NO118675B - - Google Patents
Download PDFInfo
- Publication number
- NO118675B NO118675B NO163824A NO16382466A NO118675B NO 118675 B NO118675 B NO 118675B NO 163824 A NO163824 A NO 163824A NO 16382466 A NO16382466 A NO 16382466A NO 118675 B NO118675 B NO 118675B
- Authority
- NO
- Norway
- Prior art keywords
- parts
- amino
- acid
- anthraquinone
- dyes
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 12
- 239000001000 anthraquinone dye Substances 0.000 claims description 6
- -1 α-bromoacrylic acid halides Chemical class 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 5
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 239000003513 alkali Substances 0.000 claims description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000000926 separation method Methods 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- 239000000975 dye Substances 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 7
- 210000002268 wool Anatomy 0.000 description 6
- 230000010933 acylation Effects 0.000 description 5
- 238000005917 acylation reaction Methods 0.000 description 5
- 235000011121 sodium hydroxide Nutrition 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000004043 dyeing Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- QGLWBTPVKHMVHM-KTKRTIGZSA-N (z)-octadec-9-en-1-amine Chemical compound CCCCCCCC\C=C/CCCCCCCCN QGLWBTPVKHMVHM-KTKRTIGZSA-N 0.000 description 2
- ZMYAKSMZTVWUJB-UHFFFAOYSA-N 2,3-dibromopropanoic acid Chemical compound OC(=O)C(Br)CBr ZMYAKSMZTVWUJB-UHFFFAOYSA-N 0.000 description 2
- HMENQNSSJFLQOP-UHFFFAOYSA-N 2-bromoprop-2-enoic acid Chemical compound OC(=O)C(Br)=C HMENQNSSJFLQOP-UHFFFAOYSA-N 0.000 description 2
- SGHZXLIDFTYFHQ-UHFFFAOYSA-L Brilliant Blue Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 SGHZXLIDFTYFHQ-UHFFFAOYSA-L 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- SJKGPSSRBXDMCH-UHFFFAOYSA-N 2-bromoprop-2-enoyl bromide Chemical compound BrC(=C)C(Br)=O SJKGPSSRBXDMCH-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 238000009940 knitting Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 230000003381 solubilizing effect Effects 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 239000012209 synthetic fiber Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/44—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring
- C09B62/465—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group not directly attached to a heterocyclic ring the reactive group being an acryloyl group, a quaternised or non-quaternised aminoalkyl carbonyl group or a (—N)n—CO—A—O—X or (—N)n—CO—A—Hal group, wherein A is an alkylene or alkylidene group, X is hydrogen or an acyl radical of an organic or inorganic acid, Hal is a halogen atom, and n is 0 or 1
- C09B62/467—Anthracene dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH955765A CH462352A (de) | 1965-07-07 | 1965-07-07 | Verfahren zur Herstellung neuer Anthrachinonfarbstoffe |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO118675B true NO118675B (OSRAM) | 1970-01-26 |
Family
ID=4353218
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO163824A NO118675B (OSRAM) | 1965-07-07 | 1966-07-06 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3549665A (OSRAM) |
| AT (1) | AT258435B (OSRAM) |
| BE (1) | BE683734A (OSRAM) |
| CH (1) | CH462352A (OSRAM) |
| DE (1) | DE1644507C3 (OSRAM) |
| DK (1) | DK118907B (OSRAM) |
| GB (1) | GB1107515A (OSRAM) |
| NL (1) | NL151116B (OSRAM) |
| NO (1) | NO118675B (OSRAM) |
| SE (1) | SE310745B (OSRAM) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH638546A5 (de) | 1978-06-02 | 1983-09-30 | Ciba Geigy Ag | Anthrachinonverbindungen und deren gemische. |
