- G02—OPTICS
- G02B—OPTICAL ELEMENTS, SYSTEMS OR APPARATUS
- G02B23/00—Telescopes, e.g. binoculars; Periscopes; Instruments for viewing the inside of hollow bodies; Viewfinders; Optical aiming or sighting devices
- G02B23/12—Telescopes, e.g. binoculars; Periscopes; Instruments for viewing the inside of hollow bodies; Viewfinders; Optical aiming or sighting devices with means for image conversion or intensification
Landscapes
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Engineering & Computer Science (AREA)
- Computer Networks & Wireless Communication (AREA)
- Signal Processing (AREA)
- Astronomy & Astrophysics (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Optical Communication System (AREA)
- Manufacture And Refinement Of Metals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US524353A US3277303A (en) | 1966-02-01 | 1966-02-01 | Combined binocular and optical communication device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO119008B true NO119008B (enFirst) | 1970-03-09 |
Family
ID=24088844
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO164725A NO119008B (enFirst) | 1966-02-01 | 1966-09-14 |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3277303A (enFirst) |
| BE (1) | BE687439A (enFirst) |
| DE (1) | DE1276516B (enFirst) |
| DK (1) | DK115795B (enFirst) |
| GB (1) | GB1126189A (enFirst) |
| NL (1) | NL144461B (enFirst) |
| NO (1) | NO119008B (enFirst) |
Families Citing this family (27)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4038547A (en) * | 1966-05-31 | 1977-07-26 | Philco Corporation | Tracking and sighting instrument |
| US4027159A (en) * | 1971-10-20 | 1977-05-31 | The United States Of America As Represented By The Secretary Of The Navy | Combined use of visible and near-IR imaging systems with far-IR detector system |
| US3760182A (en) * | 1972-02-29 | 1973-09-18 | C Poole | Semi conductor heat-fault detector |
| US3761815A (en) * | 1972-03-20 | 1973-09-25 | D Bower | Combination optical and radio apparatus |
| US3787688A (en) * | 1972-06-12 | 1974-01-22 | Us Army | Low light level, underwater, viewing device |
| US4035731A (en) * | 1976-01-21 | 1977-07-12 | Warren Dixon | Combined binocular radio unit |
| USD265479S (en) | 1979-05-23 | 1982-07-20 | Ajia Amerikan Boueki Kabushiki Kaisha | Combined binocular and detachable camera |
| EP0245282A1 (en) * | 1985-11-14 | 1987-11-19 | GONEN, Shlomo | Optical underwater communicator |
| US4953963A (en) * | 1989-08-17 | 1990-09-04 | Miller Alan K | Aviator's night vision system |
| US5662230A (en) * | 1990-07-13 | 1997-09-02 | J. G. Finneran Associates | Crimp top seal for vials |
| US5389790A (en) * | 1991-02-15 | 1995-02-14 | Sri International | Technique for detecting and identifying certain objects |
| US5455702A (en) * | 1993-02-22 | 1995-10-03 | Reed; Clay R. | Light communication apparatus |
| GB2320151A (en) * | 1996-11-12 | 1998-06-10 | L F D Limited | Covert infra-red communications system |
| DE19715636A1 (de) * | 1997-04-15 | 1998-10-22 | Renfer Robert O | Vorrichtung zur drahtlosen optischen Übertragung |
| WO2000025452A1 (de) * | 1998-10-22 | 2000-05-04 | Renfer Robert O | Vorrichtung und verfahren zur drahtlosen optischen übertragung |
| US6400503B1 (en) * | 2001-06-08 | 2002-06-04 | Philip A. Mickelson | Portable variable power zoom periscope |
| JP2003107369A (ja) * | 2001-09-28 | 2003-04-09 | Pentax Corp | 撮影機能付双眼鏡 |
| US6893346B2 (en) * | 2002-02-08 | 2005-05-17 | Shoot The Moon Products Ii, Llc | System, method, and apparatus for bi-directional infrared communication |
| US7338375B1 (en) | 2002-02-21 | 2008-03-04 | Shoot The Moon Products Ii, Llc | Integrated voice and data communication for laser tag systems |
| US20040208603A1 (en) * | 2002-05-03 | 2004-10-21 | Hekkel Steve D | Mobile infrared communication system |
| US7846028B2 (en) * | 2005-05-19 | 2010-12-07 | Shoot The Moon Products Ii, Llc | Lazer tag advanced |