| US4244691A (en) * | 1978-11-24 | 1981-01-13 | Ciba-Geigy Corporation | Novel water-soluble anthraquinone dyes |
| CN101585974B (zh) * | 2008-12-12 | 2013-05-08 | 天津德凯化工股份有限公司 | 一种毛用活性染料艳蓝的制备方法 |
| CN102863815B (zh) * | 2012-08-06 | 2014-12-10 | 湖北华丽染料工业有限公司 | 一种蓝色毛用活性染料的制备方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1342433A (fr) * | 1962-11-21 | 1963-11-08 | Ciba Geigy | Nouveaux colorants anthraquinoniques, leur procédé d'obtention et leur emploi |
| FR1372343A (fr) * | 1963-10-24 | 1964-09-11 | Cassella Farbwerke Mainkur Ag | Nouveaux colorants anthraquinoniques et leur préparation |
-
1965
- 1965-07-07 CH CH955765A patent/CH462352A/de unknown
-
1966
- 1966-06-29 DE DE1644507A patent/DE1644507C3/de not_active Expired
- 1966-07-01 GB GB29732/66A patent/GB1107515A/en not_active Expired
- 1966-07-06 NL NL666609464A patent/NL151116B/xx not_active IP Right Cessation
- 1966-07-06 DK DK348766AA patent/DK118907B/da unknown
- 1966-07-06 AT AT646866A patent/AT258435B/de active
- 1966-07-06 BE BE683734D patent/BE683734A/xx not_active IP Right Cessation
- 1966-07-06 NO NO163824A patent/NO118675B/no unknown
- 1966-07-06 SE SE9269/66A patent/SE310745B/xx unknown
-
1969
- 1969-01-21 US US792829*A patent/US3549665A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1644507B2 (de) | 1974-12-05 |
| BE683734A (OSRAM) | 1967-01-06 |
| US3549665A (en) | 1970-12-22 |
| CH462352A (de) | 1968-09-15 |
| DE1644507C3 (de) | 1975-07-17 |
| SE310745B (OSRAM) | 1969-05-12 |
| GB1107515A (en) | 1968-03-27 |
| NL6609464A (OSRAM) | 1967-01-09 |
| AT258435B (de) | 1967-11-27 |
| NL151116B (nl) | 1976-10-15 |
| DK118907B (da) | 1970-10-19 |
| DE1644507A1 (de) | 1969-10-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO163824B (no) | Fortykket, faststoff-fri, vandig, i det vesentlige ikke-utvidende saltvannsopploesning for boring og overhaling og fremgangsmaate for fremstilling av en slik opploesning. | |
| KR910002516B1 (ko) | 실크 또는 함실크 혼방직물의 염색방법 | |
| US2935506A (en) | New dyestuffs and process for dyeing therewith | |
| US3627749A (en) | Mono-and disazo dyestuffs containing triazinylureylene groups | |
| NO124932B (OSRAM) | ||
| US2892670A (en) | Table of dyestuffsxcontinued | |
| US3234205A (en) | Metal complex compounds of monoazo-dyestuffs | |
| NO118675B (OSRAM) | ||
| US2817659A (en) | Polyazo dyestuffs | |
| NO132116B (OSRAM) | ||
| US3157630A (en) | Copper-containing monoazo dyestuffs having a cyanuric halide radical | |
| US2519651A (en) | Polyazo dyestuffs | |
| US3278549A (en) | Water-soluble dyestuffs and process for preparing them | |
| US3294778A (en) | Fiber-reactive dyestuffs | |
| US2541623A (en) | Dyestuffs of the anthraquinone series and a process for their manufacture | |
| US3415825A (en) | Anthraquinone dyestuffs | |
| NO131157B (OSRAM) | ||
| US3385843A (en) | Water-soluble yellow monoazo pyrazolone dye | |
| US3042475A (en) | New dyestuffs and process for colouring textile materials therewith | |
| US2952690A (en) | Anthraquinone dyestuffs | |
| US2714588A (en) | Copper-containing disazo dyestuffs | |
| US2844597A (en) | Blue leveling dyestuffs of the anthraquinone series | |
| US3065221A (en) | Copper complex monoazo dyes containing a monohalogenotriazinyl substituent | |
| US3070602A (en) | New anthraquinone dyestuffs containing a reactive triazine group | |
| US4263206A (en) | Reactive dyestuffs containing chlorine or fluorine substituents and one or more 1,3-dicyanobenzene radicals linked to the dyestuff at the 2-, 4- or 6-position |