| US8123622B1 (en) | 2011-06-03 | 2012-02-28 | Nyko Technologies, Inc. | Lens accessory for video game sensor device |
| USD665461S1 (en) * | 2011-06-07 | 2012-08-14 | Microsoft Corporation | Game controller |
| US9602203B2 (en) * | 2015-03-24 | 2017-03-21 | The United States Of America As Represented By The Secretary Of The Navy | Methods and systems for identification and communication using free space optical systems including wearable systems |
| US10277316B1 (en) | 2017-05-01 | 2019-04-30 | The United States Of America As Represented By The Secretary Of The Air Force | Free space optical headset |
| IT201700101072A1 (it) * | 2017-09-08 | 2019-03-08 | Slux Sagl | Dispositivo ottico di puntamento con sistema di comunicazione ottica |
| WO2019049091A1 (en) * | 2017-09-08 | 2019-03-14 | Slux Sagl | OPTICAL OPTICAL DEVICE WITH COMMUNICATION OPTICAL SYSTEM |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL44197C (enFirst) * | 1935-01-08 | |||
| US2153709A (en) * | 1936-05-06 | 1939-04-11 | Bournisien Jacques | Apparatus for establishing communications by means of light |
| US2494645A (en) * | 1944-09-15 | 1950-01-17 | Rca Corp | Two-way light communication system |
| DE1002224B (de) * | 1953-11-05 | 1957-02-07 | Aldis Brothers Ltd | Signalleuchte |
| US3111587A (en) * | 1954-09-30 | 1963-11-19 | Hupp Corp | Infra-red radiant energy devices |
| DE1165462B (de) * | 1960-09-20 | 1964-03-12 | Willy Ostermann | Signalgeraet unter Verwendung von Lichtstrahlen, insbesondere Infrarotstrahlen |
| US3164725A (en) * | 1961-03-29 | 1965-01-05 | Harald W Straub | Optical range finder |
| NL6811672A (enFirst) * | 1967-09-08 | 1969-03-11 |
-
1966
- 1966-02-01 US US524353A patent/US3277303A/en not_active Expired - Lifetime
- 1966-09-14 NO NO164725A patent/NO119008B/no unknown
- 1966-09-20 GB GB42041/66A patent/GB1126189A/en not_active Expired
- 1966-09-27 BE BE687439D patent/BE687439A/xx unknown
- 1966-09-28 DE DEG48016A patent/DE1276516B/de not_active Withdrawn
- 1966-09-29 DK DK503466AA patent/DK115795B/da unknown
- 1966-09-29 NL NL666613788A patent/NL144461B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL6613788A (enFirst) | 1967-08-02 |
| GB1126189A (en) | 1968-09-05 |
| DE1276516B (de) | 1968-08-29 |
| NL144461B (nl) | 1974-12-16 |
| DK115795B (da) | 1969-11-10 |
| US3277303A (en) | 1966-10-04 |
| BE687439A (enFirst) | 1967-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO119008B (enFirst) | ||
| US4731221A (en) | Nickel aluminides and nickel-iron aluminides for use in oxidizing environments | |
| US4671931A (en) | Nickel-chromium-iron-aluminum alloy | |
| US3526499A (en) | Nickel base alloy having improved stress rupture properties | |
| WO2006041167A1 (ja) | nearβ型チタン合金 | |
| US2892706A (en) | Titanium base alloys | |
| NO136208B (enFirst) | ||
| US3378368A (en) | Titanium-base alloys | |
| GB1433371A (en) | Titanium-base alloy and method of improving its creep properties | |
| GB1361055A (en) | Ioron-nickel-chromium alloys | |
| US4722828A (en) | High-temperature fabricable nickel-iron aluminides | |
| GB1385163A (en) | High temperature titanium alloy | |
| NO138808B (no) | Analogifremgangsmaate ved fremstilling av terapeutisk aktive pregnansyrederivater | |
| US3169857A (en) | Free machining steel with improved hot workability | |
| US1911078A (en) | Aluminum alloy | |
| GB796781A (en) | Improvements in or relating to titanium alloys | |
| GB1355475A (en) | Age-hardened nickel martensitic steel | |
| GB782148A (en) | Improvements in and relating to the heat treatment of titanium alloys | |
| GB595905A (en) | Aluminium base alloy | |
| JPS6141746A (ja) | 熱間加工性に優れた高強度高耐食性耐熱鋼 | |
| GB496774A (en) | Improvements in or relating to permanent magnets and alloys therefor | |
| US2787541A (en) | Titanium-base alloys | |
| US3859080A (en) | Corrosion resistant alloys | |
| Iwao et al. | Mechanical properties of high strength vanadium-base ternary alloys | |
| SU287791A1 (ru) | Жаропрочный сплав |